Control Syste1
Control Syste1
Definition of Terms
System- combination or arrangement of a number of different physical components to form a whole unit
such that it performs to achieve a certain goal.
Control- command,regulateor direct a system.
Plant/process- Part or component of a system that needs to be controlled.
Input-It is a signal or excitation supplied to the control system
Output-actual response obtained from control system
Controller- the part or component of the system that controls the plant.
Disturbance- The signal that has adverse effect on the performance of a control system.
Control system-
Actuator- A device that causes the process to provide the output. Provides the motive power to the
process.
Signal flow graph-A diagram that consists of nodes connected by several directed branches and is a
graphical representation of a set of linear relationship.
Specification- Is a set of prescribed performance criteria.
Open loop control system-it utilizes a device to control the process without using feedback hence the
output has no effect upon the signal to process.
closed loop control system-The system that uses measurement of the output and compares it with the
desired output.
Servo system- The control of any physical quantity e.g. position,velocity,displacement etc.
stability- If the system is able to follow the input command and unstable if its output is out of control.
Multivariable- A system with more than one input variable or more than one output variable.
Not accurate and reliable when input or system parameters are variable in nature
Recalibration of the parameters are required time to time
Linear relationship between control signal and motor speed over a wide range
Inertia of the motor should be as low as possible
Response should be high as possible
Easily reversible
Linear torque characteristics
Stable operation without any oscillations
DC SERVOMOTORS
Stator-field winding
Rotor- armature winding
Field controlled servo motor:
1. https://youtu.be/t_k7oRICmWo?list=PLBlnK6fEyqRineUwP-HPdkQvowXqq5IxA
2. https://youtu.be/iLSb89PK_ec?list=PLBlnK6fEyqRineUwP-HPdkQvowXqq5IxA
3. https://youtu.be/Aabq8t9EE1M?list=PLBlnK6fEyqRineUwP-HPdkQvowXqq5IxA
4. https://youtu.be/bk5Lmk-mr-I?list=PLBlnK6fEyqRineUwP-HPdkQvowXqq5IxA
5. https://youtu.be/T3AD4rxIJxI?list=PLBlnK6fEyqRineUwP-HPdkQvowXqq5IxA
6. https://youtu.be/plHIyNUvwiQ
process control
Process control refers to the methods and techniques used to monitor and regulate industrial
processes to ensure they operate efficiently, reliably, and consistently. It involves the
measurement of process variables, comparison of actual performance to desired targets or set
points, and adjustment of process parameters to maintain optimal operation. Process control is
essential for industries such as manufacturing, chemical processing, power generation, and
many others
Process characteristics
I. Process Load-Amount of the control agent that is needed the process in a balanced
condition.
II. Process Lag-Time taken for a control variable to reach a new value after the process load
change.
It can be caused using 3 properties
Capacitance-ability of a system to store energy i.e. high capacitance more time and
vice versa is true.
Resistance- (opposition to flow, thermal resistance)
Transportation/dead time-Time taken for a change to move from one place to
another in the process.
III. Stability –a system is said to be stable if the controlled can be returned to its steady
state value.
INDUSTRIAL CONTROLLERS
Uses of controllers
Amplification
Ensure the reference input is close as possible to the controlled output
Modes of controls
It’s how the acts in order to restore its system to a controlled value.
I. Two position
II. Floating
III. Proportional
IV. Integral mode (reset)
V. Derivative mode (rate or preset)
Neutral zone are set of values around zero on the error must pass
It supplies energy in pulses e.g. Iron box it supplies energy in pulses by switching ON
and OFF depending on the set temperature.
The pulses are called cycling or the control variable and the amplitude depends on:-
i. Capacitance of the process
ii. Dead time
iii. Size of load changes that the system can handle
The controller is simple and cheap and is always preferred if the cycling can be reduced
it acceptable limits levels. Examples are switch, iron box etc
II. Floating control
Is a special application of two position control in the final control element is always stationery as
long as the error is within the neutral zone but when the control variable goes beyond the
neutral zone the final control element changes at constant rate and is in the direction
determined by the sign of the error.
The final control element will continue to change until the error returns to neutral zone or until
the final control element reaches one of its extreme position either fully opened or fully closed
Just like two position it produces cycling. Advantage of this floating controller is that it has the
ability to handle large load changes done by adjusting final control element.
The proportional control cannot completely eliminate the error in the system hence there is
always an offset e.g. an electronic amplifier
Time domain equation
v=ke+vo
frequency domain equation
V=KE
Transfer function:
𝐕
=𝐊
𝐄
v=Time domain output signal & always given as a %
vo=Time domain output signal when e=0
V=Frequency domain output(laplas transform) vo is assumed to be zero
e=Time domain error signal
E=Frequency domain error signal
RF
𝐊=
R1
where:
RF=Out resistance in ohms
R1=input resistance in ohms
Terminologies used
1. Process Variables: These are the measurable quantities that characterize the state of
the process, such as temperature, pressure, flow rate, level, pH, concentration, etc.
2. Set points: Set points are the target values or desired levels for the process variables.
They are typically determined based on factors such as product specifications, quality
standards, safety requirements, and energy efficiency considerations.
3. Sensors: Sensors are used to measure the process variables in real-time. They provide
feedback to the control system, allowing it to monitor the current state of the process.
4. Controllers: Controllers are devices or software algorithms that receive input from
sensors, compare the measured process variables to the setpoints, and generate control
signals to adjust the process accordingly. Common types of controllers include
proportional-integral-derivative (PID) controllers, which use a combination of
proportional, integral, and derivative actions to achieve control objectives.
5. Actuators: Actuators are devices that receive control signals from the controller and
physically adjust process parameters to maintain the desired setpoints. Examples include
valves, motors, pumps, heaters, and cooling systems.
6. Control Strategies: There are various control strategies and techniques used in process
control, including feedback control, feedforward control, cascade control, ratio control,
and advanced control methods such as model predictive control (MPC) and adaptive
control.
7. Control Loops: A control loop is the fundamental building block of process control,
consisting of a sensor, controller, and actuator working together to regulate a specific
process variable.
8. Safety Systems: Safety is a critical aspect of process control, and systems such as
emergency shutdown systems (ESD), safety instrumented systems (SIS), and alarm
systems are implemented to prevent accidents and protect personnel, equipment, and
the environment.
9. Human-Machine Interface (HMI): HMIs provide operators with graphical interfaces to
interact with the control system. They display real-time process data, alarms, trends, and
allow operators to adjust setpoints and control parameters.
Block diagram
https://youtu.be/uk57TnrCoIw?list=PLVsrfTSlZ_41FNjVk8MjdFVR1zONyf5-5
Types of Analogue Controllers
Analog controllers are devices that operate on continuous signals, often used to regulate or
manipulate physical systems. Here are some types of analog controllers:
Adjusts the control variable proportionally to the error signal. The output is
directly proportional to the error signal, with a gain factor.
2. Integral Controller (I-Controller):
Integrates the error signal over time and adjusts the control variable based on
the accumulated error. It eliminates steady-state errors.
Adjusts the control variable based on the rate of change of the error signal. It
anticipates future behavior and helps in stabilizing the system.
Incorporates proportional, integral, and derivative control actions. It's one of the
most common types of controllers due to its ability to balance stability, accuracy,
and responsiveness.
Proportional derivative
Proportional-Derivative (PD) control is a type of control system that combines both
proportional and derivative control actions.
1. Proportional (P) term: This term is proportional to the error signal, which is the
difference between the desired set point and the current value of the process
variable. The proportional term determines the immediate response to changes
in the error signal.
2. Derivative (D) term: This term is proportional to the rate of change of the error
signal with respect to time. It anticipates the future behavior of the error and acts
to dampen rapid changes, thus improving system stability and reducing
overshoot.
The combined action of the proportional and derivative terms in a PD controller helps to
achieve a balance between responsiveness and stability. The proportional term provides
quick response to deviations from the set point, while the derivative term helps to
dampen oscillations and improve the transient response of the system.
PD control is commonly used in various control applications where there is a need to
minimize overshoot and improve stability, such as in motion control systems,
automotive control systems, and process control systems.
1. Mechanical systems
Newton’s law of motion
2. Electrical systems
Ohms law
Kirchhoff’s law
3. Chemical systems
Heat balances
Differential equations
i. Transient
ii. Steady state
i. Dot method
𝑑𝑥 𝑑2 𝑥
𝑥. = 𝑥 .. =
𝑑𝑡 𝑑𝑡 2
ii. D-operator
𝑑 𝑑𝑛
𝐷 = 𝑑𝑡 𝑑𝑛 = 𝑑𝑡 𝑛
iii. S-operator
𝑑 𝑑𝑛 𝑑 1
𝑆 = 𝑑𝑡 𝑠 𝑛 = 𝑑𝑡 𝑛 and ∫ 𝑑𝑡 = 𝑆
s-operator transforms transfer function from time domain to frequency domain
TRANSFER FUNCTION
𝐿𝑎𝑝𝑙𝑎𝑐𝑒 𝑡𝑟𝑎𝑛𝑠𝑓𝑜𝑟𝑚 𝑜𝑓 𝑡ℎ𝑒 𝑜𝑢𝑡𝑝𝑢𝑡
𝑻. 𝑭 =
𝑙𝑎𝑝𝑙𝑎𝑐𝑒 𝑡𝑟𝑎𝑛𝑠𝑓𝑜𝑟𝑚 𝑜𝑓 𝑡ℎ𝑒 𝑖𝑛𝑝𝑢𝑡
IF INITIAL CONDITIONS WAS ZERO
EXAMPLE
Derive the t.f of a physical system which can be described by the following differential equation
𝑑2 𝑐(𝑡) 𝑑𝑐(𝑡) 𝑑𝑟(𝑡)
+ 10 + 5𝑐(𝑡) = 7 + 𝑟(𝑡)
𝑑𝑡 2 𝑑𝑡 𝑑𝑡
Solution
Taking LTs
S2C(s)+10SC(s)+5C(s)=7SR(s)+R(s)
C(s){S2+10S+5}=R(s){7S+1} hence t.f of the system
𝐶(𝑠) 7𝑆 + 1
𝐺(𝑠) = = 2
𝑅(𝑠) 𝑆 + 10𝑆 + 5
1. T.F of Electricals network (https://youtu.be/xzGOpHFIhx8)
Steps to follow:
Example 1
Ei=VL+VR VR=Vo
𝑣 𝐸𝑜
Ei=VL+Vo V=IR 𝒊 = 𝑅 Hence 𝒊 = 𝑅
𝐿𝑑𝑖
𝑬𝒊 = + 𝐸𝑜
𝑑𝑡
𝑙𝑑𝑖 Vi=VL+VR BUT VR=VC= VO
𝑣𝑜𝑙𝑡𝑔𝑒 𝑎𝑐𝑟𝑜𝑠𝑠 𝑖𝑛𝑑𝑢𝑐𝑡𝑎𝑛𝑐𝑒 Vi=VL+VO
𝑑𝑡
𝐿𝑑𝐸𝑜
𝑬𝒊(𝒕) = (𝑡) + 𝐸𝑜(𝑡) I=i1+i2
𝑅𝑑𝑡
Current across the resistance:
Taking LTs 𝑉𝑜
𝐿 𝒊=
𝑬𝒊(𝒔) = 𝐸𝑜(𝑠) + 𝐸𝑜(𝑠) 𝑅
𝑅
𝐿 And current through the capacitor:
𝑬𝒊(𝒔) = 𝐸𝑜(𝑠){ 𝑆 + 1} 𝑐𝑑𝑣 𝑐𝑑𝑉𝑜
𝑅 𝒊= =
𝑑𝑡 𝑑𝑡
Vi(t)= 𝐿 𝑑𝑡 (𝑡)+VO(t)
𝑑𝑖
𝑬𝒐(𝒔) 𝑹
= 𝑑 𝑉𝑜 𝑐𝑑𝑉𝑜
𝑬𝒊(𝒔) 𝑳𝑺 + 𝑹 𝑽𝒊(𝒕) = 𝐿 { + } (𝑡) + 𝑉𝑜(𝑡)
𝑑𝑡 𝑅 𝑑𝑡
SECOND ORDER SYSTEM 𝑑𝑉𝑜 𝑑 2 𝑉𝑜
𝑽𝒊(𝒕) = 𝐿 (𝑡) + 𝐿𝐶 (𝑡) + 𝑉𝑜(𝑡)
𝑅𝑑𝑡 𝑑𝑡 2
𝑑𝑉𝑜 𝑑 2 𝑉𝑜
𝑽𝒊(𝒕) = 𝐿 (𝑡) + 𝐿𝐶 (𝑡) + 𝑉𝑜(𝑡)
𝑅𝑑𝑡 𝑑𝑡 2
𝐿𝑆
𝑽𝒊(𝒔) = 𝑉𝑜(𝑠) + 𝐿𝐶 𝑆2 𝑉𝑜(𝑠) + 𝑉𝑜(𝑠)
𝑅
𝐕𝐨(𝐬) 𝐑
=
𝐕𝐢(𝐬) 𝑳𝑪𝑺𝟐 𝐑 + 𝐋𝐒 + 𝐑
Show that the transfer function for a circuit shown TRANSFER FUNCTION OF MECH
below is given by:
SYSTEMS
𝐕𝐨(𝐬) 𝝰(𝟏 + 𝐬𝐉)
= (https://youtu.be/oUYyDgy0PBc)
𝐕𝐢(𝐬) 𝟏 + 𝝰𝐉 1. Transitional system
R2
Where 𝝰= and J=R 1 𝑪 2. Rotational/rational system
R 1 +R2
1. Transitional system
M-mass of an element
K-spring constant
R-friction constant
F-force applied
y/x-displacement
V-velocity
I. MASS
𝟏
R 1 .𝐉𝐰𝐜
𝑽𝒊 = 𝐈 { 𝟏 } + 𝐈R2 but JW=S
R 1 +𝐉𝐰𝐜
R1
𝐒𝐂
𝑽𝒊(𝒕) = 𝐈(𝐭) { R1𝑺𝑪+𝟏 } + 𝐈R2 (𝒕)
𝐒𝐂
𝒅𝒗 𝒅𝒙
R1 F(t)=Ma(t) a= but v=
𝑽𝒊(𝒕) = 𝐈(𝐭) { } + 𝐈R2 (𝒕) 𝒅𝒕 𝒅𝒕
R 1 𝑺𝑪+𝟏 𝒅𝟐 𝒙
F(t)=M 𝟐 (t)
𝒅𝒕
𝐕𝐨 R2 II. SPRING
=
𝐕𝐢 R1
+ R2
R1𝑺𝑪 + 𝟏
𝐕𝐨 R 2 (R1 𝑺𝑪 + 𝟏)
=
𝐕𝐢 R1 + R 2 (R1 𝑺𝑪 + 𝟏)
𝐕𝐨 𝝰(𝟏 + 𝐒𝐉)
=
𝐕𝐢 𝟏 + 𝝰𝐒𝐉
III. DASHPOT/DAMPER 𝒅ɵ
T(t)=RW(t)= R (t)
𝒅𝒕
EXAMPLES
𝒅𝒙 𝒅𝒙
FR𝝰V hence FR=RV but V= thus FR=R (t)
𝒅𝒕 𝒅𝒕
2. Rotational/rational system
J=Inertia of an element
S=Stiffness
R=Friction
T=Torque applied
ɵ=Angle moved
W=Angular velocity Newton’s law of motion
F(t)=FM+FR+FK
𝒅𝟐 𝒙 𝒅𝒙
F(t)= M 𝟐 (t)+ R (t)+ Kx(t)
𝒅𝒕 𝒅𝒕
Taking the LTs
F(s) = MS 2 x(s) + RSx(s) + Kx(s)
𝐗(𝐬) 𝟏
=
𝐅(𝐬) 𝐌𝐒 𝟐 +𝐑𝐒+𝐊
ɵ 𝒅ɵ
T(t)=S∫Wdt but W= = hence T(t)=Sɵ
𝒕 𝒅𝒕
(b) Moment of inertia
𝒅𝑾
T(t)=J (t) = J𝑑𝑑𝑡ɵ (t)
2
2
𝒅𝒕
(c)The dashpot
J & E=negligible
F(t)=FM+FR+FK Taking LTs
𝒅𝟐 𝒙 𝒅𝒙 RCSɵL(s)+ ɵL(s)= ɵj(s)
F(t)= M 𝟐 (t)+ R (t)+ Kx(t)
𝒅𝒕
Taking the LTs
𝒅𝒕
ɵL 1
F(s) = MS 2 x(s) + RSx(s) + Kx(s)
=
ɵj RCS + 1
𝐗(𝐬) 𝟏
=
𝐅(𝐬) 𝐌𝐒 𝟐 +𝐑𝐒+𝐊
F=FM+FB+FK
𝒅𝟐 𝒙 𝒅𝒙 𝑉 1 𝑑𝑣
F(t)= M (t)+ B (t)+ Kx(t)--------------1 i= + ∫ 𝑉𝑑𝑡 + 𝐶 -----------------4
𝒅𝒕𝟐 𝒅𝒕 𝑅 𝐿 𝑑𝑡
𝑑𝛷
substitute V=
𝑑𝑡
1 𝑑𝛷 1 𝒅𝟐 𝛷
i= + 𝛷+𝐶 ----------------5
𝑅 𝑑𝑡 𝐿 𝒅𝒕𝟐
hence
𝒅𝟐 𝛷 1 𝑑𝛷 1
i= 𝐶 + + 𝛷---------------6
𝒅𝒕𝟐
𝑅 𝑑𝑡 𝐿
Comparing equation 1 and 6
𝒅𝟐 𝒙 𝒅𝒙
F(t)= M (t)+ B (t)+ Kx(t)---------1
𝒅𝒕𝟐 𝒅𝒕
Where never the armature is rotating a voltage
proportional to the product of the flux and angular
TRANSLATION MECH SYS ELECTRICAL SYSTEM velocity is induced to the armature.
Force (F) Current (I) If 𝛷 = constant then
Mass (M) Capacitance(C) 𝒅ɵ 𝒅ɵ
Frictional coefficient (B) Reciprocal of Eb𝝰 Eb=Kb --------------1
𝒅𝒕 𝒅𝒕
1
resistance(𝑅) Taking LTs
Spring constant(K) Reciprocal of Eb(s)=K b 𝑺ɵ(s)
1 Equation of the motor
inductance(𝐿)
Displacement(x) V=Ia Ra + 𝐄𝐛
Flux𝛷
Velocity (V) Voltage (V) Block representation
𝐄𝐚(𝐬)
=
𝐒{(𝐋𝐚𝐉𝐒 𝟐 +(𝐋𝐚𝐟+𝐑𝐚𝐟)𝐒+𝐊𝐊𝐒} J𝐝𝐝𝐭 ɵ+ F dɵdt = T = K2If ----------------3
𝟐
LTs of the equation above.