SENIOR IPE IMPORTANT QUESTION BANK

SR.MATHMATICS- IIA
QUESTION BANK ANALYSIS

S.NO NAME OF THE CHAPTER WEIGHTAGE MARKS

01 Complex numbers 8(4+2+2)
02 Be Maivre’s Theorem 9(7+2)
03 Quadratic equations 6(4+2)
04 Theory of equations 9(7+2)
05 Permutations and combinations 12(4+4+2+2)
06 Binomial theorem 16(7+7+2)
07 Partial fractions 4(4)
08 Measures of Dispersion 9(7+2)
09 Probability 15(7+4+4)
10 Random variables and probability 9(7+2)
Distributions
Total marks 97

S. TOPIC NAME LAQ SAQS VSAQS TOTAL

N
O
*** ** * *** ** *
01 Complex numbers - - - 8 5 - 27 40
02 De Moivre’s 8 3 2 - - - 9 22
Theorem
03 Quadratic equations - - - 9 - 8 21 38
04 Theory of equations 11 3 5 - - - 14 33
05 Permutations and - - - 19 6 2 37 64
combinations
06 Binomial theorem 22 5 - - - - 25 52
07 Partial fractions - - - 10 3 2 - 15
08 Measures of 12 5 - - - - 9 26
Dispersion
09 Probability 11 4 - 9 6 7 11 48
10 Random variables 09 1 2 - - - 15 27
and probability
Distributions
SUB TOTAL 73 21 9 55 20 19 168 365
TOTAL 103 94
 1. COMPLEX NUMBERS
SHORT ANSWER QUESTIONS (4 MARKS)
𝑧 −𝑧
01.*** If 𝑧3 −𝑧1 is a real number , show that the points represented by the complex numbers z1,z2, z3 are
2 1
collinear
02.*** If z= x+iy and if the point P in the Argand plane represents z. Find the locus of z satisfying the
equation
|𝑧 − 3 + 𝑖|=4
−3
03. ***(i) Show that the points in the Argand plane represented by the complex numbers -2+7i, +
2
1 7
𝑖, 4 − 3𝑖, 2 (1+i) are the vertices of a rhombus
2
ii) show that the four points in the Argand plane represented by the complex numbers 2+i,
4+3i, 3i are the vertices of a square
(iii) show that the points in the argand diagram represented by the complex numbers 2+2i, -2-I,
-2√3+2√3I are the vertices of an equilateral triangle
04*** The points P,Q denote the complex numbers z1,z2 in the argand diagram O is the origin . If z1𝑧̅2
+ 𝑧̅1 z2=0 then show that ⌊𝑃𝑂𝑅 = 900
𝑧−4
05*** Determine the locus of z,z≠2i, such that Re (𝑧−2𝑖)=0
2+11𝑖 −2+𝑖
06.*** Show that z1= , z2= (1+2𝑖)2 are conjugate to each other
25
1
07.*** i) If x+iy = 1+𝑐𝑜𝑠𝜃+𝑖𝑠𝑖𝑛𝜃 then show that (4x2-1)=0
2+𝑖
ii) If u+iv = 𝑧+3 and z= x+iy then find u,v
𝑥 𝑦
iii) If (x-iy)1/3=a-ib, then show that : 𝑎 + 𝑏 =4 (a2-b2)
08.*** Show that the equation of any circle in the complex plane is of the form z𝑧̅+ b𝑏̅ + 𝑏̅z +c=0 (b∈
𝐶: 𝑐 ∈ 𝑅)
09.** If z= 2-i√7, then show that 3z3-4zz+z+88=0
𝑧−2 𝜋
10.** If the amplitude of (𝑧−6𝑖) = 2 , find its locus
𝑧 2𝑧 +𝑧
11.** If 𝑧2.z1≠0, is an imaginary number then find the value of |2𝑧1 −𝑧2 |
1 1 2
3
12.** If x+iy= 2+cos 𝜃+𝑖𝑠𝑖𝑛𝜃 then, show that x2+y2= 4x-3
𝜋
13.* The complex number z has argument 𝜃, 𝑜 < 𝜃 < and satisfying the equation |𝑧 − 3𝑖|=3 . Then
2
6
prove that (𝑐𝑜𝑡𝜃 − 𝑧)=i
VERY SHORT ANSWER QUESTIONS (2 MARKS)
01. Find the square roots of (i) (7+24i) ii) -47+i8√3
02. find the complex conjugate of (3+4i)(2-3i)
03. find the complex conjugate of (2+5i)(-4+6i)
04. Find the polar form of following complex numbers
i) (-1-√3i) ii) z= - √7 + 𝑖√21 iii) -1-I iv) (1+i√3)
05. If z= 2-3i, show that z2-4z+13=0
06. i) If z1=-1 and z2=-I , then find Arg(z1z2)
𝑧
ii) If z1=-1,z2=i, then find Arg (𝑧1 )
2
1
07. If z= (cos𝜃, 𝑠𝑖𝑛𝜃) , find (z- 𝑧)
08. Find the additive inverse of (-6,5) + (10,-4)
𝑎+𝑖𝑏
09. Find the real imaginary parts of the complex number 𝑎−𝑖𝑏
10. Find the multiplicative inverse of 7+24i
11. If z≠0, find Arg z+ Arg 𝑧̅
12. If (1-i)(2-i)(3-i)….(1-ni) = x-iy then prove that 2.5.10……(1+n2)= x2+y2
𝑧+1
13. If the real part of is 1 then find the locus of z
𝑧+𝑖
14. If z= x+iy and |𝑧|=1 then find the locus of z
𝜋
15. If the amplitude of (z-1) is then find the locus of z
2
𝜋 𝜋
16. If the Arg 𝑧̅1 and Arg z2 are 5 𝑎𝑛𝑑 3 respectively then find (Arg z1 + Arg Z2)
1+𝑖 𝑛
17. Find the least positive integer n, satisfying (1−𝑖) =1
18. If |𝑧 + 𝑎𝑖| = |𝑧 − 𝑎𝑖|, find the locus of z
𝑥 𝑦
19. If (x+ay)1/3= a-ib then prove that 𝑎 + 𝑏 =4(a2+b2)
20. If (√3+i)100= 299(a+ib) then find that a2+b2=4
21. If (a+ib)2= x+iy, find x2+y2
22. If x+iy = cis𝛼. 𝑐𝑖𝑠𝛽, then find the value of x2+y2
5𝑖
23. Write the conjugate of complex number 7+𝑖
24. Express 1-I in modulus- amplitude form
25. Represent the complex number 2+3i in argand plane
26. S.T the complex number z satisfying z2+z-2 =2 constitute a hyperbola
27. Describe geometrically the following subsets of C.{z∈ 𝐶/|𝑧 − 1 + 𝑖| = 1}
2. DE MOIVRE’S THEOREM
LONG ANSWER QUESTIONS (7 MARKS)
𝑛𝜋
01.*** i) If n is an integer then show that (1+i)2n+(1-i)2n= 2n+1 cos 2
𝑛𝜋
ii) If n is a positive integer then show that (1+i)n+(1-i)n= 2n+2/2 cos ( 4 )
02.*** If 𝛼, 𝛽 are the roots of the equation x2+2x+4=0 then for any positive integer n show that 𝛼 n+ 𝛽 n
𝑛𝜋
= 2n+1 cos ( 3 )
𝜃 𝑛𝜃
03.*** If n is an integer then show that (1+cos𝜃+isin𝜃)n + (1+cos𝜃- isin𝜃)n = 2n+1 cosn( 2) cos ( 2 )
8
𝜋 𝜋 3
1+sin +𝑖𝑐𝑜𝑠
04.*** Show that one value of ( 8
𝜋 𝜋
8
) = -1
1+sin −𝑖𝑐𝑜𝑠
8 8
05.*** If cos𝛼 + 𝑐𝑜𝑠𝛽 + 𝑐𝑜𝑠𝛾 = 0 = 𝑠𝑖𝑛𝛼 + 𝑠𝑖𝑛𝛽 + 𝑠𝑖𝑛𝛾. Then prove that
3
cos2𝛼 + cos2𝛽 + cos2𝛾 = 2 =sin2𝛼 + sin2𝛽 + sin2𝛾
06.*** If cos𝛼 + 𝑐𝑜𝑠𝛽 + 𝑐𝑜𝑠𝛾 = 0 = 𝑠𝑖𝑛𝛼 + 𝑠𝑖𝑛𝛽 + 𝑠𝑖𝑛𝛾 then show that
i) cos3𝛼 + 𝑐𝑜𝑠3𝛽 + 𝑐𝑜𝑠3𝛾 =3cos(𝛼 + 𝛽 + 𝛾)
 ii)𝑠𝑖𝑛3𝛼 + 𝑠𝑖𝑛3𝛽 + 𝑠𝑖𝑛3𝛾= 3 sin(𝛼 + 𝛽 + 𝛾)
iii) cos(𝛼 + 𝛽) + cos(𝛽 + 𝛾) + cos(𝛾 + 𝛼)=0
1 𝑄
07.***If n is a positive integer, show that (P+iQ)Vn+(P- iQ)1/n =2(P2+Q2)1/2n cos (𝑛 tan-1𝑃 )
08.*** Find all the roots of the equation x11-x7+x4-1=0
09.*** Solve (x-1)n=xn, where n is a positive integer
10.** Solve x9-x5+x4-1=0
𝜋 𝑧 2𝑛 −1
11.** If n is an integer and z= cis𝜃, (𝜃 ≠ (2𝑛 + 1) 2 ), then show that 𝑧 2𝑛+1 = 𝑖𝑡𝑎𝑛𝑛𝜃
12.* If m,n ∈Z and x= cos𝛼 + 𝑖𝑠𝑖𝑛𝛼, 𝑦 = 𝑐𝑜𝑠𝛽 + 𝑖𝑠𝑖𝑛𝛽 then show that
1
i) xmyn +𝑥 𝑚 𝑦 𝑛 = 2cos(𝑚𝛼 + 𝑛𝛽) and
1
ii) xmyn - 𝑥 𝑚𝑦 𝑛 = 2isin(𝑚𝛼 + 𝑛𝛽)
13.* State & prove De Moivre’s theorem for integral index
VERY SHORT ANSER QUESTIONS (2 MARKS)
1
01. If x= cis𝜃, then find the value of (x6+ 𝑥 6 )
02. If A,B,C are angles of a triangle ABC such that x= cisA, y= cisB, z= cisC, then find the value of
XYZ
03. i) If the cube roots of unity are 1, 𝜔, 𝜔2 , then find the roots of the equation (x-1)3+8=0
ii) find the cube roots of 8
04. Find the value of the following
√3 𝑖 √3 𝑖
i) (1+i√3)3 ii) (1+i)16 iii) ( 2 + 2)5 – ( 2 − 2)5
05. Find all the values of (i) (√3 + 𝑖)1/4 ii) (-i)i/6 iii) (-32)1/5
1 1 1
06. If 1, 𝜔, 𝜔2 are the cube roots of unity, then prove that i) 2+𝜔 + 1+2𝜔 = 1+𝜔
𝑖𝑖) (2 − 𝜔)(2 − 𝜔2)(2-𝜔10)(2-𝜔11)=49
07. If 1, 𝜔, 𝜔2 are the cube roots of unity , then find the values of the following
i) (a+2b)2+(a𝜔2+2b𝜔2)+(𝑎𝜔+2b𝜔2)2 ii) (1-𝜔 + 𝜔2)3
𝑎+𝑏𝜔+𝑐𝜔 2 𝑎+𝑏𝜔+𝑐𝜔 2
iii) (1-𝜔)(1-𝜔2)(1-𝜔4)(1-𝜔8) iv) (𝑐+𝑎𝜔+𝑏𝜔2) + (𝑏+𝑐𝜔+𝑎𝜔2 )
v) (1-𝜔 + 𝜔2)5+(1+𝜔 − 𝜔 2)5 vi) (1-𝜔 + 𝜔2)6+(1-𝜔2+𝜔)6
vii) (1-𝜔 + 𝜔2)3
08. If 1,𝜔, 𝜔2 are the cube roots of unity . Then prove that x2+4x+7=0 where x= 𝜔 − 𝜔 2-2
(𝑐𝑜𝑠𝛼+𝑖𝑠𝑖𝑛𝛼)4
09. simplify (𝑠𝑖𝑛𝛽+𝑖𝑐𝑜𝑠𝛽)8

3. QUADRATIC EQUATIONS & EXPRESSIONS

SHORT ANSWER QUESTIONS (3 MARKS)
𝑥−𝑝
01.*** If the expression 𝑥 2 −3𝑥+2 takes all real values of x𝜖 R then find the limits for ‘p’
𝑥 −1
02.*** If ‘x’ is real then prove that 𝑥 2 −5𝑥+9 lies between and 1
11
𝑥 2 +34𝑥−71
03.*** If ‘x’ is real show that the value of the expression does not lie between 5 and 9
𝑥 2 +2𝑥−7
1 1 1
04.*** Prove that 3𝑥+1 + 𝑥+1 − (3𝑥+1)(𝑥+1) does not lie between 1 and 4, if x is real
 𝑥 2 +14𝑥+9
05.*** If ‘x’ is real, find the maximum and minimum values of the expression 𝑥 2 +2𝑥+3
𝑥+2
06.*** Determine the range of for x ∈ 𝑅
2𝑥 2 +3𝑥+6
𝑥 2 +𝑥+1
07.*** Determine the range of the expression 𝑥 2 −𝑥+1 for x ∈ 𝑅
2𝑥 2 −6𝑥+5
08*** i) If x is real, then find the range of 𝑥 2 −3𝑥+2
(𝑥−1)(𝑥+2)
ii) Determine the range of the expression ,x∈𝑅
𝑥+3
09.*** If x1,x2 are the roots of the quadratic equation ax2+bx+c=0 and c≠0. find the value of (ax1+b)-2+
(ax2+b)-2 in terms
of a,b,c
10.* Let a,b,c ∈ R a≠0 such that the equation ax2+bx+c=0 has real roots 𝛼𝑎𝑛𝑑𝛽, 𝑤𝑖𝑡ℎ𝛼 < 𝛽 then
i) For 𝛼 < 𝑥 < 𝛽, ax2+bx+c and a have opposite signs
ii) For x<𝛼𝑜𝑟𝑥 > 𝛽, ax2+bx+c and a have the same sign
11.* If c2≠ab and the roots of the equation (c2-ab)x2-2(a2-bc)x-(b2-ac)=0 are equal, then show that
a3+b3+c3=3abc or a=0
12.* Let a,b,c 𝜖𝑅 and a≠0 then the roots of ax2+bx+c=0 are non real complex numbers if and only if
ax2+bx+c and a have
the same sign for all x∈ 𝑅
13.* If the equations x2+cx+d=0 and x2+ax+b=0 have a common root and the second equation has
equal roots, then
prove that 2(b+d)=ac
14.* Solve 2x4+x3-11x2+x+2=0
15.* solve 71+x+71-=50 for real x
𝑥 1−𝑥 13
16.* solve √1−𝑥 + √ =6
𝑥

17.* Solve the inequaion √𝑥 2 − 3𝑥 − 10 >(8-x)

VERY SHORT ANSWER QUESTIONS (2 MARKS)
01. Find the quadratic equation whose roots are 7+2√5𝑎𝑛𝑑 7 − 2 √5
02. find the quadratic equation whose roots are -3±5i
𝑝−𝑞 −(𝑝+𝑞)
03. Find the quadratic equation whose roots are 𝑝+𝑞 , (𝑝 ≠ ±𝑞)
𝑝−𝑞
04. (i) For what values of ‘m’ the equation (m+1)x2+2(m+3)x+8=0 has equal roots
(ii) For what values of x the expression x2-5x-14 is positive?
05. If the equation x2-15-m(2x-8)=0 has equal roots find the value of m
06. If 1, 𝜔, 𝜔2 are the solutions of x2+x-12≤0 by algebraic method
07. If 𝛼, 𝛽 are the roots of the equation ax2+bx+c=0 find the value of
1 1 1 1 𝛼 𝛽
i) 𝛼 + 𝛽 𝑖𝑖) 𝛼2 + 𝛽2 𝑖𝑖𝑖) 𝛽2 + 𝛼2 𝑖𝑣) 𝛼 4 𝛽 7 +𝛼 7 . 𝛽 4
08. i) Find the maximum (or) minimum of the expression 12x-x2-32
ii) Find the maximum (or) minimum of the expression 2x-7-5x2
iii) Find the maximum (or) minimum of the expression 3x2+2x+11
iv) Find the value of x at which the expression x2+5x+6 have maximum or minimum
 v) Find the maximum (or) minimum of the expression x2-x+7 as x varies over R
09. State the sign of the expression x2-5x+6
10. Find the quadratic equation the sum of whose roots is one and sum of the square of the roots is 13
11. x2-6x+5=0 and x2-3ax+35=0 have a common root then find the value of ‘a’
12. i) x2+bx+c=0 and x2+cx+b=0 have a common root then show that b+c+1=0
ii) If the quadratic equations ax2+2bx+c=0 and ax2+2cx+b=0 , (b≠0 ) have a common root, then
show that a+4b+4c=0
13. Suppose that the quadratic equations ax2+bx+c=0 and bx2+cx+a=0 have a common root. Then
show that
a3+b3+c3=3abc
14. If x2+4ax+3=0 and 2x2+3ax-9=0 have a common root, then find the values of ‘a’ and the common
roots
15. prove that the roots of (x-a)(x-b)=h2 are always real
16. Find all the numbers which exceeds their square root by 12
17. Find the condition that one root of the quadratic equation ax2+bx+c=0 shall be n times the other ,
where n is a
positive integer
18. For what values of x, the expression 15+4x-3x2 is negative
19. prove that there is a unique pair of consecutive positive odd integers such that the sum of their
squares is 290 and find it
20. Show that the roots of the equation x2-2px+p2-q2+2qr-r2=0 are rational, given that p,q,r are rational
21. If 𝛼, 𝛽 are the roots of the equation ax2+bx+c=0 then form a quadratic equation whose roots are
p𝛼𝑎𝑛𝑑𝑝𝛽(p is real number) in terms of a,b,c,p
4. THEORY OF EQUATIONS
LONG ANSWER QUESTIONS (7 MARKS)
01.*** Solve the equation x4-10x3+26x2-10x+1=0
02.*** Solve 6x6-25x5+31x4-31x2+25x-6=0
03.*** solve 6x4-35x3+62x2-35x+6=0
04.*** solve the equation x5-5x4+9x3-9x2+5x+1=0
05. ***Solve the equation 2x5+x4-12x3-12x2+x+2=0
06.*** Give that the roots of x3+3px2+3qx+r=0 are in
i) A.P show that 2p3-3pq+r=0
ii) G.P show that p3r = q3
iii) H.P show that 2q3=r(3pq-r)
07.*** Solve 18x3+81x2+121x+60=0 , give that one root is equal to half the sum of the remaining roots
08.*** Solve : x4+x3-16x2-4x+48=0 , given that the product of two roots is 6
09.*** Solve 4x3-24x2+23x+18=0 given that the roots are in the A.P
10.***solve the equation x4-6x3+13x2-24x+36=0 , given that they have multiple roots
12.** Solve x4+4x3-2x2-12x+9=0 , given that it has two pairs of equal roots
13.** solve 8x4-2x3-27x2+6x+9=0 , given that two of the roots have the same absolute value, but are
opposite in sign
14.** solve x3-9x2+14x+24=0 , given that two of the roots are in the ratio 3:2
15*. i) Transform x4+4x3+2x2-4x-2=0 into one in which the coefficient of second highest power of x is
zero and also find its transformed equation
ii) Transform x4+2x3-12x2+2x-1=0 into one in which the coefficient of second highest power of x
is zero and also find its transformed equation
16.* Find the equation whose roots are the translates of the roots of x5+4x3-x2+11=0 by -3.
17.* Find the polynomial equation whose roots are the translate of the equation x5-4x4+3x2-4x+6=0 nu
-3
18.* Solve 3x3-26x2+52x-24=0 , give that the roots are in geometric progression
19.*solve x4-4x2+8x+35=0 , give that 2+i√3 is a root
VERY SHORT ANSWER QUESTIONS (2 M)
01. Form the equation whose roots are 2±√3; 1 ± 2𝑖
02. If -1,2 and 𝛼 are the roots of 2x3+x2-7x-6=0 , then find 𝛼
03. If 1,-2 & 3 are the roots of x3-2x2+ax+6=0 then find ‘a’
04. If the product of the roots of 4x3+16x2-9x-a=0 is 9, then find a
05. If 1,1,𝛼 are the roots of x3-6x2+9x-4=0 then find 𝛼
06. If 𝛼, 𝛽, 1 are the roots of x3-2x2-5x+6=0 , then find 𝛼𝑎𝑛𝑑𝛽
07. If 𝛼, 𝛽𝑎𝑛𝑑𝛾 are the roots of x3-2x2+3x-4=0 then find
i) ∑ 𝛼 2 𝛽 2 𝑖𝑖) ∑ 𝛼 2 𝛽 + ∑ 𝛼𝛽 2
08. Find the quotient and remainder when x4-11x3+44x2-76x+48 is divided by x2-7x+12
09. Find the transformed equation whose roots are the negatives of the roots of x4+5x3+11x+3=0
10.Find the polynomial equation whose roots are reciprocals of the roots of
x4-3x3+7x2+5x-2=0
11. i) If 𝛼, 𝛽 , 𝛾 are the roots of the equations x3+2x2-4x-3=0 find the equation whose roots are 3 times
the roots of given equation
ii) Find the algebraic equation whose roots are two times the roots of x5-2x4+3x3-2x2+4x+3=0
iii) If 𝛼, 𝛽 , 𝛾 are the roots of 4x3-6x2+7x+3=0 then find the values of 𝛼𝛽 + 𝛽𝛾 + 𝛾𝛼
12. Find the polynomial equation whose roots are the squares of the roots of x3+3x2-7x+6=0
13. If 1,2,3, and 4 are the roots of x4+ax3+bx26+cx+d=0 then find the values of a,b,c and d
1 1 1
14. Form the equation whose roots are ‘m’ times the roots of the equation x3+4x2- 16x+72=0 and
deduce the case when m=12
5. PERMUTATIONS & COMBINATIONS
SHORT ANSWER QUESTIONS (4M)
01. *** i) Simply 34C5+ ∑4𝑟=0(38 − 𝑟)𝐶4
ii) prove that : 25𝐶4 + ∑4𝑟=0(29 − 𝑟) 𝐶 3=30𝐶4
4𝑛𝐶2𝑛 1.3.5……….(4𝑛−1)
02.***prove that = {1.3.5………..(2𝑛−1)}2
2𝑛𝐶𝑛

03.*** If the letters of the word MASTER are permuted in all possible ways and the words thus
formed are arranged in the dictionary order. Then find the rank of the word
i) REMAST II) MASTER
04. *** If the letters of the word PRISON are permuted in all possible ways and the words thus
formed are arranged in dictionary order. Then find the rank of the word PRISON
05.*** IF the letters of the word BRING are permuted in all possible ways and the words thus formed
are arranged in the dictionary order, thus find the 59th word
06.*** If the letters of the word EAMCET are permuted in all possible ways and if the words thus
formed are arranged in dictionary order, find the rank of EAMCET
07.***If the letters of the word AJANTA are permuted in all possible ways and the words thus formed
are arranged in the dictionary order, find the ranks of the words
i) AJANTA II) JANATA
08.*** Find the number of ways of permuting the letters of the word ‘PICTURE’ so that
i) all vowels come together ii) no two vowels come together
09.*** Find the number of ways of seating 5 Indians, 4 americans and 3 Russians at a round table so
that
i) all Indians are sit together ii) persons of same nationality sit together iii) no two
Russians sit together
10.*** Find the number of ways of arranging 6red roses and 3 yellow rose of different sizes into a
garland. In how many of them
i) all the yellow roses are together ii) no two yellow roses are together
11.*** Find the number of ways of arranging 6 boys and 6 girls in a row. In how many of these
arrangements
i) all the girls are together ii) no two girls are together iii) boys and girls come alternately
12.*** Find the number of ways of arranging 6 boys and 6 girls around a circular table so that
i) all the girls sit together ii) no two girls sit together iii) boys and girls sit
alternately
13.***i) find the number of ways of selecting a cricket team of 11 players from 7 batsmen and 6
bowlers such that there will be atleast 5 bowlers in the team
ii)find the number of ways of selecting 11 members cricket team from 7 batsmen, 6 bowlers
and 2 wicket- keepers, so that the team contains 2 wicket – keepers and atleast 4 bowlers
14.*** Find the number of ways of forming a commit of 5 members out of 6 Indians and 5 Americans
so that always the Indians will be in majority in the committee
15.***A candidate is required to answer 6 out of 10 questions which are divided into 2 groups A and
B each containing 5 questions. He is not permitted to attempt more than 4 questions from either
group. Find the no. of different ways in which the candidate can choose six questions
16.*** Find the no. of ways of forming a committee of 4 members out of 6boys and 4 girls such that
there is atleast one girl in the committee
17.***i) If 1≤ 𝑟 ≤ 𝑛, then prove that nCr-1 + nCr = n+1Cr
ii) for 3≤ 𝑟 ≤ 𝑛, prove that n-3Cr +3. n-3Cr-1+3.n-3Cr-2+n-3Cr-3 = nCr
18.*** i) find the sum of all 4 digited numbers that can be formed using the digits 1,2,4,5,6 without
repetition
ii) find the sum of all 4- digit numbers that can be formed using the digits 1,3,5,7,9 (with our
repetition)
19.*** Find the number of numbers that are greater than 4000 which can be formed using the digits
0,2,4,8 without repetition
20.*** Find the number of 4 digited numbers that can be formed by using the digits 1,2,3,4,5,6 that are
divisible by i) 2 ii) 3 when repetition is allowed
21.** Find the no. of 4- digit numbers that can be formed using the digits 2,3,5,6,8 (without
repetition).How many of them are divisible by
i)2 ii)3 iii)4 iv)5 v)25
22.**In how many ways 9 mathematics papers can be arranged so that the best and the worst i) may
come together ii) may not come together
23.** Find the number of 4 letter words that can be formed using the letters of the word ‘RAMANA’
24.** A double decker minibus has 8 seats in the lower deck and 10 seats in the upper deck. Find the
number of ways of arranging 18 persons in the bus if 3 children want to go the upper deck and 4 old
people can not go to the upper deck
25.** Find the sum of all 4- digited numbers that can be formed using digits 0,2,4,7,8 with out
repetition
26.* If a set A has 8 elements. find the number of subsets of A containing atleast 6 elements?
27.* 14 persons are seated at a round table. Find the no. of ways of selecting two persons out of them
who are not seated adjacent to each other
VERY SHORT ANSWER QUESTION (2 MARKS)
01. I) If nP4=1680 then find ‘n’
ii) If nP3=1320 find ‘n’
02. i) If (n+1)P5 : nP6 = 2:7 , find n
ii) If (n+1)P5: nP5 =3:2 then find n
03. If nP7 = 42 . nP5 find n
04.(i) If 12P5+5. 12 P4 = 13Pr find ‘r’
05. If 10. nC2=3. (n-1)C3 then find n
06. If nC21= nC27, then find 50Cn
07. If nC5=nC6 then find the value of 13Cn
08. (i) If 12Pr = 1320, find ‘r’ ii) IF nC4=210 , then find n
09. i) IF 12Cr-1 = 12C3r-5 find ‘r’
ii) IF 12Cs/1= 12C(2s-5) then find ‘s’
iii) IF 15C2r-1= 15C(2r+4) then find ‘r’
10. Find the value of 10C5+2. 10C4 + 10C3
11. If nPr = 5040 and nCr=210 find ‘n’ and ‘r’
12. Find the number of ways of arranging the letters of the word
i) PERMUTATION
ii) INTERMEDIATE
iii) INDEPENDENCE
iv) MATHEMATICS
13. Find the number of ways of arranging the letters of the word TRIANGLE so that the relative
position of the vowels and consonants are not disturbed
14. Find the number of 4 letter words that can be formed using the letters of the word PISTON in
which at least one letter is repeated
15. Find the number of ways of arranging 4 boys and 3 girls around a circle so that all the girl sit
together
16. Find the number of ways of selecting 3 vowels and 2 consonants form the letters of the word
‘EQUATION’
17. Find the number of ways of selecting 7 members form a contingent of 10 soldiers
18. Find the number of ways of selecting 3 girls and 3 boys out of 7 girls and 6 boys
19. Find the number of different chains that can be prepared using 7 different coloured beads
20. Find the number of ways of arranging 5 boys and 5 girls around a circle
21. Find the number of ways of preparing a chain with 6 different coloured beads
22. How many numbers can be formed using all the digits 1,2,3,4,3,2,1 such that even digits always
occupy even places
23. Find the number of 5 letters words that can be formed using the letters of the word NATURE, that
begin with ‘N’ when repetition is allowed
24. Find the number of bijections from a set A containing 7 elements on to itself
25. Find the number of injections from set A containing 5 element in to a set B containing 7 elements
26. Find the number of positive divisors of 1080
27. Find the no. of zero’s in 100!
28. To pass an examination a student has to pass in each of the three papers. In how many ways can a
student fail in the examination?
29. Find the number of i)6 ii)7 letter palindromes that can be formed using the letters of the
word EQUATION
30. Define palindrome and give examples
31. Find the number of seven digited palindromes that can be formed using 0,1,2,3,4
32. If a set A has 12 elements, then find the number of subsets of A having 4 elements
33. Find the number of ways in which 4 letters can be put in 4 addressed envelopes so that no letter
goes into the envelope meant for it
34. Find the number of diagonals of a polygon with 12 sides
35. Find the number of ways of selecting 4 boys and 3 girls from a group of 8 boys and 5 girls
36. A number lock has 3 rings and each ring has 9 digits 1,2,3,…..9 . Find the maximum no. of
unsuccessful attempts that can be made by a person who tries to open the lock with out knowing the
key code
37. If a set of m parallel lines intersect another set of n parallel lines (not parallel to the lines in the
first set ), then find the no. of parallelograms formed in this lattice structure
6. BINOMIAL THEOREM
LONG ANSWER QUESTIONS( 7MARKS)
3.5 3.5.7 3.5.7.9
01.*** Find the sum of series 5.10
+ 5.10.15 + 5.10.15.20 + ⋯ … … … . . ∞
3 3.5 3.5.7
02. *** Find the sum of series + 4.8 + 4.8.12 + ⋯ ∞
4
1 1.3 1.3.5
03.*** Find the sum of series 1 + 3 + 3.6 + 3.6.9 + ⋯ . . ∞
 2 1 2.5 1 2.5.8 1
04.*** Find the sum of infinite series 1 + 3 . 2 + 3.6 . (2)2 + 3.6.9 . (2)3 + ⋯ ∞
1.3 1.3.5 1.3.5.7
05.*** IF x= + + + ⋯, then prove that 9x2+24x=11
3.6 3.6.9 3.6.9.12
4 4.6 4.6.8
06. *** If t= 5 + 5.10 + 5.10.15 + ⋯ ∞ then prove that 9t=16
5 5.7 5.7.9
07. *** If x= (2!)3 + 2 + 3 + ⋯, then find the value of x2+4x
(3!)3 (4!)3
1 1.3 1.3.5
08.*** If x= 5 + 5.10 + 5.10.15 + ⋯ ∞, then find 3x2+6x
7 1 1.3 1 1.3.5 1
09.*** Find the sum of the infinite series 5 (1 + 102 + 1.2 (104 ) + 1.2.3 (106 ) + ⋯ )
3 3.5 3.5.7
10.*** Find the sum of the infinite series 4.8 − 4.8.12 + 4.8.12.16 − ⋯
11.*** Show that for any non- zero rational number
𝑥 𝑥(𝑥−1) 𝑥(𝑥−1)𝑥−2) 𝑥 𝑥(𝑥+1) 𝑥(𝑥+1)(𝑥+2)
x, 1 + 2 + + +⋯= 1+3+ + +⋯
2.4 2.4.6 3.6 3.6.9
12.*** If ‘n’ is a positive integer and ‘x’ is any non- zero real number, then prove that
𝑥 𝑥2 𝑥𝑛 (1+𝑥)𝑛+1 −1
C0+C1. 2 +C2+ + ⋯ +Cn𝑛+1 = (𝑛+1)𝑥
3
13.*** For r= 0,1,2…….,n prove that C0.Cr+C1.Cr+1 +C2.Cr+2 + …….+Cn-r.Cn=2𝑛𝐶𝑛+𝑟 hence deduce that
i) Co2+C12+C22+……..+Cn2 = 2nCn
ii) C0.C1+ C1.C2 + C2.C3+….+Cn-1.Cn = 2𝑛𝐶𝑛+1
(𝑛+1)𝑛
14.*** Prove that (C0+C1).(C1+C2).(C2+C3)………..(Cn-1+Cn) = C0.C1.C2………Cn
𝑛!
15.*** If the coefficients of 4 consecutive terms in the expansion of (1+x)n are a1,a2 , a3,a4 respectively
𝑎1 𝑎3 2𝑎2
then show that 𝑎 +𝑎 =𝑎
1 +𝑎2 3 +𝑎4 2 +𝑎3

16.*** If the 2nd, and 3rd 4th

terms is the expansion of (a+x)n are respectively 240, 720, 1080, find a,x,n
17.*** If 36, 84, 126 are three successive binomial co- efficient in the expansion of (1+x)n, then find n
18.*** If the coefficients of rth , (r+1)th and (r+2)th terms is the expansion of (1+x)n are in A.P, then
show that n2-(4r+1)n+4r2-1=0
19.*** If the coefficient of x9,x10 and x11 terms in the expansion of (1+x)n are in A.P , then prove that n2-
41n+398=0
20.*** If P and Q are the sum of odd terms and the sum of even terms respectively in the expansion of
(x+a)n then prove that i) P2-Q2 = (x2-a2)n ii) 4PQ = (x+a)2n- (x-a)2n
1
21.*** If the coefficient of x10 in the expansion of (ax2+ 𝑏𝑥)11 is equal to the coefficient of x-10 in the
expansion
1
(ax2+ 𝑏𝑥 2 )11 , find the relation between a and b, where a and b are real numbers
22.*** Suppose that ‘n’ is a natural numbers and I,F are integral part and fractional part of (7+4√3)n.
then show that i)I is an odd integer ii) (I+F)(I-F)= I
23.*** If R, n are positive integers, n is odd, 0 < F < I and if (5√5+11) = R+F then prove that
i) R is an even integer and ii) (R+F).F=4n
24.*** State and prove binomial theorem for the positive integral index
25.** Using binomial theorem prove that 50n-49n-1 is divisible by 492 in all positive integer ‘n’
2
𝑛𝐶𝑟 𝑛(𝑛+1)2 (𝑛+2)
26.** If ‘n’ is positive integer, prove that ∑𝑛𝑟=1 𝑟 3 (𝑛 ) =
𝐶𝑟−1 12
27.** If |𝑥| is so small that x3 and higher powers of x can be neglected, find the approximate value of
(4−7𝑥)1/2
(3+5𝑥)3

VERY SHORT ANSWER QUESTIONS (2 MARKS)

01.Find the number of terms in the expansion of
3𝑎 𝑏
i) (2x+3y+z)7 ii) ( 4 + 2) 9
02. Find the number of terms with non- zero coefficient in (4x-7y)49+ (4x+7y)49
03. Find the set of values of ‘x’ for which
i) (2+3x)-2/3 is valid ii) (7+3x)-5 is valid iii) (3-4x)3/4 is valid
04. If 22Cr is the largest binomial coefficient in the expansion of (1+x)22 find the value of 13Cr
05. Find the largest binomial coefficient (s) in the expansion of (1+x)19
2𝑥 2 5
06. Find the coefficient of x-7 in ( − )7
3 4𝑥 5
3𝑥 3
07. Find the middle terms in the expansion of i) ( 7 − 2𝑦)10 𝑖𝑖) (4𝑎 + 2 𝑏)11
9
7 2𝑥 2 15
08. Find the term independent of ‘x’ in the expansion of i) (4𝑥 3 + 𝑥 2 )14 ii) ( + 4𝑥)
5
09. Prove that C0+ 2.C1+4C2+8.C3+……..+2nCn
= 3n
10. Prove that 2.C0+5.C1+8.C2+……+(3n+2).Cn= (3n+4).2n-1
11. Find the sum of the following
15𝐶1 15𝐶2 15𝐶3 15𝐶15
i) 15 + 2. 15 + 3. 15 + ⋯ + 15. 15
𝐶0 𝐶1 𝐶2 𝐶14

ii) 22 . C0 + 32.C1 +42.C2+………..+(n+2)2.Cn

3 2
12. Find the numerically greatest term (s) in the expansion of (3x-5y)n where x= , 𝑦 = and n=17
4 7
5𝑥 -3/2
13. Find the 8th term of (1 − )
2
5 3 3 6
14. Find the approximate values of i) √242𝑖𝑖) √1002 − √998𝑖𝑖𝑖) √63 correct to 4 decimal places
4
15. Expand 5√5 in increasing power of 5
16. If (1+x+x2)n= a0+a1x+a2x2+…………….+a2nx2n then find the value of a0+a2+a4+……..+a2n
17. If (1+3x-2x2)10 = a0+a1x+a2x2+………….+a20x20, prove that
i) a0+a1+a2+…………….+a20= 210
ii) a0-a1+a2-………………+a20= 410
18. Find the remainder when 22013 is divided by 17
1.3.5………..(2𝑛−1)
19. show that the middle term in the expansion of (1+x)2n is (2𝑥)n
𝑛!
20. Find the number of irrational terms is the expansion of (51/6+21/8)100
21. Find the sum of last 20 coefficients in the expansion of (10x)39
3
22. find the 3rd term from the end in the expansion of (x-2/3 - 𝑥 2 )8
23. If the coefficients of (2r+4)th term and (3r+4)th term in the expansion of (1+x)21 are equal, then find
‘r’
14
4 𝑥2
24. Find the 7th term in the expansion of (𝑥 3 + )
2
2𝑥 3𝑦 9
25. Find the 6th term in the expansion of ( 3 + )
2
 7. PARTIAL FRACTIONS
SHORT ANSWER QUESTIONS (4M)
𝑋+4
01. *** (𝑋 2 −4)(𝑋+1)
𝑋−1
02.*** (𝑋+1)(𝑋−2)2
𝑋 2 −3
03.*** (𝑋+2)(𝑋 2 +1)
2𝑋 2 +3𝑋+4 𝑥 2 +5𝑥+7
04. *** i) (𝑋−1)(𝑋 2 +2) ii) (𝑥−3)3
𝑥3 𝑥3
05.*** i) (2𝑥−1)(𝑥+2)(𝑥−3) ii) (𝑥−𝑎)(𝑥−𝑏)(𝑥−𝑐)
𝑥4 𝑥3
06.*** i) (𝑥−1)(𝑥−2) ii) (𝑥−1)(𝑥+2)
3𝑥 3 −8𝑥 2 +10
07.***
(𝑥−1)4
𝑥 3 +𝑥 2 +1
08.*** (𝑥 2 +2)(𝑥 2 +3)
𝑥−4
09.*** Find the coefficient of xn in the power series expansion of 𝑥 2 −5𝑥+6 specifying the region in which
the expansion is valid
𝑥
10.*** Find the coefficient of xn in the power series expansion of (𝑥−1)2 (𝑥−2) specifying the region in
which the expansion is valid
𝑥 2 +13𝑥+15
11. ** (2𝑥+3)(𝑥+3)2
2𝑥+3
12.** 5(𝑥+2)(2𝑥+1)
3𝑥−18
13.** 𝑥 3 (𝑥+3)
𝑥 2 +1
14.* (𝑥 2 +𝑥+1)2
𝑥 2 −𝑥+1
15.* (𝑥+1)(𝑥−1)2
8. MEASURES OF DISPERSION (STATISTICS)
LONG ANSWER QUESTIONS (7 MARKS)
01.*** Calculate the variance and standard deviation of the following continuous frequency
distribution
Class 30-40 40-50 50-60 60-70 70-80 80-90 90-100
interval
frequency 3 7 12 15 8 3 2
02.*** Calculate the variance and standard deviation for the following discreate frequency
distribution:
Xi 4 8 11 17 20 24 32
Fi 3 5 9 5 4 3 1
03.*** Find the mean deviation from the median for the following data
xi 6 9 3 12 15 13 21 22
fi 4 5 3 2 5 4 4 3
04.*** The following table givens the daily wages of workers in a factory. Compute the standard
deviation and the coefficient of variation of the wages of the workers
 Wages 125-175 175-225 225-275 275-325 325-375 375-425 425-475 475-525 527-575
(Rs.)
No . of 2 22 19 14 3 4 6 1 1
workers
05.*** Find the mean deviation about the median from the following continuous distribution
Class 0-10 10-20 20-30 30-40 40-50 50-60 60-70 70-80
interval
Frequency 5 8 7 12 28 20 10 10
06.*** Find the mean deviation about the mean for the following continuous distribution
Height 95-105 105-115 115-125 125-135 135-145 145-155
(in cms)
No . of 9 13 26 30 12 10
Boys
07.*** Find the mean and variance using the step deviation method, of the following tabular data
giving the age distribution of 542 members
Age of 20-30 30-40 40-50 50-60 60-70 70-80 80-90
years (Xi)
Number of 3 61 132 153 140 51 2
members(Fi)
08.*** Find the mean deviation from the mean of the following data, using the step deviation method

Marks 0-10 10-20 20-30 30-40 40-50 50-60 60-70

No .of 6 5 8 15 7 6 2
students

09.*** Lives of two models of refrigerators A and B, obtained in a surver, are given below
Life (in Model A Model B
years
0-2 5 2
2-4 16 7
4-6 13 12
6-8 7 19
8-10 5 9
which refrigerator model would you suggest to purchase
10.***An analysis of monthly wages pair to the workers of two firms A and B belonging to the same
industry gives the following data
Firm Firm
A B
Number of workers 500 600
Average daily wage (Rs.) 186 175
i) Which firm A Variance of distribution of 81 100 or B has greater
variability in individual wages wages?
ii) which firm has larger wage bill?
11.*** The cores of two crickets A and B in 10 innings are given below. find who is a better run getter
and who is a more consistent player
Scores 40 25 19 80 38 8 67 121 66 76
of A :xi
Scores 28 70 31 0 14 111 66 31 25 4
of B:yi
12.***From the prices of shares X and Y given below, for 10 days of trading , find out which share is
more stable?
X 35 54 52 53 56 58 52 50 51 49
Y 108 107 105 105 106 107 104 103 104 101
13.** The mean of 5 observations is 4.4, their variance is 8.24. If three of the observations are 1,2 &6
.Find the other two observations
14.** The arithmetic man and standard deviation of a set of 9 items are 43 and 5 respectively. If an
item of value 63 is added to that set, find the new and standard deviation of 10 item set given
15.** Find the mean deviation from the mean for the following continuous frequency distribution
Sales in 40-50 50-60 60-70 70-80 80-90 90-100
Rs.
thousand
Number of 5 15 25 30 20 5
companies
16.** Find the mean deviation about the mean of data
Marks 0-10 10-20 20-30 30-40 40-50
obtained
No .of 5 8 15 16 6
students
17.** Find the variance and standard deviation of the following frequency distribution
xi 0-10 10-20 20-30 30-40 40-50
fi 5 8 15 16 6

VERY SHORT ANSWER QUESTIONS (2 MARKS)

01. The variance of 20 observation is 5. If each of the observation is multipled by 2, find the variance
of the resulting observations
02. i) Find the mean deviation from the mean of the following discrete data 6,7,10,12,13,4,12,16
ii) find the mean deviation from the mean for the following data 38,70,48,40,42,55,63,46,54,44
iii) Find the mean deviation from the mean of the following discrete data 3,6,10,4,9,10
03. Find the mean deviation about the median for the following data 13,17,16,11,13,10,16,11,18,12,17
04. Find the variance and standard deviation of the following data 5,12,3,18,6,8,2,10
05. The coefficient of variation of two distribution are 60 and 70 and their standard deviations are 21
and 16 respectively. Find their arithmetic mean
06. Find the mean deviation about the mean for the following data
xi 2 5 7 8 10 35
fi 6 8 10 6 8 2
07. Find the mean deviation about the median for the following frequency distribution
xi 5 7 9 10 12 15
fi 8 6 2 2 2 6
08. Find the mean deviation about the median for the following data : 4,6,9,3,10,13,2
09. Define range for an ungrouped data and also find the range of the given data
38,70,48,40,42,55,63,46,54,44
9. PROBABILITY
LONG ANSWER QUESTIONS (7MARKS)
01.*** State and prove addition theorem on probability
02.*** Define conditional probability .state and prove the multiplication theorem on probabiliey
03.*** State and Prove Baye’s theorem
04. *** Three boxes numbered I,II,III contain the balls as follows
Box White Black Red
I 1 2 3
II 2 1 1
III 4 5 3
one day is randomly selected and a ball is drawn from it. If the ball is red then find the probability
that it is from box II
05.*** Three boxes B1, B2 and B3 contain balls with different colours as shown below
Box White Black Red
B1 2 1 2
B2 3 2 4
B3 4 3 2
A die is thrown , B1 is chosen if either 1 or 2 turns up. B2 is chosen if 3 or 4 turns up and B3 is
chosen if 5 or
6 turns up. Having choosen a box in this way, a ball is choosen at random from this box. If the
ball drawn is
found to be red, find the probability that it is drawn from bax B2
06.*** Three Urns have the following composition of balls
Urn I: 1 white, 2 black , Urn II: 2 white, 1 black, Urn III: 2 white, 2 black
one of the Urns is selected at random and a ball is drawn, It turns out to be white .Find the
probability that it came from urn III
07.*** If one ticket is randomly selected from the tickets numbered 1 to 30, then find the probability
that the number on the tickets i) a multiple of 5 or 7 ii) a multiple of 3 or 5
08.*** Define conditional probability . Bag B1 contains 4 white and 2 black balls . Bag B2 contains 3
white and 4 black balls. A bag is drawn at random and a ball is chosen at random from it. what is the
probability that the ball drawn is white?
09.*** There are 3 black and 4 white balls in one bag, 4 black and 3 white balls in the second bag. A
die is rolled and the first bag is selected if the die shows up 1 or 3 , and the second bag for the rest.
find the probability of drawing a black ball, from the bag thus selected
10.*** A,B,C are 3 newspapers from a city . 20% of the population read A, 16% read B, 14% read C, 8%
read both A and B ,5% read both A and C ,4% read both B and C and 2% read all the three. find the
percentage of the population who read atleast one newspaper
11.*** In a box containing 15 bulbs, 5 are defective. If 5 bulbs are selected at random from the box.
Find the probability of the event that
i)none of them is defective
ii) only one of them is defective
iii) atleast one of them is defective
12.**Two persons A and B are rolling a die on the condition that the person who gets 3 will win the
game. If A starts the game, then find the probabilities of A and B respectively to win the game
13.**In an experiment of drawing a card at random from a pack, the event of getting a space is
denoted by A and getting a pictured cad (king, queen or jack) is denoted by b. find the probability of
A,B,A∩ 𝐵, 𝐴 ∪ B
1 2 3
14.** In a shooting test the probability of A,B,C hitting the targets are 2 , 3 𝑎𝑛𝑑 4 respectively. If all of
them fire at the same target, find the probability that
i) only one of them hits the target ii) atleast one of them hits the target
1+3𝑝
15.** The probabilities of three mutually exclusive events are respectively given as ,
3
1−𝑝 1−2𝑝 1 1
, prove that 3 ≤ 𝑝 ≤ 2
4 2
SHORT ANSWER QUESTIONS (4 MARKS)
01.***A,B,C are three horses in a race. the probability of A to win the race is twice that of B, and
probability of B is twice that of C. what are the probabilities of A. B and C to win the race
02.***i) If A and B are independent events with P(A)= 0.2, P(B)= 0.5 .then find
a) P(A/B) b)P(B/A) c)P(A∪ 𝐵) d) P(A ∩ B)
ii) If A and B be independent events with P(A) = 0.6, P(B)= 0.7 then compute
a) P(A ∩ 𝐵) b) P(A∪B) c) P(A/B) d) P(AC∩ BC)
iii) A and B are events with P(A)= 0.5, P(B)= 0.4 and P(A∩B) = 0.3. Find the probability that i) A
does not occur ii) neither A nor B occurs
03.*** If the numbers are selected randomly from 20 consecutive natural numbers, find the probability
that the sum of the two numbers is i) and even number ii) an odd number
04.*** A speaks truth in 75% of the cases and B in 80% cases. what is the probability that their
statements about an incident do not match
05.*** If A,B,C are three independent events of an experiment such that
1 1 1
P(A∩BC∩CC) = 4, P(AC∩B∩CC) = 8, P(AC∩BC∩CC)= 4, then find P(A).P(B) and P(C)
1 1
06.*** A problem in calculus is given to two students A and B whose chances of solving it are 3 and 4
respectively . Find the probability of the problem being solved if both of them try independently
07.*** A number x is drawn arbitarity from the set { 1,2,3,………………,100} . find the probability that
100
(𝑥 + )>29
𝑥
1
08.*** The probability that Australia wins a match against Indian in a cricket game is given to be 3. If
india and Australia play 3 matches what is the probability that
 i) Australia will lose all the 3 matches ii) Australia will win atleast one match
09.*** find the probability of drawing an ace or a spade from a well shuffled pack of 52 playing cards
10.*** If A and B are independent events of a random experiment then show that 𝐴̅ 𝑎𝑛𝑑 𝐵̅ are also
independent events
2 5
11.** The probability for a contractor to get a road contract is 3 and to get a building contract is 9. The
4
probability to get atleast one contract is 5. find the probability that he gets both the contracts
12.** In a committee of 25 members, each member is proficient either in mathematics or in statistics
or in both. If 19 of these are proficient in mathematic, 16 in statistics , find the probability that a
person selected from the committee is proficient in both
13.** A bag contains 12 two rupee coins, 7 one rupee coins and 4 half a rupee coins . If three coins are
selected at random, then find the probability that
i) the sum of three coins is maximum ii) the sum of three coins is minimum
iii) each coin is of different value
14.** The probability of three events A,B,C are such that P(A)=0.3, P(B)= 0.4, P(C)= 0.8, P(A∩B)= 0.09,
P(A∩ 𝐶) = 0.28, 𝑃(𝐴 ∩ 𝐵 ∩ 𝐶) = 0.08 and P(A∪ 𝐵 ∪ 𝐶)≥0.75. show that P(B∩ 𝐶) lies in the
interval [0.21, 0.46]
15.** If A,B,C are three events then show that
P(A∪B∪C)=P(A)+P(B)+P(C)-P(A∩B)-P(B∩C)-P(C∩A)+P(A∩ 𝐵 ∩C)
16.* If p is a probability function then show that for any two events A and B
P(A∩ 𝐵) ≤ 𝑃(𝐴) ≤ 𝑃(∪ 𝐵) ≤ 𝑃(𝐴) + 𝑃(𝐵)
17.* A pair of dice is rolled, what is the probability that they sum to 7 given that neither die shows a
2?
18.* A page is opened at random from a book containing 200 pages. what is the probability that the
number on the page is a perfect square
19.* A fair coin is tossed 200 times . find the probability of getting a head an odd number of times.
20.* Suppose that a coin is tossed three times. Let event A be “getting three heads” and B be the event
of “ getting a head on the first toss”. Show that A and B are dependent events
21.* A single die is rolled twice in succession . what is the probability that the number on the second
toss is greater than that on the first rolling?
22.* If A,B are two events, then show that P(A/B)P(B)+P(A/BC)P(BC)=P(A)
ADDITIONAL PROBLEMS
01. Find the probability that a non- leap year contains
i. 53 Sundays ii. 52 Sundays only
02. If A and B are two events with P(A∪ 𝐵)=0.15. Then find the value of p(𝐴̅) + 𝑃(𝐵̅ )
03. For any two events A and B show that p(𝐴̅ ∩ 𝐵̅)1+P(A∩ 𝐵) − 𝑃(𝐴) − 𝑃(𝐵)
04. If P(A) =x, P(B)= y, P(A∩ 𝐵) = 𝑧 then P(𝐴̅ ∩ 𝐵̅)
05. Two fair dice are rolled, what is the probability that the sum on the faces of the two dice is 10.
06. Find the probability of throwing a total score of 7 with 2 dice
07. Two dice are thrown. Then find the probability of getting the same number on both the faces
08. Find the probability of getting two heads and two tails when four coins are tossed at a time
09. Define i) mutually exclusive events ii) Independent events
10. Find the probability of obtaining two tails and one head when 3 coins are tossed
11. A and B are among 20 persons who sit at random along a round table. Find the probability that
there are any six persons between A and B
10. RANDOM VARIABLES & PROBABILITY DISTRIBUTIONS
LONG ANSWER QUESTIONS(7 MARKS)
01.*** A random variable X has the following probability distribution

X=xi 1 2 3 4 5
P(X=xi) k 2k 3k 4k 5k

find (i)k (ii) mean (iii) variance of X

02.*** A random variable X has the following probability distribution
X=x 0 1 2 3 4 5 6 7
P(X=x) 0 k 2k 2k 3k K 2 2k2 7k2+k
find (i)k (ii) the mean of X (iii) P(0<X<5)
03.*** A random variable X has the following probability distribution

X=xi -2 -1 0 1 2 3
P(X=xi) 0.1 k 0.2 2k 0.3 k

find ‘k’ mean and variance of X

1 1
04.***Let X be a random variable such that P(X=-2)=P(X=-1)=P(X=2)=P(X=1)=6& P(X=0)=3 Find
mean and variance of x
05.*** X=x -3 -2 -1 0 1 2 3
No. of 1/9 1/9 1/9 1/3 1/9 1/9 1/9
workers
is the probability distribution of a random variable x. find the variable of x
06.*** A cubical die is thrown . find the mean and variance of x, giving the number on the face that
shows up
07.*** The range of a random variable X is {0,1,2} and given that P(X=0)=3c3, P(X=1)=4c-
10c2,P(X=2)=5c-1,
find (i) the value of c ii) P(X<1),P(1<X≤2) and P(0<X≤ 3)
08.*** One in 9 ships is likely to be wrecked, when they are set on sail. when 6 ships are on sail find
the probability for (i) atleast one will arrive safely ii) exactly three will arrive safely
09.*** In the experiment of tossing a coin ‘n’ times, if the variable X denotes the number of heads and
P(X=4),P(X=5) and P(X=6) are in A.P., then find ‘n’
10.** Find the probability of guessing atleast 6 out of 10 answer in i) true or false type examination
ii) multiple choice with four possible answers
11.* Five coins are tossed 320 times. Find the frequencies of the distribution of number of heads and
tabulate the result
12.* Two dice are rolled at random. find the probability distribution of the sum of the numbers on
them. find the mean of the random variable
 VERY SHORT ANSWER QUESTIONS (2 MARKS)
01. The mean and variance of a binomial distribution are 4 and 3 respectively. find P(X≥ 1)
02. A poisson variable satisfies P(X=1)=P(X=2) and P(X=5)
03.If the mean and variance of a binomial variable X are 2.4 and 1.44 respectively. find P(1<x≤ 4)
04. For a binomial distribution with mean 6 and variance 2. find the first two terms of the distribution
5
05. If the difference between the mean and the variance of a binomial variate is 9. then find the
probability for the event of 2 successes. when the experiment is conducted 5 times
(𝑘+1)
06. If X is a random variable with probability distribution P(X=k)= , k=0,1,2,……..then find C
2𝑘
𝐶𝑘
07. The range of a random variable X is {1,2,3..} and P(X=k) = ;m (k=1,2,3……….) find the value of
𝑘!
C and P(0<C<3)
2
08. Find the constant ‘c’ so that P(X)= c( )𝑥 , 𝑥 = 1,2,3,4 … 𝑖𝑠 𝑡ℎ𝑒 p.d.f of a discrete random variable X
3
09. In a city 10 accidents take place in a span of 50 days, assuming that the number of accidents
follows the poisson distribution , find the probability that there will be three or more accidents in
a day
10. It is given that 10% of the electric bulbs manufactured by a company are defective . In a sample of
20 bulbs, find the probability that more than 2 are defective
11. On an average, rain falls on 12 days in every 30 days. Find the probability that , rain will fall on
just 3 days of a given week
12. The probability that a person chosen at random is left handed (in handwriting) is 0.1. what is the
probability that in a group of 10 people, there is one who is left handed?
13. Define mean and variance of a random variable
14. Define Binomial distribution
15. Define Poisson distribution
 SENIOR IPE IMPORTANT QUESTION BANK
SR.MATHMATICS- IIB
QUESTION BANK ANALYSIS

S.NO NAME OF THE CHAPTER WEIGHTAGE MARKS

Co – ordinate Geometry
01 Circles 22(7+7+4+2+2)
02 System of circles 06(4+2)
03 Parabola 09(7+2)
04 Ellipse 08(4+4)
05 Hyperbola 06(4+2)
Calculus
06 Integration 18(7+7+2+2)
07 Definite integration 15(7+4+2+2)
08 Differential equations 13(7+4+2)
Total marks 97

S. TOPIC NAME LAQ SAQS VSAQS TOTAL

N
O
*** ** * *** ** *
Co –ordinate Geometry
01 Circles 11 3 8 10 8 9 34 83
02 System of circles - - - 7 5 4 10 26
03 Parabola 12 5 2 - - - 12 31
04 Ellipse - - - 20 6 1 - 27
05 Hyperbola - - - 7 3 6 12 28

Calculus
06 Indefinite 23 6 8 - - - 39 76
Integration
07 Definite Integration 14 2 3 13 9 2 24 67
08 Differential 11 2 3 14 11 5 18 64
equations
SUB TOTAL 71 18 24 71 42 27 149 402
TOTAL 140
 CIRCLES
LONG ANSWER QUESTIONS (7 MARKS)
01.*** Find equation centre of the circle passing through the points (3,4),(3,2)&(1,4)
02.***Find the value of ‘c’ if the points (2,0) ,(0,1),(4,5) and (0,c) are concylic
03.***Find the equation of a circle which passes through the points (4,1),(6,5) and having centre on
4x+3y-24=0
04. ***Find the equation of the circle which passes through (2,-3) and (-4,5) and having the centre on
4x+3y+1=0
05.*** Find the equation of the circle whose centre lies on X-axis and passing through the points (-2,3)
and (4,5)
06.*** i) show that the circles x2+y2-4x-6y-12=0 and x2+y2+6x+18y+26=0 touch each other also find the
point of contact and common tangent at this point of contact
ii)show that circles x2+y2-6x-9y+13=0 , x2+y2-2x-16y=0 touch each other also find the point of
contact and common tangent at this point of contact
07.*** Show that the circles x2+y2-6x-2y+1=0 ; x2+y2+2x-8y+13=0 touch each other. Find the point of
contact and the equation of common tangent at their point of contact
08.*** Find the equation of the pair of direct common tangents to the circles x2+y2-22x-4y-100=0 and
x2+y2-22x+4y+100=0
09.*** Find the equations of the transverse common tangents of the circles
x2+y2-4x-10y+28=0; x2+y2+4x-6y+4=0
10.*** Find the equations of the circles with radius √13 units and touching 2x-3y+1=0 at (1,1)
11. Prove that the equation to the pair of tangents drawn from the point (x1,y1) to the circle S ≡
x2+y2+2gx+2fy+c=0 is S12 = S.S11
12.* Show that the four points (-6,0) , (-2,2), (-2,-8) and (1,1) are concylic
13.** Find the equations of the circles which touches the x- axis at a distance of 3units from the origin
and making an intercept of length 6 units on the y- axis
14.** If the polar of points on the circle x2+y2=a2 with respect to x2+y2=b2 touches the circle x2+y2=c2
then show that a,b ,c are in G.P
15.* show that the points (1,2),(3,-4),(5,-6) and (19,8) are concylic and find the equation of the circle on
which they lie
16.* Show that the points (9,1),(7,9),(-2,12),(6,10) are concyclic and find the equation of the circle on
which they lie
17.* Find the equation of the circle passing through the points (5,7),(8,1),(1,3)
18.* Show that the four common tangents can be drawn for the circles given by x2+y2-114x+6y+33=0,
x2+y2+30x-2y+1=0 and find the internal and external center of similitudes
19.* Find the equation of the circle circumscribing the triangle formed by the lines 2x+y=4, x+y=6
and x+2y=5
20.* If 𝜃1, 𝜃2 are the angles of inclination of tangents through a point P to the circle x2+y2=a2 then find
the locus of P when cot 𝜃1 +cot 𝜃2=k
21.* Find the equation of the circle passing through the three points (1,2),(3,-4),(5,-6)
22.* Find the pair of tangents drawn from (1,3) to the circle x2+y2-2x+4y-11=0 and also find the angle
 between them

SHORT ANSWER QUESTIONS (4MARKS)

01.*** Find the length of the chord intercepted by the circle x2+y2-x+3y-22=0 on the line y=x-3
02.*** Find the length of the chord intercepted by the circle x2+y2-8x-2y-8=0 on the line x+y+1=0
03.*** Show that the tangent at (-1,2) of the circle x2+y2-4x-8y+7=0 touches the circle x2+y2+4x+6y=0
and also find its point of tangency
04.*** Find the equations of tangents to the circle x2+y2-4x+6y-12=0 which are parallel to x+y-8=0
05.*** If a point P is moving such that the lengths of the tangents drawn from P to the circles
x2+y2-4x-6y-12=0 and x2+y2+6x+18y+26=0 are in the ratio 2:3 then find the equation of the locus
of P
06.*** If the chord of contact of a point ‘p’ with respect to the circle x2+y2=a2 cut the circle at A and B
such that ⌊𝐴𝑂𝐵 =900 then show that ‘p’ lies on the circle x2+y2=2a2
07.*** Find the angle between the tangents drawn from (3,2) to the circles x2+y2-6x+4y-2=0
08.*** find the locus of mid points of the chords of contact x2+y2=a2 from the points lying on the line
lx+my+n=0
09.*** If the abscissa of points A,B are the roots of the equation x2+2ax-b2=0 and ordinates of A,B are
roots of y2+2py-q2=0 , then find the equation of a circle for which ̅̅̅̅
𝐴𝐵 is a diameter
10.*** Find the equation of the circle which touches the circle x +y -2x-4y-20=0 externally at (5,5) with
2 2

radius 5 units
11.** find the inverse point of (-2,3) with respect to the circle x2+y2-4x-6y+9=0
12.** Find the area of the triangle formed by the normal at (3,-4) to the circle x2+y2-22x-4y+25=0 with
the coordinate axes
13.** Show that the lines 2x+3y+11=0 and 2x-2y-1=0 are conjugate with respect to the circle
x2+y2+4x+6y+12=0
14.** Show that the poles of the tangent of the circle x2+y2=a2 w.r.to the circle (x+a)2+y2=2a2 lies on the
curve y2+4ax=0
15.** Find the pair of tangents drawn from P(3,2) to the circle x2+y2-6x+4y-2=0
16.** Show that x+y+1=0 touches the circle x2+y2-3x+7y+14=0 and find the point of contact
17.** Find the equation of the circle with centre (-2,3) cutting a chord length 2units on 3x+4y+4=0
18.** Find the value of k, if kx+3y-1=0, 2x+y+5=0 are conjugate lines with respect to circle
x2+y2-2x-4y-4=0
19.* Find the equation of the circle passing through (0,0) and making intercepts 4,3 on X- axis and Y-
axis respectively
20.* Find the area of the triangle formed with the coordinate axes and the tangent drawn at the point
p(x1,y1) on the circle x2+y2=a2
̅̅̅̅ (other than the diameter) of the circle
21.* If P(X1,Y2) is the midpoint of a chord 𝐴𝐵
x2+y2+2gx+2fy+c=0 then the equation of the chord AB is S1=S11
22.* Equation of the chord joining P(𝜃1), & Q(𝜃2) on the circle S= x2+y2+2gx+2fy+c=0 is
𝜃1 +𝜃2 𝜃1 +𝜃2 𝜃1 −𝜃2
(x+g)cos ( ) + (𝑦 + 𝑓) sin ( ) = 𝑟 cos ( ) 𝑤ℎ𝑒𝑟𝑒 r is radius of a circle
2 2 2
23.* Prove that the tangent at (3,-2) of the circle x2+y2=13 touches the circle x2+y2+2x-10y-26=0 and
 find its point of contact
24.*find the equation of tangents of the circle x2+y2=10 at the points whose abscissa are 1
25.* Find the equation of circle which touches x2+y2-4x+6y-12=0 at (-1,1) internally with a radius of 2
26.* The line y=mx+c and the circle x2+y2=a2 intersect at A and B. If AB =2⋋ then show that
c2=(1+m2)(a2-⋋2)
27.* Find the condition that the tangents drawn from (0,0) to the circle s= x2+y2+2gx+2fy+c=0 be
perpendicular to each other
VERY SHORT ANSWER QUESTIONS (2MARKS)
01. Find the centre and radius of the circle √1 + 𝑚2 (x2+y2) -2cx-2mcy=0 (c>0)
02. Find the values of a,b if ax2+bxy+3y2-5x+2y-3=0 represents a circle. also find the radius and centre
of the circle
03. If the center of the circle x2+y2+ax+by-12=0 is (2,3) , find the values of a,b and the radius of the
circle
04. Find the values of g and f , if x2+y2+2gx+2fy-12=0 represents the circle with centre (2,3) and
radius?
05. Find the other end of the diameter of the circle x2+y2-8x-8y+27=0 if one end of it is (2,3)
06. If x2+y2-4x+6y+c=0 represents a circle with radius ‘6’ , then find the value of ‘c’
07. If the length of the tangent from (2,5) to the circle x2+y2-5x+4y+k=0 is √37, then find ‘k’
08. find the equation of the circle passing through (2,-1) and having the centre at (2,3)
09. Find the equation of the circle passing through (3,4) and having the centre at (-3,4)
10. i) Find the equation of the circle whose centre is (-4,-3) and which passes through the origin
ii) find the equation of the circle whose centre is (-1,2) and which passes through (5,6)
11. Obtain the parametric equation of the circle x2+y2-6x+4y-12=0
12. Obtain the parametric equation of the circle (x-3)2+(y-4)2=82
13. (i) find the equation of the circle whose extremities of a diameter are (1,2) and (4,5)
(ii) find the equation of the circle for which the points (4,2) ,(1,5) are the end points of a diameter
14. Find the polar of (1,2) with respect to x2+y2=7
15. Find the pole of ax+by+c=0 (c≠ 0)with respect x2+y2=r2
16. Find the pole of 3x+4y-45=0 with respect x2+y2-6x-8y+5=0
17. find the value of ‘k’ , if the points (4,k) ,(2,3) are conjugate with respect to x2+y2=17
18. Find the number of common tangents that can be drawn to the circles x2+y2=4, x2+y26x-8y+16=0
19. Find the value of a if 2x2+ay2-3x+2y-1=0 represents a circle and also radius
20. State necessary and sufficient condition for lx+my+n=0 be a normal to the circle
x2+y2+2gx+2gy+c=0
21. show that A(3,-1) lies on the circle x2+y2-2x+4y=0 also find the other end of the diameter through
A
22. Find the value of k, if the points (4,2) and (k,-3) are conjugate with respect to the circle x2+y2-
5x+8y+6=0
23. find the chord of contact of (2,5) with respect to circle x2+y2-5x+4y-2=0
24. (i) find the equation of the normal to the circle x2+y2-4x-6y+11=0 at (3,2) also find the other point
where the normal meets the circle
 ii) find the equation of the normal at P(3,5) of he circle S≡ x2+y2-10x-2y+6
25. i) Obtain the parametric equation of the circle represented by x2+y2=4
ii) write the parametric equation of the circle 2x2+2y2=7
26. Find the equation of the circle which is concentric with x2+y2-6x-4y-12=0 and passing through
(-2,14)
27. Find the value ‘a’ if 2x2+ay2-3x+2y-1=0 represents a circle and also find its radius
28. If the length of a tangent from (5,4) to the circle x2+y2+2ky=0 is ‘1’, then find ‘k’
29. find the power of the point P(-1,1) with respect to the circle x2+y2-6x+4y-12=0
30. Find the value of k, if the points (1,3) and (2,k) are conjugate with respect to the circle x2+y2=35
31. If the circle x2+y24x+6y+a=0 has radius 4, then find a
32. find the equation of the polar of (1,-2) with respect to circle x2+y2-10x-10y+25=0
33. Find the length of the tangent from (-2,5) to the circle x2+y2-25=0
34. Find the length of the chord formed by x2+y2=a2 on the line xcos𝛼 + 𝑦𝑠𝑖𝑛𝛼 =P
SYSTEM OF CIRCLES
SHORT ANSWER QUESTION (4MARKS)
01.*** find the equation of the circle which is orthogonal to each of the following circles
x2+y2+2x+17y+4=0 , x2+y2-x+22y+3=0
02.*** Find the equation of the circle cutting orthogonally to the circles x2+y2-4x-6y+11=0
x2+y2-10x-4y+21=0 and has 2x-3y=7 as diameter
03.*** Find the equation of the circle which cuts orthogonally the circles x2+y2-4x+2y-7=0 and having
the centre at (2,3)
04.*** find equation of the circle passing through origin and cuts the circles x2+y2-4x+6y+10=0 ,
x2+y2+12y+6=0 orthogonally
05.*** show that the circles S= x2+y2-2x-4y-20=0 S ≡ x2+y2+6x+2y-90=0 touch each other internally .
find their point of contact and the equation of the common tangent
06.*** show that the circles x2+y2-8x-2y+8=0 and x2+y2-2x+6y+6=0 touch each other and find the point
of contact
07.*** i) Find the radical center of the circle x2+y2+4x-7=0 , 2x2+2y2+3x+5y-9=0 and x2+y2+y=0
ii) find the radical of the circle x2+y2-4x-6y+5=0 , x2+y2-2x-4y-1=0 and x2+y2-6x-2y=0
08.*** If the straight line represented by xcos𝛼 + 𝑦𝑠𝑖𝑛𝛼=p intersects the circle x2+y2=a2 at the points A
and B , then show that the equation of the circle with ̅̅̅̅
𝐴𝐵 as diameter is
(x +y -a )- 2p(x𝑐𝑜𝑠𝛼 + 𝑦𝑠𝑖𝑛𝛼 − 𝑝)=0
2 2 2

09.*** If two circles x2+y2+2gx+2fy=0 and x2+y2+2g1x+2f1y=0 touch each other them show that f1g=fg1
1 1 1
10.** show that the circles x2+y2+2ax+c=0 and x2+y2+2by+c=0 touch each other if 𝑎2 + 𝑏2 = 𝑐 2
11. **If x+y=3 is the equation of the chord AB of the circle x2+y2-2x+4y-8=0 , find the equation of the
circle having AB as diameter
12.** Find the equation of the circle passing through the points of intersection of the circles
x2+y2-8x-6y+21=0, x2+y2-2x-15=0 and (1,2)
13.* Find the equation of the circle passing through the intersection of the circles x2+y2=2ax and
𝑥 𝑦
x2+y2=2by and having its centre on the line 𝑎 − 𝑏 = 2
14.* Find the equation and length of the common chord of the two circles S≡ x2+y2+3x+5y+4=0 and
S1≡x2+y2+5x+3y+4=0
15.* Find the equation of the circle passing through the origin having its center on line x+y=4 and
intersecting the circle x2+y2-4x+2y+4=0 orthoganally
16.* show that common chord of the circles x2+y2-6x-4y+9=0 and x2+y2-8x-6y+23=0 is the diameter of
the second circle and also find its length
VERY SHORT ANSWER QUESTIONS (2MARKS)
01. I) find the angle between the circles x2+y2-12x-6y+41=0 and x2+y2+4x+6y-59=0
ii) If the angle between the circles x2+y2-12x-6y+41=0 and x2+y2+kx+6y-59=0 is 450 then find k
02.i) find k, if the pair of circles x2+y2-6x-8y+12=0 and x2+y2-4x+6y+k=0 are orthogonal
ii) if x2+y2-5x-14y-34=0 , x2+y2+2x+4y+k=0 circles are orthogonal , then find k
3𝜋
03. show that the angle between the circles x2+y2=a2, x2+y2=ax+ay is
4
04. Find the equation of the radical axis of the circles
x2+y2+2x+4y+1=0, x2+y2+4x+y=0
05. Find the equation of radical axis of the circle x2+y2+4x+6y-7=0 , 4( x2+y2)+8x+12y-9=0
06. Find the equation of the common chord of the pair of circles x2+y2-4x-4y+3=0, x2+y2-5x-6y+4=0
07. Find the equation of the common tangent of the circles at their point of contact x2+y2+10x-2y+22=0
, x2+y2+2x-8y+8=0
08. show that the circles x2+y2-2x+4y+4=0 and x2+y2+3x+4y+1=0 are intersect each other orthogonally
09. find the equation of the common chord of the circles: (x-a)2+(y-b)2=c2, (x-b)2+(y-a)2=c2, (a≠b)
10. find the value of k, if the circles x2+y2+4x+8=0 and x2+y2-16y+k=0 are orthogonal
11. find the radical axis of x2+y2-2x-4y-1=0 and x2+y2-4x-6y+5=0
PARABOLA
LONG ANSWER QUESTIONS (7MARKS)
01.***Derive the equation of parabola y2=4ax in standard form
02.*** Find the focus, vertex, equation of the directrix, axis and length of the latusrectum to the
parabola y2-x+4y+5=0
03.*** Find the co-ordinates of vertex, focus, equation of the directrix and axis of the parabola x2-
2x+4y-3=0
04.*** Find the equations of tangents to the parabola y2=16x which are parallel and perpendicular
respectively to the line 2x-y+5=0 , also find the coordinates of their points of contact
05.*** find the equation of the parabola, whose axis is parallel to the x-axis and which passes through
the point A(-2,1),B(1,2) and C(-1,3)
06.*** Find the equation of the parabola whose axis is parallel to y-axis and which passes through the
points (4,5) ,(-2,11) and (-4,21)
07*** The normal at a point P(t1) on y2=4ax meets the parabola again in the points P(t2). then prove
2
that t2= -(t1+ 𝑡 ) (𝑜𝑟) t1t2+ t12+2=0
1
08.*** show that the equation of the common tangents to the circle x2+y2=2a2 and the parabola y2=8ax
are y= ±(x+2a)
09.*** Find the equation of the parabola whose focus is (-2,3) and directrix is the line 2x+3y-4=0 .also
find the length of the latusrectum and the equation of axis of the parabols
10.*** If a normal chord a point ‘t’ on the parabola y2=4ax subtends a right angle at vertex, then prove
that t= ±√2
11.*** show that the common tangents to the 2x2+2y2=a2 and the parabola y2=4ax intersect at the focus
of the parabola y2=-4ax
12.*** Prove that the two parabola y2=4ax and x2=4by intersect (other than the origin) at an angle of
1 1
3𝑎3 𝑏 3
tan-1( 2 )
2(𝑎3 +𝑏 2/3)
13.** show that the locus of point of intersection of perpendicular tangents to the parabola y 2=4ax is
the directirx x+a=0
14.** prove that the area of the triangle inscribed in the parabola y2=4ax is
1
|(𝑦1 − 𝑦2 )(𝑦2 − 𝑦3 )(𝑦3 − 𝑦1 )|sq.units where y1,y2,y3 are the ordinates of its vertices
8𝑎
15.** show that the common tangent to the parabola y2=4ax and x2=4by is a1/3x+b1/3y+a2/3b2/3=0
16.** If lx+my+n=0 is a normal to the parabola y2=4by , then show that al3+2alm2+nm2=0
17.** Prove that the area of the triangle formed by the tangents at (x1,y1),(x2,y2) and (x3,y3) to the
1
parabola y2=4ax (a>0) is 16𝑎 |(𝑦1 − 𝑦2 )(𝑦2 − 𝑦3 )(𝑦3 − 𝑦1 )| square units
18.* from an external point P tangents are drawn to the parabola y2=4ax and these tangents make
angles 𝜃1, 𝜃2 with its axis such that cot 𝜃1+ cot 𝜃2 is a constant ‘d’ ,then show that all such P lie on
a horizontal line also find the point of contact
19.* Find the equation of the parabola whose focus is S(3,5) and the vertex is A(1,3)
VERY SHORT ANSWER QUESTIONS (2 MARKS)
5
01. Find the coordinates of the points on the parabola y2=2x whose focal distance is
2
02. If (1/2 .2) is one extremity of a focal chord of the parabola y2=8x
find the coordinates of the other
extremity
03. show that the line 2x-y+2=0 is a tangent to the parabola y2=16x find the point of contact also
04. Find the co-ordinates of the point on the parabola y2=8x.whose focal distance is 10units
05. find the vertex and focus of x2-6x-6y+6=0
06. find the axis and directrix of y2+6y-2x+5=0
07. find the equation of parabola whose focus S(1,-7) vertex(1,-2)
08. Find the equation of the parabola whose vertex is (3,-2) and the focus is (3,1)
09. Find the value of k, if the line 2y= 5x+k is a tangent to the parabola y2=6x
10. Find the equation of normal to the parabola y2=4x which is parallel to y-2x+5=0
11. find the equation of the tangent to the parabola y2=16x inclined at an angle 600 with its axis and
3
12. Find the equation of the tangent to the parabola x2-4x-8y+6=0 at (4, 2)
ELLIPSE
SHORT ANSWER QUESTIONS
01.*** Find The length of the major axis, minor axis, latus rectum, eccentricity , coordinates of centre,
foci and the equation of directories of the ellipse x2+2y2-4x+12y+14=0
02.*** Find eccentricity , coordinates of foci, length of latusrectum and equation of directries of the
ellipse
i. 9x2+16y2-36x+32y-92=0 ii. 3x2+y2-6x-2y-5=0
03.*** Find the length of the major axis, minor axis, latus recturm, eccentricity, coordinates of centre ,
foci and the equation of directrices of the ellipse 4x2+y2-8x+2y+1=0
04.*** Find the equation of the ellipse whose focus is (1,-1) ,e=2/3 and directrix is x+y+2=0
05.***Find the equation of the tangent to the ellipse 2x2+y2=8 which is parallel and perpendicular to x-2y-4=0
𝑥2 𝑦2
06.*** If the line y=mx+c touches the ellipse 𝑎2 + 𝑏2 =1 prove that c2=a2m2+b2;(a>b)
𝑥2 𝑦2
07.*** If P is a point on the ellipse + 𝑏2 =1 whose foci S and S1 then show that SP+S1P=2a (constant)
𝑎2
08.*** Show that the points of intersection of the perpendicular tangents to an ellipse lies on a circle
(Director circle)
09.*** Find the equation of the ellipse referred to it’s major and minor axes as coordinate axes X,Y
respectively with latus rectum of length 4 and distance between foci 4√2
𝑥2 𝑦2
10.*** If a tangent to the ellipse 𝑎2 + 𝑏2 =1 (a>b) meets its major axis and minor axis at M and N
𝑎2 𝑏2
respectively, then prove that (𝐶𝑀)2 + (𝐶𝑁)2=1 where C is the centre of the ellipse
11.*** Find the equation of the ellipse in the standard form such that distance between foci is 8 and
distance between directrices is 32
12.*** If the length of the major axis of an ellipse is three times the length of its minor axis then find
the eccentricity of the ellipse
(𝑥−ℎ)2 (𝑦−𝑘)2
13.*** Find the equation of the ellipse in the form + =1 given the following data
𝑎2 𝑏2
i. centre (2,-1) ,one end of the major axis (2,-5),e=1/3
ii. centre (4,-1), one end of the major axis (-1,-1) and passes through (8,0)
iii. centre (0,-3) ,e=2/3 ,semi minor axis5
iv. centre (2,-1),e=1/2 , length of latus rectum 4
14.***Find the equations to the tangents to the ellipse x2+2y2=3 drawn from the point (1,2) and also
find the angle between these tangents
15.***show that the foot of the perpendicular drawn from the centre on any tangent to the ellipse lies
on the curve (x2+y2)2=a2x2+b2y2
16.*** find the condition for the line
𝑥2 𝑦2
i. lx+my+n=0 to be a tangent to the ellipse 𝑎2 + 𝑏2 =1
𝑥2 𝑦2
ii. lx+my+n=0 to be a normal to the ellipse 𝑎2 + 𝑏2 =1
17.*** Find the length of major axis, minor axis , latusrectum, eccentricity, coordinates of centre, foci
and the equations of directrices of the ellipse 9x2+16y2=144
𝑥2 𝑦2
18.*** Find the condition for the line xcos𝛼 + 𝑦𝑠𝑖𝑛𝛼 = 𝑝 to be a tangent to the ellipse 𝑎2 + 𝑏2 =1
19.*** find the equation the ellipse in the standard from whose distance foci 2 and the length of the
latusrectum is 15/2
20.*** find the equations of tangent and normal to the ellipse 9x2+16y2=144 at the end of latusrectum
in the first quadrant
𝑥2 𝑦2
21.** If the normal at one end of latusrectum of the ellipse 𝑎2 + 𝑏2 =1 passes through one end of minor
axis, then show e4+e2=1 [where is the eccentricity of the ellipse]
22.**Find the value of ‘k’ if the 4x+y+k=0 is tangent to the ellipse x2+3y2=3
23.** Find the equation of the tangents to the ellipse 2x2+3y2=11 at the point whose ordinate ‘1’
24.** Prove that the equation of the chord joining the points 𝛼&𝛽 on the ellipse
𝑥2 𝑦2 𝑥 𝛼+𝛽 𝑦 𝛼+𝛽 𝛼−𝛽
+ 𝑏2 =1 is 𝑎 cos ( ) + 𝑏 sin( ) = cos ( )
𝑎2 2 2 2
25.** Find the equation of the tangent and normal to the ellipse x2+8y2=33 at (-1,2)
𝑥2 𝑦2
26.** Derive the equation of an ellipse in the standard form 𝑎2 + 𝑏2 =1
𝑥2 𝑦2
27.** If 𝜃1&𝜃2 are the eccentric angle of the extremities of a focal chord of the ellipse 𝑎2 + 𝑏2 =1(a>b)
𝑒+1 𝜃 𝜃
and e is the eccentricity then show that 𝑒−1 = cot ( 21 ) cot ( 22 )
HYPERBOLA
SHORT ANSWER QUESTIONS
01.***Find The centre, eccentricity , foci,equations, of the directrices, length of the latusrectum of the
hyperbola 9x2-16y2+72x-32y-16=0
02.*** Find the centre,foci, eccentricity and the equations of directrices of the hyperbola 16y2-9x2=144
03.*** Find the centre, eccentricity, foci, length of latus rectum and equations of the directrices of the
hyperbola x2-4y2=4
04.***find the equations of the tangents drawn to the hyperbola x2-4y2=4which are i. parallel and ii.
perpendicular to the line x+2y=0
05.***Find the equations of the tangents to the hyperbola 3x2-4y2=12 which are i. parallel and ii.
perpendicular to the line y=x-7
𝑥2 𝑦2
06.*** Prove that the point of intersection of two perpendicular tangents to the hyperbola 𝑎2 − 𝑏2 =1
lies on the circle x2+y2=a2-b2
07.*** Show that the angle between the two asymptotes of the hyperbola
𝑥2 𝑦2 𝑏
− 𝑏2 =1 is 2tan-1(𝑎) (or) 2sec-1(e)
𝑎2
𝑥2 𝑦2
08.**If the line lx+my+n=0 is a tangent to the hyperbola 𝑎2 − 𝑏2 =1 then show that a2l1-b2m2=n2
𝑥2 𝑦2
09.** Tangents to the hyperbola 𝑎2 − 𝑏2 =1 make angles 𝜃1 and 𝜃2 with transverse axis of a hyperbola.
show that the point of intersection of these tangents lies on the curve 2xy=k(x2-a2) when
tan 𝜃1 + tan 𝜃2=k
10.**Find the equation of the hyperbola of given length of transverse axis ‘6’ whose vertex bisects the
distance between the centre and the focus
11.* One focus of a hyperbola is located at the point (1,-3) and the corresponding directrix is the line
y=2. find the equation of hyperbola whose asymototes are the straight lines
x+2y+3=0,3x+4y+5=0, and which passes through the point (1,-1)
13.* Show that the differences of the focal distances of any point on the hyperbola is constant i.e.,if is a
𝑥2 𝑦2
point on the hyperbola 𝑎2 − 𝑏2 =1 with foci S and S1then show that S1P-SP =2a (constant)
𝑥2 𝑦2 𝑎2 𝑏2
14.* If the line lx+my=1 is a normal to the hyperbola 𝑎2 − 𝑏2 =1 then show that − 𝑚2 =(a2+b2)2
𝑙2
𝑥2 𝑦2
15.* Derive the standard form of hyperbola 𝑎2 − 𝑏2 =1
𝑥2 𝑦2
16.* show that the equation + =1 represents
9−𝑐 5−𝑐
 i. an ellipse if ‘c’ is a real constant less that ‘5’
ii. a hyperbola if ‘c’ if any real constant between 5 and 9
iii. show that the eqch ellipse in i. and each hyperbola ii. has fociat two points (± ±2,0)
independent of the value ‘c’
VERY SHORT ANSWER QUESTIONS
1 1
01. If e,e1 are the eccentricities of a hyperbola and its conjugate hyperbola , prove that 𝑒 2 − 𝑒 2 =1
1
02. If the eccentricity of a hyperbola is 5/4 then find the eccentricity of its conjugate hyperbols
03. Find the equation of the hyperbola whose foci are (±5,0) and the transverse axis of length 8
05.i. find the eccentricity and length of latusrectum of the hyperbola x2-4y2=4
ii. find the eccentricity and length of latusrectum of the hyperbola 16y2-9x2=144
06. Find the length of the laturectum of the hyperbola x2-3y2=144
07. find the equations of the tangents to the hyperbola 3x2-4y2=12 which is parallel to the line y=x-7
08. If 3x-4y+k=0 is a tangent to x2-4y2=5 find the value of k
09. If the angle between the asymptotes of a hyperbola is 300 then find its eccentricity
𝜋
10. Find the equation of the normal at 𝜃 = 3 to the hyperbola 3x2-4y2=12
11. Define rectangular hyperbola and find its eccentricity
𝑥2 𝑦2
12. Find the product of the length of the perpendiculars from any point on the hyperbola 16 − =1 to
9
its asymptotes
INDEFINITE INTEGRATION
LONG ANSWER QUESTIONS (7MARKS)
9𝑜𝑠𝑥−𝑠𝑖𝑛𝑥
01.***Evaluate ∫ 4𝑠𝑖𝑛𝑥+5𝑐𝑜𝑠𝑥
2𝑐𝑜𝑠𝑥+3𝑠𝑖𝑛𝑥
02.*** Evaluate ∫ 4𝑐𝑜𝑠𝑥+5𝑠𝑖𝑛𝑥
2𝑠𝑖𝑛𝑥+3𝑐𝑜𝑠𝑥+4
03.*** Evaluate ∫ 3𝑠𝑖𝑛𝑥+4𝑐𝑜𝑠𝑥+5
𝑐𝑜𝑠𝑥+3𝑠𝑖𝑛𝑥+7
04.*** Evaluate ∫ 𝑐𝑜𝑠𝑥+𝑠𝑖𝑛𝑥+1
05.*** Evaluate ∫ 𝑒 𝑎𝑥 𝑠𝑖𝑛𝑥( 𝑏x+c)dx; (a,b,c ∈R; b≠0)on R
06.*** Find the reduction formula for ∫ 𝑠𝑖𝑛𝑛 𝑥𝑑𝑥(𝑛 ≥ 2) and hence find ∫ 𝑠𝑖𝑛4 𝑥 𝑑𝑥
07.*** Find the reduction formula for ∫ 𝑡𝑎𝑛𝑛 𝑥𝑑𝑥 (𝑛 ≥ 2) 𝑎𝑛𝑑 ℎ𝑒𝑛𝑐𝑒 𝑓𝑖𝑛𝑑 ∫ 𝑡𝑎𝑛6 xdx
08.*** obtain reduction formula for In = ∫ 𝑐𝑜𝑡 𝑛 𝑥 𝑑𝑥, 𝑛 𝑏𝑒𝑖𝑛𝑔 𝑎 𝑝𝑜𝑠𝑖𝑡𝑖𝑣𝑒 𝑖𝑛𝑡𝑒𝑔𝑒𝑟 𝑛 ≥ 2 and hence deduce
the value of ∫ 𝑐𝑜𝑡 4 𝑥 𝑑𝑥
09.*** Obtain reduction formula for In = ∫ 𝑠𝑒𝑐 𝑛 xdx, n being a positive integer n≥2 and hence deduce
the value of ∫ 𝑠𝑒𝑐 5 𝑥𝑑𝑥
1 𝑛−1
10.*** If In = ∫ 𝑐𝑜𝑠 𝑛 𝑥 𝑑𝑥 then show that In = 𝑛 cosn-1 xsinx + In-2
𝑛
11.***Obtain the reduction formula for In= ∫ 𝑐𝑜𝑠𝑒𝑐 𝑛 𝑥𝑑𝑥, n being a positive integer, n≥2 and hence
deduce the value of ∫ 𝑐𝑜𝑠𝑒𝑐 5 𝑥𝑑𝑥
12.*** Evaluate ∫ (6𝑥 + 5)√6 − 2𝑥 2 + 𝑥 𝑑𝑥
13.*** Evaluate ∫(3𝑥 − 2) √2𝑥 2 − 𝑥 + 1 𝑑𝑥
 2𝑥+5
14.*** Evaluate ∫ √𝑥 2 dx
−2𝑥+10
𝑥+1
15.*** Evaluate ∫ √𝑥 2 dx
+3𝑥+12
𝑥+1
16.*** Evaluate ∫ √𝑥 2 dx
−𝑥+1
1
17.*** Evaluate ∫ dx
(1+𝑥)√3+2𝑥−𝑥 2
𝑑𝑥
18.*** Evaluate ∫
(𝑥+1)√2𝑥 2 +3𝑥+1
𝑑𝑥
19.*** Evaluate ∫ 𝑜𝑛 (−1,3)
(1−𝑥)√3−2𝑥−𝑥 2

5−𝑥
20.*** Evaluate ∫ √𝑥−2 dx on (2,5)
𝑥+3
21.*** Evaluate ∫ (𝑥−1)(𝑥 2 +1) dx
𝑑𝑥 𝑑𝑥
22.*** i. Evaluate ∫ 3 𝑐𝑜𝑠𝑥+4𝑠𝑖𝑛𝑥+6 ii. Evaluate ∫ 4𝑐𝑜𝑠𝑥+3𝑠𝑖𝑛𝑥
𝑥 𝑎2 𝑥
23.*** show that ∫ √𝑎2 − 𝑥 2 𝑑𝑥 = 2 √𝑎2 − 𝑥 2 + sin-1(𝑎) + 𝑐
2
𝑑𝑥
24.** Evaluate ∫ 5+4𝑐𝑜𝑠𝑥
1 1
25.** Evaluate ∫ 4+5𝑠𝑖𝑛𝑥 dx ii. Evaluate ∫ 1+𝑠𝑖𝑛𝑥+𝑐𝑜𝑠𝑥 dx
𝑑𝑥
26.** Evaluate ∫ 5+4𝑐𝑜𝑠2𝑥
𝑑𝑥
27.*** Evaluate ∫ 2−3𝑐𝑜𝑠2𝑥
2𝑥+3
28.** Evaluate ∫ (𝑥+3)(𝑥 2 +4) dx
𝑑𝑥
29.** Evaluate ∫ on R
1+𝑥 4
−𝑠𝑖𝑛𝑚−1 𝑥𝑐𝑜𝑠𝑛+1 𝑥 𝑚−1
30.* If Im.n = ∫ 𝑠𝑖𝑛𝑚 𝑥𝑐𝑜𝑠 𝑛 𝑥dx then show that Im,n= + 𝑚+𝑛 Im-2,n , for a positive integer n
𝑚+𝑛
and an integer m≥ 2
31.* Evaluate ∫ 𝑥𝑠𝑖𝑛−1 𝑥𝑑𝑥 on (-1,1)
32.* Evaluate ∫ 𝑥 2 𝑐𝑜𝑠𝑥𝑑𝑥
1−𝑥
33.* Evaluate ∫ 𝑡𝑎𝑛−1 √1+𝑥 dx, on (-1,1)
1
34.* Evaluate ∫ 𝑥 3 +1 dx
1
35.* Evaluate ∫ 𝑠𝑖𝑛𝑥+√3𝑐𝑜𝑠𝑥 dx
2𝑥 2 +𝑥+1
36.* Evaluate ∫ (𝑥+3)(𝑥−2)2 dx
37.* Evaluate ∫ 𝑥√1 + 𝑥 − 𝑥 2 𝑑𝑥
VERY SHORT ANSWER QUESTIONS (2 MARKS)
1 3
01. Evaluate ∫ (𝑋 + 𝑋) dX, X>0
(𝑎𝑥 −𝑏 𝑥 )2
02. Evaluate ∫ dx
𝑎𝑥 𝑏 𝑥
03. Evaluate ∫ √1 − 𝑐𝑜𝑠2𝑥 dx
04. Evaluate ∫ 𝑠𝑒𝑐 2 𝑥𝑐𝑜𝑠𝑒𝑐 2 𝑥𝑑𝑥
1 2
05. Evaluate ∫ (√1−𝑥 2 + √1+𝑥 2 ) 𝑑𝑥𝑜𝑛 (−1,1)
 𝑑𝑥
06. Evaluate ∫ 𝑐𝑜𝑠ℎ𝑥+𝑠𝑖𝑛ℎ𝑥 on R
sin(𝑡𝑎𝑛−1 𝑥)
07. Evaluate ∫ 𝑑𝑥𝑥 ∈ 𝑅
1+𝑥 2
08. Evaluate ∫ 𝑒 𝑥 [𝑡𝑎𝑛𝑥 + log(𝑠𝑒𝑐𝑥)]𝑑𝑥
09. Evaluate ∫ 𝑒 𝑥 (1 + 𝑡𝑎𝑛2 𝑥 + 𝑡𝑎𝑛𝑥) 𝑑𝑥
10. Evaluate ∫ 𝑒 𝑥 (𝑠𝑒𝑐𝑥 + 𝑠𝑒𝑐𝑥𝑡𝑎𝑛𝑥)𝑑𝑥
(1+𝑥𝑙𝑜𝑔𝑥)
11. Evaluate ∫ 𝑒 𝑥 dx
𝑥
𝑒 𝑥 (1+𝑥)
12. Evaluate ∫ dx
(2+𝑥)2
𝑥𝑒 𝑥 𝑒𝑥
13. i. Evaluate ∫ (𝑥+1)2 dx ii. Evaluate ∫ 𝑒 𝑥 +1 dx
1
14. Evaluate ∫ (𝑥+1)(𝑥+2) dx
𝑑𝑥
15. Evaluate ∫ (𝑥+3)√𝑥+2
𝑑𝑥
16. Evaluate ∫
(𝑥+5)√(𝑥+4)
1
1
17. Evaluate ∫ (1 − 𝑥 2 ) 𝑒 (𝑥+𝑥) dx
𝑒 𝑥 (1+𝑥)
18. Evaluate ∫ 𝑐𝑜𝑠2 (𝑥𝑒 𝑥 ) dx on I ⊂ R/{x∈ R: cos (xex)=0}
𝑥 18
19. Evaluate ∫ 1+𝑥 18 dx on R
2𝑥 3
20. Evaluate ∫ 1+𝑥 18 dx
2𝑥 3
21. Evaluate ∫ 1+𝑥 8 dx
𝑠𝑖𝑛4 𝑥
22. Evaluate ∫ 𝑐𝑜𝑠6 𝑥dx
cot(𝑙𝑜𝑔𝑥)
23. Evaluate ∫ dx
𝑥
𝑐𝑜𝑠√𝑥
24. i. Evaluate ∫ dx ii. Evaluate ∫ 𝑐𝑜𝑠 3 𝑥 𝑠𝑖𝑛𝑥 𝑑𝑥
√𝑥
25. Evaluate ∫ 𝑠𝑒𝑐𝑥 log(𝑠𝑒𝑐𝑥 + 𝑡𝑎𝑛𝑥) 𝑑𝑥
1
26. Evaluate ∫ 𝑥𝑙𝑜𝑔𝑥[log(𝑙𝑜𝑔𝑥)] dx
1
27. Evaluate ∫ 𝑒 𝑥 −1 dx
1+𝑐𝑜𝑠2 𝑥
28. Evaluate ∫ 1−𝑐𝑜𝑠2𝑥 dx
29. Evaluate ∫ log 𝑥 𝑑𝑥
30. Evaluate ∫ 𝑥 𝑡𝑎𝑛−1 𝑥 𝑑𝑥
31. Evaluate ∫ 𝑠𝑖𝑛−1 𝑥𝑑𝑥
𝑑𝑥
32. Evaluate ∫ √𝑥 2 dx
+2𝑥+10
𝑠𝑖𝑛2𝑥
33. Evaluate ∫ 𝑎𝑐𝑜𝑠2 𝑥+𝑏𝑠𝑖𝑛2 𝑥 dx
1−𝑠𝑖𝑛𝑥
34. Evaluate ∫ 𝑒 𝑥 (1−𝑐𝑜𝑠𝑥)dx
𝑐𝑜𝑠𝑥
35. Evaluate ∫ 𝑠𝑖𝑛2 𝑥+4𝑠𝑖𝑛𝑥+5 dx
−4 4
36. Evaluate ∫ √16 − 25𝑥 2 𝑑𝑥 𝑜𝑛 ( 5 , 5)
 log(1+𝑥)
37. Evaluate ∫ 𝑑𝑥 𝑜𝑛 (−1, ∞)
1+𝑥
1
38. Evaluate ∫ 𝑑𝑥 𝑜𝑛 1 ⊂ 𝑅 − {2𝑛 + 1)𝜋: 𝑛 ∈ 𝑧}
1+𝑐𝑜𝑠𝑥
39. Evaluate ∫ √𝑥𝑙𝑜𝑔𝑥 𝑑𝑥 𝑜𝑛 (0, ∞)
DEFINITE INTEGRATION
LONG ANSWER QUESTIONS (7MARKS)
1 log(1+𝑥) 𝜋
01.***Show that ∫0 dx = 8 𝑙𝑜𝑔2
1+𝑥 2
𝜋
𝑠𝑖𝑛𝑥+𝑐𝑜𝑠𝑥 1
02.*** show that ∫02 9+16𝑠𝑖𝑛2𝑥 𝑑𝑥 = 20 𝑙𝑜𝑔3
𝜋
𝑥 𝜋
03.***Show that ∫02 𝑠𝑖𝑛𝑥+𝑐𝑜𝑠𝑥 = 2√2 log(√2 + 1)
𝜋
𝑠𝑖𝑛2 𝑥 1
04.*** Show that ∫02 𝑠𝑖𝑛𝑥+𝑐𝑜𝑠𝑥 𝑑𝑥 = log(√2 + 1)
√2
𝜋 𝑥𝑠𝑖𝑛𝑥 𝜋2
05.*** Show that ∫0 𝑑𝑥 = −𝜋
1+𝑠𝑖𝑛𝑥 2
𝜋 𝑥
06.*** Show that ∫0 𝑑𝑥
1+𝑠𝑖𝑛𝑥
𝜋
07.*** Show that ∫0 𝑥𝑠𝑖𝑛7 𝑥 𝑐𝑜𝑠 6 𝑥 𝑑𝑥
𝜋 𝑥𝑠𝑖𝑛𝑥
08.*** Show that ∫0 1+𝑐𝑜𝑠2 𝑥 𝑑𝑥
𝜋 𝑥𝑠𝑖𝑛3 𝑥
09.*** Show that ∫0 1+𝑐𝑜𝑠2 𝑥 𝑑𝑥
𝑥2 𝑦2
10.*** Find the area of ellipse 𝑎2 + 𝑏2 =1 . Also deduce the area of the circle x2+y2=a2
11.*** Find the area enclosed between the curves y2=4x, y2=4(4-x)
12.*** Find the area bounded by the parabolas y2=4x and x2=4by (a>0, b>0)
𝜋
𝑐𝑜𝑠𝑥
13.*** Evaluate ∫−𝜋
2
𝑑𝑥
1+𝑒 𝑥
2
𝑏 𝜋
14.*** prove ∫𝑎 √(𝑥 − 𝑎)(𝑏 − 𝑥)𝑑𝑥 = 8 (𝑏 − 𝑎)2
64 5
15.** Show that the area enclosed between the curves y2=12(x+3) and y2=20(5-x) is √3 sq.units
𝑥2 𝑦2
16.** Let AOB be positive quadrant of ellipse 𝑎2 + 𝑏2 =1 with OA=a, OB=b then show that area
𝜋−2
bounded between chord AB and Arc AB of ellipse ( )ab sq.units
4
17.* Find the area enclosed between the curves y=x2-5x and y=4-2x
18.* Find the area enclosed between the curves y=x2+1, y=2x-2, x=-1,x=2
𝜋
19.* Evaluate ∫04 log(1 + tan 𝑥)𝑑𝑥
SHORT ANSWER QUESTIONS (4MARKS)
01.*** Find the area enclosed between the curves y2=4x and x2=4y
02.*** Find the area enclosed by the curves y=3x and y=6x-x2
03.*** Find the area bonded between the curves y=x2, y=√𝑥
04.*** find the area bounded by y2=3x and x=3
1
05.*** Find ∫0 𝑥 𝑡𝑎𝑛-1x dx
𝜋
𝑎 𝑠𝑖𝑛𝑥+𝑏 𝑐𝑜𝑠𝑥
06.*** Find ∫02 𝑑𝑥
𝑠𝑖𝑛𝑥+𝑐𝑜𝑠𝑥
 𝜋
√𝑠𝑖𝑛𝑥
07.*** Find ∫𝜋3 dx
√𝑠𝑖𝑛𝑥+√𝑐𝑜𝑠𝑥
6
𝜋
08.*** Evaluate ∫−𝜋
2
𝑠𝑖𝑛2 𝑥𝑐𝑜𝑠 4 𝑥𝑑𝑥
2
2𝜋
09.*** find ∫0 𝑠𝑖𝑛4 𝑥 𝑐𝑜𝑠 6 𝑥 𝑑𝑥
𝜋
10.*** Find the reduction formula for ∫02 𝑠𝑖𝑛𝑛 𝑥 𝑑𝑥
1 2 𝑛
11.*** Evaluate lim [(1 + 𝑛) (1 + 𝑛) … … … … … … . (1 + 𝑛)]1/n
𝑛→∞
12.*** Find the area of the region enclosed by the curves y=4x-x2 y=5-2x
13.*** find the area bounded by the curves y=sinx and y= cosx between any two consecutive points of
intersection
𝑎
14.** find ∫0 (𝑎 − 𝑥)𝑛 𝑑𝑥
𝑎
15.** Evaluate ∫𝑛 𝑥 2 (𝑎2 − 𝑥 2 )3/2 dx
𝜋
𝑑𝑥
16.** find ∫0 2
4+5 𝑐𝑜𝑠𝑥
𝜋
17.** evaluate ∫04 log(1 + 𝑡𝑎𝑛𝑥) 𝑑𝑥
1 3
18.** Find ∫0 𝑥 2 √1 − 𝑥 𝑑𝑥
16 𝑥 1/4
19.** evaluate ∫0 dx
1+𝑥 1/2
√𝑛+1+√𝑛+2+⋯+√𝑛+𝑛
20.** Find lim [ ]
𝑛→∞ 𝑛 √𝑛
1 1 1
21.** find lim [𝑛+1 + 𝑛+2 + ⋯ + 6𝑛]
𝑛→∞
22.** find area bounded by the curves y=x2,y=x3
1 𝜋 2𝜋 𝑛𝜋
23.* find lim 𝑛 [tan 4𝑛 + tan 4𝑛 + ⋯ + tan 4𝑛 ]
𝑛→∞
24.* find the area between the line y=0 and the curves y=x2-4x+3
VERY SHORT ANSWER QUESTIONS (2MARKS)
𝜋
𝑠𝑖𝑛5 𝑥
01. Find the value of ∫02 𝑠𝑖𝑛5 𝑥+𝑐𝑜𝑠5 𝑥 dx
4 2
02. i. find ∫0 |2 − 𝑥|dx ii. ∫0 |1 − 𝑥|𝑑𝑥
𝜋
03. evaluate ∫−𝜋
2
𝑠𝑖𝑛|𝑥|dx
2
3 2𝑥
04. Evaluate ∫2 dx
1+𝑥 2
1 𝑥2
05. Evaluate ∫0 𝑥 2 +1dx
4 𝑥2
06. Evaluate ∫0 1+𝑥dx
2
07. Evaluate ∫0 √4 − 𝑥 2 dx
𝜋
08. Evaluate ∫0 √2 + 2𝑐𝑜𝑠𝜃. 𝑑𝜃
𝜋/2
09. Evaluate ∫0 𝑠𝑖𝑛4 𝑥𝑐𝑜𝑠 5 𝑥 𝑑𝑥
2𝑘 +4𝑘 +6𝑘 +⋯…+(2𝑛)𝑘
10. Evaluate lim by the method of finding definite integral as limit of a sum
𝑛→∞ 𝑛𝑘+1
𝜋/2 𝑠𝑖𝑛 𝑥−𝑐𝑜𝑠2 𝑥
2
11. Evaluate ∫0 𝑠𝑖𝑛3 𝑥+𝑐𝑜𝑠3 𝑥dx
12. find the area bounded by y=x3+3 , X- axis x=-1 and x=2
13. find the area bounded by the parabola y=x2, the x-axis and the lines x=-1 and x=2
14. find the area of the region enclosed by the given curves x=4-y2, x=0
15. i. find the area under the curve f(x)=sinx in [0,2𝜋 ]
1 𝑑𝑥
ii. Evaluate ∫0
√3−2𝑥
16. find the area bounded by the curve y2-1=2x and x=0
2𝜋 𝜋/2
17. i. Evaluate ∫0 𝑠𝑖𝑛2 𝑥𝑐𝑜𝑠 4 𝑥 𝑑𝑥 ii. Evaluate ∫−𝜋/2 𝑠𝑖𝑛2 𝑥𝑐𝑜𝑠 4 𝑥 𝑑𝑥
𝜋
18. Evaluate ∫02 𝑡𝑎𝑛5 𝑥𝑐𝑜𝑠 8 𝑥 𝑑𝑥
𝜋/2
19. Evaluate ∫0 𝑠𝑖𝑛5 𝑥𝑐𝑜𝑠 4 𝑥 𝑑𝑥
𝜋/2
20. Evaluate ∫0 𝑠𝑖𝑛6 𝑥𝑐𝑜𝑠 4 𝑥 𝑑𝑥
𝜋
21. Evaluate ∫02 𝑐𝑜𝑠11 𝑥 𝑑𝑥
𝑖
22. Evaluate lim ∑𝑛𝑖=1 𝑛2 +𝑖 2
𝑛→∞
𝑎
23. Evaluate ∫0 √𝑎2 − 𝑥 2 𝑑𝑥
𝑎
24. Evaluate ∫0 (√𝑎 − √𝑥)2 𝑑𝑥
DIFFERENTIAL EQUATIONS
LONG ANSWER QUESTIONS (7 MARKS)
01.*** Solve (2x+y+3)dx= (2y+x+1)dy
𝑑𝑦 2𝑦+𝑥+1
02.*** solve the differential equation: 𝑑𝑥 = 2𝑥+4𝑦+3
𝑑𝑦 3𝑦−7𝑥+7
03.*** solve 𝑑𝑥 = 3𝑥−7𝑦−3
𝑑𝑦 𝑥−𝑦+3
04.*** solve 𝑑𝑥 = 2𝑥−2𝑦+5
𝑑𝑦 𝑦 2 −2𝑥𝑦
05.*** solve 𝑑𝑥 = 𝑥 2 −𝑥𝑦
𝑑𝑦
06.*** solve (2x+2y+3)𝑑𝑥 = (𝑥 + 𝑦 + 1)
𝑑𝑦
07.*** solve 𝑑𝑥 (x2y3+xy)=1
𝑑𝑦
08.*** solve (x+y+1) 𝑑𝑥 = 1
𝑑𝑦 −1 𝑥
09.*** solve (1+x2) + 𝑦 = 𝑒 𝑡𝑎𝑛
𝑑𝑥
𝑑𝑦
10.*** solve 𝑑𝑥 +ytanx=sinx
𝑑𝑦 𝑦 2 +𝑦+1
11.*** solve 𝑑𝑥 = =0
𝑥 2 +𝑥+1
12. i. solve the differential equation (x3-3xy2)dx+(3x2y-y3)dy=0
ii. solve (x2y-2xy2)dx= (x3-3x2y)dy
𝑦 𝜋
13.* give the solution of x sin2(𝑥 ) 𝑑𝑥= ydx- xdy which passes through the point (1, 4 )
𝑌 𝑦
14.** solve xsec(𝑋) (𝑌𝑑𝑥 + 𝑥𝑑𝑦)= ycosec(𝑥 ) (xdx-ydy)
𝑑𝑦
15.* solve 𝑑𝑥 +xsin2y=x3cos2y
𝑑𝑦
16.* find the solution of x(x-2) -2(x-1)y=x3(x-2) which satisfies the condition that y=9 when x=3
𝑑𝑥
17.* solve the differential equation (2x+y+1)dx+(4x+2y-1)dy=0
SHORT ANSWER QUESTIONS (4 MARKS)
𝑑𝑦
01.*** I. Solve 𝑑𝑥 =ex-y+x2e-y
𝑑𝑦
02.***solve sin-1(𝑑𝑥 ) = 𝑥 + 𝑦
𝑑𝑦 𝑥(2𝑙𝑜𝑔𝑥+1)
03.*** solve 𝑑𝑥 = 𝑠𝑖𝑛𝑦+𝑦𝑐𝑜𝑠𝑦
𝑑𝑦
04.*** solve 𝑑𝑥 =sin(x+y)+cos(x+y)
𝑦
05.*** solve xdy=[ y+xcos2(𝑥 )] 𝑑𝑥
06.*** solve (x2-y2)dx-xy dy=0
07.*** solve (2x-y)dy=(2y-x)dx
08.*** solve (x2+y2)dx=2xy dy
𝑑𝑦
09.*** solve 𝑑𝑥 - ytanx= exsecx
𝑑𝑦
10.***solve 𝑑𝑥 + ysecx= tax
𝑑𝑦
11.*** solve 𝑑𝑥 +ytanx= cos3x
12.*** solve (11+y2)dx= (tan-1y-x)dy
𝑑𝑦 𝑦 𝑦
13.*** find the equation of a curve whose gradients is 𝑑𝑥 = 𝑥 − 𝑐𝑜𝑠2 𝑥 when x>0 ,y>0 and which
𝜋
passes through the point (1, 4 )
𝑑𝑦 𝑥𝑦+𝑦
14.*** solve 𝑑𝑥 = 𝑥𝑦+𝑥
15.*** solve √1 + 𝑥 2 𝑑𝑥 + √1 + 𝑦 2 dy=0
16.*** solve (xy2+x)dx+(yx2+y)dy=0
17.*** solve (ex+1)ydy+(y+1)dx=0
𝑑𝑦 𝑦 𝑦2
18.*** solve 𝑑𝑥 + 𝑥 = 𝑥 2
𝑑𝑦 (𝑥+𝑦)2
19.*** solve 𝑑𝑥 = 2𝑥 2
𝑑𝑦
20.*** solve cosx𝑑𝑥 +ysinx = sec2x
𝑑𝑦
21.** solve (1+x2)𝑑𝑥 +2xy-4x2=0
𝑑𝑦 4𝑥 1
22.** solve the D.E 𝑑𝑥 + (1+𝑥 2 ) 𝑦 = (1+𝑥 2 )2
𝑑𝑦
23.** solve xlogx 𝑑𝑥 + 𝑦=2log x
𝑑𝑦 3𝑥−𝑦+7
24.** solve 𝑑𝑥 = 𝑥−7𝑦−3
𝑑𝑦
25.** solve 2(x-3y+1)𝑑𝑥 =4x-2y+1
26.* solve √1 + 𝑥 2 √1 + 𝑦 2 dx+xydy=0
𝑑𝑦
27.* solve 𝑑𝑥 -x tan(y-x)=1
𝑑𝑦 𝑦 𝑦2
28.* solve 2 𝑑𝑥 = 𝑥 + 𝑥 2
𝑦 𝑑𝑦 𝑦
29.* solve xsin(𝑥 ) 𝑑𝑥 = 𝑦𝑠𝑖𝑛 (𝑥 ) − 𝑥
𝑑𝑦
30.* solve x(x-1) − 𝑦 =x3(x-1)3
𝑑𝑥
 VERY SHORT ANSWER QUESTIONS (2 MARKS)
𝑑2 𝑦 𝑑𝑦
01. Find the order and degree of [𝑑𝑥 2 + (𝑑𝑥 )3 ]6/5 = 6y
5/3
𝑑2 𝑦 𝑑𝑦 2
02. find the order and degree of the differential equation 𝑑𝑥 2 = [1 + (𝑑𝑥 ) ]
1/4
𝑑𝑦 1/2 𝑑2 𝑦 1/3
03. find the order and degree of [(𝑑𝑥 ) + (𝑑𝑥 2 ) ] =0
𝑑2 𝑦 𝑑𝑦 𝑑𝑦
04. find the order and degree of 𝑑𝑥 2 + 2 𝑑𝑥 + 𝑦 = log (𝑑𝑥 )
𝑑2 𝑦 1 𝑑𝑦
05. find the order and degree of x1/2(𝑑𝑥 2 )3 + 𝑥 𝑑𝑥 + 𝑦=0
𝑑3 𝑦 𝑑𝑦 2
06. find the order and degree of (𝑑𝑥 3 )2 − 3 (𝑑𝑥 ) -ex=4
07. form the differential equation corresponding to y=cx-2c2 where c is a parameter
08. form the differential equation corresponding to y= Acos3x +Bsom3x where A and B are
parameters
09. form the differential equation corresponding to the family of circles passing through the origin
and having centers on Y-axis
10. Form the differential equation of the family of all circles with their centres at the origin and also
find its order
𝑑𝑦
11. find the I.F. of the differential equation x𝑑𝑥 − 𝑦 = 2𝑥 2sec22x
12. find the I.F, of the differential equation (1+y2)dx=(tan-1y-x)dy
𝑥 𝑑𝑦 𝑦
13. express (1+ex/y)dx+ex/y(1-𝑦) dy=0 in the form 𝑑𝑥 = 𝐹 (𝑥 )
𝑑𝑦 𝑦
14. Express (x√𝑥 2 + 𝑦 2 − 𝑦 2 )dx+xudu=0 in the form 𝑑𝑥 = 𝐹 (𝑥 )
15. Form the differential equation corresponding to the family of curves y=c(x-c)2. where c is a
parameter
𝑑𝑦
16. find the general sol of x+y 𝑑𝑥 = 0
𝑑𝑦
17. find the general sol of 𝑑𝑥 =ex+y
𝑑𝑦 2𝑦
18. find the general sol of 𝑑𝑥 = 𝑥
 SENIOR IPE IMPORTANT QUESTION BANK
SR. PHISICS
QUESTION BANK ANALYSIS

S.NO NAME OF THE CHAPTER WEIGHTAGE MARKS

01 WAVES 8
02 RAY OPTICS & OPTICAL 4+2
INSTRUMENTS
03 WAVE OPTICS 4
04 ELECTRIC CHARGES & FIELDS 4
05 ELECTROSTATIC POTENTIAL & 4
CAPACITANCE
06 CURRENT ELECTRICITY 8
07 MOVING CHARGES AND 4+2
MAGNETISM
08 MAGNETISM AND MATTER 2+2
09 ELECTRO MAGNETIC INDUCTION 4
10 ALTERNATING CURRENT 2
11 ELECTROMAGNETIC WAVES 2
12 DUAL NATURE OF RADIATION 2+2
AND MATTER
13 ATOMS 4
14 NUCLEI 8
15 SEMI CONDUCTOR ELECTRONICS 4+2
16 COMMUNICATION SYSTEMS 2
Total marks 76

S. TOPIC NAME LAQ SAQS VSAQ PROBLEMS TOTAL

N S
O
*** ** * *** ** *
01 WAVES 5 - - 2 3 1 11 10 32
02 RAY OPTICS & 2 2 - 5 2 - 8 7 26
OPTICAL
INSTRUMENTS
03 WAVE OPTICS 1 2 2 6 - - 13 2 24
04 ELECTRIC - 1 2 6 - - 13 2 24
CHARGES &
FIELDS
 05 ELECTROSTATIC 2 1 - 2 2 1 8 5 21
POTENTIAL &
CAPACITANCE
06 CURRENT - - 2 3 3 3 10 15 36
ELECTRICITY
07 MOVING 1 4 - 6 3 - 11 9 34
CHAREGES AND
MAGNETISM
08 MAGNETISM 1 1 - 2 1 1 10 2 18
AND MATTER
09 ELECTRO - - 1 3 1 - 8 2 15
MAGNETIC
INDUCTION
10 ALTERNATING - 1 - 1 2 - 10 4 18
CURRENT
11 ELECTROMAGNE - - - 2 - - 9 - 11
TIC WAVES
12 DUAL NATURE - 1 1 2 1 2 10 5 22
OF RADIATION
AND MATTER
13 ATOMS 2 1 - 7 - - 8 1 19
14 NUCLEI 2 2 - 5 3 1 14 6 33
15 SEMI 3 2 1 4 9 3 14 4 40
CONDUCTOR
SYSTEM
16 COMMUNICATIO - - - - - - 9 - 9
N SYSTEMS
SUB TOTAL 19 18 9 56 31 12 160 77 382
TOTAL 46 99

1. WAVES
LONG ANSWER QUESTIONS (8 M)
01.*** What is Doppler effect? obtain an expression for the apparent frequency of sound heard when
the source is in motion with respect to an observe at rest?
02.*** Explain the formation of stationary wave in an air column enclosed in open pipe. derive the
equations for the frequencies of the harmonics produced?
03.*** How are stationary waves formed in closed pipes? explain the various modes of vibrations and
obtain relations for their frequencies?
04.*** explain the formation of stationary waves in stretched strings and hence deduce the laws of
transverse waves in stretched string?
05.*** what is Doppler’s shift ? obtain an expression for the apparent frequency of sound heard when
the observe is in motion with respect to a source at rest?
SHORT ANSWER QUESTIONS (4MARKS)
01.*** What are ‘beats’? when do they occur? explain their uses, if any?
02.*** write an expression for progressive harmonic wave and explain the various parameters used in
the expression?
03.*** what are standing waves? explain how standing waves may be formed in a stretched string?
04.** explain the modes of vibration of a stretched string with examples?
05.** what is ‘Doppler effect? “ effect illustrative examples?
06.* what do you understand by ‘resonance’? how would you use resonance to determine the velocity
of sound in air?
PROBLEMS
01. A stretched wire of length 0.6m is observed to vibrate with a frequency of 30Hz in the
fundamental mode. If the string has a linear mass of 0.05 kg/m find
a. the velocity of propagation of transverse waves in the string
b. the tension in the string
02. A steel wire 0.72m long has a mass 5.0x 10-3kg. If the wire is under a tension of 60N , what is the
speed of transverse waves on the wire?
03. A closed organ pipe 70cm is sounded . If the velocity of sound is 331 m/s, what is the
fundamental frequency of vibration of the air column?
04. A pipe 30cm long is open at both ends. find the fundamental frequency. velocity of sound in air is
300ms-1
05. A rocket is moving at speed of 200ms-1 towards a stationary target. while moving, it emits a wave
of frequency 1000 Hz calculate
(1) the frequency of the sound as detected by the target
06. A open organ pipe 85cm long is sound. if the velocity of sound is 340 m/s, what is the
fundamental frequency of vibration of the air column?
07. A string has a length of 0.4m and a mass of 0.16g . If the tension in the string is 70N what are the
three lowest frequencies it produces when plucked?
08. A vertical tube is made to stand in water so that the water level can be adjusted. sound waves of
frequency 320 Hz are sent into the top of the tube. If standing waves are produced at two
successive water levels of 20cm and 73cm, what is the speed of sound waves in the air in the
tube?
09. Two organ pipes of lengths 65cm and 70cm respectively, are sounded simultaneously. How many
beats per second will be produced between the fundamental frequencies of the two pipes?
(velocity of sound=330m/s)
10. A train sounds its whistle as it approaches and crosses a level- crossing. An observer at the
crossing measures a frequency of 219Hz as the train approaches and a frequency of 184Hz as it
leaves. if the speed of sound is taken to be 340m/s, find the speed of the train and the frequency of
its whistle
VERY SHORT ANSWER QUESTIONS (2M)
01. The air column in a long tube closed at one end, is set in vibration. what harmonics are possible in
the vibrating air column?
02. If the air column in a tube, open at both ends, is set in vibration . what harmonics are possible?
03. Distinguish between transverse and longitudinal waves?
04. what is the phase difference between the incident and reflected waves when the wave is reflected
by a rigid boundary?
05. what is a stationary or standing wave?
06. what do you understand by the terms’ node’ and ‘ antinode’?
07. what is the distance between a node and antinode in a stationary wave?
08. what is ‘Doppler effect’? give an example?
09. what is the principle of superposition of waves?
10. write the expression for beat frequency?
11. what are beats?
2. RAY OPTICS AND OPTICAL INSTRUMENTS
LONG ANSWER QUESTIONS (8M)
01.*** (a) Define snell’s law. using a neat labeled diagram derive expression for the refractive index of
the material of an equilateral prism?
(b) A ray of light, after passing through a medium, meets the surface separating the medium
form air at an angle of 450 and is just not refracted. what is the refractive index of the medium?
02.*** Draw a neat labeled diagram of a compound microscope and explain its working .Derive an
expression for its magnification?
03.*** obtain an expression for the combined focal length for two thin convex lenses kept in contact
and hence obtain an expression for the combined power of the combination of the lenses?
04.** (a) using a neat labeled diagram derive the mirror equation. Define linear magnification?
(b) an object is placed at 5cm . from a convex lens of focal length 15cm . what is the position and
nature of the image?
SHORT ANSWER QUESTIONS (4 M)
01.***Define critical angle. Explain total internal reflection using a neat diagram?
02.***explain the formation of a rainbow?
03.***with a neat labeled diagram explain the formation of image in a simple microscope?
04.***explain the formation of a mirage?
05.*** why does the setting sun appear red?
06. ** define focal length of a concave mirror. prove that the radius of curvature of a concave mirror is
double its focal length?
07.** Explain the Cartesian sign convention for mirrors?
PROBLEMS
01. A concave mirror of focal length 10 cm is placed at a distance 35cm form a wall. How far from the
wall should an object be placed so that its real image is formed on the wall?
02. A concave mirror produces an image of a long vertical pin, placed 40cm from the mirror, at the
position of the object. find the focal length of the mirror
1
03. The focal length of a concave lens is 30cm. where should an object be placed so that its image is 10
of its size
04. A light wave of frequency 4x1014Hz and a wave length of 5x10-7m passes through a medium .
estimate the refractive index of the medium
05. Two lenses of power -1.75D and +2.25D respectively, are placed in contact calculate the focal
 length of the combination
06. A double convex lens of focal length 15cm is used as a magnifying glass in order to produce an
erect image which is 3 times magnified. what is the distance between the object and the lens?
07. what focal length should the reading spectacles have a person for whom the least distance of
distinct vision is 50cm
VERY SHORT ANSWER QUESTIONS (2 M)
01. Define ‘power ‘ of a convex lens. what is its unit?
02. what is dispersion ? which colour gets relatively more dispersed?
03. what is myopia? how can it be corrected?
04. what is hypermetropia? how can it be corrected?
05. A small angled prism of 40 deviates a ray through 2.480 find the refractive index of the prism
06. Define focal length and radius of curvature of a concave lens
07. what is optical density and how is it different from mass density?
08. what are the laws of reflection through curved mirrors?
WAVE OPTICS
LONG ANSWER QUESTIONS (8M)
01.*** Describe young’s experiment for observing interference and hence derive the expression for
‘fringe width’?
02.***Distinguish between coherent and incoherent addition of waves. Develop the theory of
constructive and destructive interferences?
03.*** what is diffraction? discuss diffraction pattern obtainable from a single slit?
04.* what is resolving power of optical instrument? Derive the condition under which images are
resolved?
05.* what is Huygens principle? explain the optical phenomenon of refraction using Huygens
principle?

SHORT ANSWER QUESTIONS(4 M)

01.*** Explain Doppler effect in light. distinguish between red shift and blue shift?
02.*** derive the expression for the intensity at a point where interference of light occurs. Arrive at
conditions for maximum and zero intensity
03.***Does the principle of conservation of energy hold for interference and diffraction phenomena?
explain briefly?
04.***How do you determine the resolving power of your eye?
05.*** Explain polarization of light by reflection and arrive at Brewster’s law from it
06.*** Discuss the intensity of transmitted light when a Polaroid sheet is rotated between two crossed
polaroids?
07.** what is total internal reflection. explain the phenomenon using Huygens principle?
PROBLEMS
01. Two slits are made one millimeter apart and the screen is places one meter away. what is the
frings separation when blue- green light of wave length 500m us used?
02. what should the width of each slit to obtain 10 maxima of the double slit pattern within the central
maximum of the single slit pattern?
03. In a young’s double slit experiment, the slits are separated by 0.28 mm and the screen is placed
1.4m away . the distance between the central bright fringle and the fourth bright fringle is
measured to be 1.2m. Determine the wave length of light used in the experiment?
04. what is the Brewster angle for air to glass transition ? (Refractive index of glass= 1.5)
05. Estimate the distance for which ray optics is good approximation for an aperture of 4mm and
wavelength 400nm
VERY SHORT ANSWER QUESTIONS (2M)
01. what is Malus’ law?
02. Explain Brewster’s law?
03. what is polarization of light?
04. what is Fresnel distance?
05. give the justification for validity of ray optics?
06. when does a monochromatic beam of light incident on a reflective surface get completely
transmitted?
07. what change will occur in young’s double slit experiment if the whole apparatus is immersed in
water rather than air?
4. ELECTRIC CHARGES & FIELDS
LONG ANSWER QUESTIONS (8M)
01.**Applying Gauss’s law derive the expression for electric intensity due to a changed conducting
spherical shell at
i. a point outside the shell ii. a point on the surface of the shell and
iii a point inside the shell
02.* state Gauss’s law in electrostatics applying Gauss’s law derive the expression for electric
intensity due to an infinite plane sheet of charge
03.* Define electric flux. Applying Gauss’s law and derive the expression for electric intensity due to
an infinite long straight charged wire (Assume that the electric field is everywhere radial and
depends only on the radial distance r of the point from the wire)
SHORT ANSWER
01.*** Derive an expression for the intensity of the electric field at a point on the equatorial plane of
an electric dipole
02.*** Derive an expression for the intensity of electric field at a point on the axial line of a dipole
03.*** state and explain Coulomb’s inverse square law in electricity
04.*** Define intensity of electric field at a point. Derive an expression for the intensity due to a point
charge
05.*** state Gauss’s law in electrostatics and its importance
06.*** Derive an equation for the couple acting on a electric dipole in a uniform electric field
PROBLEMS
01. An electric dipole moment 4x10-9 Cm is aligned at 300 with the direction of a uniform electric field
of magnitude 5x104 NC-1. calculate the magnitude of the torque acting on the dipole
02. what is the force between two small charged spheres having charges of 2x10-7C and 3x10-7 C
placed 30cm apart in air?
VERY SHORT ANSWER QUESTIONS (2M)
01.What is meant by the statement ‘charge is quantized?
02. repulsion is the sure test of electrification than attraction . why?
03. How many electrons constitude 1C of charge
04. What happens to the weight of a body when it is charged positively?
05. what happens to the force between two charges if the distance between them is
a. halved b. doubled
06. The electric lines of force do not intersect why?
07. Consider two charges +q and –q placed at B and C of an equilateral triangle ABC. for this system,
the total charges is zero.. but the electric field (intensity) at A which is equidistant from B and C
is not zero. why?
08. Electrostatic field lines of force do not form closed loops. If they form closed loops then the work
done in moving a charge along a closed path will not be zero. from the above two statements
can you guess the nature of electrostatic force?
09. state Gauss’s law in electrostatics?
10. when will be the electric flux negative? and when is it positive
11. write the expression for electric intensity due to infinite long charged wire, at a radial distance r
from the wire
12. write the expression for electric intensity due to an infinite plane sheet of charge
13. write the expression for electric intensity due to a charged conducting spherical shell at points
outside and inside the shell

5. ELECTRIC POTENTIAL AND CAPACITANCE

LONG ANSWER QUESTIONS (8M)
01.***Explain series and parallel combination of capacitors Derive the formula for equivalent
capacitance in each combination
02.*** Derive an expression for the energy stored in a capacitor what is the energy stored when the
space between the plates is filled with a dielectric
a. with charging battery disconnected b. with charging battery connected in the circuit
03.*** Define electric potential . Derive an expression for the electric potential due to an electric dipole
and hence the electric potential at a point
a. on the axis line of electric dipole
b. on the equatorial line of electric dipole
SHORT ANSWER QUESTIONS (4M)
01.*** Derive an expression for the capacitance of a parallel plate capacitor
02.*** Derive an expression for the electric potential due to point charge
03.** Derive expression for the potential energy of an electric dipole placed in a uniform electric field
04.*** explain behavior of dielectrics in an electric field
05.* Derive an expression for the electrostatic potential energy of a system of two point charges and
find its relation with electric potential of a charge
PROBLEMS
01. In a hydrogen atom the electron and proton are at a distance of 0.5Å. The dipole moment of the
system is
02. Three capacitors each of capacitance 9pF are connected in series
a. what is the total capacitance of he combination?
b. what is the potential difference across each capacitor if the combination is connected to a 120V
supply?
03. Three capacitors of capacitances 2pF, 3pF and 4pF are connected in parallel
a. what is the total capacitance of the combination
b. Determine the charges on each capacitor if the combination is connected to a 100V supply
04. In a parallel plate capacitor with air between the plates. each plate has an area of 6x10-3m2 and the
distance between the plates is 3mm. calculate the capacitance of the capacitor. IF this capacitor is
connected to a 100V supply. what is the charge on each plate of the capacitor?
05. A 12pF capacitor is connected to a 50V battery. How much electrostatic energy is stored in the
capacitor
VERY SHORT ANSWER QUESTIONS (2M)
01. Can there be electric potential at a point with zero electric intensity? give an example
02. can there be electric intensity at a point with zero electric potential ? give an example
03. what are meant by equipotential surfaces?
04. why is the electric field always at right angles to the equipotential surface? explain
05. Three capacitors of capacitances 1𝜇F, 2 𝜇F, and 3 𝜇F are connected in parallel
a. what is the ratio of charges? b. what is the ratio of potential differences?
06. Three capacitors of capacitances 1𝜇F, 2 𝜇F, and 3 𝜇F are connected in series?
a. what is the ratio of charges b. what is the ratio of potential differences
07. what happens to the capacitance of a parallel plate capacitor if the area of its plates is doubled
08. The dielectric strength of air is 3x106V/m at certain pressure, a parallel plate capacitor with air in
between the plates has a plate separation of 1cm. can you charge the capacitor to 3x106V
6. CURRENT ELECTRICITY
LONG ANSWER QUESTIONS (8M)
01.*In a house, three bulbs of 100W each are lighted for 4hours daily and six tube lights of 20W each
are lighted for 5 hours daily and a refrigerator of 400w is working for 10 hours daily for a month
of 30 days . calculate the electricity bill, if the cost of one unit is Rs. 4/-
02. Three resistors of 4 ohms, 6ohms and 12 ohms are connected in parallel . The combination of
above resistors is connected in series to a resistance 2 ohms and then to a battery of 6volts. Draw
a circuit diagram calculate
a. current in main circuit b. current flowing through each of the resistors in parallel
c. P.D and the power used by the 2ohms resistors
 SHORT ANSWER QUESTIONS (4M)
01.****State Kirchhoff’s laws for electrical network. using these laws deduce the condition for
balancing in a wheat stone bridge
02.*** state the working principle of potentiometer explain with the help of circuit diagram how the
potentiometer is used to determine the internal resistance of the given primary cell
03.*** state the working principle of potentiometer explain with the help of circuit diagram. how the
emf of two primary cells are compared by using the potentiometer
04.* A battery of emf 10V and internal resistance 3Ω, is connected to a resistor ‘R’
i. if the current in the circuit is 0.5A calculate the value of ‘R’
ii. what is the terminal voltage of the battery when the circuit is closed
05.** Three identical resistors are connected in parallel and the total resistance of the circuit is R/3.
find the value of each resistance
06.** Derive an expression for the effective resistance when three resistors are connected in
i. series ii. parallel
07.* ‘m’ cells each of emf ‘E’ and internal resistance ‘r’ are connected in parallel .what is the total emf
and internal resistance? Under what conditions in the current drawn from mixed groping of cells
a maximum?
08.* Two cells of emf 4.5 v and 6.0v and internal resistance 6Ω and 3Ω respectively have their negative
terminals joined by a wire of 18Ω and positive terminals by a wire of 12Ω resistance and third
resistance wire of 24Ωconnects middle points of these wires using kirchhoff’s laws find the
potential differences at the ends of this third resistance wire
09.* Three resistances each of resistance 100ohm are connected in turn to obtain
i. minimum resistance
ii. maximum resistance
compute:
a. The effective resistance in each case
b. the ratio of minimum to maximum resistance so obtained
PROBLEMS
01. A wire of resistance 4R is bent in the form of a circle. what is the effective resistance between the
ends of the diameter
02. Find the resistivity of a conductor which carries a current of density of 2.5x106Am-2 when an
electric field of 15Vm-1 is applied across it
03. A 10Ω thick wire is stretched so that its length becomes three times .Assuming that there is no
change in its density on stretching , calculate the resistance of the stretched wire
04. what is the colour code for a resistor of resistance 350 MΩ with 5% tolerance
05. You are given 8Ω resistor. what length of wire of resistivity 120Ωm should be joined in parallel
with it to get a value of 6Ω?
06. Three resistors 3Ω,6Ω and 9Ω are connected to a battery. In which of them will the power
dissipation be maximum if : (a)they all are connected in parallel (b) they all are connected in
series? give reasons
07. A silver wire has a resistance of 2.1Ω at 27.50C and a resistance of 2.7Ω at 1000C .Determine the
 temperature coefficient of resistivity of silver
08. If the length of a wire conductor is doubled by stretching it while keeping the potential difference
constant, by what factor will the drift speed of the electrons change?
09.Two 120V light bulbs, one of 25W and another of 200W are connected in series. One bulb burnt out
almost instantaneously. which one was burnt and why?
10. A cylindrical metallic wire is stretched to increase its length by 5% calculate the percentage
change in resistance
11. Two wire A and B of same length and same material, have their cross sectional areas in the ratio
1:4 what would be the ration of heat produced in these wires when the voltage across each is
constant?
12. two bulbs whose resistance are in the ratio of 1:2 are connected in parallel to a source of constant
voltage .what will be the ratio of power dissipation in these?
13. A potentiometer wire is 5m long and a potential difference of 6v is maintained between its ends .
find the emf of a cell which balances against a length of 180 cm of the potentiometer wire
14 A battery of emf 2.5 V and internal resistance r is connected in series with a resistor of 45 ohm
through an ammeter of resistance 1 ohm. the ammeter reads a current of 50m A. draw the
circuit diagram and calculate the value of r
15. Amount of charge passing through the cross section of a wire is q(t) =at2+bt+c. write the
dimensional formula for a,b and c. If the values of a,b and c in SI unit are 6,4,2 respectively, find
the value of current at t=6 seconds
VERT SHORT ANSWER QUESTIONS (2M)
01. Define mean free path of electron in a conductor
02. State ohm’s law and write its mathematical form
03. Define resistivity or specific resistance
04. Define temperature coefficient of resistance
05. Under what conditions is the current through the mixed grouping of cells maximum
06. why is manganin used for making standard resistors
07. The sequence of bands marked on a carbon resistor are : Red, Red.Red.silver. what is its resistance
and tolerance
08. Write the colour code of a carbon resistor of resistance 23 kilo ohms
09. If the voltage V applied across a conductor is increased to 2V, how will the drift velocity of the
electrons change?
10. why are household appliances connected in parallel?
7. MOVING CHARGES AND MAGNETISM
LONG ANSWER QUESTIONS (8M)
01.***Obtain an expression for the torque on a current carrying loop placed in a uniform magnetic
field. Describe the construction and working of a moving coil galvanometer
02.***Deduce an expression for the force on a current carrying conductor placed in a magnetic field.
Derive an expression for the force per unit length between two parallel current carrying
conductors
03.** How can a galvanometer be converted to an ammeter? why is the parallel resistance smaller
 than the galvanometer resistance?
04. *How can a galvanometer be converted to a voltmeter? why is the series resistance greater than
the galvanometer resistance
05.** Derive an expression for the force acting between two parallel current carrying conductors and
hence define the ampere
SHORT ANSWER QUESTION (4M)
01.***State and explain Biot- savart law
02.*** state and explain Ampere’s law
03.*** what are the basic components of cyclotron? mention its uses?
04.*** Derive an expression for the magnetic dipole moment of a revolving electron?
05.*** Derive an expression for the magnetic field at a point on the axis of a current carrying circular
coil using diot- savart law?
06.*** Derive an expression for the magnetic induction at he centre of a current circular coil using
biot- savart law?
07.*** find the magnetic induction intensity B due to a long current carrying conductor?
08.** obtain an expression for the magnetic dipole moment of a current loop?
09.** explain how crossed E and B fields serve as a velocity selector?
PROBLEMS
01. A current of 10A passes through two very long wires held parallel to teach other and separated by
a distance of 1m. what is the force per unit length between them?
02. A square coil of side 10cm consists of 20 turns and carries a current of 12A . the coil is suspended
vertically and the normal to the plane of the coil makes an angle of 300 with the direction of a
uniform horizontal field of magnitude 0.80 T. what is the magnitude of torque experience by the
coil
03. what is the magnitude of magnetic force per unit length on a wire carrying a current of 8A and
making an angle of 300 with the direction of a uniform magnetic field of 0.15T
04. A moving coil galvanometer can measure a current of 10-6A. what is the resistance of the shunt
required if it is to measure 1A
05. The resistance of MCG is 5Ω . The maximum current it can measure is 0.015A. How would you
convert it into voltmeter to measure 1.5 volts?
06. Two long and parallel straight wires A and B carrying current of 8.0A and 5.0A in the same
direction are separated by a distance of 4.0 cm . Estimate the force on a 10cm section of wire A
07. A circular coil of wire consisting of 100 turns, each of radius 8.0 cm carries a current of 0.40A what
is the magnitude of the magnitude field B at the centre of the coil
08. A 100 turn closely wound circular coil of radius 10cm carries a current of 3.2A.
a. what is the field at the centre of the coil? b. what is the magnetic moment of this coil?
09. A long straight wire carries a current of 35A. what is the magnitude of the field B at a point 20cm
from the wire?
VERY SHORT ANSWER QUESTION (2M)

01. Distinguish between ammeter and voltmeter?

02. what is the principal of a moving coil galvanometer?
03. what is the smallest value of current that can be measured with a moving coil galvanometer?
04. How do you convert a moving coil galvanometer into an ammeter?
05. how do you convert a moving coil galvanometer into a voltmeter
06. what is the importance of oersted’s experiment
07. state Ampere’s law and Biot- savart’s law
08. A circular coil of radius ‘r’ having ‘N’ turns carries a current ‘I’ what is its magnetic moment
09. what is the force on a charged particle of charge ‘q’ moving with a velocity ‘V’ in a uniform
magnetic field of induction B? when does it become maximum
10. what is the force on a conductor of length ‘L’ carrying current ‘i’ placed in a magnetic field of
induction B? when does it become maximum?
11. what is the relation between the permittivity of free space ɛv ,the permeability of free space 𝜇 0 and
the speed of light in vacuum?
8. MAGNETISM AND MATTER
LONG ANSWER QUESTIONS (8M)
01.*** Derive an expression for the magnetic field at a point on the axis of a current carrying circular
loop
02.** Obtain Gauss law for magnetism and explain it
SHORT ANSWER QUESTIONS (4M)
01.*** Derive an expression for the axial field of a solenoid of radius ‘r’ , containing ‘n’ turns per unit
length and carrying current ‘I’
02.** how do you distinguish Dia, para and Ferromagnetisms in matter
03.**Define retentivity and coercivity. draw the hysteresis curve for soft iron and steel. what do you
infer from these curves
04.* If B is the magnetic field produced at the centre of a circular coil of one turn of length L carrying
current I then what is the magnetic field at the centre of the same coil which is made into 10
turns
PROBLEM
01. A bar magnet of length 0.1m and with a magnetic moment of 5Am is placed in a uniform
magnetic field of intersity 0.4T with its axis making an angle of 600 with the field. what is the
torque on the magnet
02. In the magnetic meridian of a certain place, the horizontal component of the earth’s magnetic field
is 0.26 G and the dip angle is 600. what is the magnetic field of the earth at this location
VERY SHORT ANSWER QUESTIONS (2 M)
01. Define magnetic declination
02. Classify the following materials with regard to magnetism
i. manganese, ii . cobalt, iii. nickel ,iv. bismuth, v. oxygen, vi. copper
03. what are the units of magnetic moment . magnetic induction and magnetic field?
04. Define magnetic inclination (or) angle of dip
05. what direction compass needle points at poles? which needle to be used at poles?
06. magnetic lines of force form continuous closed loops. why?
07. what do you understand by the “magnetization” of a sample?
08. Define magnetic susceptibility? mention its unit
09. what is the magnetic moment associated with a solenoid?
10. state Gauss law of magnetisum?
9. ELECTRO MAGNETIC INDUCTION
LONG ANSWER QUESTIONS (8M)
01.* describe the working of a AC generator with the aid of a simple diagram and necessary
expressions
SHORT ANSWER QUESTIONS (4M)
01.*** Obtain an expression for the emf induced across a conductor which is moved in a uniform
magnetic field which is perpendicular to the plane of motion
02.*** Describe the ways in which Eddy currents are used to advantage
03.*** obtain an expression for the mutual inductance of two long co- axial solenoids
04.** obtain an expression for the magnetic energy stored in a solenoid in terms of the magnetic field,
area and length of the solenoid
PROBLEMS
01. The current in a circuit falls from 5A to 0A in 0.1s. If an average emf of 200V is induced, give an
estimate of the self inductance of the circuit
02. The current in a coil changes form 5Amp to 10Amp in 102sec then the emf of 50 milli volts is
induced in a coil near it. calculate the mutual inductance of coil
VERY SHORT ANSWER QUESTIONS (2M)
01. What did the experiments of faraday henry show?
02. Define magnetic flux
03. state Faraday’s law of electromagnetic induction?
04. state lenz’s law
05. Define inductance
06. what do you understand by ‘self inductance’?
07. what happens to mechanical energy (of motion) when a conductor is moved in a uniform
magnetic field ?
08. what are eddy currents?
10. ALTERNATING CURRENT
LONG ANSWER QUESTIONS (8M)
01.** Obtain an expression for impedance and current in series LCR circuit. Deduce an expression for
the resonating frequency of an LCR series resonating circuit?
SHORT ANSWER QUESTIONS (4M)

01.*** State the principle on which transformer works. Describe the working of a transformer with
necessary theory
02.*** obtain expression for the current through an inductor when an a.c. emf is applied?
03.** obtain an expression for the current in a capacitor when an a.c. emf is applied?
 PROBLEMS
01. A 100 Ω resistor is connected to a 220 V, 50Hz ac supply
a. what is the rms value of current in the circuit?
b. what is the net power consumed over a full cycle?
02. A 44 mH inductor is connected to 220V,50Hz ac supply. Determine the rms value of the current in
the circuit
03. A 60Ω F capacitor is connected to a 110 V, 60Hz ac supply Determine the rms value of the current
in the circuit
04. A series LCR circuit with R=20 Ω,L= 1.5H and C= 35𝜇F is connected to a variable frequency 200V
ac supply. when the frequency of the supply equals the natural frequency of the circuit, what is
the average power transferred to the circuit in one complete cycle?
VERY SHORT ANSWER QUESTIONS (2M)
01. What is the phenomenon involved in the working of a transformer?
02. what is the phase difference between AC emf and current in the following : pure resistor, pure
inductor and cure capacitor
03. A transformer converts 200V ac into 2000C ac. calculate the number of turns in the secondary if
the primary has 10 turns
04. write the expression for the reactance of (i) an inductor (ii) a capacitor
05. what is meant by wattles component of current?
06. what type of transformer is used in a 6V bed lamp?
07. what is transformer ratio?
08. Define power factor. On which factors does power factor depends?
09. what is the phase difference between voltage and current when the power factor in LCR series
circuit is unity?
10. when does a LCR series circuit have minimum impedance?

11. ELECTROMAGANETIC WAVES

SHORT ANSWER QUESTIONS (4M)
01.*** What does an electromagnetic wave consists of? on what factors does its velocity in vacuum
depends?
02.*** what is green house effect and its contribution towards the surface temperature of earth?
VERT SHORT ANSWER QUESTIONS (2M)
01. If the wave length of electromagnetic radiation is doubled what happens to the energy of photon?
02.micro waves are used in radars why?
03. what are the applications of micro waves?
04. How are microwaves produced?
05. what is the principle of production of electromagnetic waves?
06. what is the ratio of speed of infrared rays and ultraviolet rays in vacuum?
07. what is the relation between the amplitudes of the electric and magnetic fields in free space for an
electromagnetic wave?
08. Give two uses of infrared rays? which animal can ditect infrared waves?
09. The charging current for a capacitor is 0.6A. what is the displacement current across its plates?
12. DUAL NATURE OF RADIATION AND MATTER
LONG ANSWER QUESTIONS (8M)
01.** How Einstein’s photoelectric equation account for the effect of frequency of incident light on
stopping potential. explain the effect of intensity and potential on photoelectric current?
02.* Describe the Davisson and Germer experiment. what did this experiment conclusive prove?
SHORT ANSWER QUESTIONS (4M)
01.*** What is the effect of i. intensity of light ii. potential on photoelectric current?
02.*** Describe an experiment to study the effect of frequency of incident radiation on “stopping
potential”
03.** summarise the photon picture of electromagnetic radiation
04.* what is the debroglie wavelength of a ball of mass 0.12kg moving with a speed of 20ms-1? what
can we infer from this result?
05.* Define photoelectric effect? what is the effect of intensity of light on photoelectric current? give
one application of photoelectric effect
PROBLEMS
01. If the wavelength of electromagnetic radiation is doubled, what happens to the energy of photon?
02. find the a. maximum frequency, and b. minimum wavelength of X- rays produced by 30kV
electrons
03. The work function of Caesium metal is 2.14eV .when light of frequency 6x1014Hz is incident on
the metal surface, photoemission of electrons occurs. what is the a)maximum kinetic energy of
the emitted electrons b) stopping potential, and c)maximum speed of the emitted
photoelectrons?
04. The photoelectric cut- off voltage in a certain experiment is 1.5V. what is the maximum kinetic
energy of photoelectrons emitted?
05. what is the a) momentum b) speed and c) di- Broglie wavelength of an electron with
kinetic energy fo 120eV
VERY SHORT ANSWER QUESTIONS (2M)
01. What are “cathode rays”
02. what is ‘work function’
03. what is “photo electric effect’?
04. Give example of ‘ photosensitive substances’ why they are called so
05. write down Einstein’s photo electric equation
write down DeBroglie’s relation and explain the terms there in
07. state Heisenberg’s uncertainty principle?
08. An electron, and 𝛼 particle and a proton have the same kinetic energy . which of these particles
has the shortest De Broglie wavelength?
09. How is the De-Broglie wavelength associated with an electron accelerated through a potential
difference of 100 volts?
10. what important fact did millikan’s experiment establish?
 13. ATOMS
LONG ANSWER QUESTIONS (8M)
01.*** STATE THE BASIC POSTULATES OF Bohr’s theory of atomic spectra. Hence obtain an
expression for the radius of orbit and the energy of orbital electron in a hydrogen atom
02.*** Discuss Bohr’s theory of spectrum of hydrogen atom
03.** Describe Geiger- Marsden experiment on scattering of 𝛼 particle. How is the size of the nucleus
estimated in this experiment
SHORT ASNWER QUESTIONS (4M)
01.*** What are the limitations of Bohr’s theory of hydrogen atom?
02.*** explain the different types of spectral series
03.*** Describe Rutherford atom model. what are the drawbacks of this model
04.*** Derive an expression for potential and kinetic energy of an electron in any orbit of a hydrogen
atom according to Bohr’s atomic model
05.*** state the basic postulates of Bohr’s theory of atomic spectra
06.***what is impact parameter and angle of scattering ? how are they related to each other
07.*** Explain the distance of the closest approach and impact parameter
PRBOLEMS
01. The radius of the first electron orbit of hydrogen atom is 5.3x10-11m . what is the radius of the
second orbit
VERY SHORT ANSWER QUESTIONS (2M)
01.The lyman series of hydrogen spectrum lies in the UV region .why?
02. what is the angular momentum of electron in the second orbit of bohr’s model of hydrogen atom
03. what is the expression for fine structure constant and what is its value?
04. what is he physical meaning of ‘negative energy of an electron’?
05. sharp lines are present in the spectrum of a gas, what does this indicate?
06. what is the difference between 𝛼 − particle and helium atom?
07. among alpha, beta, gamma radiations, which get affected by the electric field?
08. what do you understand by the phrase ‘ ground state atom’?
14. NUCLEI
LONG ANSWER QUESTIONS (8M)
01.*** Explain the principle and working of a nuclear reactor with the help of a labeled diagram
02.*** what is radioactivity? state the law of radioactive decay. show that radioactive decay is
exponential in nature
03.** explain the source of stellar energy. explain the carbon- nitrogen cycle, proton- proton cycle
occurring in stars
04.** Define mass defect and binding energy. How does binding energy per nucleon vary with mass
number? what is its significance?
SHORT ANSWER QUESTIONS (4M)
01.*** Write a short note on the discovery of neutron
02.*** Distinguish between nuclear fission and nuclear fusion
03.*** Define half life period and decay constant for a radioactive substance . Deduce the relation
 between them
04.*** Define average life of a radioactive substance. obtain the relation between decay constant and
average life
05.*** what are the properties of a neutron?
06.** what are nuclear forces? write their properties
07.** what is nuclear fission ? give an example to illustrate it
08.** what is nuclear fusion? write the conditions for nuclear fusion to occur
09.* explain 𝛼 − 𝑑𝑒𝑐𝑎𝑦 𝑎𝑛𝑑 𝛽 − decay
PROBLEM
01. The half life of radium is 1600 years, How much time does 1 go of radium take to reduce to 0.125g
02. How much 235U is consumed in a day in an atomic power house operating at 400 MW, provided
the whole of mass 235U is converted into energy
03. Find the bonding energy of 56 26𝐹𝑒 . Atomic mass of Fe is 55.9349u and that of hydrogen is 1.00783 u
and mass of neutron is 1.00876u
04. calculate the binding energy of an 𝛼 − particle . Give that the mass of proton = 1.0083u, mass of
neutron =1.0087u and mass of 𝛼- particle = 4.0015u
05. The half life period of a radioactive substance is 20 days. what is the time taken for 7/8th of its
original mass to disintegrate
06. If one microgram of 23592𝑈 is completely destroyed in an atom bomb, how much energy will be
released?
VERY SHORT ANSWER QUESTIONS (2M)
01. What are thermal neutrons? what is their importance ?
02. what is the function of moderator in a nuclear reactor
03. what are isotopes and isobars
04. what are isotones and isomers
05. what is a..m.u? what is its equivalent energy?

06. what will be the ratio fo the radii of two nuclei of mass numbers A1 and A2
07. what re the units and dimensions of the disintegration constant
08. Neutrons are the best projectiles to produce nuclear reactions. why?
09. Neutrons cannot produce ionization.why?
10. what is the value of neutron multiplication factor in a controlled reaction and in an uncontrolled
chain reaction
11. what is the role of controlling rods in a nuclear reactor?
12. Define Becquerel and curie
13. what is the chain reaction
14 what is the energy released in the fusion of four protons of form a helium nucleus
15. SEMI CONDUCTOR ELECTRONICS
LONG ANSWER QUESTIONS (8M)
01.*** What is rectifier? Explain the working of half wave and full wave rectifiers with diagrams
02.*** what is zener diode? explain how it is used as voltage regulator
03.*** Describe a transistor and explain its working
04.** sketch a basic AND circuit with two diodes and explain its operation . explain how doping
increasing the conductivity in semiconductors?
05.** what is junction diode? explain the formation of depletion region at the junction. explain the
variation of depletion region in farward and reverse biased condition
06.* Draw OR gate using two diodes and explain its operation write the truth table and logic symbol
of OR gate
SHORT ANSWER QUSTIONS (4M)
01.*** Describe how a semi conductor diode is used as a half wave rectifier
02.*** what is rectification? explain the working of a full wave rectifier
03.** explain how transistor can be used as a switch
04.*** what are n-type and p- type semiconductors? how is a semiconductor junction formed?
05.** Distinguish between ener breakdown and avalanche breakdown
06.** Distinguish between half- wave and full- wave rectifiers
07.** what is a photodiode? explain its working with a circuit diagram and draw its I-V characteristics
08.** Explain the working of LED and what are its advantages over conventional incandescent low
power lamps
09.** explain the working of a solar cell and draw its I- V characteristics
10.** Explain how transistor can be used as an oscillator
11.** Define NAND and NOR gates .Give their truth tables
12.** Explain the operation of a NOT gate and give its truth table
13.** Explain the different transistor configurations with diagrams
14.* Discuss the behavior of p-n junction How does a potential barrier develop at the junction?
15.* Draw and explain the current – voltage (I - V) characteristics curves of a junction diode in
forward and reverse bias
16.* Explain hole conduction in intrinsic semiconductors?

PROBLEMS
01. In a half wave rectifier, a p-n junction diode with internal resistance 20 ohm is used. if the load
resistance of 2k ohms is used in the circuit, then find the efficiency of this half wave rectifier
02. A full wave p-n junction diode rectifier uses a load resistance of 1300 ohm. The internal resistance
of each diode is 9 ohm. find the efficiency of this full wave rectifier
03. Calculate the current amplification factor 𝛽 (beta) when change in collector current is 1mA and
change in base current is 20𝜇 A
04. For a transistor amplifier, the collector load resistance 2K ohm and the input resistance R i= 1K
ohm. If the current gain is 50, calculate voltage gain of the amplifier
VERY SHORT ANSWER QUESTIONS (2M)
01. What is an n-type semiconductor? what are the majority and minority charge carriers in it?
02. what are intrinsic and extrinsic semiconductors?
03. what is a p-type semiconductor? what are the majority and minority charge carriers in it?
04. what is p-n junction diode?Define depletion layer
05. How is a battery connected to a junction diode in i. forward and ii. reverse bias?
06. Draw the circuit symbols for p-n-p and n-p-n transistors
07. In which bias can a zener diode be used as voltage regulator
08. which gates are called universal gates
09. what is the maximum percentage of rectification in half wave and full wave rectifiers
10. what is zener voltage (Vz) and how will a zener diode be connected in circuits generally
12. what happens to the width of the depletion layer in a p-n junction diode when its is in
i. forward- biased ii. reverse biased?
13. Define amplifier and amplification factor
14. write the truth table of NAND gate. How does it differ From AND gate?
16. COMMUNICATION SYSTEMS
VERY SHORT ANSWER QUESTIONS (2M)
01. What is sky wave propagation
02. Define modulation. why is it necessary?
03.Mention the various parts of the ionosphere
04. Mention the basic methods of modulation
05. which type of communication is employed in mobile phones
06. Define modulation. Mention the basic methods of modulation
07. what are the basic blocks of communication system
08. what are “ world wide web” (WWW)
09. Mention the frequency range of speech signals
 SENIOR IPE IMPORTANT QUESTION BANK
SR. CHEMISTRY
QUESTION BANK ANALYSIS

S.NO NAME OF THE CHAPTER WEIGHTAGE MARKS

01 SOLID STATE 26
02 SOLUTIONS 43
03 ELECTRO CHEMISTRY 36
04 CHEMICAL KINETICS 40
05 SURFACE CHEMISTRY 31
06 GENERAL PRINCIPAL OF 23
METALLURGY
07 P- BLOCK ELEMENTS 108
08 d & f- BLOCK ELEMENTS 48
09 POLYMERS 26
10 BIOMOLECULES 35
11 CHEMISTRY IN EVERY DAY LIFE 18
12 HALOALANES AND HALOARENES 30
13 ORGANIC COMPOINDS 31
CONTAINING C,H &O
14. ORGANIC COMPOUNDS
CONTAINING NITROGEN
SUB TOTAL 22
Total marks

S. TOPIC NAME LAQ SAQS VSAQS TO

N TAL
O
*** ** * *** ** *
01 SOLID STATE - - - 3 5 2 16 22
02 SOLUTIONS - - - 10 6 6 21 43
03 ELECTRO 2 - - 3 8 3 20 36
CHEMISTRY

04. CHEMICAL 2 1 - 3 6 7 21 40
KINETICS
05 SURFACE - - - 7 3 1 20 31
CHEMISTRY
06 GENERAL - - - 4 1 4 14 23
PRINICIPAL OF
METALLURY
07 P- BLOCK 8 - - 15 11 - 74 108
 ELEMENTS
08 d &f BLOCK - - - 6 5 5 32 48
ELEMENTS
09 POLYMERS - - - - - - 26 26

10 BIOMOLECULS - - - 4 4 2 25 35
11 CHEMISTRY IN - - - - - - 18 18
EVERYDAY LIFE
12 HALOALKANES 4 4 - 5 - 2 15 30
AND
HALOARENES
13 ORGANIC 6 - 1 4 8 - 12 31
COMPOUNDS
CONTAINING C,
&O
14 ORGANIC 3 - - 4 2 4 9 22
COMPOINTS
CONTAINING
NITROGEN
SUB TOTAL 25 5 1 68 59 36 323 157
TOTAL 31 163

1. SOLID STATE
SHORT ANSWER QUESTIONS (4M)
01.***Describe Bragg’s equation
02.*** Describe the two main types of semiconductors and contrast their conduction mechanism
03.*** classify each of the following as either a p-type or a n-type semiconductor
i. Ge doped with in ii. Si doped with B
04.*** Explain why ionic solids are hard and brittle
05.*** In terms of band theory, what is the difference between a conductor and an insulator?
06.*** In terms of band theory, what is the difference between a conductor and a semiconductor?
07.*** A cubic solid is made of two elements P and Q . atoms of Q are at the corners of the cube and P
at the body- centre . what is the formula of the compound ? what are the coordination numbers of P
and Q?
08.** If the radius of the octahedral void is ‘r’ and radius of the atoms in close packing is ‘R’ derive
relation between r and R
09.* Calculate the efficiency of packing in case of a metal of body- centered cubic crystal?
10.* Aluminum crystallizers in a cubic close packed structure. Its metallic radius is 125pm
i. what is the length of the side of the unit cell
ii. how many unit cells are there in 1.00 cm3 of aluminum?
VERY SHORT ANSWER QUESTIONS (2M)
01.How do your distinguish between crystal lattice and unit cell
02.what is schottky defect?
03. what is frenkel defect?
04. stability of a crystal is reflected in the magnitude of its melting point. comment
05. what makes a glass different from quartz?
06. How many lattice points are there in one unit cell of face- centered cubic lattice?
07. How many lattice points are there in one unit cell of face- centered tetragonal lattice?
08. How many lattice points are there in one unit cell of body centered cubic lattice?
09. Explain ferromagnetism with suitable example
10. Explain paramagnetism with suitable example
11. Explain antiferromagnetism with suitable example
12. what are f- centres
13. what is co- ordination number?
14. what is the colour of LiCI crystal in excess of lithium?
15. Give an example which shows both schottky defect and frenkel defect
16. what is metal deficiency defect? give example
2. SOLUTIONS
SHORT ANSWER QUESTIONS(4M)
01.***Define mole fraction. A solution of sucrose in water is labeled as20 % w/w. what would be the
mole fraction of each component in the solution
02.*** what is meant by positive deviations from Raoult’s law and how is the sign of ∆mixH related to
positive deviation from Raoult’s law
03.*** what is meant by negative deviation from Raoult’s law and how is the sign of ∆mixH related to
negative deviation from Raoult’s law
04.*** what is relative lowering of vapour pressure? how is it useful to determine the molar mass of
solute
05.*** State Raoult’s law. Vapour pressure of water at 293K is 17.535 mm.Hg calculate the vapour
pressure of the solution at 293K when 25g of glucose is dissolved in 450g of water
06.***State Raoult’s law. calculate the vapour pressure of a solution containing 9g of glucose in 162g
of water at 293K . the vapour pressure of water at 293K is 17.535mmHg
07.***state Raoults law
The vapour pressure of pure benzene at a certain temperature is 0.850 bar. A non- volatile, non-
electrolyte solid weighing 0.5g when added to 39.0g of benzene (molar mass 78 mol-1). vapour
pressure of the solution, then is 0.845 bar. what is the molar mass of the solid substance
08.*** what is an ideal solution ? give suitable example
09.*** calculate the mass of non- volatile solute (molar mass 40g mol-1 ) which should be dissolved in
14g octane to reduce its vapour pressure to 80%
10.***Define molality (m). calculate molality (m) of 10gm of Glucose (C6H12O6) in 90 gm of water
11.** How is molar mass- related to the elevation in boiling point of a solution
12.** How is molar mass related to the depression in freezing point of a solution
13.** A solution of glucose in water is labeled as 10% w/w . what would be the molarity of the
solution
14.** Define molefraction? calculate mole fraction of ethylene glycol (C2H6O2) in solution containing
20% of C2H6O2 by mass
15.** Define the following
a. RLVP B. elevation of boiling point c. osmotic pressure d. henry’s law
e. depression in freezing point
16.** Define molefraction? calculate the mole fraction of H2SO4 in a solution containing 98% H2SO4 by
mass
17.* Define mass percentage, volume percentage and mass to volume percentage solutions
18.* concentrated nitric acid used in the laboratory work is 68% nitric acid by mass is aqueous
solution. what should be the molarity of such a sample of the acid if the density of the solution is
1.504mL
19.* A solution is obtained by mixing 300g of 25% solution and 400g of 40% solution by mass
calculate the mass percentage of the resulting solution
20.* 45g of ethylene glycol (C2H6O2) is mixed with 600g of water. calculate (a) the freezing point
depression and (b) the freezing point of the solution
21.* 1.00g of a non- electrolyte solute dissolved in 50g of benzene lowered the freezing point of
benzene by 0.40K. The freezing point depression contact of benzene is 5.12K Kg mol-1 . find the molar
mass of the solute
22.* 200cm3 of an aqueous solution of a protein contains 1.26g of the protein. The osmotic pressure of
such a solution at 300K is found to be 2.57x10-3 bar. calculate the molar mass of the protein
VERY SHORT ANSWER QUESTIONS (2M)
01. Define the term solution
02. Define molarity
03. calculate the molarity of a solution containing 5gm of NaOH in 450ml solution?
04. Define molality
05. calculate the molality of 2.5 gm of ethanoic acid (CH3COOH) in 75gm of benzene
06. give an example of solid solution in which the solute is solid
07. Define mole fraction
08. calculate the mole fraction of H2SO4 in a solution containing 98% H2SO4 by mass
09. Define mass percentage of solution
10. what is ppm of a solution
11. what role do the molecular interactions play in solution of alcohol and water
12. state Raoult’s law and give its two limitations
13. state Henry’s law
14. Define osmotic pressure
15. what are isotonic solutions give example
16. what is van’t Hoff’s factor ‘i’ and how is it related to ‘𝛼’ in the case of a binary electrolyte
17.what is relative lowering of vapour pressure?
18. what are colligative properties, give examples
19. what is amalgam? give example
20. Define plasmolysis and haemolysis
21. calculate weight of glucose required to prepare 500ml of 0.1M solution
3. ELECTROCHEMISTR & CHEMICAL KINETICS
 LONG ANSWER QUESTIONS (8M)
01.*** (a)what is electrolysis ? and state Faraday’s laws of electrolysis
(b) A solution of CuSO4 is electrolysed for 10minutes with a current of 1.5 amperes. what is the
mass of copper deposited at the cathode
02***(a) State and explain Kohlrausch’s law of independent migration of ions
(b) give the applications of Kohlrausch’s law of independent migration of ions
03.*** Give a detailed account of the collsion theory of reaction rates of bimolecular gaseous reactions
04.***what is rate of reaction? Explain the effect of temperature and effect of catalyst on rate of
reaction
05.** Explain the following terms with suitable examples
(a)average rate of a reaction (b) slow and fast reactions (c) order of a reaction
(d) molecularity of a reaction (e) activation energy of a reaction

ELECTROCHEMISTRY
SHORT ANSWER QUESTIONS (4M)
01.***Give the construction and working of a standard hydrogen electrode with a neat diagram
02.*** what are galvanic cells? Explain the working of a galvanic cell with a neat sketch taking Daniel
cells as example
03.*** state and explain Nernst equation with the help of a metallic electrode and non metallic
electrode
04.** what are primary and secondary batteries? give examples
05.** what is metallic corrosion ? explain it with respect to iron corrosion
06.* what are fuel cells? How they are different from galvanic cells? give the construction of H2- O2
fuel cell
07.* what are the products obtained at the cathode and the anode during the electrolysis of the
following when platinum electrodes are used in the electrolysis
a. molten KCI b. aq. CuSO4 c. aq.K2SO4
NUMERICAL PROBLEMS
01.** Calculate the EMF of the following galvanic cell: Zn(s) + Cu+2(aq) →Zn+2(aq) +Cu(s)
0 0
𝐸𝑍𝑛 −2 /𝑧𝑛 =-0.76V; 𝐸𝑍𝐶𝑢+2 /𝐶𝑢 =+0.34V

02.** ∧0m for NaCI, HCI and CH3COONa are 126.4,425.9 and 91.0 S cm2 mol-1 respectively calculate
∧0m for CH3COOH
03.** Calculate the emf of cell at 250C Cr/Cr3(0.1)//Fe+2 (0.01M)/Fe
0 0
give that 𝐸𝐶𝑟 3+ /𝑐𝑟 =-0.74V and 𝐸𝐹𝑒 +2 /𝐹𝑒 =-0.44V

04.** Calculate the equilibrium constant of the reaction

0
Cu(s) +2Ag+(aq)→ Cu2+aq+2Ag(s) given 𝐸(𝑐𝑒𝑙𝑙) =0.46V
05.** The standard emf of Daniell cell is 1.1V.calculate the standard gibbs energy for the cell reaction
Zn(s)+ Cu2+aq→ Zn2+(aq)+ Cu(s)
06.* Calculate ∧0m for CaCI2 and MgSO4 (given ⋋0𝐶𝑎2+ =119, ⋋0𝐶𝑙− =76.3
⋋0𝑀𝑔2+ =106 ⋋𝑆𝑂
0
−2 =160
4
 VERY SHORT ANSWER QUESTIONS (2M)
01. What is galvanic cell or a voltaic cell give one example
02. what is standard hydrogen electrode?
03. what is Nernst equation write the equation for an electrode with electrode reaction Mn-(aq)+ ne-
=M(s)
04. How is Gibb’s energy (G)related to the cell emf (E) mathematically
05. what is cell constant of a conductivity cell
06. Define molar conductivity ∧m and how is it related to conductivity (K)
07. state Kohlrausch’s law of independent migration of ions
08. state faraday’s first law of electrolysis
09. state faraday’s second law of electrolysis
10. what re the product obtained at the platinum anode and the platimum cathode respectively in the
electrolysis of fused or molten. NaCI?

11. Give the products obtained at the platinum electrodes (cathode and anode) when aqueous
solution of K2SO4 is electrolysed
12. what is a primary battery? give one example
13. what is a fuel cell? how is it different from conventional galvanic cell
14. Give the electrode reactions occurring at the anode and at the cathode in H2 – O2 fuel cell
15. what is metallic corrosion ? give one example
16. write the cell reaction taking place in the cell Cu(s)/Cu+2(aaq)//Ag+aq/Ag(s)
17. write the Nernst equation for the EMF of the cell Ni(S)/Ni2+(aq)//Ag+(aq)/Ag
0
18. How is 𝐸(𝑐𝑒𝑙𝑙) related mathematically to the equilibrium constant Kc of the cell reaction
19. Give one example for a secondary battery. give the cell reaction
20. Define conductivity of a material . give its SI units
4.CHEMICAL KINETICS
SHORT ANSWER QUESTIONS (4M)
01.***Define and explain the order of a reaction. how is it obtained experimentally
02.*** what is ‘molecularity’ of a reaction? how is it different from the order of a reaction? name one
bimolecular and one trimolecular gaseous reaction
03.***what is half- life (tm) of a reaction? Derive the equations for the ‘half – life’ value of zero and
first order reaction
4.* what is Arrhenius equation? Derive an equation which describes the effect of rise of temperature
(T) on the rate constant (K) of a reaction
05.** Discuss the effect of catalyst on the kinetics of a chemical reaction with suitable diagram
06.* Derive the integrated rate equation for a first order reaction
07.* Explain the terms
a. activation energy (Ea) b. collision frequency (Z) c. probability factor (P) with
reapect to arrhenius equation
NUMERICAL PROBLEMD
01.** A reaction is 50% completed in 2hours and 75% completed in 4 hours. what is the order of the
reaction
02.** A reaction has a half life of 10 minutes. calculate the rate constant for the first order reaction
03.** In a first order reaction. the concentration of the reactant is reduced from 0.6 mol/L to 0.2 mol/L
in 5min . calculate the rate constant
04.** Show that in the case of first order reaction, the time required for 99.9% completion of the
reaction is 10 times that required for 50% completion . (log2=0.3010)
05.*For the reaction R→ P, the concentration of a reactant changes from 0.03M to 0.02M in 25minutes .
calculate the average rate of reaction using units in seconds
06.* A first order reaction has a rate constant of 1.15x10-3s-1.How long will 5.0g of this reactant take to
reduce to 3.0g
07.* From the rate expression for the following reactions determine their order of reaction and the
dimensions of the rate constants:
i. 3NO(g) → N2O(g)+NO2(g), rate = K[NO]2
ii. H2O2(aq)+3I-(aq)+2H+(aq) → 2H2O(I)+I-3 , rate= k[H2O2][I-]
iii. CH3CHO(g) → CH4(g)+ CO(g), rate =k[CH3CHO]3/2
08.* For a first order reaction, show that time required for 99% completion is twice the time required
for the completion of 90% of reaction
09.* Identify the reaction order from each of the following rate constants
i. k=2.3 x 10-5 L mol-1s-1 ii. k= 3x10-4s-1
VERY SHORT ANSWER QUESTIONS (2M)
01. Define the speed or rate of a reaction
02. what are the units of rate of reaction
03. what is rate law? Illustrate with an example
04. Define order of a reaction ? Illustrate your answer with an example
05. what are elementary reactions
06. what are complex reactions? give one example
07.Give the units of rate constants for zero, first order and second order reactions
08. Define molecularity of a rection ? Illustrate with an example
09. Give two example for zero order reactions
10. write the integrated equation for a first order reaction in terms of [R], [R]0 and ‘t’?
11. give two examples for gaseous first order reaction
12. what is half- life of a reaction? Illustrate your answer with an example
13. write the equation relating the half- life (t1/2) of a reaction and the rate constant ‘K’ for first order
reaction
14. write the equation useful to calculate half-life (t1/2) values for zero and first order reactions
15. what are pseudo first order reaction? give one example?
16. write the equation which relates the rate constant k1 and k2 at temperatures T1 and T2 of a
reaction
17. write the Arrhenius equation for the rate constant (K) of a reaction
18. what is the effect of temperature on the rate constant
19. what is rate determining step in a complex reaction
20. Define law of mass action
21. what is positive catalyst? give an example
SURFACE CHEMISTRY
SHORT ANSWER QUESTIONS (4M)
01.*** What are different types of adsorption ? give any four difference between characteristics of the
different types
02.*** what is an emulsion ?explain the classification of emulsion with example
03.*** what is catalysis ? How is catalysis classified ? Give two examples for each
04.*** what are micelles? Discuss the mechanism of micelle formation and cleaning action of soap
05.*** How are colloids classified on the basis of interaction between dispersed phase and dispersion
medium
06.*** Name the dispersed phase and dispersion medium in the following colloidal systems
i. fog ii. smoke iii. milk iv. cloud v. blood vi. gold sol.
07.*** write any four enzyme catalysed reactions
08.*** what is coagulation ?explain with suitable example
09.** what are colloidal solutions ? how are they classified? give examples
10.** explain the following terms
a. electrophoresis b. coagulation c. tyndall effect
11.* what is an adsorption isotherm? discuss the phenomenon of adsorption of gases on solids with
the help of freundlich adsorption isotherm
VERY SHORT ANSWER QUESTIONS (2M)
01. What is emulsifying agent? give one example
02. what is gold number
03. what is the general difference between soap and detergent chemically
04. what is auto catalysis ? give one example
05. what is tyndal effect
06. what is Brownian movement
07 what is protective colloid
08. what is Hard- schulze’s law
09. what is adsorption? give two application
10. why is adsorption always exothermic
11. Define ‘promoters’ and ‘ poisons’ in the phenomenon of catalysis
12. easily liquefiable gases are readily adsorbed on solids . why
13. why zeolites are treated as shape selective catalysts
14. what is critical micelle concentration (CMC) and kraft temperature (Tk )
15. what is peptization and dialysis
16. what is electrokinectic potential or zeta potential
17. sky appears blue in colour. explain
18. what is electro osmosis and electrophoresis
19. Define flocculation value
20. Define occulusion
6. GENERAL PRINCIPLES OF METALLURGY
SHORT ANSWER QUESTIONS (4M)
01.*** Giving examples to differentiate roasting and calcinations
02.*** explain the purification of sulphide ore by froth floatation method
03.*** write down the chemical reactions taking place in different zones in the blast furnace during
the extraction of iron
04.*** Outline the principles of refining of metals by the following methods
a. zone refining b. electrolytic refining c. poling d. vapour phase refining
05.** How is copper extracted from copper pyrites
06.* write down the chemical reactions taking place in the extraction of zinc from zinc blende
07.* explain electrometallury with an example
08.* explain briefly the extraction of aluminum from bauxite
09.* explain the process of leaching of alumina from bauxite
VERY SHORT ANSWER QUESTIONS (2M)
01. What is the role of depresent in froth floatation?
02. Name the common elements present in the anode mud in the eletrolytic refining of copper.
03. What is the difference between a mineral and an ore?
04. Give the composition of the following alloys.(Mar-17,19AP&TS, 18 A.P)(May-16T.S)
A) Brass B) Bronze C) German silver
05. Explain the terms gangue and slag.
06. Write any two ores with formulae of the following metals: (May-14)
A) Aluminium B) Zinc C) Iron D) Copper
07. What is matte? Give its composition.
08. What is blister copper? Why is it so called? (Mar-18T.S)
09. What is flux? Give an example.
10. Describe a method for the refining of nickel.
11. State the role of silica in the metallurgy of copper (May-14)
12. What is the role of graphite rod in the electrometallurgy of aluminium?
13. What is the role of cryolite rod in the metallurgy of aluminium? (Mar-15&16 T.S&A.P)
14. What is poling? (Mar-16 A.P)
6. p-BLOCK ELEMENTS
LONG ANSWER QUESTIONS(8M)
GROUP 15 ELEMENTS
***1. How is ammonia manufactured by Haber’s process? Explain the reactions of ammonia with
(a) ZnSO4(oq) (b) CuSO4(oq) (c) AgCl(s) (Mar-17TS.18 AP)(May-15 A.P)
***2. Write the important reactions involved in the manufacture of sulphuric acid by’ contact process.
(Mar-18T.S)
***3. How is nitric acid manufactured by Ostwald’s process? Hoe dose it react with the following ?
(mar-17 A.P&19T.S)
(a) Copper (b) Zn (c) S8 (d) P4
 GROUP 16 ELEMENTS
***4. How is ozone prepared from oxygen? Explain it’s reaction with(Mar-17,18,19 A.P)(Mar&May-16A.P)
(a) C2H4 (b) Kl (c) Hg (d) PbS (e) Ag
***5. Explain in detail the manufacture of sulphuric acid by contact process.
(Mar-16&May-15 T.S)
GROUP 17 ELEMENTS
***6. How is chlorine prepared in the laboratory or Deacon’s method? How does it react with the following ?
(Mar-15,18,19 T.S)
(a) Iron (b) NaOH (c) Acidified FeSO4 (d) Iodine (e) H2S
(f) Na2S2O3 (Mar-16 T.S) (g) Excess NH3 (h) Ca(OH)2
***7. How is chlorine prepared by electrolytic method? Explain it’s reaction with
(Mat-14) (Mar-15,16 A.P)
(a) NaOH (b) NH3 under different conditions (Mar-16 T.S) (c) Nal (d) Slaked lime
GROUP 18 ELEMENTS
***8. How are XeF2, XeF4, and XeF6 prepared? Explain their reaction with water?
Discuss their structures

SHORT ANSWER QUESTION (4M)

GROUP 15 ELEMENTS
1*** What is allotropy? Explain the difference allotropic forms of phosphorus?
2*** How dose PCl5 react with the following?
(a) Water (b) C2H5OH (c) CH3COOH (d) Ag
3** How dose P4 react with the following ?
(a) SOCl2 (b) SO2Cl2
4** Complete the following reactions
(a) Ca3P2 + H2O→ (b) P4 + KOH→
(b) HNO3 + P4O10→ (d) Mg + N2→
∆
(e) (NH4)2 Cr2O7→ (f) Decomposition of nitrous acid
5** Complete the following
∆
(a) NH4NO3→
673𝑘
(b) HNO3 + P4O10→ (c) Pb(NO3)2→
(c) Zn + dil HNO3→ (e) P4 + Conc. HNO3→ (f) HgCl2 + PH3→

GROUP 16 ELEMENTS
6*** Write a short note on the allotropy of sulphur

7*** Which oxide of sulphur can act as both oxidizing and reducing agent? Give one example each

8*** Write the structures of oxoacids of sulphur (Mar-16 T.S)

9** Explain the structures of SF4and SF6

10** How dose so2 react with the following?
(a) Na2SO3(aq) (b) Cl2 (c) Fe-3ions (d) KMnO4
11** Complete the following
𝐶𝑜𝑛𝑐.𝐻2 𝑆𝑂2
(a) KCl + H2SO4(conc)→ (b) Sucrose→
 (b) Cu+H2SO2(conc)→ (d) C+ H2SO4(conc)→
12** Describe the structures of SO-24 and SO3
GROUP 17 ELEMENTS
13*** How can you prepare Cl2 from HCl and HCl from Cl2 ? Write the reactions? (May-16 A.p)
14*** Explain the structures of (a) BrF5 (b) IF7?
15*** Write balanced equations for the following ? (May-14)
(a) NaCl is heated with conc H2SO4 in the presence of MnO2
(b) Chlorine is passed into a solution of NaI in water
16*** What are interhalogen compounds ? Give some exampels to illustrate the definition how are they classified ?
17*** Give the preparation of chlorine by Deacon’s process. How does it react with hyposolution(Na2S2O3)
(Mar&May-16 T.S)
18** Write the names and formulae of the oxoacids of chlorine explain their structures and relative acidic nature
19** How is ClF3 prepared ? How dose it react with water ? Explain it’s structure?
20** Compare the bleaching action of Cl2 and SO2
21** Write a short note on hydrides of halogens?
GROUP 18 ELEMENTS
22*** How are XeF2 and XeF4 are prepared ? Give their structure. (Mar-17,18 T.S, 19 A.P)
23*** How are XeO3 and XeOF4 prepared? Give their structure? (May-14)
24*** Explain the structure of a) XeF6 b) XeOF4
25*** Explain the reaction of the following with water a) XeF2 b) XeF4 c) XeF6
26*** Complete the following
a) XeF2+H2O→ b) XeF2+PF5→
b) XeF4+SbF5→ d) XeF6+AsF5→
c) XeF4+O2F2→ e) NaF+XeF6
VERY SHORT ANSWER QUESTIONS (2M)
GROUP 15 ELEMENTS
1. Why does the reactivity of nitrogen differ from phosphorus?
2. Nitrogen exists as diatomic molecule and phosphorus as p4-why? (Mar-15 T.S)
3. Nitrogen molecule is highly stable- why? (May-14)
4. Why are the compounds of bismuth more stable in +3 oxidation state?
5. What is inert pair affect?
6. Arrange the hydrides of group-15 elements in the decreasing order of basic strength and increasing
order of reducing character?
7. What happens when white phosphorus is heated with conc. NaOH solution in an inert atmosphere of
CO2?
(Mar-15 A.P)(May-16 T.S)
8. NH3 forms hydrogen bonds but PH3 does not-why? (May-15 A.P)
9. How do calciumphosphide and heavy water react?
10. Ammonia is a good complexing agent explain with an example? (Mar-14)
11. A mixtrue of Ca3P2 and CaC2is used in making Holme’ssignal-explain? (Mar&May-17 A.P)
12. Which chemical compounds is formed in the brown ring test of nitrate ions?
13. How is nitric oxied (No) prepared?
14. No is paramagnetic in gaseous state but diamagnetic in liquid and soild states why?
15. PCl3 can act as oxidizing as well as reducing agent-justify?
16. Which of the following is more covalent- SbCl5 (or) SbCl3?
17. Write the chemical reactions that occur in the manufacture of nitric acid?
18. Iron becomes passive in conc. HNO3 why? (Mar-15 T.S)
19. Give the uses of (a) Nitric acid (b) Ammonia?
20. Give the disproportionation reacting of H3PO3?
21. Draw the structures of (a) Hypo phosphoric acid (b) cyclic meta phosphoric acid?
22. Are all the five bonds in PCl5 molecule equivalent? Justify Your answer.(Mar-16 A.P)
23. What are the Neutral oxides of Nitrogen?
24. What is laughing gas? Why it is so called?
25. Give the disproportionation reaction of phosporous acid?
26. Draw the structures of PCl5 (May-15 A.P)
27. PH3 has lower boiling point than NH3 why? (Mar-16 T.S)
28. What is allotropy? Write any two alltropes of phosphorus. (May-16 T.S)
29. What happens when white phosphorus is heated with concentrated NaOH solution in an inert
atmosphere of CO2. (Mar-19 A.P)
GROUP I6 ELEMENTS
30. Why is dioxygen a gas but sulphur a soild?
31. What happens when
a) And SKClO3 is heated with MnO2 b) O3 is passed through KI solution
32. Give to examples each for amphoteric oxides and neutral oxides? (May-15 T.S)
33. Why is H2O a liquid while H2S is a gas (May-14)
34. H2O is neutral while H2S is acidic-explain (May-15 T.S)(Mar-16 T.S)
35. Name the most abundant element present in earth’s crust. (May-16 A.P)

36. Give the hybridization of sulphur in the following.

a) SO2 b) SO3 c) SF4 d) SF6
37. Write the names and formula of any two oxyacids of sulphur. Indicate the oxidation state of sulphur in
them.
38. Give one example each for
a) Neutral oxide b) peroxied c) super oxide
39. What is tailing of mercury? How is it removed? (Mar-15 T.S & A.P)
40. SO2 can be used as an anit-chlor. Explain
41. How dose ozone react with ethylene?
42. Out of O2 and O3, which is paramagnetic?
43. Write any two uses each for O3 and H2SO4. (Mar-16 T.S)
44. Why are group-16 elements called chalcogens?
45. Draw the structures of S8 and S6
46. Write the structures of oxoacids and sulphur. (Mar-16 T.S)

GROUP 17 ELEMENTS
47. Which halogen produces O2 and O3 on passing through water?
48. What is the use of ClF3?
49. Why are halogens colourd?
50. Write the reaction of “F2” and “Cl2” with water? (Mar-14,17 T.S)
-
51. With which neutral molecule, ClO is isoelectronic? Is that molecule a lewis base?
52. Electron gain enthalpy of fluorine(F2) is less than that of Cl2-explain?
53. HF is a liquid while HCl is a gas explain?
54. Bond dissociation enthaipy of “F2” is less than that of “Cl2” -explain?
55. Write two uses of hydrogen chloride?
56. Chlorine acts as an oxidising agent-explain with two examples? (May-15 A.P)
57. What is aqua regia? Write it’s reaction With gold and platinum?
58. How is chlorine manufactured by Deacon’s method? (Mar-16,17 T.S, 19 A.P)
59. Chlorine acts as a bleaching agent only in the presence of moisture explain?
60. The decreasing order of acidic character among hypohalous acids is
61. Give the oxidation state of the halogen in the following
a) Cl2O b) ClO2- c) KBrO3 d) NaClO4 (May-15 T.S)
62. What happens when Cl2 reacts with dry slaked lime? (Mar-18 T.S)

GROUP 18 ELEMENTS
63. Why do noble gases have comparatively large atomic sizes?
64. List out the uses of neon? (Mar-18 A.P)
65. In modern diving apparatus, a mixture of He & O2 is used - why? (Mar-16 A.P)
66. Noble gases are inert. Explain?
67. Write the name & formula of the first noble gas compound prepared by Bertlett?
68. Explain the shape of XeF4 on the basis of VSEPR theory? (Mar-18 A.P)
69. Why do noble gases from compounds with Fluorine and Oxygen only?
70. How is XeF4 prepared? Describe its molecular shape? (Mar-17 T.S)
71. Give any to uses of Helium?
72. Give any two uses of Argon?
73. Write the shapes of XeO3 and XeF2? (May-16 T.S&A.P)
74. Mention the shape and draw a diagram of XeO3 (Mar-16T.S)

7.d & f-BLOCK ELEMENTS & CO-ORDINATION COMPOUNDS

SHORT ANSWER QUESTIONS (4M)
1*** Explain Werner’s theory of coordination compounds with suitable examples. (Mar-18 A.P)
(Mar-11,14 June-10)(Mar-15 T.S, 17 A.P)(May-16A.P)
2*** Write the characteristic properties of transition elements(Mar-15A.P) (May-09)(May-16T.S)
3*** Using IUPAC names write the formulae for the following. (Mar-17T.S)(May-12)
(I) Tetrahydroxozincate(II) (ii) Hexaamminecobalt(III)sulphate
(iii) potassium tetrachloropalladate(II)and (iv) potassium tri(oxalato) chromate(III)
4*** Using IUPAC names write the systematic names of the following: (Mar-19 A.P, T.S)
(i) [Co(NH3)6]Cl3 (ii) [pt(NH3)2Cl(NH2CH3)]Cl (iii) [Ti(H2O)6]3+
(iv) K2[pdCl4] (v) K3[Fe(CN)6] (vi) Fe4[Fe(CN)6]3 (vii) [Ni(CO)4](Mar-17 T.S)
5*** Explain geometrical isomerism in coordination compounds giving suitable examples.
6*** What is lanthanoid contraction? What are the consequences of lanthanoid contraction?
7** What is spectro chemical series? Explain the difference between a weak field ligand and a strong field
ligand.
8** Explain the applications of co-ordination compounds in different fields.
9** What is meant by chelate effect? Give example.
10** Explain the terms (i) Ligand (ii) Coordination number (iii) Coordination entity (iv) Central metal atom/ion
11** Why do the transition metal ions exhibit Characteristic colours in a aqueous solutions explain giving
examples
12** Use Hund’s rule to derive the electronic configuration of Ce3+ ion and calculation its magnetic moment
on the basic of ‘spin-only’ formula.
13** Predict which of the ions Cu+, Sc3+, Mn2-, Fe2- are coloured in aqueous solution? Give reasons.
14** Write a short note on metal carbonyls.
15** Account for the zero oxidation state of Ni and Fe in [Ni(CO)4] and [Fe(CO)5] respectively.
16** What are homoleptic and heteroleptic complexes? Give one example for each
VERY SHORT ANSWER QUESTIONS (2M)
1. CuSO4.5H2O is blue in colour where as anhydrous CuSO4 is colourless. Why? (Mar-14)
2. How many moles of AgCl is precipitated when I mole of CoCl3.5NH3 is treated with AgNO3 solution?
3. [Cr(NH3)6]3+ is paramagnetic while [Ni(CN)4]2- is diamagnetic. Why?
4. [Fe(CN)4]2- and [Fe(H2O)6]2- are of different colours in dilute solutions. Why?
5. Calculate the ‘spin only’ magnetic moment of Fe2-(pq) ion. (Mar-17 A.P)
6. Among the first transition series (3d series) Chromium has highest melting point.why?
7. What is an alloy? Give example. (Mar-16 A.P)
8. What is an alloy? Give example.
9. What are coordination compounds? Give two examples.
10. What is the difference between a double salt and a complex compound?
11. What is a ligand? Give one example for unidentate ligand. (Mar-18 T.S)
12. Why do transition elements exhibits characteristic properties.
13. In its fluoride (or) oxide, in which a transition metal exhibits highest oxidation state and Why?
14. What is the oxidation state of cobalt in K[Co(CO)4] and [Co(NH3)6]3+?
15. Write the electronic configuration of chromium (Cr) and copper (Cu)
16. What is a chelate ligand? Give example.
17. What are complex compounds? Give examples.
18. Silver atom has completely filled d orbitals (4d10) in its ground state. How can you say that it is a
transition element?
19. Why Zn2- is diamagnetic where as Mn2+ is paramagnetic? (Mar-15T.S, 18 A.P)
2+ 2+
20. Aqueous Cu ions are blue in colour where as aqueous Zn ions are colourless. Why?
(Mar-16 T.S)(May-16 A.P)

21. How do transition metals exhibit catalytic activity?

22. Give two reactions in which transition metals (or) their compounds acts as catalysts.(Mar-17 T.S)
23. Why do the transition metals readily forms alloys?
24. What is misch-metal give its composition and uses (Mar-16,19 A.P)
25. Why do transition elements exhibt more than one oxidation state (variable oxidation states)
26. Give one example each for ionic and neutral ligands
27. What is lanthanoid contraction? (Mar-19T.S)(May-16 T.S)
28. Scandium is a transition element? But Zinc is not why? (May-14)
29. Using IUPAC norms, Write the systematic names of the following.
(i) K4[Fe(CN)6] (ii) [Cu(NH3)4]SO4
30. What is wilkinson catalyst and give its importance?
31. What is EDTA and give its importance?
32. Calculation the Magnetic moment of a divalent ion aqueous solution if its atomic number is 25?
(Mar-16A.P)
8.POLYMERS
VERY SHORT ANSWER QUESTIONS (2M)
1. Mention the type of polymerization in volved in the formation of the following polymers (Mar07,09,2014)
A) Bakelite B) PVC C) Polyethene D) Teflon
2. What is polymerisation? Give an example of a polymerization reaction. (Mar-14)
3. What is PHBV? How is it useful to man?(Mar-18 T.S)(Mar-15,16 T.S&19 A.P)(May-16 T.S)
4. Define an elastomer.
5. Mention the structures and names of the monomers used for preparing the following polymers.
A) Bakelite B) Poly styrene C) Teflon D) Poly vinyl chloride
E) Nylon-6.6 F) Glyptal G) Terylene (Mar-15 & 16 A.P)
6. What is vulcanization. (Mar-17 A.P, 19 T.S)(Mar&May-16 T.S)
7. What do you mean by polydispersity index? (Mar-19 A.P)
8. What is Bio-degradable polymer? Give two examples. (Mar-18 A.P)
9. Write the names and structures of the monomers of the following polymers (May-16 A.P)
(i) Buna-S (ii) Buna-N (iii) Dacron (iv) Neoprene.
10. What is an addition polymer? Give an example of an addition polymer. (Mar-15 T.S)
11. What is cross linking agent used in vulcanization.
12. Is [-HN.CHR-CO-]n a homopolymer or a copolymer?
13. Give two example example for Semi-Synthetic polymers?
14. What is Ziegler-natta catalyst? (Mar-19 T.S)
15. Give the structure of Nylon-2-Nylon-6
16. What are the monomer repeating units of Nylon-6 and Nylon-6,6. (Mar-16 A.P)
17. Name the different types of molecular masses of polymers.
18. What is the difference between Buna-N and Buna-S?
19. What are fibers? Give example
20. What are thermoplastic polymers? Give example.
21. What are thermosetting polymers? Give example.
22. What are copolymers? Give example. (May-14)
23. What are homopolymers? Give example.
24. What are monomers? Give example. (May-14)
25. Explain natural of synthetic polymers(rubbers)mension their monomers.(Mar-15,16 A.P & T.S)
26. What are the monomers present in the Nylon 2-nylon-6. (Mar-15 T.S)
BIOMOLECULES

SHORT ANSWER QUESTIONS (4M)

***1. Give the sources of the following vitamins and name the diseases caused by their deficiency.
a) A b) D c) E and d) K
(Mar-15 T.S & A.P)(Mar-16,17 A.P & T.S)
***2. What are hormones? Give one example for each. (Mar-18,19 A.P&T.S)(May-16 T.S&A.P)
i) Steroid hormones (ii) Poly peptide hormones and iii) Amino acid derivatives.
***3. Write notes on vitamins. (May-11)
***4. Write notes on the functions of different hormones in the body. (May-10,12)
**5. Explain the denaturation with suitable examples. (Mar-16 T.S)
**6. What are enzymes? Give examples.
**7. Explain the classification of carbohydrates.
**8. Write the importance of carbohydrates.
*9. Discuss the structure of glucose on the basis of its chemical properties.
*10. What is the DNA finger printing, mention its applications.

VERY SHORT ANSWER QUESTIONS (2M)

1. Name the vitamin responsible for the coagulation of blood. (Mar-09)
2. Why are vitamin A and vitamin C essential to us? Give their important sources.(May-09,Mar-10)
3. Define carbohydrates?
4. What are anomers?
5. What is Z witter ion? Give an example.
6. What are essential and non-essential amino acids? Give one example for each. (Mar-16 T.S)
7. Why cannot vitamin C be stored in our body?
8. What is the different between nucleoside and nucleotide?
9. Name the different types of carbohydrates on the basics of their hydrolysis. Give one example for each.
10. What do you understand from the names (a) aldo pentose and (b) Keto heptose?
11. Why are sugars classified as reducing and non reducing sugars?
12. What do you understand by invet sugars?
13. What type of bonding helps in stabilizing the a-helix structure of proteins?
14. Temperature and pH effect the native proteins. Explain.
15. What are amino acids? Give to examples
16. What are proteins? Give an examples.
17. What is fibrous proteins? Give examples.
18. What are globular proteins? Give examples.
19. Write the names of three types of RNA.
20. Write the biological functions of nucleic acids.
21. What is glycogen? How is it different from starch.
22. What are the hydrolysis products of (i) sucrose and (ii) lactose
23. What is the basic structural difference between starch and cellulose.
24. What is denaturation? Give an example.
25. Write any one method of preparation of glucose. Write the equation.
CHEMISTRY IN EVERYDAY LIFE
VERY SHORT ANSWER QUESTIONS (2M)
1. What are antibiotics? Give example. (Mar-16,18A.P T.S)
2. What are the antiseptics? Give example. (Mar-15,19 T.S & A.P T.S)
3. What are anitifertility drugs? Give example
4. What are artificial sweetening agents? Give example. (Mar-15A.P)(Mar-16T.S)(Mar&May-16A.P)
5. What are analgesics? How are they classified? Give one example for each.(Mar-18 T.S, 19A.P)
6. What are non-Narcotic analgesics? Give example
7. What are antacids? Give example.(Mar-15 T.S)(Mar-14)(May-14)(May-16 T.s & A.P)
8. What are antihistamines ? Give example. (May-14)
9. What are tranquilizers? Give example. (May-16T.S)
10. What are narcotic analgesics? Give example.
11. What are antimicrobials?
12. What are disinfectants? Give example. (Mar-15T.S,17A.P&T.S)
13. What are the main constituents of dottol?
14. What is tincture of iodine ? What is its use?
15. What are food preservatives? Give example. (Mar-16 T.S,17A.P)
16. Name two most familiar antioxidants used as food additives.?
17. What is the difference between a soap and a synthetic detergent? (Mar-
14,18A.P)
18. Name the macromolecules that are choosen as drug targets?

9.HALOALKANES AND HALOARENES

LONG ANSWER QUESTIONS (8M)
***1. Write the reactions showing the major and minor products when chlorobenzene is reacted
With CH3Cl and CH3COCl in presence of AlCl3.
***2. Explain the mechanism of Nucleophilic bimolecular substitution SN2 reaction with one example.
***3. Explain the mechanism of Nucleophilic unimolecular substitution SN1 reaction with one example.
***4. Define the following:
(i) Racemic mixture (ii) Retention of configuration (iii) Enantiomers (iv) Recemisation
**5. Write the mechanism of dehydro halogention of 2-bromobutane?
**6. Account for the following statements:
1) Arylhalides are extremely less reactive to wards Nucleophilic substitution reactions.
2) P-Nitrochlorobenzene and o,p-dinitrochlorobenzene undergo Nucleophilic substitution readily
compared to chlorobenzene.
**7. Explain how the following conversions are carried out:
1) Propene to propanol 2) Ethanol to but -1-yne 3) 1-Bromopropane to Bromopropane
**8. Name the following halides according to IUPAC system and classify them as primary, secondary,
tertiary, vinyl or aryl halides.
(i) CH3CH(CH3)CH(Br)CH3 (iii) m-ClCH2C6H4CH2C(CH3)3
(ii) CH3C(Cl)(C2H5)CH2CH3 (iv) o-Br-C6H4CH(CH3)CH2CH3
HALOALKANES AND HALOARENES
SHORT ANSWER QUESTIONS (4M)
1 2
***1. Explain SN & SN reactions (Mar-14,15,16T.S,18 A.P&T.S)
***2. Predict the alkenes that wouid be formed in the following reactions and identify the major alkene

𝑁𝑎𝑂𝐸𝑡
ii) 2-Chloro -2-methyl butane 𝐸𝑡𝑂𝐻
→?
***3. How will u carry out the following conversions?
1) Ethane to bromoethene
2) Toluene to benzyl alcohol
***4. What is the criteria for optical activity? Give two examples of chiral molecules?
***5. Write the mechanism of the following reaction
𝐸𝑡𝑜𝐻,𝐻2 𝑂
n-Butylbromide + KCN→ 𝑛-butylcyanide
*6. Ahydro carbon C5H10 does not react with chlorine in dark but gives a single monochloro compund C5H9CL in
bright sun light identify the hydrocarbon.
*7. Explain why the dipolemoment of chlorobenzene is lower than that of cyclohexylchloride.
VERY SHORT ANSWER QUESTIONS (2M)
1. What are the ambident nucloephiles? (Mar-17 T.S)(May-16 A.P)
1 2
2. What is the stereochemical result of 𝑆⋀ and 𝑆⋀ reactions? (Mar-17T.S)
3. What type of isomerism is exhibited by o, m, and p-chlorobenzenes ?
4. Write the isomers of the compound having molecular formula C4H9Br.
5. What are Enantiomers? (May-14,16A.P, 19 T.s)
6. Write the structures of the following compounds.
i) 2-chloro-3-methylpentance ii) 1-Bromo-4-sec-buty1-2-methylbenzene
7. Which one of the following has highest dipole moment?
i) CH2Cl2 ii) CHCl3 iii) CCl4
8. Which compound in each of the following pairs will react faster in SN2 reaction with OH-?
i) CH3Br or CH3l (ii) (CH3)3 CCl or CH3Cl (Mar-19A.P)
9. Explain why the alky halides though polar are immiscible with water?
10. Out of C6H5CH2Cl and C6H5CHClC6H5 which is more easily hydrolysed by aqueous KOH?
11. Treatment of alkylides with aq. KOH leads to the formation of alcohols, while in presence of alc.KOH what
products are formed?
12. Find the A & B products in the following reactions (Mar-15 T.S)
𝑀𝑔 𝐻2 𝑂
CH3CH2Cl 𝑒𝑡ℎ𝑒𝑟 →A → B
13. Write the strutures of the following compounds. (Mar-15A.P)(May-16T.S)
i) 2-chloro-3-methyl pentane.
ii) P-bromo chloro benzene.
14. What is wurtz reaction? Write an example.
10.ORGANIC COMPOUNDS CONTAINING C, H & O
ALCOHOLS, PHENOLS AND ETHERS
LONG ANSWER QUESTIONS(8M)
***1. Explain why(i) Ortho nitrophenol is more acidic then orthon methoxyphenol. (ii) OH group attached to benzene
ring activates it to wards elecrtophilic substitution.
***2. With a suitable example write equations for the following: (Mar-17 A.P)
(i) Kolbe’s reaction (ii) Reimer-Tiemann reaction. (iii) Williamsons ether synthesis.
***3. Write equations of the below given reactions :
(i) Alkylation of anisole (ii) Nitration of anisole (iii) Friedel-Crafts acetylation of anisole
***4. (a) Write any two methods of preparation of phenol.
(c) Explain the acidic nature of phenols and compare with that of aicohol.
SHORT ANSWER QUESTIONS (4M)
***1. Write the mechains of hydration of ethene to yield ethanol.
***2. Explain the acidic nature of phenols and compare with that of alcohols. (Mar-17 A.P)
***3. illustrate hydroboration-oxidation reaction with a suitable example.
***4. Write the products formed by the reduction and oxidation of phenol. (May-14)
***5. Write the equations for the preparation of phenol using benzene, conc. H2SO4 and NaOH. (Mar-14)
***6. Ethanol with H2SO4 at 443K forms ethane while at 413K it forms ethoxyethane. Explain the mechanism.
***7. Write the structures of the following compounds whose IUPAC names are (May-14)
(i) 2-methylbutan-1-oI, (ii) 2,3-diethylpenol, (iii) 1-ethoxypropane, (iv) cyclohexylmethanol

VERY SHORT ANSWER QUESTIONS(2M)

1. Compare the acidic strength of acetic acid, chloroacetic acid, benzoic acid and phenol. (Mar-14)
2. Explain why propanol has higher boiling point than that of the hydrocarbon-butane.
3. Alocohols are comparatively more solube in water than hydrocarbons of comparable molecular masses.
Explain this fact.
4. Given the reagents used for the preparation of phenol from chlorobenzene.
5. Name the reagents used in the following reactions.
(i) Oxidation of primary alcohol to carboxylic acid
(ii) Oxidation of primary alcohol to aldehyde
6. Write the equations for the following reactions.
(i) Bromination of phenol to 2,4,6-tribromophenol
(ii) Benzyl alcohol to benzoic acid.
ALDEHYDES, KETONES & CARBOXYLIC ACID
LONG ANSWER QUESTIONS(8M)
***1. Describe the following (Mar-15 T.S & A.P)
1. Acetylation 2. Cannizaro reaction 3. Crossed aldol condensation 4. Decarboxylation
5. Aldol condensation
***2. Explain the following terms. Give an explain of the reaction in each case.
1. Cyanohydrin 2. Acetal 3. Semicarbazone 4. Aldol 5. Hemiacetal 6.Oxime
***3. How are the following conversions carried in not more than two steps.
1. Ethanol to 3-hydroxybutanal
2. Bromobenzene 1-Phenylethanol
3. Benzaldehyde to ± Hydroxyphenylacetic acid
4. Benzaldehyde to benzophenone
ALDEHYDES, KETONES & CARBOXYLIC ACIDS
SHORT ANSWER QUESTIONS(4M)
***1. Explain the role of electron with drawing and electron releasing groups on the acidity of carboxylic
acids.
***2. Arrange the following in the increasing order of their acidic strength: Benzoic acid, 4-Methoxybenzoic
acid, 4-Nitrobenzoic acid and 4-Methylbenzoic acid.
***3. Write the equations of any aldehyde with Fehlings reagent.
***4. What is Tollens reagent? Explain its reaction With Aldehydes.
***5. Explain the following reactions (Mar-15 A.P)
(i) Reimer-Tiemann reaction
(ii) Williamson’s ether synthesis
VERY SHORT ANSWER QUESTIONS(2M)
1. Arrange the following compounds in increasing order of their property indicated.
I. Acetaldehyde, Acetone, Methylt.butyl ketone reactivity to wards. HCN
 II. Floroacetic acid monochloroacetic acid, Acetic acid and Dichloroacetic acid(Acid strength)
2. Write the reaction showing α-halogenation of carboxylic acid and gives its name.
3. How do you distinguish acetophenone and benzophenone?
4. Explain the position of electrophilic substitution in benzoic acid.
5. Write equations showing the conversion of -
1. Acetic acid to Acetyl chloride
2. Benzoic acid to Benzamide
6. Write the mechanism of esterification.
11 ORGANIC COMPOUNDS CONTAINING NITROGEN
LONG ANSWER QUESTIONS(8M)
***1. Complete the following conversions Aniline to
i) Fluorobenzene ii) Cyanobenzene iii) Benzene and iv) phenol

***2. Explain the following named reactions: (Mar-17 T.S(VSAQ)

i) Sandmeyer reaction ii) Gatterman reaction.

***3. Complete the following conversions

i) CH3NC + HgO → ?
ii) ? + 2H2O → CH3NH3 + HCOOH
𝐻2 𝑂4
iii) CH3CN + C2H5MgBr→ ? → ?
ℎ𝑒𝑎𝑡
iv) CH3CH2NH2 + CHCl3 + KOH → ?
v)
NH2+3Br2 →?

SHORT ANSWER QUESTIONS(4M)

**1. How do you prepare ehtyl cyanide and Ethyl isocyanide from a common alkylhalide?

(May-14,16 A.P)

***2. Explain the following (Mar-14) (Mar-15T.S)

A) Diazotisation B) Carbylamine reaction

***3. How do you prepare the following

i) N,N-dimethylpropanamine from Ammonia, (ii) Propanamine from chloroethane

***4. How do you carryout the following conversations?

i) N-ethylamic to N,N-diethylpropanamine, (ii) Aniline to Benzenesulphonamide

***5. Explain the following:

 i) PKb of aniline is more than that of methylamine.

ii) Reduction of alkyylcyanide froms primary amine whereas alkyl isocyanide forms secondary
amine.

**6. Compare the basiccity of the following in gaseous and in aqueous state and arrange them in
increasing order of basicity. CH3NH2, (CH3)2 NH, (CH3)3 N and NH3.

**7. Write the IUPAC names of the following compounds

i) CH3CH2NHCH2CH2CH3 (ii) phCH2CN

NH2 CH2NC

iii) iv)
Br Br

*8. Write the equation involved in the reaction of Nitrous acid with Ethylamine and aniline.
*9. Explain with equations how methylamine, N,N-dimethylamine and N,N,N-trimethylamine
react with benzenesulphonyl chloride and how this reactions is useful to separate these
amines.
*10. Write the steps involved in the coupling of benzene diazonium chloride with aniline and
phenol.
VERY SHORT ANSWER QUESTIONS(2M)
1. Write equations for carbylamine reaction of any one aliphatic amine. (Mar-14,18 T.S)
2. What is Diazotisation. (Mar-14)
3. Explain why ethylamine is more solube in water whereas aniline is not soluble.
4. Garbriel phthalimide synthesis exclusively forms primary amines only Explain?
5. Give structures of A, B and C in the following reaction. (Mar-17 T.S)
𝐶𝑢𝐶𝑁 𝐻2 𝑂/𝐻 − 𝑁𝐻3 ,∆
C6H5N2Cl→ A→ B→ C
6. How do you carryout the following conversions:
i) Benzoic acid to Benzamide, ii) Aniline to p-bromo aniline (Mar-14)
7. Arrange the following bases in decresing order of Pkb values. (Mar-15,19 T.S)
C6H5NH2, C6H5NHCH3, C2H5NH2 and (C6H5)2NH
8. How is nitrobenzene converted in to Aniline? (Mar-16 TS)
9. Explain the reaction of Aniline with nitrous acid (Diazotisation) (Mar-18 T.S)
LIST OF NAMED REACTIONS:
01. Grignard Reaction (Mar-19 T.S)
***02. SN1 & SN2 Reactions
***03. Aidol condensation (Mar-18 A.P& May-16 T.S &
AP)
***04. Cross AIdol condensation (Mar-17 TS, 19 AP)
***05. Cannizaro’s Reactions (May-16 T.S)(Mar-16,18 A.P, 19 A.P &T.S)
06. Clemmensen’s reactions
07. Wolff-kishner reduction
 ***08. Carbylamine Reaction (Mar-19T.S)(Mar-16 T.S &A.P)
***09. Reimer- Tiemann reaction (mar-19T.S)(Mar 18 A.P & May -16 A.P)
***10. Esterification (Mar-16 T.S)
***11. Sandmeyer Reaction (May-16 T.S)(Mar-16,18 A.P)
***12. Gattermann Reaction
***13. Williamson’s Ether synthesis (Mar-19 T.S)(Mar & May-16 T.S & A.P)
***14. Decarboxylation (Mar-19 A.P)(Mar-17 T.S)(Mar&May-16A.p)
***15. H.V.Z. Reaction (Mar -16 T.S)
***16. Diazotisation (Mar-16 T.S)
***17. Wurtz- fitting Reaction
18. Fitting Reaction
19. Wurtz Reaction
***20. Kolbe’s Reaction (Mar-16,19 T.S)
21. Hoffimann Bromamide degradation Reaction
22. Acetylation (Mar-19 A.P)
IMPORTANT LONG ANSWER QUESTIONS FORM ORGANIC CHEMISTRY
***01. Explain the following with one example (Mar-16 T.S)
a) Williamson’s synthesis (Mar-18 T.S)
b) Kolbe’s reaction (Mar-18 T.S)
c) Hell-volhard-zelinsky(HVZ) reaction (Mar-18 T.S)
d) Aldol condensation
***02. Explain the following (Mar-16 T.S)
a)Aldol condensation
b) Esterification
c) Williamson’s synthesis
d) cannizzaro reaction
***03. Explain the following with suitable example
a) SN1 & SN2 reactions (Mar-16 T.S)
b) Reimer tjemann reactions (Mar-18 T.S)
c) Sandmeyer reaction (Mar-16 T.S)
d) Gattermann reaction
***04. Explain the following
a) Carbylamine reaction
b) Diazotisation reaction (Mar-16 T.S)
c) Wurtz reaction
d) cross aldol condensation