Xem mã nguồn của Acid calendic

{{Short description|Acid béo}}{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 472228235
| ImageFile =Alpha-calendic acid.svg
| ImageSize =
| PIN = (8''E'',10''E'',12''Z'')-Octadeca-8,10,12-trienoic acid
| OtherNames = {{bulleted list|Acid α-Calendic | Acid (8''E'',10''E'',12''Z'')-Octadecatrienoic | Acid ''trans''-8-''trans''-10-''cis''-12-Octadecatrienoic}}
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 5204-87-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DK8G4N35L5
| PubChem = 5282818
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4445945
| ChEBI_Ref = {{ebicite|changed|EBI}} 
| ChEBI = 86148
| SMILES = O=C(O)CCCCCC\C=C\C=C\C=C/CCCCC
| InChI = 1/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-11H,2-5,12-17H2,1H3,(H,19,20)/b7-6-,9-8+,11-10+
| InChIKey = DQGMPXYVZZCNDQ-KBPWROHVBR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-11H,2-5,12-17H2,1H3,(H,19,20)/b7-6-,9-8+,11-10+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DQGMPXYVZZCNDQ-KBPWROHVSA-N
 }}
|Section2={{Chembox Properties
| C=18 | H=30 | O=2
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
 }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
 }}
}}

'''Acid calendic''' (thỉnh thoảng cũng được gọi '''acid α-calendic''') là một [[Chất béo không bão hoà|acid béo không bão hoà]], được đặt tên Theo [[Cúc tâm tư|hoa cúc tâm tư]] (''Calendula officinalis''), mà nó được trích xuất từ đó ra. Về mặt hoá học, nó có cấu trúc tương tự như [[acid linoleic liên hợp]]; các nghiên cứu phòng thí nghiệm gợi ý rằng, nó có thể có các hoạt tính sinh học ''[[in vitro]]'' tương tự.<ref name=Yasui>{{chú thích tạp chí|vauthors=Yasui Y, Hosokawa M, Kohno H, Tanaka T, Miyashita K|title=Growth inhibition and apoptosis induction by all-trans-conjugated linolenic acids on human colon cancer cells|journal=Anticancer Res|volume=26|issue=3A|pages=1855–60|year=2006|pmid=16827117}}</ref>

==Sinh tổng hợp==

Acid calendic là một [[acid béo omega-6]]<ref name=Kinney>{{chú thích web|author=Kinney, Tony|title=Metabolism in Plants to Produce Healthier Food Oils|url= http://www.metabolicengineering.gov/me2005/Kinney.pdf|access-date=2007-01-11|url-status=dead|archive-url= https://web.archive.org/web/20060929134832/http://www.metabolicengineering.gov/me2005/Kinney.pdf|archive-date=2006-09-29}}</ref>, mặc dù không thường xuyên được liệt kê với nhóm này. Acid calendic được tổng hợp trong loài cây ''Calendula officinalis'' từ [[Acid linoleic|linoleate]] bởi một quá trình [[Phi bão hoà acid béo|phi bão hoà hoá]] bất thường Δ12-oleate (một biến thể FAD 2), giúp chuyển hoá liên kết đôi ''cis''- tại vị trí thứ 9 thành một hệ thống liên kết đôi ''trans'',''trans''-liên hợp.<ref name=lipd_library>{{chú thích web|publisher=Lipid Library|title=Fatty Acids: Polyunsaturated with other than Methylene-Interrupted Double Bonds|url=http://www.lipidlibrary.co.uk/Lipids/fa_conj+/index.htm|author=Christie, William W|access-date=2007-01-11|archive-url=https://web.archive.org/web/20070112084411/http://www.lipidlibrary.co.uk/Lipids/fa_conj+/index.htm#|archive-date=2007-01-12|url-status=dead}}</ref> Một đồng phân ''toàn-trans'' beta cũng đã được mô tả.<ref name=Yasui />
:[[Tập tin:Ringelblume Blüte.jpg|left|thumb|200px|Acid calendic comes from the pot marigold]]{{clear-left}}

==Ảnh hưởng==
Acid calendic là acid béo chịu trách nhiệm làm giảm lượng thức ăn ăn vào và cải thiện việc tối ưu hoá thức ăn ở chuột khi thêm dầu hoa cúc vào thức ăn, như đã được thể hiện qua các thí nghiệm so sánh trong các ví dụ sử dụng dầu ngô.<ref name=patent>{{US patent|20050118208|US Patent 20050118208: Powder formulation comprising conjugated octadecapolyenic acids}}</ref>

==Chú thích và Tham khảo==
{{tham khảo}}
{{Fatty acids}}

[[Thể loại:Acid béo]]
[[Thể loại:Acid alkenoic]]
[[Thể loại:Polyene]]