Intermolecular Forces
Intermolecular Forces
The stronger the The stronger the It is related to the ease with
intermolecular forces intermolecular forces which molecules can move
between solute molecule and between the molecules of a past each other.
solvent molecule, the greater liquid, the greater
the solubility of the solute in the energy required to
the solvent. separate the molecules and
turn them into gas → higher
boiling
point
London Dispersion
Dipole-Dipole
Hydrogen Bonding
Attraction between two polar molecules, specifically one molecule having a H bonded
directly to an electronegative atom (eg. H-O-, H-N-, HF), and the other having a nonbonding
electron pair on an electronegative atom. A special type of dipole-dipole bond that is
particularly strong.
Eg. H-bonding between ethanol and water; H-bonding between two water molecules
Ion-Dipole
Trends
1. Between two polar molecules, the molecule with the smaller hydrocarbon portion
(or the larger polar portion) is more soluble in water.
CH3CH2OH Soluble in water
CH3CH3CH3CH3CH3CH2OH Insoluble in water
CH2(OH)CH(OH)CH(OH)CH(OH)CH(OH)CH2OH Soluble in water. Large but many OHs
that can hydrogen bond with water.
Main Idea: Intermolecular attractive forces hold molecules together in the liquid state.
The stronger the intermolecular forces between the molecules of a liquid, the greater
the energy required to separate the molecules and turn them into gas à higher boiling
point
Trends:
1. Between two molecules of similar mass, the one with the stronger type of
intermolecular force has a higher boiling point (Look for functional groups that may
indicate polar molecule).
CH3CH2CH3 CH3CH2OH
bp = –42 °C bp = 78 °C
2. Between two nonpolar molecules of similar mass, the more extended molecule will
have the higher boiling point (more extended à more surface area for London
dispersion interaction).
n-pentane, bp = 309.4 K neopentane, bp = 282.7 K
3. Between two nonpolar molecules of different masses, the larger molecule will have
the higher boiling point (larger molecule à more electrons à more polarizability à
more London dispersion forces)
CH3(CH2)5CH3 CH3CH2CH3
bp = 98 °C bp = –42 °C