100% found this document useful (29 votes)
18K views609 pages

Calculus PDF

Copyright
© © All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd
100% found this document useful (29 votes)
18K views609 pages

Calculus PDF

Copyright
© © All Rights Reserved
We take content rights seriously. If you suspect this is your content, claim it here.
Available Formats
Download as PDF, TXT or read online on Scribd
You are on page 1/ 609

McGraw-Hill Ryerson McGraw-Hill Ryerson

Pre-Calculus Pre-Calculus

Pre-Calculus 11
11
McAskill
Watt
Balzarini
Bonifacio
Carlson
11
Johnson
Kennedy
Wardrop

Explore our
Web Site
http://www.mcgrawhill.ca
McGraw-Hill Ryerson

Pre-Calculus
Authors Assessment Consultant Advisors
Bruce McAskill, B.Sc., B.Ed., M.Ed., Ph.D. Chris Zarski, B.Ed., M.Ed. John Agnew, School District 63 (Saanich),
Mathematics Consultant, Victoria, British Wetaskiwin Regional Division No. 11, British Columbia
Columbia Alberta Katharine Borgen, School District 39
Wayne Watt, B.Sc., B.Ed., M.Ed. (Vancouver) and University of British
Pedagogical Consultant
Mathematics Consultant, Winnipeg, Manitoba Columbia, British Columbia
Terry Melnyk, B.Ed.
Eric Balzarini, B.Sc., B.Ed., M.Ed. Barb Gajdos, Calgary Roman Catholic
Edmonton Public Schools, Alberta
School District 35 (Langley), British Columbia Separate School District No. 1, Alberta
Len Bonifacio, B.Ed. Aboriginal Consultant Sandra Harazny, Regina Roman Catholic
Edmonton Catholic Separate School District Chun Ong, B.A., B.Ed. Separate School Division No. 81,
No. 7, Alberta Manitoba First Nations Education Resource Saskatchewan
Centre, Manitoba Rene Jackson, University of Alberta, Alberta
Scott Carlson, B.Ed., B.Sc.
Golden Hills School Division No. 75, Alberta Gerald Krabbe, Calgary Board of Education,
Differentiated Instruction Consultant
Alberta
Blaise Johnson, B.Sc., B.Ed. Heather Granger
School District 45 (West Vancouver), British Prairie South School Division No. 210, Gail Poshtar, Calgary Catholic School
Columbia Saskatchewan District, Alberta
Ron Kennedy, B.Ed. Francophone Advisor
Mathematics Consultant, Edmonton, Alberta
Gifted and Career Consultant
Mario Chaput, Pembina Trails School
Rick Wunderlich Division Manitoba
Harold Wardrop, B.Sc. School District 83 (North Okanagan/
Brentwood College School, Mill Bay Shuswap), British Columbia Luc Lerminiaux, Regina School Division
(Independent), British Columbia No. 4, Saskatchewan
Math Processes Consultant
Contributing Author Inuit Advisor
Reg Fogarty
Stephanie Mackay Christine Purse, Mathematics Consultant,
School District 83 (North Okanagan/
Edmonton Catholic Separate School District British Columbia
Shuswap), British Columbia
No. 7, Alberta
Mtis Advisor
Technology Consultants
Senior Program Consultants Greg King, Northern Lights School Division
Ron Kennedy
Bruce McAskill, B.Sc., B.Ed., M.Ed., Ph.D. No. 69, Alberta
Mathematics Consultant, Edmonton, Alberta
Mathematics Consultant, Victoria, British
Ron Coleborn Technical Advisor
Columbia
School District 41 (Burnaby), British Darren Kuropatwa, Winnipeg School
Wayne Watt, B.Sc., B.Ed., M.Ed. Columbia Division #1, Manitoba
Mathematics Consultant, Winnipeg, Manitoba

Toronto Montral Boston Burr Ridge, IL Dubuque, IA Madison, WI New York


San Francisco St. Louis Bangkok Bogot Caracas Kuala Lumpur Lisbon London
Madrid Mexico City Milan New Delhi Santiago Seoul Singapore Sydney Taipei
COPIES OF THIS BOOK McGraw-Hill Ryerson
MAY BE OBTAINED BY Pre-Calculus 11
CONTACTING:
Copyright 2011, McGraw-Hill Ryerson Limited, a Subsidiary of The McGraw-Hill Companies.
McGraw-Hill Ryerson Ltd. All rights reserved. No part of this publication may be reproduced or transmitted in any
form or by any means, or stored in a data base or retrieval system, without the prior written
WEB SITE: permission of McGraw-Hill Ryerson Limited, or, in the case of photocopying or other
http://www.mcgrawhill.ca reprographic copying, a licence from The Canadian Copyright Licensing Agency (Access
Copyright). For an Access Copyright licence, visit www.accesscopyright.ca or call toll free to
E-MAIL: 1-800-893-5777.
[email protected]
ISBN-13: 978-0-07-073873-7
TOLL-FREE FAX: ISBN-10: 0-07-073873-4
1-800-463-5885
http://www.mcgrawhill.ca
TOLL-FREE CALL:
1-800-565-5758 2 3 4 5 6 7 8 9 10 TCP 1 9 8 7 6 5 4 3 2 1

OR BY MAILING YOUR Printed and bound in Canada


ORDER TO:
McGraw-Hill Ryerson Care has been taken to trace ownership of copyright material contained in this text. The
Order Department publishers will gladly accept any information that will enable them to rectify any reference
300 Water Street or credit in subsequent printings.
Whitby, ON L1N 9B6
Microsoft Excel is either a registered trademark or trademarks of Microsoft Corporation in
Please quote the ISBN and the United States and/or other countries.
title when placing your
order. TI-84 and TI-Nspire are registered trademarks of Texas Instruments.

The Geometers Sketchpad, Key Curriculum Press, 1150 65th Street, Emeryville, CA
94608, 1-800-995-MATH.

VICE-PRESIDENT, EDITORIAL AND PUBLISHER: Beverley Buxton


ASSOCIATE PUBLISHER AND CONTENT MANAGER: Jean Ford
PROJECT MANAGER: Janice Dyer
DEVELOPMENTAL EDITORS: Maggie Cheverie, Jackie Lacoursiere, Jodi Rauch
MANAGER, EDITORIAL SERVICES: Crystal Shortt
SUPERVISING EDITOR: Janie Deneau
COPY EDITOR: Julie Cochrane
PHOTO RESEARCH & PERMISSIONS: Linda Tanaka
EDITORIAL ASSISTANT: Erin Hartley
EDITORIAL COORDINATION: Jennifer Keay, Janie Reeson, Alexandra Savage-Ferr
MANAGER, PRODUCTION SERVICES: Yolanda Pigden
PRODUCTION COORDINATOR: Jennifer Hall
INDEXER: Natalie Boon
INTERIOR DESIGN: Pronk & Associates
COVER DESIGN: Michelle Losier
ART DIRECTION: Tom Dart, First Folio Resource Group Inc.
ELECTRONIC PAGE MAKE-UP: Tom Dart, Kim Hutchinson,
First Folio Resource Group Inc.
COVER IMAGE: Courtesy of Ocean/Corbis
Acknowledgements
There are many students, teachers, and administrators who the publisher, authors,
and consultants of Pre-Calculus 11 wish to thank for their thoughtful comments and
creative suggestions about what would work best in their classrooms. Their input
and assistance have been invaluable in making sure that the Student Resource and its
related Teachers Resource meet the needs of students and teachers who work within
the Western and Northern Canadian Protocol Common Curriculum Framework.

Reviewers
Stella Ablett Carol Funk Andrew Jones Kim Mucheson
Mulgrave School, West Nanaimo/Ladysmith School St. Georges School (Private Comox Valley School
Vancouver (Independent) District No. 68 School) District #71
British Columbia British Columbia British Columbia British Columbia
Kristi Allen Howard Gamble Jenny Kim Yasuko Nitta
Wetaskiwin Regional Public Horizon School Division #67 Concordia High School Richmond Christian School
Schools Alberta (Private) (Private)
Alberta Alberta British Columbia
Jessika Girard
Karen Bedard Conseil Scolaire Janine Klevgaard Vince Ogrodnick
School District No. 22 Francophone No. 93 Clearview School Division Kelsey School Division
(Vernon) British Columbia No. 71 Manitoba
British Columbia Alberta Crystal Ozment
Pauline Gleimius
Gordon Bramfield B.C. Christian Academy Ana Lahnert Nipisihkopahk Education
Grasslands Regional (Private) Surrey School District Authority
Division No. 6 British Columbia No. 36 Alberta
Alberta British Columbia Curtis Rey
Marge Hallonquist
Yvonne Chow Elk Island Catholic Schools Carey Lehner Hannover School Division
Strathcona-Tweedsmur Alberta Saskatchewan Rivers School Manitoba
School (Independent) Division No. 119 Oreste Rimaldi
Jeni Halowski
Alberta Saskatchewan School District No. 34
Lethbridge School District
Lindsay Collins No. 51 Debbie Loo (Abbotsford)
South East Cornerstone Alberta Burnaby School District #41 British Columbia
School Division No. 209 British Columbia Wade Sambrook
Jason Harbor
Saskatchewan North East School Division Jay Lorenzen Western School Division
Julie Cordova No. 200 Horizon School District #205 Manitoba
St. Jamies-Assiniboia School Saskatchewan Sakatchewan James Schmidt
Division Dale Hawken Terza Malmstrom Pembina Trails School
Manitoba St. Albert Protestant Calgary Board of Education Division
Janis Crighton Separate School District Alberta Manitoba
Lethbridge School District No. 6 Rodney Marseille Sonya Semail
No. 51 Alberta School District No. 62 School District 39
Alberta Murray D. Henry British Columbia (Vancouver)
Steven Daniel Prince Albert Catholic British Columbia
Darren McDonald
Department of Education, School Division #6 Parkland School Division Dixie Sillito
Culture and Employment Saskatchewan No. 70 Prairie Rose School Division
Northwest Territories Barbara Holzer Alberta Alberta
Ashley Dupont Prairie South School Dick McDougall Clint Surry
St. Maurice School Board Division Calgary Catholic School School District 63 (Saanich)
Manitoba Saskatchewan District British Columbia
Dee Elder Larry Irla Alberta Debbie Terceros
Edmonton Public Schools Aspen View Regional Georgina Mercer Peace Wapiti School
Alberta Division No. 19 Fort Nelson School District Division #76
Alberta No. 81 Alberta
Janet Ferdorvich
Alexis Board of Education Betty Johns British Columbia John Verhagen
Alberta University of Manitoba Livingstone Range School
(retired) Division
Manitoba Alberta
Contents

A Tour of Your Textbook ..................... vi Unit 2 Quadratics ............................. 138

Unit 1 Patterns ..................................... 2 Chapter 3 Quadratic Functions ................... 140


3.1 Investigating Quadratic Functions in
Chapter 1 Sequences and Series ................... 4 Vertex Form............................................................ 142
1.1 Arithmetic Sequences ..............................................6 3.2 Investigating Quadratic Functions in
1.2 Arithmetic Series..................................................... 22 Standard Form ....................................................... 163
1.3 Geometric Sequences ........................................... 32 3.3 Completing the Square ...................................... 180
1.4 Geometric Series ..................................................... 46 Chapter 3 Review ......................................................... 198
1.5 Innite Geometric Series ..................................... 58 Chapter 3 Practice Test ............................................. 201
Chapter 1 Review ............................................................ 66
Chapter 4 Quadratic Equations .................. 204
Chapter 1 Practice Test ................................................ 69 4.1 Graphical Solutions of Quadratic
Unit 1 Project .................................................................... 71 Equations................................................................. 206
4.2 Factoring Quadratic Equations ....................... 218
Chapter 2 Trigonometry ................................ 72
4.3 Solving Quadratic Equations by
2.1 Angles in Standard Position ............................... 74
Completing the Square ...................................... 234
2.2 Trigonometric Ratios of Any Angle ................. 88
4.4 The Quadratic Formula ...................................... 244
2.3 The Sine Law ......................................................... 100
Chapter 4 Review ..................................................... 258
2.4 The Cosine Law .................................................... 114
Chapter 4 Practice Test ............................................. 261
Chapter 2 Review ......................................................... 126
Chapter 2 Practice Test ............................................. 129 Unit 2 Project Wrap-Up .................... 263
Unit 1 Project ................................................................. 131 Cumulative Review,
Unit 1 Project Wrap-Up .................... 132 Chapters 34 ................................. 264
Unit 2 Test ........................................ 266
Cumulative Review,
Chapters 12 ................................. 133
Unit 3 Functions and Equations ..... 268
Unit 1 Test ........................................ 136
Chapter 5 Radical Expressions and
Equations ....................................................... 270
5.1 Working With Radicals ....................................... 272
5.2 Multiplying and Dividing Radical
Expressions ............................................................ 282
5.3 Radical Equations ................................................ 294
Chapter 5 Review ......................................................... 304
Chapter 5 Practice Test ............................................. 306

iv MHR Contents
Chapter 6 Rational Expressions and Unit 4 Systems of Equations
Equations ....................................................... 308 and Inequalities ............................... 420
6.1 Rational Expressions .......................................... 310
Chapter 8 Systems of Equations ................ 422
6.2 Multiplying and Dividing Rational 8.1 Solving Systems of Equations
Expressions ............................................................ 322 Graphically .............................................................. 424
6.3 Adding and Subtracting Rational 8.2 Solving Systems of Equations
Expressions ............................................................ 331 Algebraically........................................................... 440
6.4 Rational Equations .............................................. 341 Chapter 8 Review ......................................................... 457
Chapter 6 Review ......................................................... 352 Chapter 8 Practice Test ............................................. 459
Chapter 6 Practice Test ............................................. 355 Unit 4 Project ................................................................. 461
Chapter 7 Absolute Value and Reciprocal Chapter 9 Linear and Quadratic
Functions ....................................................... 356 Inequalities.................................................... 462
7.1 Absolute Value ...................................................... 358 9.1 Linear Inequalities in Two Variables............ 464
7.2 Absolute Value Functions ................................ 368 9.2 Quadratic Inequalities in
7.3 Absolute Value Equations ................................ 380 One Variable ........................................................... 476
7.4 Reciprocal Functions .......................................... 392 9.3 Quadratic Inequalities in
Two Variables ........................................................ 488
Chapter 7 Review ......................................................... 410
Chapter 9 Review ......................................................... 501
Chapter 7 Practice Test ............................................. 413
Chapter 9 Practice Test ............................................. 504
Unit 3 Project Wrap-Up .................... 415 Unit 4 Project ................................................................. 506

Cumulative Review, Unit 4 Project Wrap-Up .................... 507


Chapters 57 ................................. 416
Cumulative Review,
Unit 3 Test ........................................ 418 Chapters 89 ................................. 508
Unit 4 Test ........................................ 510

Answers............................................. 513

Glossary ............................................. 586

Index .................................................. 592


Credits ............................................... 596

Contents MHR v
A Tour of Your Textbook

Unit 1

Patterns
Unit Opener Many problems are solved
using patterns. Economic

Each unit begins with a two-page and resource trends may be


based on sequences and series.
Seismic exploration identifies
underground phenomena, such

spread. The first page of the Unit as caves, oil pockets, and rock
layers, by transmitting sound
into the earth and timing the
echo of the vibration. Surveyors

Opener introduces what you will use triangulation and the laws
of trigonometry to determine
distances between inaccessible
Unit 1 Project Canadas Natural Resources

learn in the unit. The Unit Project is points. All of these activities
use patterns and aspects of the
mathematics you will encounter
Canada is a country rich with natural
found in abundance in the Canadian
resources. Petroleum, minerals,
landscape. Canada is one of the
exporters of minerals, mineral products,
and forests are
worlds leading
and forest products. Resource developmen
in this unit. has been a mainstay of Canadas t

introduced on the second page. Each


economy for many years.
In this project, you will explore
one of Canadas natural resources
of petroleum, minerals, or forestry. from the categories
You will collect and present data
chosen resource to meet the following related to your

Unit Project helps you connect the


criteria:
Looking Ahead Include a log of the journey leading
to the discovery of your resource.
In this unit, you will solve In Chapter 1, you will provide
data on the production of your
problems involving you will apply your knowledge natural resource. Here
of sequences and series to show
arithmetic sequences increased or decreased over time, how production has

math in the unit to real life using and series


geometric sequences
and series
your chosen resource.
In Chapter 2, you will use skills
and the cosine law to explore the
and make predictions about future

developed with trigonometry, including


development of

the sine law


innite geometric series area where your resource was discovered.
then explore the proposed site of You will

experiences that may interest you. sine and cosine laws


At the end of your project, you
the development of your resource.
your natural resource.

will encourage potential investors


to participate in
Your final project may take many
a written or visual presentation forms. It may be
, a brochure, a video production,
show. Or, you could use the interactive or a computer slide
features of a whiteboard.
In the Project Corner box at the
end of most sections, you will find
notes about Canadas natural resources. information and
You can use this information to
data and facts about your chosen help gather
resource.

2 MHR Unit 1 Patterns

Unit 1 Patterns MHR 3

Project Corner boxes Unit 1 Project Unit 1 Project Wrap-Up


throughout the chapters help Canadas Natural Resources Canadas
Canada
Cana
Canada Natural Resources

you gather information for


Canada is the source of more than 60 mineral commodities,
mmodities, including You need in
investment capital to develop your resource. Prepare a
eral fuels.
metals, non-metals, structural materials, and mineral Unit 1 Project presentation to make to your investors to encourage them to invest in
your project.
project You can use a written or visual presentation, a brochure, a
Quarrying and mining are among the oldest industries
stries in Canada. In
1672, coal was discovered on Cape Breton Island. video production,
produ a computer slide show presentation, or an interactive
whiteboard presentation.

your project. Some Project In the 1850s, gold discoveries in British Columbia,
and increased production of Cape Breton coal marked
in Canadian mineral history.
Canadas Natural Resources
a, oil finds in Ontario,
rked a turning point
The emphasis of the Chapter 2 Task is the location of your resource.
Your presentation
presen
Actual dat
should include the following:
data taken from Canadian sources on the production of your
You will describe the route of discovery of the resource and the
In 1896, gold was found in the Klondike District of what became YukonY chosen res
resource. Use sequences and series to show how production

Corner boxes include part of the North-West Territories that later became
nds were evident in
In the late 1800s, large deposits of coal and oil sands
me Alberta.
planned area of the resource.
pectacular gold rushes.
Territory, giving rise to one of the worlds most spectacular

Chapter 2 Task
We b Link
has increased
increa
and sales.
A fictitious
or decreased over time, and to predict future production

fictitiou account of a recent discovery of your resource, including a


The Journey to Locate the Resource map of the area showing the accompanying distances.

questions to help you to In the post-war era there were many major mineralal discoveries:
deposits of nickel in Manitoba; zinc-lead, copper, and molybdenum Use the map provided. Include a brief log of the journey leading to
in British Columbia; and base metals and asbestoss in Qubec, Ontario,your discovery. The exploration map is the route that you followed to
discover your chosen resource.
To obtain a copy of an
exploration map, go to
www.mhrprecalc11.ca
and follow the links.
A proposal
proposa for how the resource area will be developed over the next
few years
ritish Columbia.
Manitoba, Newfoundland, Yukon Territory, and British

begin thinking about and berta in 1947 was With your exploration map, determine the total distance of your
The discovery of the famous Leduc oil field in Alberta
um industry.
followed by a great expansion of Canadas petroleum
In the late 1940s and early 1950s, uranium was discovered
iscovered in
route, to the nearest tenth of a kilometre. Begin your journey at
point A and conclude at point J. Include the height of the Sawback
Ridge and the width of Crow River in your calculations.
Saskatchewan and Ontario. In fact, Canada is noww the worlds largest

discussing your project. uranium producer.


roduction in October
Canadas first diamond-mining operation began production
1998 at the Ekati mine in Lac de Gras, Northwest Territories,
T
Developing the Area of Your Planned Resource

Your job as a resource development officer for the company is to


followedpresent a possible area of development. You are restricted by land
by the Diavik mine in 2002. boundaries to the triangular shape shown, with side AB of 3.9 km,
side AC of 3.4 km, and B = 60.
Chapter 1 Task
Determine all measures of the triangular region that your company

The Unit Projects in Units 1 Choose a natural resource that you would like to research. You may could develop.
d in the Project Corner
wish to look at some of the information presented
boxes throughout Chapter 1 for ideas. Research your
our chosen resource. Possible Proposed Development
A
e, including what it is,
List interesting facts about your chosen resource,

and 4 are designed for you to how it is produced, where it is exported, how much is exported, and
so on.
Look for data that would support using a sequence
nce or series in

complete in pieces, chapter


discussing or describing your resource. List the terms for the
sequence or series you include.
3.9 km 3.4 km h
uence or series to
Use the information you have gathered in a sequence
n of the resource over a
predict possible trends in the use or production

by chapter, throughout the ten-year period.


Describe any effects the production of the natural
community.
ral resource has on the

60
B

unit. At the end of the unit, a


C D
Unit 1 Project MHR 71 132 MHR Unit 1 Project Wrap-Up

Project Wrap-Up allows you


Unit 1 Project MHR 131

to consolidate your work in a


meaningful presentation.
Unit 2 Project Wrap-Up
Quadratic Functions in Everyday Life
You can analyse quadratic functions and their related equations to solve
problems and explore the nature of a quadratic. A quadratic can model the
curve an object follows as it flies through the air. For example, consider
the path of a softball, a tennis ball, a football, a baseball, a soccer ball, or a
basketball. A quadratic function can also be used to design an object that
has a specific curved shape needed for a project.
Quadratic equations have many practical applications. Quadratic equations
may be used in the design and sales of many products found in stores.
They may be used to determine the safety and the life expectancy of a

The Unit Projects in Units 2 and 3 provide an product. They may also be used to determine the best price to charge to
maximize revenue.
Complete one of the following two options.

opportunity for you to choose a single Project Option 1 Quadratic Functions in Everyday Life
Research a real-life situation that may be
Option 2 Avalanche Control
Research a ski area in Western Canada that
modelled by a quadratic function. requires avalanche control

Wrap-Up at the end of the unit. Search the Internet for two images or video
clips, one related to objects in motion and
one related to fixed objects. These items
Determine the best location or locations to
position avalanche cannons in your resort.
Justify your thinking.
should show shapes or relationships that are Determine three different quadratic functions
parabolic. that can model the trajectories of avalanche
Model each image or video clip with a control projectiles.
quadratic function, and determine how Graph each function. Each graph should
accurate the model is. illustrate the specific coordinates of where
Research the situation in each image or video the projectile will land.
clip to determine if there are reasons why it Write a one-page report to accompany
should be quadratic in nature. your graphs. Your report should include
Write a one-page report to accompany your the following:
functions. Your report should include the  the location(s) of the avalanche control

following: cannon(s)
 where quadratic functions and equations  the intended path of the controlled

are used in your situations avalanche(s)


 when a quadratic function is a good model  the location of the landing point for

to use in a given situation each projectile


 limitations of using a quadratic function as

a model in a given situation

Unit 2 Project Wrap-Up MHR 263

vi MHR A Tour of Your Textbook


Chapter Opener
CHAPTER

1 Sequences and Series


Each chapter begins with a two-page Many patterns and designs linked
and the human body. Certain patterns
to mathematics are found in nature
occur more often than others.
Logistic spirals, such as the Golden

spread that introduces you to what Fibonacci number sequence. The


Natures Numbers.
Mean spiral, are based on the
Fibonacci sequence is often called

13 8

you will learn in the chapter. 8 8


13
2 1
2 1
1
1 5
3

The opener includes information 3

The pattern of this logistic spiral


5

is found in the chambered nautilus,


the inner ear, star clusters, cloud

about a career that uses the skills growth, leaves on stems, petals
rabbit reproduction also appear
spiral pattern.
patterns, and whirlpools. Seed
on flowers, branch formations,
and
to be modelled after this logistic

covered in the chapter. A Web Link There are many different kinds
learn about sequences that can
of sequences. In this chapter, you
be described by mathematical rules.
will
Career Link
Link
allows you to learn more about
We b
Biomedical engineers combine
To learn
earn more about
biology,
ab the Fibonacci sequence, go to engineering, and mathematical
www.mhrprecalc11.ca and follow
the links.
sciences to
solve medical and health-relate
d problems.
Some research and develop artificial

this career and how it involves the and replacement limbs. Others
organs
design MRI
machines, laser systems, and microscopic
machines used in surgery. Many
biomedical
engineers work in research and

mathematics you are learning. Key Terms


sequence
arithmetic sequence
geometric sequence
common ratio
Did You Know?

In mathematics, the Fibonacci


sequence is a sequence of
natural numbers named after
taken insulin or used an asthma
you have benefited from the work
development
in health-related fields. If you have
ever
inhaler,
of
common difference geometric series Leonardo of Pisa, also known biomedical engineers.
as Fibonacci. Each number is
general term convergent series the sum of the two preceding
arithmetic series divergent series numbers. We b Link

Visuals on the chapter opener spread


1, 1, 2, 3, 5, 8, 13, . . .
To learn
earn more about
ab biomedical engineering, go to
www.mhrprecalc11.ca and follow
the links.
4 MHR Chapter 1

show other ways the skills and Chapter 1 MHR 5

concepts from the chapter are used in


daily life.

1.1
Arithmetic Sequences

Numbered Sections
Focus on . . .
deriving a rule for determining the general term of an
arithmetic sequence
determining t1, d, n, or tn in a problem that involves an
arithmetic sequence
describing the relationship between an arithmetic

The numbered sections in each chapter start with


sequence and a linear function
solving a problem that involves an arithmetic sequence

Comets are made of frozen lumps of gas and rock and are

a visual to connect the topic to a real setting. The often referred to as icy mudballs or dirty snowballs. In
1705, Edmond Halley predicted that the comet seen in
1531, 1607, and 1682 would be seen again in 1758. Halleys
prediction was accurate. This comet was later named in his

purpose of this introduction is to help you make honour. The years in which Halleys Comet has appeared
approximately form terms of an arithmetic sequence. What
makes this sequence arithmetic?

connections between the math in the section and in Investigate Arithmetic Sequences

the real world, or to make connections to what you Staircase Numbers


A staircase number is the number of cubes needed
to make a staircase that has at least two steps.

already know or may be studying in other classes. Is there a pattern to the number of cubes
in successive staircase numbers?
How could you predict different
staircase numbers?

1 2 3 4 5 6 7 8 9 10
Columns
Part A: Two-Step Staircase Numbers
To generate a two-step staircase number, add the numbers
of cubes in two consecutive columns.
The first staircase number is the sum of the number of
cubes in column 1 and in column 2.
1 2

6 MHR Chapter 1

A Tour of Your Textbook MHR vii


Three-Part Lesson
Each section is organized in a 2.4
three-part lesson: Investigate, Link the The Cosine Law
The cosine law relates the lengths
cosine of one of its angles.
3. a) For ABC given in step
of the sides of a given triangle to

1, determine the value of 2ab cos


the

C.

Ideas, and Check Your Understanding.


b) Determine the value of 2ab
Focus on . . . cos C for ABC from step 2.
c) Copy and complete a table
sketching a diagram and solving like the one started below. Record
a problem your
using the cosine law results and collect data for the
triangle drawn in step 2
recognizing when to use the cosine from at least three other people.
law to
solve a given problem
Triangle Side Lengths (cm)
explaining the steps in the given
proof of c2 a2 + b2 2ab cos C
the cosine law a = 3, b = 4, c = 5

Investigate The Canadarm2, also known as


the Mobile Servicing System,
a = , b = , c = 

is a major part of the Canadian


spacee 4. Consider the inequality you
robotic system. It completed its found to be true in step 2, for the
first official construction job relationship
on the International Space Station between the values of c2 and a2
in July 2001. The robotic
obotic arm can move + b2. Explain how
equipment and assist astronauts your results from step 3 might be
working in space. The robotic manipulator used to turn the inequality into

The Investigate consists of short operated by controlling the angles is an equation. This relationship is
of its joints. The final position known as the cosine law.
can be calculated by using the trigonometric of the arm 5. Draw ABC in which C
ratios of those angles. is obtuse. Measure its side lengths.
Determine whether or not your equation from
step 4 holds.
Reflect and Respond

steps often accompanied by Investigate the Cosine Law 6. The cosine law relates the
the cosine of
lengths of the sides of a given triangle
one of its angles. Under what conditions
would you use
to
the cosine law to solve a triangle?
Materials

illustrations. It is designed to help


1. a) Draw ABC, where a
= 3 cm, A
A
ruler b = 4 cm, and c = 5 cm.
protractor b) Determine the values of a2 2 c
, b , and c2. b
c) Compare the values of a2
+ b and c .
2 b c

you build your own understanding


2
Which of the following is true? B
C a
a2 + b2 = c2
a2 + b2 > c2 7. Consider the triangle shown.
C a B
a2 + b2 < c2 C

of the new concept. d) What is the measure of C?


2. a) Draw an acute ABC.
b) Measure the lengths of sides
A
10.4 cm

A
47
B
a, b, and c. 21.9 cm
c) Determine the values of a2 2 a) Is it possible to determine
, b , and c .
2
the length of side a using the sine
c law? Explain why or why not.
d) Compare the values of a2
+ b2 and c2. b
Which of the following is true? b) Describe how you could

The Reflect and Respond


solve for side a.
a2 + b2 > c2 8. How are the cosine law and
B the Pythagorean Theorem related?
a2 + b2 < c2 C
a

questions help you to analyse 114 MHR Chapter 2

and communicate what you are 2.4 The Cosine Law MHR 115

learning and draw conclusions.

Link the Ideas

The explanations in this section help you connect the concepts explored
in the Investigate to the Examples.

The Examples and worked Solutions show how to use the concepts. The
Examples include several tools to help you understand the work.
Words in green font help you think through the steps.
Different methods of solving the same problem are sometimes shown.
One method may make more sense to you than the others. Or, you may
develop another method that means more to you.

Each Example is followed by a Your Turn. The Your Turn allows you to
explore your understanding of the skills covered in the Example.

After all the Examples are presented, the Key Ideas summarize the main
new concepts.

Link the Ideas


Key Ideas

absolute value The absolute value of a number is the distance of that number ax 2 + bx + c = 0, a 0,
You can solve a quadratic equation of the form________
from zero on a real-number line.
for x using the quadratic formula x = ___ .
the distance of a -b b2 - 4ac
number from zero on 2a
a real-number line Two vertical bars around a number or expression are used to
for a real number a, represent the absolute value of the number or expression. Use the discriminant to determine the nature of the roots of a quadratic equation.
the absolute value is Example 4
For example,  When b2 - 4ac > 0, there are two y
written as |a| and is
a positive number The absolute value of a positive number is the positive number. Determine Trigonometric Ratios of Quadrantal Angles distinct real roots. The graph of
|+5| = 5 Determine the values of sin , cos , and tan when the terminal arm the corresponding function has
The absolute value of zero is zero. of quadrantal angle coincides with the positive y-axis, = 90. quadrantal angle two different x-intercepts.
|0| = 0 an angle in standard
The absolute value of a negative number is the negative of that Solution position whose 0 x
number, resulting in the positive value of that number. terminal arm lies on
Let P(x, y) be any point on the positive y-axis. Then, x = 0 and r = y. one of the axes
|-5| = -(-5)
examples are 0, 90,
=5 y
180, 270, and 360
P(0, y)  When b2 - 4ac = 0, there is one y
|-5| = 5 |+5| = 5
r=y = 90 distinct real root, or two equal
-6 -5 -4 -3 -2 -1 0 1 2 3 4 5 6 real roots. The graph of the
0 x corresponding function has one
5 units 5 units x-intercept.
In general, for any real number, the absolute value of a number a is 0 x
given by
The trigonometric ratios can be written as follows.
|a| ={ a , if a 0
-a , if a < 0 sin 90 = _
y
r cos 90 = _x
r tan 90 = _x
y
 When b2 - 4ac < 0, there are y
sin 90 = _ cos 90 = _ tan 90 = _
y 0 y
no real roots. The graph of the
y y 0
Example 1 Why is tan 90 corresponding function has no
sin 90 = 1 cos 90 = 0 tan 90 is undefined
undefined? x-intercepts.
Determining the Absolute Value of a Number
Your Turn
Evaluate the following. 0 x
a) |3| Use the diagram to determine the values of sin , cos , and tan for
b) |-7| quadrantal angles of 0, 180, and 270. Organize your answers in a table
as shown below.
Solution 90
y You can solve quadratic equations in a variety of ways. You may prefer
a) 3 is 3 units from 0 on the real-number line, so |3| = 3. (0, y), r = y some methods over others depending on the circumstances.
Also, |3| = 3 since |a| = a for a 0.
(-x, 0), r = x (x, 0), r = x
b) -7 is 7 units from 0 on the real-number line, so |-7| = 7. 180
0 x
0
Also, |-7| = -(-7)
=7 (0, -y), r = y
since |a| = -a for a < 0.
270
Your Turn
Evaluate the following. 0 90 180 270
a) |9| sin 1

b) |-12| cos 0
tan undefined

360 MHR Chapter 7 4.4 The Quadratic Formula MHR 253

2.2 Trigonometric Ratios of Any Angle MHR 93

viii MHR A Tour of Your Textbook


Check Your Understanding

Practise: These questions allow you to check your understanding of the


concepts. You can often do the first few questions by checking the Link
the Ideas notes or by following one of the worked Examples.

Apply: These questions ask you to apply what you have learned to solve
problems. You can choose your own methods of solving a variety of
problem types.

Extend: These questions may be more challenging. Many connect to


other concepts or lessons. They also allow you to choose your own
methods of solving a variety of problem types.

Create Connections: These questions focus your thinking on the Key


Ideas and also encourage communication. Many of these questions also
connect to other subject areas or other topics within mathematics.

Check Your Understanding 12. Matthew is investigating the old 14. The height of a circular
Borden Bridge, which spans the North arch is represented by r
Saskatchewan River about 50 km west of 4h2 - 8hr + s2 = 0, where h
Practise 3. Solve each equation by graphing the Saskatoon. The three parabolic arches of h is the height, r is the r
1. How many x-intercepts does each corresponding function. the bridge can be modelled using quadratic radius, and s is the span
s
quadratic function graph have? a) 0 = x 2 - 5x - 24 functions, where h is the height of the of the arch, all in feet.
a) f(x) b) 0 = -2r 2 - 6r arch above the bridge deck and x is the a) How high must an arch be to have a
6 horizontal distance of the bridge deck span of 64 ft and a radius of 40 ft?
c) h2 + 2h + 5 = 0
from the beginning of the first arch, both
f(x) = x2 b) How would this equation change if all the
4 d) 5x 2 - 5x = 30 7. Two consecutive even integers have a 10. A skateboarder jumps off a ledge in metres.
product of 168. at a skateboard park. His path measurements were in metres? Explain.
e) -z2 + 4z = 4 First arch:
2
a) What single-variable quadratic equation is modelled by the function 15. Two new hybrid vehicles accelerate
f) 0 = t 2 + 4t + 10 h(x) = -0.01x 2 + 0.84x
can be used to represent the product of h(d) = -0.75d2 + 0.9d + 1.5, where h at different rates. The Ultra Ranges
-4 -2 0 2 4 x 4. What are the roots of each quadratic Second arch:
the two numbers? is the height above ground and d is the acceleration can be modelled by the
equation? Where integral roots cannot h(x) = -0.01x 2 + 2.52x - 141.12
horizontal distance the skateboarder function d(t) = 1.5t 2, while the Edisons
b) f(x) be found, estimate the roots to the b) Determine the two numbers by graphing Third arch:
travels from the ledge, both in metres. can be modelled by the function
nearest tenth. the corresponding quadratic function. h(x) = -0.01x 2 + 4.2x - 423.36
f(x) = -x2 - 5x - 4
4 a) Write a quadratic equation to represent d(t) = 5.4t 2, where d is the distance, in
a) n2 - 10 = 0 8. The path of the stream of water a) What are the zeros of each quadratic metres, and t is the time, in seconds. The
the situation when the skateboarder
-6 -4 -2 0 2 x coming out of a fire hose can be function? Ultra Range starts the race at 0 s. At what
b) 0 = 3x 2 + 9x - 12 lands.
-4
approximated using the function b) What is the significance of the zeros in time should the Edison start so that both
c) 0 = -w 2 + 4w - 3 h(x) = -0.09x 2 + x + 1.2, where h b) At what distance from the base of
this situation? cars are at the same point 5 s after the race
-8 d) 0 = 2d2 + 20d + 32 is the height of the water stream and the ledge will the skateboarder land?
c) What is the total span of the starts? Express your answer to the nearest
x is the horizontal distance from the Express your answer to the nearest
-12 e) 0 = v 2 + 6v + 6 Borden Bridge? tenth of a second.
firefighter holding the nozzle, both tenth of a metre.
f) m2 - 10m = -21
c) f(x) in metres. 11. milie Heymans is a three-time D i d You Kn ow ?
12 a) What does the equation Canadian Olympic diving medallist.
Apply Suppose that for a dive off the 10-m
A hybrid vehicle uses two or more distinct
5. In a Canadian Football League game, the
-0.09x 2 + x + 1.2 = 0 represent power sources. The most common hybrid uses a
8 tower, her height, h, in metres, above
path of the football at one particular in this situation? combination of an internal combustion engine and
4
the surface of the water is given by the an electric motor. These are called hybrid electric
kick-off can be modelled using the b) At what maximum distance from the
f(x) = x2 + 2x + 4 function h(d) = -2d2 + 3d + 10, where vehicles or HEVs.
function h(d) = -0.02d2 + 2.6d - 66.5, building could a firefighter stand and
-6 -4 -2 0 2 x
d is the horizontal distance from the end
where h is the height of the ball and d iss still reach the base of the fire with
of the tower platform, in metres.
the horizontal distance from the kicking the water? Express your answer to the Create Connections
d) f(x) nearest tenth of a metre. a) Write a quadratic equation to represent
teams goal line, both in yards. A value 16. Suppose the value of a quadratic function
of h(d) = 0 represents the height of the the situation when milie enters
4 c) What assumptions did you make when is negative when x = 1 and positive when
the water.
ball at ground level. What horizontal solving this problem? x = 2. Explain why it is reasonable to
-4 0 4 8 12 16 x distance does the ball travel before it hits
ts b) What is milies horizontal distance assume that the related equation has a root
9. The HSBC Celebration of Light
-4 the ground? from the end of the tower platform between 1 and 2.
is an annual pyro-musical
6. Two numbers have a sum of 9 and a
when she enters the water? Express
-8 f(x) = 0.25x2 - 1.25x - 6 fireworks competition that 17. The equation of the axis of symmetry of
your answer to the nearest
product of 20. takes place over English Bay a quadratic function is x = 0 and one of
tenth of a metre.
a) What single-variable quadratic equation
ion in Vancouver. The fireworks the x-intercepts is -4. What is the other
2. What are the roots of the corresponding can be used to represent the product of are set off from a barge so they x-intercept? Explain using a diagram.
quadratic equations represented by the Extend
E
the two numbers? land on the water. The path of 18. The roots of the quadratic equation
13. For what values of k does the equation
1
graphs of the functions shown in #1? a particular fireworks rocket
b) Determine the two numbers by graphing
hing x 2 + 6x + k = 0 have 0 = x 2 - 4x - 12 are 6 and -2. How can
Verify your answers. is modelled by the function
n.
the corresponding quadratic function. you use the roots to determine the vertex
h(t) = -4.9(t - 3)2 + 47, where a) one real root?
of the graph of the corresponding function?
h is the rockets height above b) two distinct real roots?
the water, in metres, at time, t, c) no real roots?
in seconds.
a) What does the equation
4.1 Graphical Solutions of Quadratic Equations MHR 215 0 = -4.9(t - 3)2 + 47 4.1 Graphical Solutions of Quadratic Equations MHR 217
represent in this situation?
b) The fireworks rocket stays
D i d You Kn ow ?
lit until it hits the water.
For how long is it lit, to the milie Heymans, from Montral, Qubec, is only the
nearest tenth of a second? fth Canadian to win medals at three consecutive
Olympic Games.

216 MHR Chapter 4

Mini-Labs: These questions provide hands-on 23. MINI LAB Work in a group of three.
Step 1 Begin with a large sheet of graph paper
activities that encourage you to further explore and draw a square. Assume that the
area of this square is 1.

the concept you are learning. Step 2 Cut the square into 4 equal parts.
Distribute one part to each member
of your group. Cut the remaining part
into 4 equal parts. Again distribute one
part to each group member. Subdivide
the remaining part into 4 equal parts.
Suppose you could continue this
pattern indefinitely.

Step 3 Write a sequence for the fraction of


the original square that each student
received at each stage.
n 0 1 2 3 4
Fraction of
0
Paper

Step 4 Write the total area of paper each


student has as a series of partial sums.
What do you expect the sum to be?

A Tour of Your Textbook MHR ix


Other Features
Key Terms are listed on the Chapter Opener pages. Key Terms
You may already know the meaning of some of rational expression
non-permissible value
them. If not, watch for these terms the first time they
rational equation
are used in the chapter. The meaning is given in the
margin. Many definitions include visuals that help
clarify the term.

Some Did You Know? boxes provide additional information about


the meaning of words that are not Key Terms. Other boxes contain
interesting facts related to the math you are learning.

Did You K now ? D id Yo u K n ow?

In mathematics, the Fibonacci The first Ferris wheel was built for the 1853 Worlds
sequence is a sequence of Fair in Chicago. The wheel was designed by George
natural numbers named after Washington Gale Ferris. It had 36 gondola seats and
Leonardo of Pisa, also known reached a height of 80 m.
as Fibonacci. Each number is
the sum of the two preceding
numbers.
1, 1, 2, 3, 5, 8, 13,

Method 2: Use a Spreadsheet


In a spreadsheet, enter the table of values shown.
Then, use the spreadsheets graphing features.

Opportunities are provided to use a


variety of Technology tools. You can
use technology to explore patterns and
relationships, test predictions, and solve
The graph crosses the x-axis at the points (-5, 0) and (20, 0). The
x-intercepts of the graph, or zeros of the function, are -5 and 20.
Therefore, the roots of the equation are -5 and 20.
Method 3: Use a Graphing Calculator

problems. A technology approach is Graph the revenue function using a


graphing calculator. Adjust the
window settings of the graph until
you see the vertex of the parabola

usually provided as only one of a variety and the x-intercepts. Use the trace
or zero function to identify the
x-intercepts of the graph.
The graph crosses the x-axis at

of approaches and tools to be used to the points (-5, 0) and (20, 0).
The x-intercepts of the graph, or zeros of the function, are -5 and 20.
Therefore, the roots of the equation are -5 and 20.
Check for Methods 1, 2, and 3:

help you develop your understanding. Substitute the values x = -5 and x = 20 into the equation
0 = 100 + 15x - x 2.
Left Side Right Side Left Side Right Side
0 100 + 15x - x 2 0 100 + 15x - x 2
= 100 + 15(-5) - (-5)2 = 100 + 15(20) - (20)2
= 100 - 75 - 25 = 100 + 300 - 400
=0 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct. A dress price Why is one price change an
increase of $20 or a decrease of $5 will increase and the other a
decrease? Do both price changes
result in no revenue from dress sales. make sense? Why or why not?

4.1 Graphical Solutions of Quadratic Equations MHR 211

Web Links provide Internet


information related to some topics. We b Link
Log on to www.mhrprecalc11.ca To learn
earn more about
ab the Fibonacci sequence, go to
and you will be able to link to www.mhrprecalc11.ca and follow the links.
recommended Web sites.

x MHR A Tour of Your Textbook


A Chapter Review and a Practice Test Chapter 2 Review

appear at the end of each chapter. The Where necessary, express lengths to the
nearest tenth and angles to the nearest
3. A heat lamp is placed above a patients
arm to relieve muscle pain. According
to the diagram, would you consider the
degree.

review is organized by section number 2.1 Angles in Standard Position, pages 7487
1. Match each term with its definition from
the choices below.
reference angle of the lamp to be 30?
Explain your answer.
lamp
Chapter 2 Practice Test
y

so you can look back if you need help a) angle in standard position
b) reference angle
c) exact value
Multiple Choice
For #1 to #5, choose the best answer.
Short Answer
6. The point P(2, b) is on the terminal
d) sine law 30 arm of an angle, , in standard position.

with a question. The test includes e) cosine law


f) terminal arm 0
skin
x
1. Which angle in standard position has
a different reference angle than all
the others?
If cos = _ 1
___ and tan is negative, what
10
is the value of b?
g) ambiguous case A 125 B 155 7. Oak Bay in Victoria, is in the direction of

multiple choice, short answer, and A a formula that relates the lengths of the
sides of a triangle to the sine values of
its angles
4. Explain how to determine the measure
of all angles in standard position,
0 < 360, that have 35 for their
C 205 D 335
2. Which angle in standard position does not
have a reference angle of 55?
N57E from Ross Bay. A sailboat leaves
Ross Bay in the direction of N79E. After
sailing for 1.9 km, the sailboat turns and
reference angle. travels 1.1 km to reach Oak Bay.

extended response questions.


B a value that is not an approximation A 35 B 125
and may involve a radical 5. Determine the exact values of the sine, a) Sketch a diagram to represent the
cosine, and tangent ratios for each angle. C 235 D 305
C the final position of the rotating arm of
situation.
a) 225 3. Which is the exact value of cos 150?
an angle in standard position __ b) What is the distance between Ross Bay
D the acute angle formed by the terminal b) 120 A _1 B
_
3 and Oak Bay?
2__ 2
c) 330 8. In ABC, a = 10, b = 16, and A = 30.
C -_ D -_
arm and the x-axis 3 1
E an angle whose vertex is at the origin d) 135 2 2 a) How many distinct triangles can be
and whose arms are the x-axis and the 4. The expression that could be used to drawn given these measurements?
terminal arm determine the measure of angle is b) Determine the unknown measures in
2.2 Trigonometric Ratios of Any Angle,
F a formula that relates the lengths of the ABC.
pages 8899
sides of a triangle to the cosine value of 9. Rudy is 20 ft from each goal post when he

one of its angles 6. The point Q(-3, 6) is on the terminal arm shoots the puck along the ice toward the
of an angle, . 70 cm goal. The goal is 6 ft wide. Within what
G a situation that is open to two or more
interpretations a) Draw this angle in standard position. angle must he fire the puck to have a hope
2. Sketch each angle in standard position. b) Determine the exact distance from the 28 of scoring a goal?
34 cm
State which quadrant the angle terminates origin to point Q. G
20 ft
in and the measure of the reference angle. c) Determine the exact values for sin , A _
sin = __
sin 28
6 ft
70 34 R
a) 200 cos , and tan .
d) Determine the value of . B
_
sin
= __
sin 28 20 ft
P
b) 130 34 70
10. In PQR, P = 56, p = 10 cm, and
C cos = ___
c) 20 7. A reference angle has a terminal arm that 702 + 342 - 282
passes through the point P(2, -5). Identify 2(70)(34) q = 12 cm.
d) 330
the coordinates of a corresponding point D 2 = 342 + 702 - 2(34)(70)cos 28 a) Sketch a diagram of the triangle.
on the terminal arm of three angles in
5. For which of these triangles must you b) Determine the length of the unknown
standard position that have the same
consider the ambiguous case? side and the measures of the unknown
reference angle.
A In ABC, a = 16 cm, b = 12 cm, and angles.
c = 5 cm.
126 MHR Chapter 2 B In DEF, D = 112, e = 110 km, and
f = 65 km.
C In ABC, B = 35, a = 27 m, and the
height from C to AB is 21 m.
D In DEF, D = 108, E = 52, and
f = 15 cm.

Chapter 2 Practice Test MHR 129

A Cumulative Review and a Unit Test Cumulative Review, Chapters 12


appear at the end of each unit. The Chapter 1 Sequences and Series
1. Match each term to the correct expression. 6. Phytoplankton, or algae, is a nutritional
supplement used in natural health

review is organized by chapter. The test a) arithmetic sequence


b) geometric sequence
c) arithmetic series
Ltd. is located in Nanaimo, British
Columbia. The company can grow 10 t of
ton
programs. Canadian Pacific Phytoplankton

Unit 1 Test
d) geometric series day
marine phytoplankton on a regular 11-day

includes multiple choice, numerical e) convergent series


A 3, 7, 11, 15, 19, . . .
_1 + _
1 + ...
cycle. Assume this cycle continues.
a) Create a graph showing the amount of
phytoplankton produced for the first
Multiple Choice Numerical Response
B 5+1+ For #1 to #5, choose the best answer. Complete the statements in #6 to #8.
5 25 five cycles of production.

response, and written response C 1 + 2 + 4 + 8 + 16 + . . .


D 1, 3, 9, 27, 81, . . .
E 2 + 5 + 8 + 11 + 14 + . . .
b) Write the general term for the sequence
produced.
nce 1. Which of the following expressions could
represent the general term of the sequence
8, 4, 0, . . . ?
6. A coffee shop is holding its annual
fundraiser to help send a local child to
summer camp. The coffee shop plans to
c) How does the general term relate to the
donate a portion of the profit for every

questions. A tn = 8 + (n - 1)4
2. Classify each sequence as arithmetic or characteristics of the linear function
geometric. State the value of the common described by the graph? cup of coffee served. At the beginning of
B tn = 8 - (n - 1)4
difference or common ratio. Then, write the day, the owner buys the first cup of
7. The Living Shangri-La is the tallest C tn = 4n + 4
the next three terms in each sequence. coffee and donates $20 to the fundraiser.
building in Metro Vancouver. The ground nd
D tn = 8(-2)n - 1 If the coffee shop regularly serves another
a) 27, 18, 12, 8, . . . floor of the building is 5.8 m high, and
2. The expression for the 14th term of the 2200 cups of coffee in one day, they must
b) 17, 14, 11, 8, . . . each floor above the ground floor is
geometric sequence x, x3, x5, . . . is collect $ per cup to raise $350.
c) -21, -16, -11, -6, . . . 3.2 m high. There are 62 floors altogether,
er,
including the ground floor. How tall is A x13 7. An angle of 315 drawn in standard
d) 3, -6, 12, -24, . . . position has a reference angle of .
the building? B x14
3. For each arithmetic sequence, determine 8. The terminal arm of an angle, , in
C x 27
the general term. Express your answer in standard position lies in quadrant IV, and
D x 29 __
simplified form.
it is known that sin = - _ . The measure
3
a) 18, 15, 12, 9, . . . 3. The sum of the series 6 + 18 + 54 + . . . to 2
n terms is 2184. How many terms are in of is .
b) 1, _5 , 4, _
11 , . . .
2 2 the series?
4. Use the general term to determine t20 in the A 5 Written Response
geometric sequence 2, -4, 8, -16, . . . . B 7 9. Jacques Chenier is one of Manitobas
5. a) What is S12 for the arithmetic series with C 8 premier childrens entertainers. Jacques
a common difference of 3 and t12 = 31? D 6
was a Juno Award Nominee for his album
b) What is S5 for a geometric series where
Walking in the Sun. He has performed
4. Which angle has a reference angle of 55? in over 600 school fairs and festivals
t1 = 4 and t10 = 78 732?
A 35 across the country. Suppose there were
B 135 150 people in the audience for his first
performance. If this number increased by 5
C 235
for each of the next 14 performances, what
D 255
__ total number of people attended the first
5. Given the point P(x, 5 ) on the __
terminal 15 of Jacques Cheniers performances?
arm of angle , where sin = _ and
5
10. The third term in an arithmetic sequence
5
90 180, what is the exact value is 4 and the seventh term in the sequence
of cos ? is 24.
A _
3 a) Determine the value of the common
Cumulative Review, Chapters 12 MHR 133 5 difference.
B -_
3__
b) What is the value of t1?
5

C _
2__ c) Write the general term of the sequence.
5 d) What is the sum of the first 10 terms
__
D -_
25 of the sequence?
5

136 MHR Unit 1 Test

Answers are provided for the Practise, Apply, Extend, Create


Connections, Chapter Review, Practice Test, Cumulative Review, and
Unit Test questions. Sample answers are provided for questions that
have a variety of possible answers or that involve communication. If
you need help with a question like this, read the sample and then try
to give an alternative response.

Refer to the illustrated Glossary at the back of the student resource if


you need to check the exact meaning of mathematical terms.

If you want to find a particular math topic in Pre-Calculus 11, look


it up in the Index, which is at the back of the student resource. The
index provides page references that may help you review that topic.

A Tour of Your Textbook MHR xi


Unit 1

Patterns
Many problems are solved
using patterns. Economic
and resource trends may be
based on sequences and series.
Seismic exploration identifies
underground phenomena, such
as caves, oil pockets, and rock
layers, by transmitting sound
into the earth and timing the
echo of the vibration. Surveyors
use triangulation and the laws
of trigonometry to determine
distances between inaccessible
points. All of these activities
use patterns and aspects of the
mathematics you will encounter
in this unit.

Looking Ahead
In this unit, you will solve
problems involving
arithmetic sequences
and series
geometric sequences
and series
innite geometric series
sine and cosine laws

2 MHR Unit 1 Patterns


Unit 1 Project Canadas Natural Resources

Canada is a country rich with natural resources. Petroleum, minerals, and forests are
found in abundance in the Canadian landscape. Canada is one of the worlds leading
exporters of minerals, mineral products, and forest products. Resource development
has been a mainstay of Canadas economy for many years.

In this project, you will explore one of Canadas natural resources from the categories
of petroleum, minerals, or forestry. You will collect and present data related to your
chosen resource to meet the following criteria:
Include a log of the journey leading to the discovery of your resource.
In Chapter 1, you will provide data on the production of your natural resource. Here
you will apply your knowledge of sequences and series to show how production has
increased or decreased over time, and make predictions about future development of
your chosen resource.
In Chapter 2, you will use skills developed with trigonometry, including the sine law
and the cosine law to explore the area where your resource was discovered. You will
then explore the proposed site of your natural resource.

At the end of your project, you will encourage potential investors to participate in
the development of your resource. Your final project may take many forms. It may be
a written or visual presentation, a brochure, a video production, or a computer slide
show. Or, you could use the interactive features of a whiteboard.

In the Project Corner box at the end of most sections, you will find information and
notes about Canadas natural resources. You can use this information to help gather
data and facts about your chosen resource.

Unit 1 Patterns MHR 3


CHAPTER

1 Sequences and Series


Many patterns and designs linked to mathematics are found in nature
and the human body. Certain patterns occur more often than others.
Logistic spirals, such as the Golden Mean spiral, are based on the
Fibonacci number sequence. The Fibonacci sequence is often called
Natures Numbers.

13 8

8 8
13
2 1
2 1
1
1 5
3

3 5

The pattern of this logistic spiral is found in the chambered nautilus,


the inner ear, star clusters, cloud patterns, and whirlpools. Seed
growth, leaves on stems, petals on flowers, branch formations, and
rabbit reproduction also appear to be modelled after this logistic
spiral pattern.

There are many different kinds of sequences. In this chapter, you will
learn about sequences that can be described by mathematical rules.

We b Link
To learn
earn more about
a the Fibonacci sequence, go to
www.mhrprecalc11.ca and follow the links.

D i d You K n ow ?
Key Terms In mathematics, the Fibonacci
sequence geometric sequence sequence is a sequence of
arithmetic sequence common ratio natural numbers named after
Leonardo of Pisa, also known
common difference geometric series as Fibonacci. Each number is
general term convergent series the sum of the two preceding
numbers.
arithmetic series divergent series 1, 1, 2, 3, 5, 8, 13,

4 MHR Chapter 1
Career Link
Biomedical engineers combine biology,
engineering, and mathematical sciences to
solve medical and health-related problems.
Some research and develop artificial organs
and replacement limbs. Others design MRI
machines, laser systems, and microscopic
machines used in surgery. Many biomedical
engineers work in research and development
in health-related fields. If you have ever
taken insulin or used an asthma inhaler,
you have benefited from the work of
biomedical engineers.

We b Link
To learn
earn more about
a biomedical engineering, go to
www.mhrprecalc11.ca and follow the links.

Chapter 1 MHR 5
1.1
Arithmetic Sequences
Focus on . . .
deriving a rule for determining the general term of an
arithmetic sequence
determining t1, d, n, or tn in a problem that involves an
arithmetic sequence
describing the relationship between an arithmetic
sequence and a linear function
solving a problem that involves an arithmetic sequence

Comets are made of frozen lumps of gas and rock and are
often referred to as icy mudballs or dirty snowballs. In
1705, Edmond Halley predicted that the comet seen in
1531, 1607, and 1682 would be seen again in 1758. Halleys
prediction was accurate. This comet was later named in his
honour. The years in which Halleys Comet has appeared
approximately form terms of an arithmetic sequence. What
makes this sequence arithmetic?

Investigate Arithmetic Sequences

Staircase Numbers
A staircase number is the number of cubes needed
to make a staircase that has at least two steps.
Is there a pattern to the number of cubes
in successive staircase numbers?
How could you predict different
staircase numbers?

1 2 3 4 5 6 7 8 9 10
Columns
Part A: Two-Step Staircase Numbers
To generate a two-step staircase number, add the numbers
of cubes in two consecutive columns.
The first staircase number is the sum of the number of
cubes in column 1 and in column 2.
1 2

6 MHR Chapter 1
For the second staircase number, add the number of
cubes in columns 2 and 3.

2 3

For the third staircase number, add the number of


cubes in columns in 3 and 4.

3 4

1. Copy and complete the table for the number of cubes required
for each staircase number of a two-step staircase.
Term 1 2 3 4 5 6 7 8 9 10
Staircase Number
3 5
(Number of Cubes Required)

Part B: Three-Step Staircase Numbers


To generate a three-step staircase number, add the numbers of cubes
in three consecutive columns.
The first staircase number is the sum of the number of cubes in
column 1, column 2, and column 3.
For the second staircase number, add the number of cubes in columns
2, 3, and 4.
For the third staircase number, add the number of cubes in columns
3, 4, and 5.
2. Copy and complete the table for the number of cubes required
for each step of a three-step staircase.
Term 1 2 3 4 5 6 7 8 9 10
Staircase Number
6 9
(Number of Cubes Required)

3. The same process may be used for staircase numbers with more than
three steps. Copy and complete the following table for the number
cubes required for staircase numbers up to six steps.
Number of Steps in the Staircase
Term 2 3 4 5 6
1 3 6
2 5 9
3
4
5
6

1.1 Arithmetic Sequences MHR 7


4. Describe the pattern for the number of cubes in a two-step staircase.
5. How could you find the number of cubes in the 11th and 12th terms
of the two-step staircase?
6. Describe your strategy for determining the number of cubes required
for staircases with three, four, five, or six steps.

Reflect and Respond


sequence 7. a) Would you describe the terms of the number of cubes as a
an ordered list of sequence?
elements b) Describe the pattern that you observed.
8. a) In the sequences generated for staircases with more than two
steps, how is each term generated from the previous term?
b) Is this difference the same throughout the entire sequence?
9. a) How would you find the number of cubes required if you
were asked for the 100th term in a two-step staircase?
b) Derive a formula from your observations of the patterns that
would allow you to calculate the 100th term.
c) Derive a general formula that would allow you to calculate
the nth term.

Link the Ideas

Sequences
A sequence is an ordered list of objects. It contains elements or terms
that follow a pattern or rule to determine the next term in the sequence.
The terms of a sequence are labelled according to their position in the
sequence.
The first term of the sequence is t1. The first term of a sequence
The number of terms in the sequence is n. is sometimes referred to as a.
In this resource, the first term
The general term of the sequence is tn. This will be referred to as t1.
term is dependent on the value of n.
tn is read as t subscript n or
Finite and Infinite Sequences t sub n.

A finite sequence always has a finite number of terms.


Examples: 2, 5, 8, 11, 14
5, 10, 15, 20, , 100
An infinite sequence has an infinite number of terms. Every term is
followed by a new term.
Example: 5, 10, 15, 20,

8 MHR Chapter 1
Arithmetic Sequences
An arithmetic sequence is an ordered list of terms in which the arithmetic
difference between consecutive terms is constant. In other words, the sequence
same value or variable is added to each term to create the next term. a sequence in which
This constant is called the common difference. If you subtract the the difference between
consecutive terms is
first term from the second term for any two consecutive terms of the constant
sequence, you will arrive at the common difference.
common difference
The formula for the general term helps you find the terms of
the difference between
a sequence. This formula is a rule that shows how the value of tn
successive terms in an
depends on n. arithmetic sequence,
d = tn - tn - 1
Consider the sequence 10, 16, 22, 28, .
the difference may be
positive or negative
Terms t1 t2 t3 t4
for example, in the
Sequence 10 16 22 28 sequence 10, 16, 22,
Sequence Expressed Using 28, , the common
difference is 6
First Term and Common 10 10 + (6) 10 + (6) + (6) 10 + (6) + (6) + (6)
Difference
general term
General Sequence t1 + d + d t1 + d + d + d an expression for
t1 t1 + d
= t1 + 2d = t1 + 3d directly determining
any term of a sequence
The general arithmetic sequence is t1, t1 + d, t1 + 2d, t1 + 3d, ,
symbol is tn
where t1 is the first term and d is the common difference.
for example,
t1 = t1 tn = 3n + 2
t2 = t1 + d
t3 = t1 + 2d

tn = t1 + (n - 1)d

The general term of an arithmetic sequence is


tn = t1 + (n - 1)d
where t1 is the first term of the sequence
n is the number of terms
d is the common difference
tn is the general term or nth term

1.1 Arithmetic Sequences MHR 9


Example 1
Determine a Particular Term
A visual and performing arts group wants to hire a community events
leader. The person will be paid $12 for the first hour of work, $19 for
two hours of work, $26 for three hours of work, and so on.
a) Write the general term that you could use to determine the pay for any
number of hours worked.

b) What will the person get paid for 6 h of work?

Solution
State the sequence given in the problem.
t1 = 12 The common difference of the sequence may be found
t2 = 19 by subtracting any two consecutive terms. The common
difference for this sequence is 7.
t3 = 26 19 - 12 = 7
 26 - 19 = 7

The sequence is arithmetic with a common difference equal to 7.


Subtracting any two consecutive terms will result in 7.
Did Yo u Know ? a) For the given sequence, t1 = 12 and d = 7.
Use the formula for the general term of an arithmetic sequence.
The relation
tn = 7n + 5 may also tn = t1 + (n - 1)d
be written using tn = 12 + (n - 1)7 Substitute known values.
function notation: tn = 12 + 7n - 7
f(n) = 7n + 5.
tn = 7n + 5
The general term of the sequence is tn = 7n + 5.

b) For 6 h of work, the amount is the sixth term in the sequence.


Determine t6.

Method 1: Use an Equation


tn = t1 + (n - 1)d or tn = 7n + 5
t6 = 12 + (6 - 1)7 t6 = 7(6) + 5
t6 = 12 + (5)(7) t6 = 42 + 5
t6 = 12 + 35 t6 = 47
t6 = 47
The value of the sixth term is 47.
For 6 h of work, the person will be paid $47.

10 MHR Chapter 1
Method 2: Use Technology
You can use a calculator or spreadsheet to determine the sixth term of
the sequence.
Use a table.
You can generate a table of values and a graph to represent
the sequence.

The value of the sixth term is 47.


For 6 h of work, the person will be paid $47.

Your Turn
Many factors affect the growth of a child. Medical and health officials
encourage parents to keep track of their childs growth. The general
guideline for the growth in height of a child between the ages of 3 years
and 10 years is an average increase of 5 cm per year. Suppose a child was
70 cm tall at age 3.
a) Write the general term that you could use to estimate what the childs
height will be at any age between 3 and 10.
b) How tall is the child expected to be at age 10?

1.1 Arithmetic Sequences MHR 11


Example 2
Determine the Number of Terms
The musk-ox and the caribou of northern Canada are hoofed mammals
that survived the Pleistocene Era, which ended 10 000 years ago. In
1955, the Banks Island musk-ox population was approximately
9250 animals. Suppose that in subsequent
years, the growth of the musk-ox
population generated an arithmetic
sequence, in which the number of
musk-ox increased by approximately
1650 each year. How many years
would it take for the musk-ox
population to reach 100 000?

Solution
The sequence 9250, 10 900, 12 550, 14 200, , 100 000
is arithmetic.
For the given sequence,
First term t1 = 9250
Common difference d = 1650
nth term tn = 100 000
To determine the number of terms in the sequence, substitute the known
values into the formula for the general term of an arithmetic sequence.
tn = t1 + (n - 1)d
100 000 = 9250 + (n - 1)1650
100 000 = 9250 + 1650n - 1650
100 000 = 1650n + 7600
92 400 = 1650n
56 = n
There are 56 terms in the sequence.
It would take 56 years for the musk-ox population to reach 100 000.

Your Turn
Carpenter ants are large, usually black ants that make their colonies in
wood. Although often considered to be pests around the home, carpenter
ants play a significant role in a forested ecosystem. Carpenter ants begin
with a parent colony. When this colony is well established, they form
satellite colonies consisting of only the workers. An established colony
may have as many as 3000 ants. Suppose that the growth of the colony
produces an arithmetic sequence in which the number of ants increases
by approximately 80 ants each month. Beginning with 40 ants, how
many months would it take for the ant population to reach 3000?

12 MHR Chapter 1
Example 3
Determine t1, tn, and n
Jonathon has a part-time job at the local grocery store. He has been asked Yums BITES

to create a display of cereal boxes. The top six rows of his display are BITES Yums
Bits Bits
shown. The numbers of boxes in the rows produce an arithmetic
Bits Yu
ms Yums BITES
sequence. There are 16 boxes in the third row from the bottom, Bits Bits

and 6 boxes in the eighth row from the bottom. BITES Yums Bits BITES Yums BITES Bits Yums

a) How many boxes are in the bottom row? BITES Yums BITES Bits
BITES Yums Bits Yums BITES Bits

b) Determine the general term, tn, for the sequence. Bits Yums BITES Yums Bits Bits
BITES Yums BITES Bits Yums BITES

c) What is the number of rows of boxes in his display?

Solution
a) Method 1: Use Logical Reasoning
The diagram shows the top six rows. From the diagram, you can see What is the value of d if you
that the number of boxes per row decreases by 2 from bottom to top. go from top to bottom?

Therefore, d = -2.
You could also consider the fact that there are 16 boxes in the 3rd
row from the bottom and 6 boxes in the 8th row from the bottom.
This results in a difference of 10 boxes in 5 rows. Since the values
are decreasing, d = -2.
Substitute known values into the formula for the general term.
tn = t1 + (n - 1)d
16 = t1 + (3 - 1)(-2)
16 = t1 - 4
20 = t1
The number of boxes in the bottom row is 20.

Method 2: Use Algebra


Since t1 and d are both unknown, you can use two equations to
determine them. Write an equation for t3 and an equation for t8
using the formula for the general term of an arithmetic sequence.
tn = t1 + (n - 1)d
For n = 3 16 = t1 + (3 - 1)d
16 = t1 + 2d
For n = 8 6 = t1 + (8 - 1)d
6 = t1 + 7d

Subtract the two equations.


16 = t1 + 2d
6 = t1 + 7d
10 = -5d
-2 = d

1.1 Arithmetic Sequences MHR 13


Substitute the value of d into the first equation. Is there another way to
solve this problem? Work
16 = t1 + 2d
with a partner to discuss
16 = t1 + 2(-2) possible alternate methods.
16 = t1 - 4
20 = t1

The sequence for the stacking of the boxes is 20, 18, 16, .
The number of boxes in the bottom row is 20.

b) Use the formula for the general term of the sequence.


tn = t1 + (n - 1)d
tn = 20 + (n - 1)(-2)
tn = -2n + 22
The general term of the sequence is tn = -2n + 22.

c) The top row of the stack contains two boxes.


Use the general term to find the number of rows.
tn = -2n + 22
2 = -2n + 22
-20 = -2n
10 = n
The number of rows of boxes is 10.

Your Turn
Jonathon has been given the job of stacking cans in a
similar design to that of the cereal boxes. The numbers of
cans in the rows produces an arithmetic sequence. The
top three rows are shown. There are 14 cans in the 8th
row from the bottom and 10 cans in the 12th row from the
bottom. Determine t1, d, and tn for the arithmetic sequence.

Example 4
Generate a Sequence
A furnace technician charges $65 for making a house call, plus $42 per
hour or portion of an hour.
a) Generate the possible charges (excluding parts) for the first 4 h of
time.

b) What is the charge for 10 h of time?

14 MHR Chapter 1
Solution
a) Write the sequence for the first four hours.

Terms of the Sequence 1 2 3 4


How do you determine
Number of Hours Worked 1 2 3 4 the charge for the
Charges ($) 107 149 191 233 first hour?

The charges for the first 4 h are $107, $149, $191, and $233.

b) The charge for the first hour is $107. This is the first term.
The common difference is $42.
t1 = 107
d = 42
Substitute known values into the formula to determine the
general term.
tn = t1 +(n - 1)d
tn = 107 + (n - 1)42
tn = 107 + 42n - 42
tn = 42n + 65
Method 1: Use the General Term
The 10th term of the sequence may be generated by substituting 10
for n in the general term.
tn = 42n + 65
t10 = 42(10) + 65
t10 = 485
The charge for 10 h of work is $485.
Method 2: Use a Graph
The general term
tn = 42n + 65 is a function
that relates the charge to
the number of hours
worked. This equation
f (x) = 42x + 65 could be
graphed. The slope of 42 is
the common difference of
the sequence. The
y-intercept of 65 is the
initial charge for making a house call.

The terms may now be generated by either


tracing on the graph or accessing the table of values.

The charge for 10 h of work is $485.

Your Turn
What is the charge for 10 h if the furnace technician charges $45 for the
house call plus $46 per hour?

1.1 Arithmetic Sequences MHR 15


Key Ideas

A sequence is an ordered list of elements.


Elements within the range of the sequence are called terms of the sequence.
To describe any term of a sequence, an expression is used for tn, where n N.
This term is called the general term.
In an arithmetic sequence, each successive term is formed by adding a constant.
This constant is called the common difference.
The general term of an arithmetic sequence is
tn = t1 + (n - 1)d
where t1 is the first term
n is the number of terms (n N)
d is the common difference
tn is the general term or nth term

Check Your Understanding

Practise 4. For each arithmetic sequence determine


1. Identify the arithmetic sequences from the the values of t1 and d. State the missing
following sequences. For each arithmetic terms of the sequence.
sequence, state the value of t1, the value of a) , , , 19, 23
d, and the next three terms.
b) , , 3, _3
a) 16, 32, 48, 64, 80, 2
c) , 4, , , 10
b) 2, 4, 8, 16, 32,
5. Determine the position of the given term to
c) -4, -7, -10, -13, -16,
complete the following statements.
d) 3, 0, -3, -6, -9,
a) 170 is the th term of -4, 2, 8,
2. Write the first four terms of each arithmetic
sequence for the given values of t1 and d.
_1 _4
b) -14 is the th term of 2 , 2, 1 ,
5 5
a) t1 = 5, d = 3 c) 97 is the th term of -3, 1, 5,
b) t1 = -1, d = -4 d) -10 is the th term of 14, 12.5, 11,

c) t1 = 4, d = _1 6. Determine the second and third terms of


5 an arithmetic sequence if
d) t1 = 1.25, d = -0.25
a) the first term is 6 and the fourth term
3. For the sequence defined by tn = 3n + 8, is 33
find each indicated term.
b) the first term is 8 and the fourth term
a) t1 b) t7 c) t14 is 41
c) the first term is 42 and the fourth term
is 27

16 MHR Chapter 1
7. The graph of an arithmetic sequence 12. The numbers represented by x, y, and z
is shown. are the first three terms of an arithmetic
y sequence. Express z in terms of x and y.
30 13. Each square in this pattern has a side
length of 1 unit. Assume the pattern
25 continues.
20

15
Figure 1 Figure 2 Figure 3 Figure 4
10
a) Write an equation in which the
5
perimeter is a function of the figure
number.
0 2 4 6 8 10 12 x
b) Determine the perimeter of Figure 9.

a) What are the first five terms of the c) Which figure has a perimeter of
sequence? 76 units?
b) Write the general term of this sequence. 14. The Wolf Creek Golf Course, located
near Ponoka, Alberta, has been the site
c) What is t50? t200?
of the Canadian Tour Alberta Open Golf
d) Describe the relationship between the Championship. This tournament has a
slope of the graph and your formula maximum entry of 132 players. The tee-off
from part b). times begin at 8:00 and are 8 min apart.
e) Describe the relationship between the a) The tee-off times generate an arithmetic
y-intercept and your formula from sequence. Write the first four terms of
part b). the arithmetic sequence, if the first
tee-off time of 8:00 is considered to
Apply be at time 0.
8. Which arithmetic sequence(s) contain the
b) Following this schedule, how many
term 34? Justify your conclusions. players will be on the course after 1 h,
A tn = 6 + (n - 1)4 if the tee-off times are for groups of
B tn = 3n - 1 four?
C t1 = 12, d = 5.5 c) Write the general term for the sequence
D 3, 7, 11, of tee-off times.

9. Determine the first term of the arithmetic d) At what time will the last group tee-off?
sequence in which the 16th term is 110 e) What factors might affect the
and the common difference is 7. prearranged tee-off time?
10. The first term of an arithmetic sequence
D i d You K n ow ?
is 5y and the common difference is -3y.
Write the equations for tn and t15. The first championship at Wolf Creek was held in
1987 and has attracted PGA professionals, including
11. The terms 5x + 2, 7x - 4, and 10x + 6 Mike Weir and Dave Barr.
are consecutive terms of an arithmetic
sequence. Determine the value of x and
state the three terms.

1.1 Arithmetic Sequences MHR 17


15. Lucy Angoyuaq, from Baker Lake, 17. Hydrocarbons are the starting points in
Nunavut, is a prominent wall hanging the formation of thousands of products,
artist. This wall hanging is called Geese including fuels, plastics, and synthetic
and Ulus. It is 22 inches wide and fibres. Some hydrocarbon compounds
27 inches long and was completed in contain only carbon and hydrogen atoms.
27 days. Suppose on the first day she Alkanes are saturated hydrocarbons that
completed 48 square inches of the wall have single carbon-to-carbon bonds. The
hanging, and in the subsequent days the diagrams below show the first three alkanes.
sequence of cumulative areas completed by H
the end of each day produces an arithmetic H H

sequence. How much of the wall hanging H C


H C C H
H
did Lucy complete on each subsequent H
H H
day? Express your answer in square inches.
Methane Ethane
H H

H C H
C
C
H H
H
H
Propane

a) The number of hydrogen atoms


compared to number of carbon atoms
produces an arithmetic sequence. Copy
and complete the following chart to
show this sequence.
Carbon Atoms 1 2 3 4
Hydrogen Atoms 4

b) Write the general term that relates


the number of hydrogen atoms to the
number of carbon atoms.
c) Hectane contains 202 hydrogen atoms.
The Inuktitut syllabics appearing at the bottom of How many carbon atoms are required to
this wall hanging spell the artists name. For example, support 202 hydrogen atoms?
the rst two syllabics spell out Lu-Si.
18. The multiples of 5 between 0 and 50
16. Susan joined a fitness class at her local produces the arithmetic sequence 5, 10,
gym. Into her workout, she incorporated a 15, , 45. Copy and complete the following
sit-up routine that followed an arithmetic table for the multiples of various numbers.
sequence. On the 6th day of the program, Multiples of 28 7 15
Susan performed 11 sit-ups. On the 15th
1 and 500 and 50 and
day she did 29 sit-ups. Between 1000 600 500
a) Write the general term that relates the First Term, t1
number of sit-ups to the number of
Common
days.
Difference, d
b) If Susans goal is to be able to do
nth Term, tn
100 sit-ups, on which day of her
General Term
program will she accomplish this?
Number of Terms
c) What assumptions did you make to
answer part b)?

18 MHR Chapter 1
19. The beluga whale is one of the major 22. Canadian honey is recognized around
attractions of the Vancouver Aquarium. the world for its superior taste and
The beluga whale typically forages for quality. In Saskatchewan in 1986,
food at a depth of 1000 ft, but will dive there were 1657 beekeepers operating
to at least twice that depth. To build the 105 000 colonies. Each colony produced
aquarium for the whales, engineers had approximately 70 kg
to understand the pressure of the water at of honey. In 2007, the
such depths. At sea level the pressure is number of beekeepers
14.7 psi (pounds per square inch). Water was reduced to
pressure increases at a rate of 14.7 psi for 1048. Assume that
every 30 ft of descent. the decline in the
a) Write the first four terms of the number of beekeepers
sequence that relates water pressure to generates an
feet of descent. Write the general term arithmetic sequence.
of this sequence. Determine the change
in the number of
b) What is the water pressure at a depth
beekeepers each year
of 1000 ft? 2000 ft?
from 1986 to 2007.
c) Sketch a graph of the water pressure
23. The Diavik Diamond Mine is located on
versus 30-ft water depth charges.
East Island in Lac de Gras East, Northwest
d) What is the y-intercept of the graph? Territories. The diamonds that are
e) What is the slope of the graph? extracted from the mine were brought to
f) How do the y-intercept and the slope surface when the kimberlite rock erupted
relate to the formula you wrote in 55 million years ago. In 2003, the first
part a)? production year of the mine, 3.8 million
carats were produced. Suppose the life
D id Yo u Kn ow?
expectancy of the mine is 20 years, and the
In 2008, the beluga was listed on the near- number of diamond carats expected to be
threatened list by the International Union for the extracted from the mine in the 20th year
Conservation of Nature.
is 113.2 million carats. If the extraction
20. The side lengths of a quadrilateral produce of diamonds produces an arithmetic
an arithmetic sequence. If the longest side sequence, determine the common
has a length of 24 cm and the perimeter difference. What does this value represent?
is 60 cm, what are the other side lengths?
Explain your reasoning.
21. Earth has a daily rotation of 360. One
degree of rotation requires 4 min.
a) Write the sequence of the first five
terms relating the number of minutes
to the number of degrees of rotation.
b) Write an equation that describes this
sequence.
c) Determine the time taken for a rotation
of 80.

1.1 Arithmetic Sequences MHR 19


Extend b) Write the general term that defines
24. Farmers near Raymond, Alberta, use a this sequence.
wheel line irrigation system to provide c) What assumptions did you make for
water to their crops. A pipe and sprinkler your calculation in part b)?
system is attached to a motor-driven wheel d) At what time was the sun completely
that moves the system in a circle over a eclipsed by the moon?
field. The first wheel is attached 50 m from
the pivot point, and all the other wheels We b Link
are attached at 20-m intervals further along To learn
earn more about
a a solar eclipse, go to
the pipe. Determine the circumference of www.mhrprecalc11.ca and follow the links.
the circle traversed by wheel 12.

Create Connections
26. Copy and complete the following sentences
using your own words. Then, choose
symbols from the box below to create true
statements. The boxes to the right of each
sentence indicate how many symbols are
needed for that sentence.

t1 n tn < d > 0 1 =

25. A solar eclipse is considered to be one a) An arithmetic sequence is an increasing


of the most awe-inspiring spectacles in sequence if and only if   .
all of nature. The total phase of a solar b) An arithmetic sequence is a decreasing
eclipse is very brief and rarely lasts more sequence if and only if   .
than several minutes. The diagram below c) An arithmetic sequence is constant if
shows a series of pictures taken of a solar and only if   .
eclipse similar to the one that passed over
d) The first term of a sequence is .
Nunavut on August 1, 2008.
e) The symbol for the general term of a
1 2 3 4 5 6
sequence is .
27. Copy and complete the following graphic
13:54 13:59 14:04 14:09 14:14 organizer by recording the observations
7 8 9 10 11 12 you made about an arithmetic sequence.
For example, include such things as the
common difference and how the sequence
13 14 15 16 17 18 relates to a function. Compare your graphic
organizer with that of a classmate.

Common
Definition
19 20 21 22 23 24 Difference

Arithmetic
a) Write the first five terms of the Sequence
sequence that relates the time to the
picture number. State the values of t1
and d. Example General Term

20 MHR Chapter 1
28. MINI LAB Step 3 Investigate the effect of the common
difference on an arithmetic sequence
Step 1 Create or use a spreadsheet as shown
by changing the values in Cell D2.
below.
a) What effect does changing this
What is the shape of the graph that value have on the graph?
models the arithmetic sequence?
b) How does an increase in the
Could an arithmetic sequence graph
common difference affect the shape
have any other shape? Explain.
of the graph? What happens as the
Step 2 Explore the effect that the first term common difference decreases?
has on the terms of the sequence by
Step 4 If a line were drawn through the data
changing the value in Cell C2.
values, what would be its slope?
a) As the value of the first term
Step 5 What relationship does the slope of
increases, what is the effect on
the line have to the equation for the
the graph? What happens as the
general term of the sequence?
value of the first term decreases?
b) Does the graph keep its
shape? What characteristics
of the graph stay the same?

Project Corner Minerals

A telephone contains over 40 different minerals, a television set has about 35,
and an automobile about 15.
Of the approximately 193 000 metric tonnes of gold discovered, 62% is found
in just four countries on Earth. All the gold discovered so far would fit in a
cube of side length 22 m.
Of the approximately 1 740 000 metric tonnes of silver discovered, 55% is
found in just four countries on Earth. All the silver discovered so far would
fit in a cube of side length 55 m.
In the average 1360-kg car there are approximately 110 kg of aluminum, 20 kg
of copper, 10 kg of zinc, 113 kg of plastics, and 64 kg of rubber.
Canada is the worlds largest potash producer.

1.1 Arithmetic Sequences MHR 21


1.2
Arithmetic Series
Focus on . . .
deriving a rule for determining the sum of an arithmetic series
determining the values of t1, d, n, or Sn in an arithmetic series
solving a problem that involves an arithmetic series

Carl Friedrich Gauss was a mathematician born in


Braunschweig, Germany, in 1777. He is noted for his
significant contributions in fields such as number theory,
statistics, astronomy, and differential geometry. When
Gauss was 10, his mathematics teacher challenged the
class to find the sum of the numbers from 1 to 100.
Believing that this task would take some time, the teacher
was astounded when Gauss responded with the correct
answer of 5050 within minutes.
Gauss used a faster method than adding each individual term.
First, he wrote the sum twice, once in ascending order and the other We b Link
in a descending order. Gauss then took the sum of the two rows.
To learn
earn more about
ab
1 + 2 + 3 + 4 + + 99 + 100 Carl Gauss, go to
100 + 99 + + 4 + 3 + 2 + 1 www.mhrprecalc11.ca
and follow the links.
101 + 101 + + 101 + 101
What do you think Gauss did next?

Investigate Arithmetic Series

Materials In the following investigation, work with a partner to discuss


30 counting disks your findings.
grid paper Part A: Explore Gausss Method
1. a) Consider the sequence of positive
integers 1, 2, 3, 4, 5. Represent
each number by a small counting 5
Number of Disks

disk and arrange them in a 4


triangular table in which the
number of disks in each column 3
represents the integer. 2
b) What is the sum of the numbers
1
in the sequence?
1 2 3 4 5
c) How is the sum related to the Positive Integers
total number of disks used?

22 MHR Chapter 1
2. a) Duplicate the triangle of disks.
b) Rotate your new triangle 180. Join the two triangles together to
form a rectangle.
c) How many disks form the length of the rectangle? the width?
d) How many disks are in the area of the rectangle?
e) How is the area of the rectangle related to the sum of the sequence
1, 2, 3, 4, 5?

Reflect and Respond


3. Explain how you could use the results from steps 1 and 2 to find
the sum of n consecutive integers. Use the idea of the area of
the rectangle to develop a formula that would find the sum of n
consecutive integers.
4. Explain how this method is related to the method Gauss used.

Part B: Construct a Squared Spiral


5. Start from the centre of
the grid.
a) Draw a segment of length
1 unit, vertically up.
b) From the end of that
segment, draw a new
segment that is 1 unit longer
than the previous segment,
to the right.
c) From the end of this
segment, draw a new
segment that is 1 unit longer
than the previous segment, vertically down.
d) Continue this through 14 segments.
6. a) Record the lengths of the segments as an arithmetic sequence.
b) What is the total length of the spiral?
c) Explain how you calculated the total length of the spiral.

Reflect and Respond


7. a) Use Gausss method to calculate the sum of the first 14 terms of
your sequence. Is the sum the same as your sum from step 6?
b) In using Gausss method, what sum did you find for each pair of
numbers? How many terms were there?
8. Derive a formula that you could use to find the total length if there
were 20 segments for the spiral.

1.2 Arithmetic Series MHR 23


Link the Ideas

In determining the sum of the numbers from 1 to 100, Gauss had


arithmetic series discovered the underlying principles of an arithmetic series.
a sum of terms that Sn is read as S
Sn represents the sum of the first n terms of a series.
form an arithmetic subscript n or S sub n.
sequence In the series 2 + 4 + 6 + 8 + , S4 is the sum of the first four terms.
for the arithmetic
sequence 2, 4, 6, 8, You can use Gausss method to derive a formula for the sum of the
the arithmetic series general arithmetic series.
is represented by
2 + 4 + 6 + 8. The general arithmetic series may be written as
t1 + (t1 + d) + (t1 + 2d) + + [(t1 + (n - 3)d] + [(t1 + (n - 2)d]
+ [(t1 + (n - 1)d]
For this series, t1 is the first term
n is the number of terms
d is the common difference
Use Gausss method.
Write the series twice, once in ascending order and the other in
descending order. Then, sum the two series.
Sn = t1 + (t1 + d) + + [t1 + (n - 2)d] + [t1 + (n - 1)d]
Sn = [t1 + (n - 1)d] + [t1 + (n - 2)d] + + (t1 + d) + t1
2Sn = [2t1 + (n - 1)d] + [2t1 + (n - 1)d] + + [2t1 + (n - 1)d] + [2t1 + (n - 1)d]
2Sn = n[2t1 + (n - 1)d]
Sn = _n [2t + (n - 1)d]
2 1

The sum of an arithmetic series can be determined using the formula


Sn = _
n [2t + (n - 1)d]
2 1
where t1 is the first term
n is the number of terms
d is the common difference
Sn is the sum of the first n terms

A variation of this general formula can be derived by substituting tn for


the formula for the general term of an arithmetic sequence.

Sn = _
n [2t + (n - 1)d]
2 1
Sn = _
n [t + t + (n - 1)d] Since tn = t1 + (n - 1)d.
2 1 1

Sn = _ (t1 + tn)
n
2
The sum of an arithmetic series can be determined using the formula
Sn = _
n (t + t )
2 1 n
How would you need to express the
where t1 is the first term
last terms of the general arithmetic
n is the number of terms
series in order to directly derive this
tn is the nth term formula using Gausss method?
Sn is the sum of the first n terms

24 MHR Chapter 1
Example 1
Determine the Sum of an Arithmetic Series
Male fireflies flash in various patterns to signal location or to ward off
predators. Different species of fireflies have different flash characteristics,
such as the intensity of the flash, the rate of the flash, and the shape of
the flash. Suppose that under certain circumstances, a particular firefly
flashes twice in the first minute, four times in the second minute, and
six times in the third minute.
a) If this pattern continues, what is the number of flashes in the 30th minute?

b) What is the total number of flashes in 30 min?

Solution
a) Method 1: Use Logical Reasoning Method 2: Use the General Term
The firefly flashes twice in the first For this arithmetic sequence,
minute, four times in the second First term t1 = 2
minute, six times in the third Common difference d = 2
minute, and so on. Number of terms n = 30
The arithmetic sequence produced Substitute these values into the
by the number of flashes is 2, 4, 6, formula for the general term.
Since the common difference in
tn = t1 + (n - 1)d
this sequence is 2, the number of
t30 = 2 + (30 - 1)2
flashes in the 30th minute is the
t30 = 2 + (29)2
30th multiple of 2.
t30 = 60
30 2 = 60
The number of flashes in the 30th The number of flashes in the
minute is 60. 30th minute is 60.

b) Method 1: Use the Formula Sn = _n (t + tn) What information do you


2 1

=_n (t + t ) need to use this formula?


Sn
2 1 n

S30 _
= 30 (2 + 60) Substitute the values of n, t1, and tn.
2
S30 = 15(62)
S30 = 930
Method 2: Use the Formula Sn = _
n [2t + (n - 1)d] What information do you
2 1
_
n
Sn = [2t1 + (n - 1)d]
need to use this formula?
2
S30 = _
30 [2(2) + (30 - 1)(2)] Substitute the values of n, t1, and d.
2
S30 = 15(62)
S30 = 930
The total number of flashes for the male Which formula is most
firefly in 30 min is 930. effective in this case? Why?

Your Turn
Determine the total number of flashes for the male firefly in 42 min.

1.2 Arithmetic Series MHR 25


Example 2
Determine the Terms of an Arithmetic Series
The sum of the first two terms of an arithmetic series is 13 and the sum
of the first four terms is 46. Determine the first six terms of the series
and the sum to six terms.

Solution
For this series,
S2 = 13
S4 = 46

Substitute into the formula Sn = _n [2t + (n - 1)d] for both sums.


2 1
For S2: For S4:
Sn = _
n [2t + (n - 1)d] Sn = _ n [2t + (n - 1)d]
2 1 2 1
_
2
S2 = [2t1 + (2 - 1)d] _4
S4 = [2t1 + (4 - 1)d]
2 2
13 = 1[2t1 + (1)d] 46 = 2[2t1 + (3)d]
13 = 2t1 + d 23 = 2t1 + 3d
Solve the system of two equations.
13 = 2t1 + d q
23 = 2t1 + 3d w
-10 = -2d q-w
5=d
Substitute d = 5 into one of the equations.
13 = 2t1 + d
13 = 2t1 + 5
8 = 2t1
4 = t1
With t1 = 4 and d = 5, the first six terms of the series are
4 + 9 + 14 + 19 + 24 + 29.
The sum of the first six terms is
Sn = _
n [2t + (n - 1)d] or Sn = _
n (t + t ) Which formula do you
2 1 2 1 n
prefer to use? Why?
_
6
S6 = [2(4) + (6 - 1)5] _
6
S6 = (4 + 29)
2 2
S6 = 3(8 + 25) S6 = 3(33)
S6 = 99 S6 = 99

Your Turn
The sum of the first two terms of an arithmetic series is 19 and the sum
of the first four terms is 50. What are the first six terms of the series and
the sum to 20 terms?

26 MHR Chapter 1
Key Ideas

Given the sequence t1, t2, t3, t4, , tn the associated series is Sn = t1 + t2 + t3 + t4 + + tn.
For the general arithmetic series,
t1 + (t1 + d) + (t1 + 2d) + + (t1 + [n - 1]d) or
t1 + (t1 + d) + (t1 + 2d) + + (tn - d) + tn,
the sum of the first n terms is
Sn = _n [2t + (n - 1)d] or S = _ n (t + t ),
2 1 n 2 1 n

where t1 is the first term


n is number of terms
d is the common difference
tn is the nth term
Sn is the sum to n terms

Check Your Understanding

Practise 4. Determine the value of the first term, t1,


1. Determine the sum of each arithmetic for each arithmetic series described.
series. a) d = 6, Sn = 574, n = 14
a) 5 + 8 + 11 + + 53 b) d = -6, Sn = 32, n = 13
b) 7 + 14 + 21 + + 98 c) d = 0.5, Sn = 218.5, n = 23
c) 8 + 3 + (-2) + + (-102) d) d = -3, Sn = 279, n = 18
d) _2 + _5 + _8 + + _
41 5. For the arithmetic series, determine
3 3 3 3
the value of n.
2. For each of the following arithmetic series,
a) t1 = 8, tn = 68, Sn = 608
determine the values of t1 and d, and the
value of Sn to the indicated sum. b) t1 = -6, tn = 21, Sn = 75
a) 1 + 3 + 5 + (S ) 8
6. For each series find t10 and S10.
b) 40 + 35 + 30 + (S11) a) 5 + 10 + 15 +
c) _1 + _3 + _5 + (S ) b) 10 + 7 + 4 +
2 2 2 7

d) (-3.5) + (-1.25) + 1 + (S6) c) (-10) + (-14) + (-18) +


3. Determine the sum, Sn, for each arithmetic d) 2.5 + 3 + 3.5 +
sequence described.
a) t1 = 7, tn = 79, n = 8 Apply
7. a) Determine the sum of all the multiples
b) t1 = 58, tn = -7, n = 26
of 4 between 1 and 999.
c) t1 = -12, tn = 51, n = 10
b) What is the sum of the multiples of 6
d) t1 = 12, d = 8, n = 9 between 6 and 999?
e) t1 = 42, d = -5, n = 14

1.2 Arithmetic Series MHR 27


8. Its About Time, in Langley, British 13. At the sixth annual Vancouver
Columbia, is Canadas largest custom clock Canstruction Competition, architects and
manufacturer. They have a grandfather engineers competed to see whose team
clock that, on the hours, chimes the could build the most spectacular structure
number of times that corresponds to the using little more than cans of food.
time of day. For example, at 4:00 p.m., it
chimes 4 times. How many times does the
clock chime in a 24-h period?
9. A training program requires a pilot to fly
circuits of an airfield. Each day, the pilot
flies three more circuits than the previous
day. On the fifth day, the pilot flew 14
circuits. How many circuits did the
pilot fly
a) on the first day?
A Breach in Hunger
b) in total by the end of the fifth day?
c) in total by the end of the nth day?
10. The second and fifth terms of an arithmetic
The UnBEARable Truth
series are 40 and 121, respectively.
Determine the sum of the first 25 terms of Stores often stack
the series. cans for display
11. The sum of the first five terms of an purposes, although
arithmetic series is 85. The sum of the first their designs are not
six terms is 123. What are the first four usually as elaborate
terms of the series? as the ones shown
above. To
12. Galileo noticed a relationship between
calculate the
the distance travelled by a falling object
number of cans
and time. Suppose data show that when
in a display, an
an object is dropped from a particular
arithmetic
height it moves approximately 5 m during
series may be
the first second of its fall, 15 m during
used. Suppose a
the second second, 25 m during the third
store wishes to stack the cans in a pattern
second, 35 during the fourth second,
similar to the one shown. This display has
and so on. The formula describing the
one can at the top and each row thereafter
approximate distance, d, the object is from
adds one can. If there are 18 rows, how
its starting position n seconds after it has
many cans in total are there in the display?
been dropped is d(n) = 5n2.
a) Using the general formula for the
D i d You K n ow ?
sum of a series, derive the formula
d(n) = 5n2. The Vancouver Canstruction Competition
aids in the fight against hunger. At the end of
b) Demonstrate algebraically, using the competition, all canned food is donated to
n = 100, that the sum of the series food banks.
5 + 15 + 25 + is equivalent to
d(n) = 5n2.

28 MHR Chapter 1
14. The number of handshakes between Extend
6 people where everyone shakes hands 16. A number of interlocking rings each 1 cm
with everyone else only once may be thick are hanging from a peg. The top ring
modelled using a hexagon. If you join has an outside diameter of 20 cm. The
each of the 6 vertices in the hexagon to outside diameter of each of the outer rings
every other point in the hexagon, there are is 1 cm less than that of the ring above it.
1 + 2 + 3 + 4 + 5 lines. Therefore, there The bottom ring has an outside diameter
are 15 lines. of 3 cm. What is the distance from the
A top of the top ring to the bottom of the
bottom ring?

F B

20 cm

E C

a) What does the series 1 + 2 + 3 + 4 + 5


represent?
b) Write the series if there are 10 people
in the room and everyone shakes hands 3 cm
with everyone else in the room once.
c) How many handshakes occur in a room 17. Answer the following as either true or
of 30 people? false. Justify your answers.
d) Describe a similar situation in which a) Doubling each term in an arithmetic
this method of determining the number series will double the sum of the series.
of handshakes may apply. b) Keeping the first term constant and
15. The first three terms of an arithmetic doubling the number of terms will
sequence are given by x, (2x - 5), 8.6. double the sum of the series.
a) Determine the first term and the c) If each term of an arithmetic sequence
common difference for the sequence. is multiplied by a fixed number, the
b) Determine the 20th term of the resulting sequence will always be an
sequence. arithmetic sequence.
c) Determine the sum of the first 20 terms
of the series.

1.2 Arithmetic Series MHR 29


18. The sum of the first n terms of an Create Connections
arithmetic series is Sn = 2n2 + 5n. 21. An arithmetic series was defined where
a) Determine the first three terms of this t1 = 12, n = 16, d = 6, and tn = 102. Two
series. students were asked to determine the sum
b) Determine the sum of the first 10 terms of the series. Their solutions are shown
of the series using the arithmetic sum below.
formula. Pierres solution:
c) Determine the sum of the first 10 terms Sn = _
n (t + t )
2 1 n

S16 = _ (12 + 102)


of the series using the given formula. 16
d) Using the general formula for the sum 2
of an arithmetic series, show how the S16 = 8(114)
formulas in parts b) and c) are equal. S16 = 912
19. Nathan Gerelus is a Manitoba farmer Jeanettes solution:
preparing to harvest his field of wheat. Sn = _
n [2t + (n - 1)d]
Nathan begins harvesting the crop at 2 1
11:00 a.m., after the morning dew has S16 = _
16 [2(12) + (16 - 1)6]
2
evaporated. By the end of the first hour
S16 = 8(24 + 90)
he harvests 240 bushels of wheat. Nathan
challenges himself to increase the number S16 = 912
of bushels harvested by the end of each Both students arrived at a correct answer.
hour. Suppose that this increase produces Explain how both formulas lead to the
an arithmetic series where Nathan correct answer.
harvests 250 bushels in the second hour, 22. The triangular arrangement shown consists
260 bushels in the third hour, and so on. of a number of unit triangles. A unit
a) Write the series that would illustrate triangle has side lengths equal to 1. The
the amount of wheat that Nathan series for the total number of unit triangles
has harvested by the end of the in the diagram is 1 + 3 + 5 + 7.
seventh hour. a) How many unit triangles are there
b) Write the general sum formula that if there are 10 rows in the triangular
represents the number of bushels of arrangement?
wheat that Nathan took off the field by b) Using the sum of a series, show how the
the end of the nth hour. sum of the blue unit triangles plus the
c) Determine the total number of bushels sum of the green unit triangles results
harvested by the end of the seventh in your answer from part a).
hour.
d) State any assumptions that you made.
20. The 15th term in an arithmetic sequence
is 43 and the sum of the first 15 terms of
the series is 120. Determine the first three
terms of the series.

30 MHR Chapter 1
23. Bowling pins and snooker balls are often
arranged in a triangular formation. A
triangular number is a number that can
be represented by a triangular array
of dots. Each triangular number is an
arithmetic series. The sequence 1, (1 + 2),
(1 + 2 + 3), (1 + 2 + 3 + 4), gives the
first four triangular numbers as 1, 3, 6,
and 10.
1 3 6 10

a) What is the tenth triangular number?


b) Use the general formula for the sum of
an arithmetic series to show that the
nth triangular number is _n (n + 1).
2

Project Corner Diamond Mining

In 1991, the first economic diamond deposit


was discovered in the Lac de Gras area of
the Northwest Territories. In October
1998, Ekati diamond mine opened
about 300 km northeast of Yellowknife.
By April 1999, the mine had produced
one million carats. Ekatis average
production over its projected 20-year life is
expected to be 3 to 5 million carats per year.
Diavik, Canadas second diamond mine, began
production in January 2003. During its projected
20-year life, average diamond production from A polar bear diamond is a certified
this mine is expected to be about 8 million carats Canadian diamond mined, cut, and
per year, which represents about 6% of the polished in Yellowknife.
worlds total supply.

1.2 Arithmetic Series MHR 31


1.3
Geometric Sequences
Focus on . . .
providing and justifying an example of a geometric sequence
deriving a rule for determining the general term of a geometric
sequence
solving a problem that involves a geometric sequence

Many types of sequences can be found in nature. The


Fibonacci sequence, frequently found in flowers, seeds,
and trees, is one example. A geometric sequence can be
approximated by the orb web of the common garden
spider. A spiders orb web is an impressive architectural
feat. The web can capture the beauty of the morning
dew, as well as the insects that the spider may feed
upon. The following graphic was created to represent an
approximation of the geometric sequence formed by the
orb web.

60.75 mm

40.5 mm

27 mm
geometric sequence
18 mm a sequence in which
the ratio of consecutive
12 mm
terms is constant
8 mm
hub

The capture spiral is constructed by the spider starting on the


outside edge of the web frame, and winding inward toward the hub.
The lengths of the sections of the silk between the radii for this
section of the spiral produce a geometric sequence. What makes this
sequence geometric?

Did Yo u Know ?

An orb web is a round spider web with a pattern of lines in a


spiral formation.

32 MHR Chapter 1
Investigate a Geometric Sequence

Coin Toss Outcomes Materials


Work with a partner for the following activity. 3 coins

1. a) Toss a single coin. How many possible outcomes are there?


b) Toss two coins. How many possible outcomes are there?
c) Create a tree diagram to show the possible outcomes for
three coins.
2. Copy the table. Continue the pattern to complete the table.

Number of Number of Expanded Using


Coins, n Outcomes, tn Form Exponents
1 2 (2) 21
2 4 (2)(2) 22
3
4
   
n

3. a) As the number of coins increases, a sequence is formed by


the number of outcomes. What are the first four terms of
this sequence?
b) Describe how the terms of the sequence are related. Is this
relationship different from an arithmetic sequence? Explain.
c) Predict the next two terms of the sequence. Describe the method
you used to make your prediction.
d) Describe a method you could use to generate one term from
the previous term.
4. a) For several pairs of consecutive terms in the sequence,
divide the second term by the preceding term.
b) What observation can you make about your predictions in
step 3c)?

Reflect and Respond


5. a) Is the sequence generated a geometric sequence? How do
you know?
b) Write a general term that relates the number of outcomes
to the number of coins tossed.
c) Show how to use your formula to determine the value of
the 20th term of the sequence.

1.3 Geometric Sequences MHR 33


Link the Ideas

common ratio In a geometric sequence, the ratio of consecutive terms is constant. The
the ratio of successive common ratio, r, can be found by taking any term, except the first, and
terms in a geometric dividing that term by the preceding term.
sequence,

r=
_tn The general geometric sequence is t1, t1r, t1r 2, t1r 3, , where t1 is the first
tn - 1 term and r is the common ratio.
the ratio may be t1 = t1
positive or negative
t2 = t1r
for example, in the
sequence 2, 4, 8, 16, ,
t3 = t1r 2
the common ratio is 2 t4 = t1r 3

tn = t1r n - 1

The general term of a geometric sequence where n is a positive


integer is
tn = t1r n - 1
where t1 is the first term of the sequence
n is the number of terms
r is the common ratio
tn is the general term or nth term

Example 1
Determine t1, r, and tn
Did Yo u Know ? In nature, many single-celled organisms, such as bacteria, reproduce by
splitting in two so that one cell gives rise to 2, then 4, then 8 cells, and
One of the most
common bacteria on so on, producing a geometric sequence. Suppose there were 10 bacteria
Earth, Shewanella originally present in a bacteria sample. Determine the general term that
oneidensis MR-1, uses relates the number of bacteria to the doubling period of the bacteria. State
oxygen as an energy
source for respiration. the values for t1 and r in the geometric sequence produced.
This bacterium is
generally associated Solution
with the removal of
metal pollutants in State the sequence generated by the doubling of the bacteria.
aquatic and marine t1 = 10
environments.
t2 = 20
t3 = 40
t4 = 80
t5 = 160


The common ratio, r, may be found by dividing any two consecutive


tn
terms, r = _ .
tn - 1
_
20 = 2 _ 40 = 2 _ 80 = 2 _
160 = 2
10 20 40 80
The common ratio is 2.

34 MHR Chapter 1
For the given sequence, t1 = 10 and r = 2. Use the general term of a
geometric sequence.
tn = t1r n - 1
tn = (10)(2)n - 1 Substitute known values.

The general term of the sequence is tn = 10(2)n - 1.

Your Turn
Suppose there were three bacteria originally present in a sample.
Determine the general term that relates the number of bacteria to
the doubling period of the bacteria. State the values of t1 and r in
the geometric sequence formed.

Example 2
Determine a Particular Term
Sometimes you use a photocopier to create
enlargements or reductions. Suppose the
actual length of a photograph is 25 cm and
the smallest size that a copier can make is
67% of the original. What is the shortest
possible length of the photograph after
5 reductions? Express your answer to the
nearest tenth of a centimetre.

Solution
This situation can be modelled by a
geometric sequence.
For this sequence,
First term t1 = 25
Common ratio r = 0.67
Number of terms n=6 Why is the number of terms 6 in this case?

You need to find the sixth term of the sequence.


Use the general term, tn = t1r n - 1.
tn = t1r n - 1
t6 = 25(0.67)6 - 1 Substitute known values.
t6 = 25(0.67)5
t6 = 3.375
After five reductions, the shortest possible length of the photograph is
approximately 3.4 cm.

Your Turn
Suppose the smallest reduction a photocopier could make is 60% of
the original. What is the shortest possible length after 8 reductions of
a photograph that is originally 42 cm long?

1.3 Geometric Sequences MHR 35


Example 3
Determine t1 and r
In a geometric sequence, the third term is 54 and the sixth term
is -1458. Determine the values of t1 and r, and list the first three
terms of the sequence.

Solution
Method 1: Use Logical Reasoning
The third term of the sequence is 54 and the sixth term is -1458.
t3 = 54
t6 = -1458
Since the sequence is geometric,
t4 = t3(r)
t5 = t3(r)(r)
t6 = t3(r)(r)(r) Substitute known values.
-1458 = 54r 3
__
-1458 = r 3
54
-27 = r 3
_____
3
-27 = r
-3 = r
You can use the general term of a geometric sequence to determine the
value for t1.
tn = t1r n - 1
t3 = t1r 3 - 1
t3 = t1r 2
54 = t1(3)2 Substitute known values.
54 = 9t1
6 = t1
The first term of the sequence is 6 and the common ratio is -3.
The first three terms of the sequence are 6, -18, 54.
Method 2: Use the General Term
You can write an equation for t3 and an equation for t6 using the general
term of a geometric sequence.
tn = t1r n - 1
For the third term, n = 3.
tn = t1r n - 1
54 = t1r 3 - 1
54 = t1r 2
For the sixth term, n = 6.
tn = t1r n - 1
-1458 = t1r 6 - 1
-1458 = t1r 5

36 MHR Chapter 1
Solve one of the equations for the variable t1.
54 = t1r 2
_
54 = t
1
r2
Substitute this expression for t1 in the other equation. Solve for the
variable r.
-1458 = t1r 5
-1458 = _( )54 r 5
r2
-1458 = 54r 3
__
-1458 = _ 54r 3
54 54
-27 = r 3
_____
3
-27 = r
-3 = r
Substitute the common ratio of -3 in one of the equations to solve for
the first term, t1.
Substitute r = -3
54 = t1r 2
54 = t1(-3)2
54 = 9t1
6 = t1
The first term of the sequence is 6 and the common ratio is -3.
The first three terms of the sequence are 6, -18, 54.

Your Turn
In a geometric sequence, the second term is 28 and the fifth term is
1792. Determine the values of t1 and r, and list the first three terms of
the sequence.

Example 4
Apply Geometric Sequences
The modern piano has 88 keys. The frequency of the notes ranges from D i d You K n ow?
A0, the lowest note, at 27.5 Hz, to C8, the highest note on the piano, at
A sound has two
4186.009 Hz. The frequencies of these notes approximate a geometric characteristics, pitch
sequence as you move up the keyboard. and volume. The
pitch corresponds
a) Determine the common ratio of the geometric sequence produced to the frequency
from the lowest key, A0, to the fourth key, C1, at 32.7 Hz. of the sound wave.
High notes have
b) Use the lowest and highest frequencies to verify the common ratio high frequencies.
Low notes have
found in part a).
low frequencies.
Frequency is
measured in Hertz
(Hz), which is the
number of waves per
second.

1.3 Geometric Sequences MHR 37


Solution
a) The situation may be modelled by a geometric sequence.
For this sequence,
First term t1 = 27.5
Number of terms n = 4
nth term tn = 32.7

Use the general term of a geometric sequence.


tn = t1r n - 1
32.7 = (27.5)(r 4 - 1) Substitute known values.
_ = __
32.7 27.5r 3
27.5 27.5
_
32.7 = r 3
27.5
_____
3 _
32.7 = r
27.5
Take the cube root of both sides.

1.0594 = r
The common ratio for this sequence is approximately 1.06.

b) For this sequence,


First term t1 = 27.5
Number of terms n = 88
nth term tn = 4186.009

Use the general term of a geometric sequence.


tn = t1r n - 1
4186.009 = (27.5)(r 88 - 1) Substitute known values.
__
4186.009
= __
27.5r 87

27.5 27.5
__
4186.009
=r 87
27.5
__________
87 __
4186.009 = r
27.5
Take the 87th root of both sides.

1.0594 = r

The common ratio of this sequence is approximately 1.06.

Your Turn
In 1990 the population of Canada was approximately 26.6 million.
The population projection for 2025 is approximately 38.4 million. If
this projection were based on a geometric sequence, what would be
the annual growth rate? Given that this is a geometric sequence what
assumptions would you have to make?

38 MHR Chapter 1
Key Ideas

A geometric sequence is a sequence in which each term, after the first term,
is found by multiplying the previous term by a non-zero constant, r, called
the common ratio.
The common ratio of successive terms of a geometric sequence can be found
tn
by dividing any two consecutive terms, r = _ .
tn - 1
The general term of a geometric sequence is
tn = t1r n - 1
where t1 is the first term
n is the number of terms
r is the common ratio
tn is the general term or nth term

Check Your Understanding

Practise 4. Determine the missing terms, t2, t3, and


1. Determine if the sequence is geometric. t4, in the geometric sequence in which
If it is, state the common ratio and the t1 = 8.1 and t5 = 240.1.
general term in the form tn = t1r n - 1. 5. Determine a formula for the nth term of
a) 1, 2, 4, 8, each geometric sequence.
b) 2, 4, 6, 8, a) r = 2, t1 = 3
c) 3, -9, 27, -81, b) 192, -48, 12, -3,
d) 1, 1, 2, 4, 8, c) t3 = 5, t6 = 135
e) 10, 15, 22.5, 33.75, d) t1 = 4, t13 = 16 384
f) -1, -5, -25, -125,
2. Copy and complete the following table for
Apply
6. Given the following geometric sequences,
the given geometric sequences.
determine the number of terms, n.
Geometric Common 6th 10th
Table A
Sequence Ratio Term Term
a) 6, 18, 54, First nth Number
Term, Common Term, of
b) 1.28, 0.64, 0.32,
t1 Ratio, r tn Terms, n
c)
_1 , _3 , _9 ,
5 5 5 a) 5 3 135
b) -2 -3 -1458
3. Determine the first four terms of each
geometric sequence. c)
_1 _1 _
1
3 2 48
a) t1 = 2, r = 3 b) t1 = -3, r = -4 d) 4 4 4096

-_ -_
c) t1 = 4, r = -3 d) t1 = 2, r = 0.5 1 128
e) 2
6 3

f) _p2 _p _p9
2 2 256

1.3 Geometric Sequences MHR 39


7. The following sequence is geometric. 10. The colour of some clothing fades over
What is the value of y? time when washed. Suppose a pair of jeans
3, 12, 48, 5y + 7, fades by 5% with each washing.
8. The following graph illustrates a geometric a) What percent of the colour remains after
sequence. List the first three terms for the one washing?
sequence and state the general term that b) If t1 = 100, what are the first four terms
describes the sequence. of the sequence?
tn c) What is the value of r for your
geometric sequence?
d) What percent of the colour remains after
15
10 washings?
e) How many washings would it take so
that only 25% of the original colour
10 remains in the jeans? What assumptions
did you make?
11. Pincher Creek, in the foothills of the Rocky
Mountains in southern Alberta, is an
5 ideal location to harness the wind power
of the chinook winds that blow through
the mountain passes. Kinetic energy from
the moving air is converted to electricity
0 5 10 15 n by wind turbines. In 2004, the turbines
generated 326 MW of wind energy, and it
is projected that
9. A ball is dropped from a height of 3.0 m.
the amount will
After each bounce it rises to 75% of its
be 10 000 MW
previous height.
per year by 2010.
If this growth
were modelled
by a geometric
sequence,
determine the
value of the
annual growth
rate from 2004
a) Write the first term and the common to 2010.
ratio of the geometric sequence.
b) Write the general term for the sequence D i d You K n ow ?
in part a). In an average year, a single 660-kW wind turbine
c) What height does the ball reach after produces 2000 MW of electricity, enough power
for over 250 Canadian homes. Using wind to
the 6th bounce? produce electricity rather than burning coal will
d) After how many bounces will the ball leave 900 000 kg of coal in the ground and emit
2000 tonnes fewer greenhouse gases annually. This
reach a height of approximately 40 cm? has the same positive impact as taking 417 cars off
the road or planting 10 000 trees.

40 MHR Chapter 1
12. The following excerpt is taken from the a) By what ratio did Georges improve his
book One Grain of Rice by Demi. performance with each jump? Express
your answer to three decimal places.
b) How far was Georges winning jump?
Express your answer to the nearest
tenth of a centimetre.
c) The world record frog jump is held by
a frog named Santjie of South Africa.
Santjie jumped approximately 10.2 m.
If Georges, from St-Pierre-Jolys, had
continued to increase his jumps
following this same geometric sequence,
how many jumps would Georges have
needed to complete to beat Santjies
world record jump?
14. Bread and bread products have been part
Long ago in India, there lived a raja who believed that of our diet for centuries. To help bread
he was wise and fair. But every year he kept nearly all rise, yeast is added to the dough. Yeast is
of the peoples rice for himself. Then when famine came, a living unicellular micro-organism about
the raja refused to share the rice, and the people went one hundredth of a millimetre in size.
hungry. Then a village girl named Rani devises a clever
Yeast multiplies by a biochemical process
plan. She does a good deed for the raja, and in return,
called budding. After mitosis and cell
the raja lets her choose her reward. Rani asks for just
division, one cell results in two cells with
one grain of rice, doubled every day for thirty days.
exactly the same characteristics.
a) Write the sequence of terms for the
a) Write a sequence for the first six terms
first five days that Rani would receive
that describes the cell growth of yeast,
the rice.
beginning with a single cell.
b) Write the general term that relates the
b) Write the general term for the growth
number of grains of rice to the number
of yeast.
of days.
c) How many cells would there be after
c) Use the general term to determine
25 doublings?
the number of grains of rice that Rani
would receive on the 30th day. d) What assumptions would you make
for the number of cells after
13. The Franco-Manitoban community of
25 doubling periods?
St-Pierre-Jolys celebrates Les Folies
Grenouilles annually in August. Some
of the featured activities include a slow
pitch tournament, a parade, fireworks,
and the Canadian National Frog Jumping
Championships. During the competition,
competitors frogs have five chances to
reach their maximum jump. One year,
a frog by the name of Georges, achieved
the winning jump in his 5th try.
Georges first jump was 191.41 cm, his
second jump was 197.34 cm, and his third
was 203.46 cm. The pattern of Georges
jumps approximated a geometric sequence.

1.3 Geometric Sequences MHR 41


15. The Arctic Winter Games is D i d You K n ow ?
a high profile sports
Sledge jump starts from a standing position. The
competition for northern and
athlete jumps consecutively over 10 sledges placed
arctic athletes. The premier in a row, turns around using one jumping movement,
sports are the Dene and Inuit games, which and then jumps back over the 10 sledges. This
include the arm pull, the one foot high kick, process is repeated until the athlete misses a jump
or touches a sledge.
the two foot high kick, and the Dene hand
games. The games are held every two years.
The first Arctic Winter Games, held in 1970,
drew 700 competitors. In 2008, the games
were held in Yellowknife and drew
2000 competitors. If the number of
competitors grew geometrically from 1970 to
2008, determine the annual rate of growth in
the number of competitors from one Arctic
Winter Games to the next. Express your
answer to the nearest tenth of a percent.
17. At Galaxyland in the West Edmonton Mall,
a boat swing ride has been modelled after
a basic pendulum design. When the boat
first reaches the top of the swing, this is
considered to be the beginning of the first
swing. A swing is completed when the
boat changes direction. On each successive
completed swing, the boat travels 96%
as far as on the previous swing. The ride
finishes when the arc length through
which the boat travels is 30 m. If it takes
20 swings for the boat to reach this arc
length, determine the arc length through
which the boat travels on the first swing.
Express your answer to the nearest tenth of
a metre.

16. Jason Annahatak entered the Russian


sledge jump competition at the Arctic
Winter Games, held in Yellowknife.
Suppose that to prepare for this event,
Jason started training by jumping 2 sledges
each day for the first week, 4 sledges
each day for the second week, 8 sledges
each day for the third week, and so on.
During the competition, Jason jumped
142 sledges. Assuming he continued his
training pattern, how many weeks did it
take him to reach his competition number
of 142 sledges?

42 MHR Chapter 1
18. The Russian nesting doll or Matryoshka 20. The charge in a car battery, when the car
had its beginnings in 1890. The dolls are is left to sit, decreases by about 2% per
made so that the smallest doll fits inside day and can be modelled by the formula
a larger one, which fits inside a larger C = 100(0.98)d, where d is the time, in
one, and so on, until all the dolls are days, and C is the approximate level of
hidden inside the largest doll. In a set of charge, as a percent.
50 dolls, the tallest doll is 60 cm and the a) Copy and complete the chart to show
smallest is 1 cm. If the decrease in doll the percent of charge remaining in
size approximates a geometric sequence, relation to the time passed.
determine the common ratio. Express your
Time, d (days) Charge Level, C (%)
answer to three decimal places.
0 100
1
2
3

b) Write the general term of this geometric


sequence.
c) Explain how this formula is different
from the formula C = 100(0.98)d.
d) How much charge is left after 10 days?
21. A coiled basket is made using dried pine
needles and sinew. The basket is started
from the centre using a small twist and
spirals outward and upward to shape the
19. The primary function for our kidneys is to
basket. The circular coiling of the basket
filter our blood to remove any impurities.
approximates a geometric sequence, where
Doctors take this into account when
the radius of the first coil is 6 mm.
prescribing the dosage and frequency
of medicine. A persons kidneys filter a) If the ratio of consecutive coils is 1.22,
out 18% of a particular medicine every calculate the radius for the 8th coil.
two hours. b) If there are 18 coils, what is the
a) How much of the medicine remains circumference of the top coil of
after 12 h if the initial dosage was the basket?
250 mL? Express your answer to the
nearest tenth of a millilitre.
b) When there is less than 20 mL left
in the body, the medicine becomes
ineffective and another dosage is
needed. After how many hours would
this happen?
D id Yo u Kn ow?

Every day, a persons kidneys process about 190 L


of blood to remove about 1.9 L of waste products
and extra water.

1.3 Geometric Sequences MHR 43


Extend Create Connections
22. Demonstrate that 6a, 6b, 6c, forms a 25. Alex, Mala, and Paul were given the
geometric sequence when a, b, c, forms following problem to solve in class.
an arithmetic sequence. An aquarium that originally contains 40 L of water loses
23. If x + 2, 2x + 1, and 4x - 3 are three 8% of its water to evaporation every day. Determine
consecutive terms of a geometric sequence, how much water will be in the aquarium at the
determine the value of the common ratio beginning of the 7th day.

and the three given terms. The three students solutions are shown
24. On a six-string guitar, the distance from the below. Which approach to the solution is
nut to the bridge is 38 cm. The distance correct? Justify your reasoning.
from the first fret to the bridge is 35.87 cm, Alexs solution:
and the distance from the second fret Alex believed that the sequence was
to the bridge is 33.86 cm. This pattern geometric, where t1 = 40, r = 0.08, and n = 7.
approximates a geometric sequence. He used the general formula tn = t1r n - 1.
a) What is the distance from the 8th fret to tn = t1r n - 1
the bridge? tn = 40(0.08)n - 1
t7 = 40(0.08)7 - 1
b) What is the distance from the 12th fret
t7 = 40(0.08)6
to the bridge?
t7 = 0.000 01
c) Determine the distance from the nut to There will be 0.000 01 L of water in the
the first fret. tank at the beginning of the 7th day.
d) Determine the distance from the first Malas solution:
fret to the second fret. Mala believed that the sequence was
e) Write the sequence for the first three geometric, where t1 = 40, r = 0.92, and
terms of the distances between the n = 7. She used the general formula
frets. Is this sequence geometric or tn = t1r n - 1.
arithmetic? What is the common ratio tn = t1r n - 1
or common difference? tn = 40(0.92)n - 1
t7 = 40(0.92)7 - 1
t7 = 40(0.92)6
nut t7 = 24.25
1st fret
There will be 24.25 L of water in the tank
at the beginning of the 7th day.
12th fret Pauls solution:
Paul believed that the sequence was
arithmetic, where t1 = 40 and n = 7.
To calculate the value of d, Paul took
8% of 40 = 3.2. He reasoned that this
bridge would be a negative constant since the
water was gradually disappearing. He used
the general formula tn = t1 + (n - 1)d.
tn = t1 + (n - 1)d
tn = 40 + (n - 1)(-3.2)
t7 = 40 + (7 - 1)(-3.2)
t7 = 40 + (6)(-3.2)
t7 = 20.8
There will be 20.8 L of water in the tank at
the beginning of the 7th day.

44 MHR Chapter 1
26. Copy the puzzle. Fill in the empty boxes c) If another square with an inscribed circle
with positive numbers so that each row is drawn around the squares, what is the
and column forms a geometric sequence. area of the orange region, to the nearest
hundredth of a square centimetre?
d) If this pattern were to continue, what
would be the area of the newly coloured
2 18 region for the 8th square, to the nearest
1 hundredth of a square centimetre?
9
4

1 cm

32

100

27. A square has an inscribed circle of radius


1 cm
1 cm.
a) What is the area of the red portion of
the square, to the nearest hundredth of
a square centimetre?
b) If another square with an inscribed
circle is drawn around the original,
what is the area of the blue region,
1 cm
to the nearest hundredth of a square
centimetre?

Project Corner Forestry

Canada has 402.1 million


hectares (ha) of forest and other
wooded lands. This value
represents 41.1% of Canadas total
surface area of 979.1 million
hectares.
Annually, Canada harvests 0.3%
of its commercial forest area. In
2007, 0.9 million hectares were
harvested.
In 2008, British Columbia
planted its 6 billionth tree
seedling since the 1930s, as part
of its reforestation programs.

1.3 Geometric Sequences MHR 45


1.4
Geometric Series
Focus on . . .
deriving a rule for determining the sum of n terms of a
geometric series
determining t1, r, n, or Sn involving a geometric series
solving a problem that involves a geometric series
identifying any assumptions made when identifying a
geometric series

If you take the time to look closely at nature,


chances are you have seen a fractal. Fractal
geometry is the geometry of nature. The study
of fractals is, mathematically, relatively new. A
fractal is a geometric figure that is generated by
starting with a very simple pattern and repeating
that pattern over and over an infinite number
of times. The basic concept of a fractal is that it
contains a large degree of self-similarity. This
means that a fractal usually contains small copies
of itself buried within the original. Where do you
see fractals in the images shown?

Investigate Fractals

Materials Fractal Tree


paper A fractal tree is a fractal pattern that results in a realistic looking tree.
ruler
You can build your own fractal tree:
1. a) Begin with a sheet of paper. Near the bottom of the paper and
centred on the page, draw a vertical line segment approximately
3 cm to 4 cm in length.
b) At the top of the segment, draw two line segments, splitting away
from each other as shown in Stage 2. These segments form the
branches of the tree. Each new branch formed is a smaller version
of the main trunk of the tree.

46 MHR Chapter 1
c) At the top of each new line segment, draw another two branches,
as shown in Stage 3.

Stage 1 Stage 2 Stage 3

d) Continue this process to complete five stages of the fractal tree.


2. Copy and complete the following table.

Stage 1 2 3 4 5
Number of New Branches 1 2

3. Decide whether a geometric sequence has been generated for


the number of new branches formed at each stage. If a geometric
sequence has been generated, state the first term, the common ratio,
and the general term.

Reflect and Respond


4. a) Would a geometric sequence be generated if there were three We b Link
new branches formed from the end of each previous branch?
The complex
b) Would a geometric sequence be generated if there were four mathematical
new branches formed? equations of fractals
are used in the
5. Describe a strategy you could use to determine the total number creation of many
of branches that would be formed by the end of stage 5. works of art and
computer generated
6. Would this be a suitable strategy to use if you wanted to determine fractals. To learn
the total number of branches up to stage 100? Explain. more about art and
fractals, go to
www.mhrprecalc11.ca
and follow the links.

Image rendered by Anton Bakker based on a fractal tree design by Koos


Verhoeff. Used with permission of the Foundation MathArt Koos Verhoeff.

1.4 Geometric Series MHR 47


Link the Ideas

geometric series A geometric series is the expression for the sum of the terms of a
the terms of a geometric sequence.
geometric sequence
expressed as a sum A school district emergency fan-out system is designed to enable
for example, important information to reach the entire staff of the district very quickly.
3 + 6 + 12 + 24 At the first level, the superintendent calls two assistant superintendents.
is a geometric series The two assistant superintendents each call two area superintendents.
They in turn, each call two principals. The pattern continues with each
person calling two other people.
At every level, the total number of people contacted is twice the number
of people contacted in the previous level. The pattern can be modelled
by a geometric series where the first term is 1 and the common ratio is 2.
The series for the fan-out system would be 1 + 2 + 4 + 8, which gives a
sum of 15 people contacted after 4 levels.
To extend this series to 15 or 20 or 100 levels, you need to determine a
way to calculate the sum of the series other than just adding the terms.

Superintendent

One way to calculate the sum of the series is to use a formula.


To develop a formula for the sum of a series,
List the original series.
S4 = 1 + 2 + 4 + 8 q
Multiply each term in the series by the common ratio.
2(S4 = 1 + 2 + 4 + 8)
2S4 = 2 + 4 + 8 + 16 w The number of staff contacted in the 5th level is 16.

Subtract equation q from equation w.


2S4 = 2 + 4 + 8 + 16
- S4 = 1 + 2 + 4 + 8 Why are the two equations aligned as shown?

(2 - 1)S4 = -1 + 0 + 0 + 0 + 16
Isolate S4 by dividing by (2 - 1).
S4 = __
16 - 1
2-1
S4 = 15
You can use the above method to derive a general formula for the sum of
a geometric series.

48 MHR Chapter 1
The general geometric series may be represented by the following series.
Sn = t1 + t1r + t1r 2 + t1r 3 + + t1r n - 1
Multiply every term in the series by the common ratio, r.
rSn = t1r + t1r(r) + t1r 2(r) + t1r 3(r) + + t1r n - 1(r)
rSn = t1r + t1r 2 + t1r 3 + t1r 4 + + t1r n
Subtract the two equations.
rSn = t1r + t1r 2 + t1r 3 + t1r 4 + + t1r n - 1 + t1r n
Sn = t1 + t1r + t1r 2 + t1r 3 + + t1r n - 1
(r - 1)Sn = -t1 + 0 + 0 + 0 + + 0 + 0 + t1r n
Isolate Sn by dividing by r - 1.
t1r n - t1 t1(r n - 1)
Sn = __ or Sn = __ ,r1 Why can r not be equal to 1?
r-1 r-1

The sum of a geometric series can be determined using the formula


t1(r n - 1)
Sn = __ ,r1
r-1
where t1 is the first term of the series
n is the number of terms
r is the common ratio
Sn is the sum of the first n terms

Example 1
Determine the Sum of a Geometric Series
Determine the sum of the first 10 terms of each geometric series.
a) 4 + 12 + 36 +

b) t1 = 5, r = _1
2

Solution
a) In the series, t1 = 4, r = 3, and n = 10.
n
t (r - 1)
__
1
Sn =
r-1
S10 = __
10
4(3 - 1)
3-1
S10 = __
4(59 048)
2
S10 = 118 096
The sum of the first 10 terms of the geometric series is 118 096.

1.4 Geometric Series MHR 49


b) In the series, t1 = 5, r = _1 , n = 10
2
n
t (r - 1)
Sn = __
1
r-1
5 _1 10 - 1
[( ) ]
S10 = ___
2
_1 - 1
2
5 _
( 1 -1
)
S10 = ___
1024
-_1
2
S10 = -10 __
-1023
( )
1024
S10 = _
5115
512
The sum of the first 10 terms of the geometric series is _
5115 or 9 _
507 .
512 512

Your Turn
Determine the sum of the first 8 terms of the following geometric series.
a) 5 + 15 + 45 +
b) t1 = 64, r = _
1
4

Example 2
Determine the Sum of a Geometric Series for an Unspecified Number
of Terms
Determine the sum of each geometric series.

a)
_
1
+_
1 +_
1 + + 729
27 9 3
b) 4 - 16 + 64 - - 65 536

Solution
a) Method 1: Determine the Number of Terms
tn = t1r n - 1 Use the general term.

729 = _ 1 (3)n - 1 Substitute known values.


27
(27)(729) = _ 1 (3)n - 1 (27)
[ ]Multiply both sides by 27.
27
(27)(729) = (3)n - 1
(33)(36) = (3)n - 1 Write as powers with a base of 3.
(3)9 = (3)n - 1
9=n-1 Since the bases are the same, the exponents
10 = n must be equal.

There are 10 terms in the series.

50 MHR Chapter 1
Use the general formula for the sum of a geometric series
where n = 10, t1 = _ 1 , and r = 3.
27
t1(r n - 1)
Sn = __
r-1
_
( )1 [(3)10 - 1]
S10 = ___
27
3-1
S10 = __
29 524
27
The sum of the series is __29 524 or 1093 _
13 .
27 27
Method 2: Use an Alternate Formula
Begin with the formula for the general term of a geometric sequence,
tn = t1r n - 1.
Multiply both sides by r.
rtn = (t1r n - 1)(r)
Simplify the right-hand side of the equation.
rtn = t1r n
From the previous work, you know that the general formula for the
sum of a geometric series may be written as
t1r n - t1
Sn = __
r-1
Substitute rtn for t1r n.
rtn - t1
Sn = __ where r 1.
r-1
This results in a general formula for the sum of a geometric series
when the first term, the nth term, and the common ratio are known.
Determine the sum where r = 3, tn = 729, and t1 = _ 1.
27
rtn - t1
Sn = __
r-1
(3)(729) - _ 1
Sn = ___ 27
3-1
Sn = __
29 524
27
The sum of the series is __29 524 or approximately 1093.48.
27
rtn - t1
b) Use the alternate formula Sn = __ , where t1 = 4, r = -4,
r-1
and tn = -65 536.
rtn - t1
Sn = __
r-1
Sn = ____
(-4)(-65 536) - 4
-4 - 1
Sn = -52 428
The sum of the series is -52 428.

Your Turn
Determine the sum of the following geometric series.
a)
_1
+_ 1 +_ 1 + + 1024 b) -2 + 4 - 8 + - 8192
64 16 4

1.4 Geometric Series MHR 51


Example 3
Apply Geometric Series
The Western Scrabble Network is an organization whose goal is
to promote the game of Scrabble. It offers Internet tournaments
throughout the year that WSN members participate in. The format of
these tournaments is such that the losers of each round are eliminated
from the next round. The winners continue to play until a final match
determines the champion. If there are 256 entries in an Internet
Scrabble tournament, what is the total number of matches that will
be played in the tournament?

Solution
The number of matches played at each stage of the tournament models
the terms of a geometric sequence. There are two players per match, so
the first term, t1, is _
256 = 128 matches. After the first round, half of the
2
players are eliminated due to a loss. The common ratio, r, is _ 1.
2
A single match is played at the end of the tournament to decide the
winner. The nth term of the series, tn, is 1 final match.
rtn - t1
Use the formula Sn = __ for the sum of a geometric series where
r-1
t1 = 128, r = _ 1 , and t = 1.
2 n

rt t
Sn = __ n
- 1
r-1
_1 (1) - 128
( )
Sn = ___
2

( ) _1 - 1
2
__
-255
Sn = __ 2
-_1
2
Sn = __ - _
( -255
)( ) 2
2 1
Sn = 255
There will be 255 matches played
in the tournament

Your Turn
If a tournament has 512 participants, how many matches will be played?

52 MHR Chapter 1
Key Ideas

A geometric series is the expression for the sum of the terms of a


geometric sequence.
For example, 5 + 10 + 20 + 40 + is a geometric series.
The general formula for the sum of the first n terms of a geometric series
with the first term, t1, and the common ratio, r, is
t1(r n - 1)
Sn = __ ,r1
r-1
A variation of this formula may be used when the first term, t1, the
common ratio, r, and the nth term, tn, are known, but the number
of terms, n, is not known.
rtn - t1
Sn = __ ,r1
r-1

Check Your Understanding

Practise 3. What is Sn for each geometric series


1. Determine whether each series is described? Express your answers as exact
geometric. Justify your answer. values in fraction form.
a) 4 + 24 + 144 + 864 + a) t1 = 12, r = 2, n = 10

b) -40 + 20 - 10 + 5 - b) t1 = 27, r = _1 , n = 8
3
c) 3 + 9 + 18 + 54 + c) t1 = _
1 , r = -4, n = 10
256
d) 10 + 11 + 12.1 + 13.31 + _1 , n = 12
d) t1 = 72, r =
2. For each geometric series, state the values 2
of t1 and r. Then determine each indicated 4. Determine Sn for each geometric series.
sum. Express your answers as exact Express your answers to the nearest
values in fraction form and to the nearest hundredth, if necessary.
hundredth.
a) 27 + 9 + 3 + + _
1
243
a) 6 + 9 + 13.5 + (S )
b) _ + _ + _ + + _
10
1 2 4 128
b) 18 - 9 + 4.5 + (S12) 3 9 27 6561
c) 2.1 + 4.2 + 8.4 + (S9) c) t1 = 5, tn = 81 920, r = 4

d) 0.3 + 0.003 + 0.000 03 + (S12) d) t1 = 3, tn = 46 875, r = -5

1.4 Geometric Series MHR 53


5. What is the value of the first term for each 11. Celia is training to run a marathon. In the
geometric series described? Express your first week she runs 25 km and increases
answers to the nearest tenth, if necessary. this distance by 10% each week. This
a) Sn = 33, tn = 48, r = -2 situation may be modelled by the series
_1 25 + 25(1.1) + 25(1.1)2 + . She wishes
b) Sn = 443, n = 6, r = to continue this pattern for 15 weeks. How
3
6. The sum of 4 + 12 + 36 + 108 + + tn is far will she have run in total when she
4372. How many terms are in the series? completes the 15th week? Express your
answer to the nearest tenth of a kilometre.
7. The common ratio of a geometric series
is _
1 and the sum of the first 5 terms is 121. 12. MINI LAB Building the Koch snowflake
3 is a step-by-step process.
a) What is the value of the first term?
Start with an equilateral triangle.
b) Write the first 5 terms of the series. (Stage 1)
8. What is the second term of a geometric In the middle of each line segment
series in which the third term is _
9 and the forming the sides of the triangle,
4
sixth term is - _
16 ? Determine the sum of construct an equilateral triangle with
81 side length equal to _
1 of the length of
the first 6 terms. Express your answer to 3
the line segment.
the nearest tenth.

Apply
Delete the base of this new triangle.
9. A fan-out system is used to contact a
(Stage 2)
large group of people. The person in
charge of the contact committee relays the For each line segment in Stage 2,
information to four people. Each of these construct an equilateral triangle,
four people notifies four more people, who deleting its base. (Stage 3)
in turn each notify four more people, and Repeat this process for each line
so on. segment, as you move from one
a) Write the corresponding series for the stage to the next.
number of people contacted.
b) How many people are notified after
10 levels of this system?
10. A tennis ball dropped from a height of
20 m bounces to 40% of its previous height
on each bounce. The total vertical distance
Stage 1 Stage 2
travelled is made up of upward bounces
and downward drops. Draw a diagram to
represent this situation. What is the total
vertical distance the ball has travelled
when it hits the floor for the sixth time?
Express your answer to the nearest tenth
of a metre.

Stage 3 Stage 4

54 MHR Chapter 1
a) Work with a partner. Use dot paper 14. Bead working has a long history among
to draw three stages of the Koch Canadas Indigenous peoples. Floral
snowflake. designs are the predominate patterns found
b) Copy and complete the following table. among people of the boreal forests and
northern plains. Geometric patterns are
Length of Number Perimeter
found predominately in the Great Plains.
Stage Each Line of Line of
As bead work continues to be popular,
Number Segment Segments Snowflake
traditional patterns are being exchanged
1 1 3 3
among people in all regions. Suppose a set
2
_1 12 4 of 10 beads were laid in a line where each
3
_1 successive bead had a diameter that was _ 3
3 4
9
of the diameter of the previous bead. If
4
the first bead had a diameter of 24 mm,
5 determine the total length of the line of
c) Determine the general term for the beads. Express your answer to the nearest
length of each line segment, the number millimetre.
of line segments, and the perimeter of
D i d You K n ow ?
the snowflake.
Wampum belts consist of rows of beads woven
d) What is the total perimeter of the
together. Weaving traditionally involves stringing
snowflake up to Stage 6? the beads onto twisted plant fibres, and then
13. An advertising company designs a securing them to animal sinew.

campaign to introduce a new product


to a metropolitan area. The company
determines that 1000 people are aware
of the product at the beginning of the
campaign. The number of new people
aware increases by 40% every 10 days
during the advertising
campaign. Determine the
total number of people
who will be aware of
the product after
100 days.

Wanuskewin Native Heritage Park,


Park Cree Nation,
Nation Saskatchewan

1.4 Geometric Series MHR 55


15. When doctors prescribe medicine at Create Connections
equally spaced time intervals, they are 20. A fractal is created as follows: A circle is
aware that the body metabolizes the drug drawn with radius 8 cm. Another circle
gradually. After some period of time, only is drawn with half the radius of the
a certain percent of the original amount previous circle. The new circle is tangent
remains. After each dose, the amount to the previous circle at point T as shown.
of the drug in the body is equal to the Suppose this pattern continues through
amount of the given dose plus the amount five steps. What is the sum of the areas
remaining from the previous doses. of the circles? Express your answer as an
The amount of the drug present in the exact fraction.
body after the nth dose is modelled by a
geometric series where t1 is the prescribed
dosage and r is the previous dose
remaining in the body.
Suppose a person with an ear infection
takes a 200-mg ampicillin tablet every 4 h.
About 12% of the drug in the body at the
start of a four-hour period is still present
at the end of that period. What amount of
ampicillin is in the body, to the nearest
tenth of a milligram,
T
a) after taking the third tablet?
21. Copy the following flowcharts. In the
b) after taking the sixth tablet?
appropriate segment of each chart, give a
definition, a general term or sum, or an
Extend example, as required.
16. Determine the number of terms, n,
if 3 + 32 + 33 + + 3n = 9840. Sequences
17. The third term of a geometric series is 24
and the fourth term is 36. Determine the
sum of the first 10 terms. Express your
answer as an exact fraction. Arithmetic Geometric

18. Three numbers, a, b, and c, form a


geometric series so that a + b + c = 35 and
abc = 1000. What are the values of a, b, General Example General Example
Term Term
and c?
19. The sum of the first 7 terms of a geometric
series is 89, and the sum of the first
8 terms is 104. What is the value of the Series

eighth term?

Arithmetic Geometric

General Example General Example


Sum Sum

56 MHR Chapter 1
22. Tom learned that the monarch butterfly a) What assumptions did Tom make in his
lays an average of 400 eggs. He decided calculations?
to calculate the growth of the butterfly b) Do you agree with the method Tom
population from a single butterfly by using used to arrive at the number of
the logic that the first butterfly produced butterflies? Explain.
400 butterflies. Each of those butterflies
c) Would this be a reasonable estimate of
would produce 400 butterflies, and this
the total number of butterflies in the
pattern would continue. Tom wanted
fifth generation? Explain.
to estimate how many butterflies there
would be in total in the fifth generation d) Explain a method you would use to
following this pattern. His calculation is calculate the number of butterflies in
shown below. the fifth generation.
t1(r n - 1)
__
Sn = D i d You K n ow ?
r-1
S5 =
__
1(4005 - 1) According to the American Indian Butterfly Legend:
400 - 1 If anyone desires a wish to come true they must
first capture a butterfly and whisper that wish to it.
S5 2.566 1010
Since a butterfly can make no sound, the butterfly
Tom calculated that there would be cannot reveal the wish to anyone but the Great
approximately 2.566 1010 monarch Spirit who hears and sees all.
butterflies in the In gratitude for giving the beautiful butterfly its
freedom, the Great Spirit always grants the wish.
fifth generation.
So, according to legend, by making a wish and giving
the butterfly its freedom, the wish will be taken to
the heavens and be granted.

Project Corner Oil Discovery

The first oil well in Canada was discovered by James Miller Williams in 1858
near Oil Springs, Ontario. The oil was taken to Hamilton, Ontario, where it was
refined into lamp oil. This well produced 37 barrels a day. By 1861 there were
400 wells in the area.
In 1941, Albertas population was approximately 800 000. By 1961, it was about
1.3 million.
In February 1947, oil was struck in Leduc, Alberta. Leduc was the largest
discovery in Canada in 33 years. By the end of 1947, 147 more wells were
drilled in the Leduc-Woodbend oilfield.
With these oil discoveries came accelerated population growth. In 1941, Leduc
was inhabited by 871 people. By 1951, its population had grown to 1842.
Leduc #1 was capped in 1974, after producing 300 000 barrels of oil and
9 million cubic metres of natural gas.

1.4 Geometric Series MHR 57


1.5
Infinite Geometric Series
Focus on . . .
generalizing a rule for determining the sum of an infinite geometric series
explaining why a geometric series is convergent or divergent
solving a problem that involves a geometric sequence or series

In the fifth century B.C.E., the Greek philosopher Zeno of Elea


posed four problems, now known as Zenos paradoxes. These
problems were intended to challenge some of the ideas that
were held in his day. His paradox of motion states that a person
standing in a room cannot walk to the wall. In order to do so,
the person would first have to go half the distance, then half the
remaining distance, and then half of what still remains. This
process can always be continued and can never end.

0 1
D i d You K n ow ?

The word paradox


comes from the Greek
1 1 1 1 1 para doxa, meaning
something contrary to
2 4 8 16 32 opinion.

Zenos argument is that there is no motion, because that which is moved


must arrive at the middle before it arrives at the end, and so on to infinity.
Where does the argument break down? Why?

Investigate an Infinite Series

Materials 1. Start with a square piece of paper.


square piece of paper a) Draw a line dividing it in half.
ruler b) Shade one of the halves.
c) In the unshaded half of the square, draw
a line to divide it in half. Shade one of
the halves.
d) Repeat part c) at least six more times.
2. Write a sequence of terms indicating the area of each newly shaded
region as a fraction of the entire page. List the first five terms.
3. Predict the next two terms for the sequence.

58 MHR Chapter 1
4. Is the sequence arithmetic, geometric, or neither? Justify your answer.
5. Write the rule for the nth term of the sequence.
6. Ignoring physical limitations, could this sequence continue
indefinitely? In other words, would this be an infinite sequence?
Explain your answer.
7. What conclusion can you make about the area of the square that
would remain unshaded as the number of terms in the sequence
approaches infinity?

Reflect and Respond

( _12 ) .
x
8. Using a graphing calculator, input the function y =

a) Using the table of values from the calculator, what happens to the

value of y = _
x
1 as x gets larger and larger?
( )2
b) Can the value of _ ever equal zero?
x
1
2( )
9. The geometric series _ + _ + _ + _ + can be written as
1 1 1 1
2 4 8 16
_1 + _1 2 + _1 3 + _1 4 + + _1 x.
( ) ( ) ( ) ( )
2 2 2 2 2
You can use the general formula to determine the sum of the series.
t1(1 - r x)
Sx = __ For values of r < 1, the general
(1 - r) t1(r x - 1)
__
_1 1 - _1
( ( ))
x formula Sx
=
(r - 1)
can be

Sx = ___
2 2 written for convenience as
1- _
1
Sx =
t1(1 - r x)
__ .
2 (1 - r)

Sx = 1 - _
x
1 Why do you think this is true?
( )
2
Enter the function into your calculator and use the table feature to
find the sum, Sx, as x gets larger.

a) What happens to the sum, Sx, as x gets larger?


b) Will the sum increase without limit? Explain your reasoning.
10. a) As the value of x gets very large, what value can you assume that
r x becomes close to?
b) Use your answer from part a) to modify the formula for the
sum of a geometric series to determine the sum of an infinite
geometric series.
c) Use your formula from part b) to determine the sum of the infinite

geometric series _
1 + _
1 2+ _
1 3+ _
1 4 + .
( ) ( ) ( )
2 2 2 2

1.5 Infinite Geometric Series MHR 59


Link the Ideas

Convergent Series
Consider the series 4 + 2 + 1 + 0.5 + 0.25 +

S5 = 7.75
S7 = 7.9375
S9 = 7.9844
S11 = 7.9961
S13 = 7.999
S15 = 7.9998
S17 = 7.9999
As the number of terms increases, the sequence of partial sums
approaches a fixed value of 8. Therefore, the sum of this series is 8.
convergent series This series is said to be a convergent series.
a series with an infinite
Divergent Series
number of terms, in
which the sequence Consider the series 4 + 8 + 16 + 32 +
of partial sums
approaches a fixed S1 = 4
value S2 = 12
for example, S3 = 28
_1 _1 _1
1+ + + + S4 = 60
2 4 8
S5 = 124
As the number of terms increases, the sum of the series continues to
grow. The sequence of partial sums does not approach a fixed value.
Therefore, the sum of this series cannot be calculated. This series is said
divergent series to be a divergent series.
a series with an infinite
Infinite Geometric Series
number of terms, in
which the sequence of The formula for the sum of a geometric series is
partial sums does not
n
approach a fixed value t (1 - r )
__
1
Sn = .
for example, 1-r
2 + 4 + 8 + 16 + As n gets very large, the value of the r n approaches 0, for values of r
between -1 and 1.
t1
So, as n gets large, the partial sum Sn approaches _ .
1-r
Therefore, the sum of an infinite geometric series is
t1
S = _ , where -1 < r < 1.
1-r

60 MHR Chapter 1
The sum of an infinite geometric series, where -1 < r < 1, can be
determined using the formula
t1
S = _
1-r
where t1 is the first term of the series
r is the common ratio
S represents the sum of an infinite number of terms

Applying the formula to the series 4 + 2 + 1 + 0.5 + 0.25 +


t1
S = _ , where -1 < r < 1,
1-r
S = __ 4
1 - 0.5
S = _4
0.5
S = 8

Example 1
Sum of an Infinite Geometric Series
Decide whether each infinite geometric series is convergent or divergent.
State the sum of the series, if it exists.

a) 1 - _1 + _1 - b) 2 - 4 + 8 -
3 9

Solution

a) t1 = 1, r = - _1
3
Since -1 < r < 1, the series is convergent.
Use the formula for the sum of an infinite geometric series.
t1
S = _ , where -1 < r < 1,
1-r
S = __ 1
1 - -_( ) 1
3
S = _ 1
_4
3
S = (1) _ 3
( )
4
S = _3
4
b) t1 = 2, r = -2
Since r < -1, the series is divergent and has no sum.

Your Turn
Determine whether each infinite geometric series converges or diverges.
Calculate the sum, if it exists.
a) 1 + _ + _ +
1 1 b) 4 + 8 + 16 +
5 25

1.5 Infinite Geometric Series MHR 61


Example 2
Apply the Sum of an Infinite Geometric Series
Assume that each shaded square
represents _
1 of the area of the larger
4
square bordering two of its adjacent
sides and that the shading continues
indefinitely in the indicated manner.
a) Write the series of terms that
would represent this situation.
b) How much of the total area of the
largest square is shaded?

Solution
a) The sequence of shaded regions generates an infinite geometric
sequence. The series of terms that represents this situation is
_1 + _1 +_ 1 +
4 16 64
b) To determine the total area shaded, you need to determine the sum of
all the shaded regions within the largest square.

For this series,


First term t1 = _
1
4
Common ratio r=_ 1
4
Use the formula for the sum of an infinite geometric series.
t1
S = _ , where -1 < r < 1,
1-r
_1
S = __ 4
1-_ 1
4
_1
_
S = 4
_3
4
S = _1 _
4
( )( )
4 3
S = _
1
3
A total area of _
1 of the largest square is shaded.
3
Your Turn
____
You can express 0.584 as an infinite geometric series.
____
0.584 = 0.584 584 584 . . .
= 0.584 + 0.000 584 + 0.000 000 584 +
Determine the sum of the series.

62 MHR Chapter 1
Key Ideas

An infinite geometric series is a geometric series that has an infinite


number of terms; that is, the series has no last term.
An infinite series is said to be convergent if its sequence of partial sums
approaches a finite number. This number is the sum of the infinite series.
An infinite series that is not convergent is said to be divergent.
An infinite geometric series has a sum when -1 < r < 1 and the sum is given by
t1
S = _ .
1-r

Check Your Understanding

Practise 5. What is the sum of each infinite


1. State whether each infinite geometric geometric series?
a) 5 + 5 _ + 5 _ + 5
( ) ( ) ( _23 ) +
series is convergent or divergent. 2 2 2 3

3 3
a) t1 = -3, r = 4
( ) ( ) (- _14 ) +
_ + -_ 1 2+ 3
1
= 4, r = - _
1 b) 1 + -
b) t1 4 4
4
( ) ( ) ( _12 ) +
_ _ 2 3
1 1
c) 125 + 25 + 5 + c) 7 + 7 +7 +7
2 2
d) (-2) + (-4) + (-8) +
_
243 - _
81 + _
27 - _
9 + Apply
e)
3125 625 25 5 6. The sum of an infinite geometric series is
2. Determine the sum of each infinite 81, and its common ratio is _ 2 . What is the
3
geometric series, if it exists.
value of the first term? Write the first three
a) t1 = 8, r = - _
1 terms of the series.
4
b) t1 = 3, r = _
4 7. The first term of an infinite geometric
3 series is -8, and its sum is - _
40 . What
c) t1 = 5, r = 1 3
is the common ratio? Write the first four
d) 1 + 0.5 + 0.25 + terms of the series.
e) 4 - _
12 + _
36 - _
108 +
8. In its first month, an oil well near Virden,
5 25 125
Manitoba produced 24 000 barrels of
3. Express each of the following as an infinite
crude. Every month after that, it produced
geometric series. Determine the sum of
94% of the previous months production.
the series.
___ a) If this trend continued, what would be
a) 0.87
____ the lifetime production of this well?
b) 0.437
b) What assumption are you making? Is
4. Does 0.999 = 1? Support your answer. your assumption reasonable?

1.5 Infinite Geometric Series MHR 63


9. The infinite series given by 16. A pile driver pounds a metal post into
1 + 3x + 9x + 27x + has a sum
2 3
the ground. With the first impact, the post
of 4. What is the value of x? List the moves 30 cm; with the second impact it
first four terms of the series. moves 27 cm. Predict the total distance that
10. The sum of an infinite series is twice the post will be driven into the ground if
its first term. Determine the value of the a) the distances form a geometric sequence
common ratio. and the post is pounded 8 times
11. Each of the following represents an infinite b) the distances form a geometric sequence
geometric series. For what values of x will and the post is pounded indefinitely
each series be convergent? 17. Dominique and Rita are discussing the
a) 5 + 5x + 5x2 + 5x3 + 1 +_
series - _ 4 -_ 16 + . Dominique says
3 9 27
b) 1 + _x + _
x +_
x +2 3
that the sum of the series is - _
1 . Rita says
3 9 27 7
c) 2 + 4x + 8x2 + 16x3 + that the series is divergent and has no sum.
12. Each side of an equilateral triangle has a) Who is correct?
length of 1 cm. The midpoints of the sides b) Explain your reasoning.
are joined to form an inscribed equilateral 18. A hot air balloon rises 25 m
triangle. Then, the midpoints of the sides in its first minute of
of that triangle are joined to form another flight. Suppose that
triangle. If this process continues forever, in each succeeding
what is the sum of the perimeters of the minute the balloon
triangles? rises only 80%
as high as in the
previous minute.
What would be
1

2 the balloons
1
1 maximum

4 altitude?

13. The length of the initial swing of a Hot air balloon rising over Calgary.
pendulum is 50 cm. Each successive swing Extend
is 0.8 times the length of the previous 19. A square piece of paper with a side length
swing. If this process continues forever, of 24 cm is cut into four small squares,
how far will the pendulum swing? each with side lengths of 12 cm. Three of
14. Andrew uses the formula for the these squares are placed side by side. The
sum of an infinite geometric series to remaining square is cut into four smaller
evaluate 1 + 1.1 + 1.21 + 1.331 + . He squares, each with side lengths of 6 cm.
calculates the sum of the series to be 10. Is Three of these squares are placed side by
Andrews answer reasonable? Explain. side with the bigger squares. The fourth
square is cut into four smaller squares and
15. A ball is dropped from a height of 16 m.
three of these squares are placed side by
The ball rebounds to one half of its
side with the bigger squares. Suppose this
previous height each time it bounces. If
process continues indefinitely. What is the
the ball keeps bouncing, what is the total
length of the arrangement of squares?
vertical distance the ball travels?

64 MHR Chapter 1
20. The sum of the series 23. MINI LAB Work in a group of three.
0.98 + 0.982 + 0.983 + + 0.98n = 49.
Step 1 Begin with a large sheet of grid paper
The sum of the series
and draw a square. Assume that the
0.02 + 0.0004 + 0.000 008 + = _ 1.
area of this square is 1.
49
The common ratio in the first series is 0.98 Step 2 Cut the square into 4 equal parts.
and the common ratio in the second series Distribute one part to each member
is 0.02. The sum of these ratios is equal of your group. Cut the remaining part
to 1. Suppose that _ 1 = x + x2 + x3 + ,
z into 4 equal parts. Again distribute one
where z is an integer and x = __ 1 . part to each group member. Subdivide
z+1 the remaining part into 4 equal parts.
a) Create another pair of series that would Suppose you could continue this
follow this pattern, where the sum of pattern indefinitely.
the common ratios of the two series is 1.
b) Determine the sum of each series using
the formula for the sum of an infinite
series.

Step 3 Write a sequence for the fraction of


Create Connections the original square that each student
21. Under what circumstances will an infinite
received at each stage.
geometric series converge?
22. The first two terms of a series are 1 and _1 . n 1 2 3 4
4 Fraction of
Determine a formula for the sum of n terms Paper
if the series is
Step 4 Write the total area of paper each
a) an arithmetic series
student has as a series of partial sums.
b) a geometric series What do you expect the sum to be?
c) an infinite geometric series

Project Corner Petroleum

The Athabasca Oil Sands have estimated oil reserves in excess of that of the rest
of the world. These reserves are estimated to be 1.6 trillion barrels.
Canada is the seventh largest oil producing country in the world. In 2008, Canada
produced an average of 438 000 m3 per day of crude oil, crude bitumen, and
natural gas.
As Albertas reserves of light crude oil began to deplete, so did production. By
1997, Albertas light crude oil production totalled 37.3 million cubic metres. This
production has continued to decline each year since, falling to just over half of its
1990 total at 21.7 million cubic metres in 2005.

1.5 Infinite Geometric Series MHR 65


Chapter 1 Review
1.1 Arithmetic Sequences, pages 621 6. The Gardiner Dam, located 100 km south
1. Determine whether each of the following of Saskatoon, Saskatchewan, is the largest
sequences is arithmetic. If it is arithmetic, earth-filled dam in the world. Upon its
state the common difference. opening in 1967, engineers discovered that
the pressure from Lake Diefenbaker had
a) 36, 40, 44, 48,
moved the clay-based structure 200 cm
b) -35, -40, -45, -50, downstream. Since then, the dam has
c) 1, 2, 4, 8, been moving at a rate of 2 cm per year.
d) 8.3, 4.3, 0.3, -3, -3.7, Determine the distance the dam will have
moved downstream by the year 2020.
2. Match the equation for the nth term of
an arithmetic sequence to the correct
sequence.
a) 18, 30, 42, 54, 66, A tn = 3n + 1
b) 7, 12, 17, 22, B tn = -4(n + 1)
c) 2, 4, 6, 8, C tn = 12n + 6
d) -8, -12, -16, -20, D tn = 5n + 2
e) 4, 7, 10, 13, E tn = 2n
3. Consider the sequence 7, 14, 21, 28, .
Determine whether each of the following
numbers is a term of this sequence. Justify
your answer. If the number is a term of 1.2 Arithmetic Series, pages 2231
the sequence, determine the value of n for 7. Determine the indicated sum for each of
that term. the following arithmetic series
a) 98 b) 110 a) 6 + 9 + 12 + (S )10
c) 378 d) 575 b) 4.5 + 8 + 11.5 + (S12)
4. Two sequences are given: c) 6 + 3 + 0 + (S10)
Sequence 1 is 2, 9, 16, 23,
d) 60 + 70 + 80 + (S20)
Sequence 2 is 4, 10, 16, 22,
8. The sum of the first 12 terms of an
a) Which of the following statements
arithmetic series is 186, and the 20th term
is correct?
is 83. What is the sum of the first 40 terms?
A t17 is greater in sequence 1.
9. You have taken a job that requires being
B t17 is greater in sequence 2. in contact with all the people in your
C t17 is equal in both sequences. neighbourhood. On the first day, you are
b) On a grid, sketch a graph of each able to contact only one person. On the
sequence. Does the graph support second day, you contact two more people
your answer in part a)? Explain. than you did on the first day. On day three,
you contact two more people than you
5. Determine the tenth term of the arithmetic
did on the previous day. Assume that the
sequence in which the first term is 5 and
pattern continues.
the fourth term is 17.
a) How many people would you contact
on the 15th day?
b) Determine the total number of people
you would have been in contact with by
the end of the 15th day.
66 MHR Chapter 1
c) How many days would you need 14. In the Mickey Mouse fractal shown below,
to contact the 625 people in your the original diagram has a radius of 81 cm.
neighbourhood? Each successive circle has a radius _ 1 of the
3
10. A new set of designs is created by the previous radius. What is the circumference
addition of squares to the previous pattern. of the smallest circle in the 4th stage?

Step 1 Step 2

Original Stage 1 Stage 2

15. Use the following flowcharts to describe


what you know about arithmetic and
geometric sequences.
Arithmetic Geometric
Step 3 Step 4 Sequence Sequence
a) Determine the total number of squares
in the 15th step of this design. Definition Definition
b) Determine the total number of squares
required to build all 15 steps.
11. A concert hall has 10 seats in the first row.
Formula Formula
The second row has 12 seats. If each row
has 2 seats more than the row before it and
there are 30 rows of seats, how many seats
Example Example
are in the entire concert hall?

1.3 Geometric Sequences, pages 3245


1.4 Geometric Series, pages 4657
12. Determine whether each of the following
16. Decide whether each of the following
sequences is geometric. If it is geometric,
statements relates to an arithmetic series
determine the common ratio, r, the first
or a geometric series.
term, t1, and the general term of the
sequence. a) A sum of terms in which the difference
between consecutive terms is constant.
a) 3, 6, 10, 15,
b) A sum of terms in which the ratio of
b) 1, -2, 4, -8,
consecutive terms is constant.
c) 1, _1 , _1 , _1 , t1(r n - 1)
2 4 8 c) Sn = __ ,r1
d) _
16 , - _3 , 1, r-1
n[2t1 + (n - 1)d]
Sn = ____
9 4
d)
13. A culture initially has 5000 bacteria, and 2
the number increases by 8% every hour. e) _1 + _1 + _3 + 1 +
4 2 4
a) How many bacteria are present at the
end of 5 h? f) _1 + _1 + _1 + _ 2 +
4 6 9 27
b) Determine a formula for the number of
bacteria present after n hours.

Chapter 1 Review MHR 67


17. Determine the sum indicated for each of 21. Given the infinite geometric series:
the following geometric series. 7 - 2.8 + 1.12 - 0.448 +
a) 6 + 9 + 13.5 + (S10) a) What is the common ratio, r?
b) 18 + 9 + 4.5 + (S ) 12
b) Determine S1, S2, S3, S4, and S5.
c) 6000 + 600 + 60 + (S20) c) What is the particular value that the
d) 80 + 20 + 5 + (S ) sums are approaching?
9

18. A student programs a computer to draw d) What is the sum of the series?
a series of straight lines with each line 22. Draw four squares adjacent to each other.
beginning at the end of the previous line The first square has a side length of 1 unit,
and at right angles to it. The first line the second has a side length of _1 unit, the
is 4 mm long. Each subsequent line is 2
25% longer than the previous one, so that third has a side length of _
1 unit, and the
4
a spiral shape is formed as shown. fourth has a side length of _1 unit.
8
a) Calculate the area of each square. Do
the areas form a geometric sequence?
Justify your answer.
b) What is the total area of the four
squares?
c) If the process of adding squares with
half the side length of the previous
a) What is the length, in millimetres,
square continued indefinitely,
of the eighth straight line drawn by
what would the total area of all the
the program? Express your answer to
squares be?
the nearest tenth of a millimetre.
23. a) Copy and complete each of the
b) Determine the total length of the spiral,
following statements.
in metres, when 20 straight lines have
been drawn. Express your answer to the A series is geometric if there is a
nearest hundredth of a metre. common ratio r such that .
An infinite geometric series converges
if .
1.5 Infinite Geometric Series, pages 5865 An infinite geometric series diverges
19. Determine the sum of each of the if .
following infinite geometric series. b) Give two examples of convergent
a) 5 + 5 _ + 5 _ + 5 _ +
2 2 2 2 3 infinite geometric series one with
( ) ( ) ( )
3 3 3 positive common ratio and one with
b) 1 + (- _ ) + (- _ ) + (- _ ) +
1 1 2
1 3 negative common ratio. Determine the
3 3 3 sum of each of your series.
20. For each of the following series, state
whether it is convergent or divergent.
For those that are convergent, determine
the sum.
a) 8 + 4 + 2 + 1 +
b) 8 + 12 + 27 + 40.5 +
c) -42 + 21 - 10.5 + 5.25 -

d) _3 + _3 + _
3 +_
3 +
4 8 16 32

68 MHR Chapter 1
Chapter 1 Practice Test
Multiple Choice Short Answer
For # 1 to #5, choose the best answer. 6. A set of hemispherical bowls are made so
they can be nested for easy storage. The
1. What are the missing terms of the largest bowl has a radius of 30 cm and
arithmetic sequence , 3, 9, , ? each successive bowl has a radius 90% of
A 1, 27, 81 B 9, 3, 9 the preceding one. What is the radius of
C -6, 12, 17 D -3, 15, 21 the tenth bowl?
2. Marc has set up in his fathers grocery store 30 cm
a display of cans as shown in the diagram.
The top row (Row 1) has 1 can and each
successive row has 3 more cans than the
previous row. Which expression would 7. Use the following graphs to compare and
represent the number of cans in row n? contrast an arithmetic and a geometric
sequence.
y Arithmetic Sequence

14

12

10

8
A Sn = 3n + 1 B tn = 3n - 2
6
C tn = 3n + 2 D Sn = 3n - 3
4
3. What is the sum of the first five
terms of the geometric series 2
16 807 - 2401 + 343 - ?
A 19 607 B 14 707 0 2 4 6 8 10 12 x

C 16 807.29 D 14 706.25
y Geometric Sequence
4. The numbers represented by a, b, and c
are the first three terms of an arithmetic 30
sequence. The number c, when expressed in
terms of a and b, would be represented by 25

A a+b B 2b - a 20
C a + (n - 1)b D 2a + b
15
5. The 20th term of a geometric sequence is
524 288 and the 14th term is 8192. The 10

value of the third term could be 5


A 4 only B 8 only
C +4 or -4 D +8 or -8 0 1 2 3 4 5 6 x

Chapter 1 Practice Test MHR 69


8. If 3, A, 27 is an arithmetic sequence Extended Response
and 3, B, 27 is a geometric sequence 11. Scientists have been measuring the
where B > 0, then what are the values continental drift between Europe and
of A and B? North America for about 25 years. The
9. Josephine Mandamin, an Anishinabe elder data collected show that the continents
from Thunder Bay, Ontario, set out to walk are moving apart at a steady rate of about
around the Great Lakes to raise awareness 17 mm per year.
about the quality of water in the lakes. In six a) According to the Pangaea theory,
years, she walked 17 000 km. If Josephine Europe and North America were
increased the number of kilometres walked connected at one time. Assuming this
per week by 2% every week, how many theory is correct, write an arithmetic
kilometres did she walk in the first week? sequence that describes how far apart
the continents were at the end of each
of the first five years after separation.
b) Determine the general term that
describes the arithmetic sequence.
c) Approximately how many years did it
take to separate to the current distance
of 6000 km? Express your answer to the
nearest million years.
d) What assumptions did you make in
part c)?
12. Photodynamic therapy is used in patients
with certain types of disease. A doctor
injects a patient with a drug that is
attracted to the diseased cells. The diseased
10. Consider the sequence 5, , , , , 160. cells are then exposed to red light from a
laser. This procedure targets and destroys
a) Assume the sequence is arithmetic.
diseased cells while limiting damage to
Determine the unknown terms of the
surrounding healthy tissue. The drug
sequence.
remains in the normal cells of the body and
b) What is the general term of the
must be bleached out by exposure to the
arithmetic sequence? sun. A patient must be exposed to the sun
c) Assume the sequence is geometric. for 30 s on the first day, and then increase
Determine the unknown terms of the the exposure by 30 s every day until a total
sequence. of 30 min is reached.
d) What is the general term of the a) Write the first five terms of the
geometric sequence? sequence of sun exposure times.
b) Is the sequence arithmetic or geometric?
c) How many days are required to reach the
goal of 30 min of exposure to the sun?
d) What is the total number of minutes of
sun exposure when a patient reaches
the 30 min goal?

70 MHR Chapter 1
Unit 1 Project
Canadas Natural Resources
Canada is the source of more than 60 mineral commodities, including
metals, non-metals, structural materials, and mineral fuels.
Quarrying and mining are among the oldest industries in Canada. In
1672, coal was discovered on Cape Breton Island.
In the 1850s, gold discoveries in British Columbia, oil finds in Ontario,
and increased production of Cape Breton coal marked a turning point
in Canadian mineral history.
In 1896, gold was found in the Klondike District of what became Yukon
Territory, giving rise to one of the worlds most spectacular gold rushes.
In the late 1800s, large deposits of coal and oil sands were evident in
part of the North-West Territories that later became Alberta.
In the post-war era there were many major mineral discoveries:
deposits of nickel in Manitoba; zinc-lead, copper, and molybdenum
in British Columbia; and base metals and asbestos in Qubec, Ontario,
Manitoba, Newfoundland, Yukon Territory, and British Columbia.
The discovery of the famous Leduc oil field in Alberta in 1947 was
followed by a great expansion of Canadas petroleum industry.
In the late 1940s and early 1950s, uranium was discovered in
Saskatchewan and Ontario. In fact, Canada is now the worlds largest
uranium producer.
Canadas first diamond-mining operation began production in October
1998 at the Ekati mine in Lac de Gras, Northwest Territories, followed
by the Diavik mine in 2002.

Chapter 1 Task
Choose a natural resource that you would like to research. You may
wish to look at some of the information presented in the Project Corner
boxes throughout Chapter 1 for ideas. Research your chosen resource.
List interesting facts about your chosen resource, including what it is,
how it is produced, where it is exported, how much is exported, and
so on.
Look for data that would support using a sequence or series in
discussing or describing your resource. List the terms for the
sequence or series you include.
Use the information you have gathered in a sequence or series to
predict possible trends in the use or production of the resource over a
ten-year period.
Describe any effects the production of the natural resource has on the
community.

Unit 1 Project MHR 71


CHAPTER

2 Trigonometry
Trigonometry has many applications. Bridge builders
require an understanding of forces acting at different
angles. Many bridges are supported by triangles.
Trigonometry is used to design bridge side lengths and
angles for maximum strength and safety.

Global positioning systems (GPSs) are used in many


aspects of our lives, from cellphones and cars to
mining and excavation. A GPS receiver uses satellites
to triangulate a position, locating that position in
terms of its latitude and longitude. Land surveying,
energy conservation, and solar panel placement all
require knowledge of angles and an understanding
of trigonometry.

Using either the applications mentioned here or


the photographs, describe three situations in which
trigonometry could be used.

You may think of trigonometry as the study of acute


angles and right triangles. In this chapter, you will
extend your study of trigonometry to angles greater
than 90 and to non-right triangles.

Did Yo u Know ?

Euclid defined an angle in his textbook The Elements


as follows:
A plane angle is the inclination to one another of
two lines in a plane which meet one another and do
not lie in a straight line.
Euclid, The Elements, Definition 8

Key Terms
initial arm exact value
terminal arm quadrantal angle
angle in standard sine law
position ambiguous case
reference angle cosine law

72 MHR Chapter 2
Career Link
Physical therapists help improve mobility,
relieve pain, and prevent or limit permanent
physical disabilities by encouraging patients
to exercise their muscles. Physical therapists
test and measure the patients strength, range
of motion, balance, muscle performance, and
motor functions. Next, physical therapists
develop a treatment plan that often includes
exercise to improve patient strength
and flexibility.

We b Link
To learn
earn more about
a the career of a physical
therapist, go to www.mhrprecalc11.ca and follow
the links.

Chapter 2 MHR 73
2.1
Angles in Standard Position
Focus on . . .
sketching an angle from 0 to 360 in standard position and
determining its reference angle
determining the quadrant in which an angle in standard position
terminates
determining the exact values of the sine, cosine, and tangent
ratios of a given angle with reference angle 30, 45, or 60
solving problems involving trigonometric ratios

Do you think angles are only used in geometry?


Angles occur in many everyday situations,
such as driving: when you recline a car seat to
a comfortable level, when you turn a wheel to
ensure a safe turn around the corner, and when
you angle a mirror to get the best view of vehicles
behind you.
In architecture, angles are used to create more
interesting and intriguing buildings. The use of
angles in art is unlimited.
In sports, estimating angles is important in passing
a hockey puck, shooting a basketball, and punting
a football.
Look around you. How many angles can you
identify in the objects in your classroom?

Jazz by Henri Matisse

Investigate Exact Values and Angles in Standard Position

In geometry, an angle is formed by two rays with a common endpoint.


In trigonometry, angles are often interpreted as rotations of a ray. The
starting position and the final position are called the initial arm and
the terminal arm of the angle, respectively. If the angle of rotation is
counterclockwise, then the angle is positive. In this chapter, all angles
will be positive.

terminal
arm

initial arm

74 MHR Chapter 2
Part A: Angles in Standard Position Materials
Work with a partner. grid paper
ruler
1. The diagrams in Group A show angles in standard position. The protractor
angles in Group B are not in standard position. How are the angles
in Group A different from those in Group B? What characteristics
do angles in standard position have?
Group A:
y y y



0 x 0 x 0 x

Group B:
y y y




0 x 0 x 0 x

2. Which diagram shows an angle of 70 in standard position?


Explain your choice.
A y B y C y

70 70 70

0 x 0 x 0 x

3. On grid paper, draw coordinate axes. Then, use a protractor to draw


angles in standard position with each of the following measures.
Explain how you drew these angles. In which quadrant does the
terminal arm of each angle lie?
a) 75 b) 105 c) 225 d) 320

Reflect and Respond


4. Consider the angles that you have drawn. How might you define an
angle in standard position?
5. Explore and explain two ways to use a protractor to draw each angle
in standard position.
a) 290 b) 200 c) 130 d) 325

2.1 Angles in Standard Position MHR 75


Part B: Create a 30-60-90 Triangle
_1
6. Begin with an 8  11 sheet of paper. Fold the paper in half
2
lengthwise and make a crease down the middle.
7. Unfold the paper. In Figure 1, the corners are labelled A, B, C, and D.
A B A B A B
F
A'
C'

E E

B'
D C D C D C
Figure 1 Figure 2 Figure 3

a) Take corner C to the centre fold line and make a crease, DE.
See Figure 2.
b) Fold corner B so that BE lies on the edge of segment DE. The
fold will be along line segment C E. Fold the overlap (the
grey-shaded region) under to complete the equilateral triangle
(DEF). See Figure 3.
8. For this activity, assume that the equilateral
triangle has side lengths of 2 units.
30
a) To obtain a 30-60-90 triangle, fold the 2 2
triangle in half, as shown.
b) Label the angles in the triangle as 30, 60,
and 90. 60 90
1 1
c) Use the Pythagorean Theorem to determine
the exact measure of the third side of the triangle.
Did Yo u Know ? 9. a) Write exact values for sin 30, cos 30, and tan 30.

Numbers such as b) Write exact values for sin 60, cos 60, and tan 60.
__
5 are irrational and
c) Can you use this triangle to determine the sine, cosine, and
cannot be written
as terminating or tangent ratios of 90? Explain.
repeating decimals.
__ A 10. a) On a full sheet of grid paper, draw a set of coordinate axes.
length of 5 cm is an
exact measure. b) Place your 30-60-90 triangle on the grid so that the vertex of
the 60 angle is at the origin and the 90 angle sits in quadrant I
as a perpendicular on the x-axis. What angle in standard position
is modelled?
11. a) Reflect your triangle in the y-axis. What angle in standard position
is modelled?
b) Reflect your original triangle in the x-axis. What angle in standard
position is modelled?
c) Reflect your original triangle in the y-axis and then in the x-axis.
What angle in standard position is modelled?
12. Repeat steps 10 and 11 with the 30 angle at the origin.

76 MHR Chapter 2
Reflect and Respond
13. When the triangle was reflected in an axis, what method did you
use to determine the angle in standard position? Would this work
for any angle?
14. As the triangle is reflected in an axis, how do you think that the
values of the sine, cosine, and tangent ratios might change? Explain.
__
15. a) Do all 30-60-90 triangles have the side relationship of 1 : 3 : 2?
Explain why or why not.
b) Use a ruler to measure the side lengths of your 30-60-90
__
triangle. Do the side lengths follow the relationship 1 : 3 : 2?
How do you know?
16. How can you create a 45-45-90 triangle by paper folding?
What is the exact value of tan 45? sin 45? cos 45?

Link the Ideas

Angles in Standard Position, 0 < 360


On a Cartesian plane, you can generate an angle by rotating a ray about
the origin. The starting position of the ray, along the positive x-axis, is
the initial arm of the angle. The final position, after a rotation about the initial arm
origin, is the terminal arm of the angle. the arm of an angle in
standard position that
An angle is said to be an angle in standard position if its vertex is at the lies on the x-axis
origin of a coordinate grid and its initial arm coincides with the positive
x-axis. terminal arm
y y the arm of an angle in
standard position that
90 < < 180 0 < < 90 meets the initial arm
terminal at the origin to form
II I
arm an angle
0 initial x 0 x
arm III IV angle in
180 < < 270 270 < < 360 standard position
the position of an angle
when its initial arm is
on the positive x-axis
Angles in standard position are always shown on the Cartesian plane. and its vertex is at
the origin
The x-axis and the y-axis divide the plane into four quadrants.

2.1 Angles in Standard Position MHR 77


Reference Angles
For each angle in standard position, there is a corresponding acute angle
reference angle called the reference angle. The reference angle is the acute angle formed
the acute angle whose between the terminal arm and the x-axis. The reference angle is always
vertex is the origin and positive and measures between 0 and 90. The trigonometric ratios of an
whose arms are the angle in standard position are the same as the trigonometric ratios of its
terminal arm of the
angle and the x-axis reference angle except that they may differ in sign. The right triangle that
y contains the reference angle and has one leg on the x-axis is known as
the reference triangle.
230
The reference angle, R, is illustrated for angles, , in standard position
0 x
where 0 < 360.
50
Quadrant I Quadrant II
y y
the reference angle for
230 is 50
R R

0 x 0 x

R = R = 180 -

Quadrant III Quadrant IV


y y

R 0 x 0 R x

R = - 180 R = 360 -

The angles in standard position with a reference angle of 20 are 20,


160, 200, and 340.
y y

160

180 20 0 180 20 0
0 x 0 x

y y

200
180 0 180 0
20 0 x 0 20 x
340

78 MHR Chapter 2
Special Right Triangles
For angles of 30, 45, and 60, you can determine the exact values of exact value
trigonometric ratios. answers involving
radicals are exact,
Drawing the diagonal of a square with a side length of unlike approximated
1 unit gives a 45-45-90 triangle. This is an isosceles c decimal values
1 _1
right triangle. fractions such as
3
45 are exact, but an
Use the Pythagorean Theorem to find the length 1 approximation of
_1
of the hypotenuse. 3
such as 0.333 is not
c2 = a2 + b2
c2 = 12 + 12
c2 = 2 __
c = 2
sin = ___
opposite
cos = ___
adjacent
tan = __
opposite What are the three primary
hypotenuse hypotenuse adjacent trigonometric ratios for the
other acute angle in this
sin 45 = _
1__ cos 45 = _
1__ tan 45 = _
1 triangle?
2 2 1
tan 45 = 1
Drawing the altitude of an equilateral triangle with a side length of
2 units gives a 30-60-90 triangle.
__
Using the Pythagorean Theorem, the length of the altitude is 3 units.
__ __
sin 60 = _
3
cos 60 = _
1 tan 60 = _
3
2 2 1
__ 30
= 3 2
__ 3 Which trigonometric

sin 30 = _ cos 30 = _ tan 30 = _


1 3 1__ ratios for 30 have exact
2 2 3 decimal values? Which are
60 irrational numbers?
1

Example 1
Sketch an Angle in Standard Position, 0 < 360
Sketch each angle in standard position. State the quadrant in
which the terminal arm lies.
a) 36 b) 210 c) 315

Solution
a) = 36
Since 0 < < 90, the terminal arm of lies in quadrant I.
y

36
0 x

2.1 Angles in Standard Position MHR 79


b) = 210 y
Since 180 < < 270, the terminal arm
of lies in quadrant III.
210

0 x

c) = 315 y
Since 270 < < 360, the terminal arm
of lies in quadrant IV.
315

0 x

Your Turn
Sketch each angle in standard position. State the quadrant in
which the terminal arm lies.
a) 150 b) 60 c) 240

Example 2
Determine a Reference Angle
Determine the reference angle R for each angle . Sketch in standard
position and label the reference angle R.
a) = 130 b) = 300

Solution
a) R = 180 - 130 b) R = 360 - 300
R = 50 R = 60
y y

130
R = 50 300

0 x 0 x
R = 60
In which quadrant
does the terminal In which quadrant
arm of 130 lie? does the terminal
arm of 300 lie?
Your Turn
Determine the reference angle R for each angle . Sketch and R in
standard position.
a) = 75 b) = 240

80 MHR Chapter 2
Example 3
Determine the Angle in Standard Position
Determine the angle in standard position when an angle of 40 is reflected
a) in the y-axis
b) in the x-axis
c) in the y-axis and then in the x-axis

Solution
y
a) Reflecting an angle of 40 in the y-axis
will result in a reference angle of 40 in P P
quadrant II.
The measure of the angle in 140
R = 40 = 40
standard position for quadrant II is x
0
180 - 40 = 140.

b) Reflecting an angle of 40 in the x-axis y


will result in a reference angle of 40 in
P
quadrant IV.
The measure of the angle in standard
position for quadrant IV is 320 = 40 x
360 - 40 = 320. 0 R = 40

c) Reflecting an angle of 40 in the y


y-axis and then in the x-axis will
P
result in a reference angle of 40 in
quadrant III.
The measure of the angle in standard 220 = 40 x
position for quadrant III is 0
R = 40
180 + 40 = 220.

What angle of rotation of the P


original terminal arm would
give the same terminal arm
as this reflection?

Your Turn
Determine the angle in standard position when an angle of 60 is reflected
a) in the y-axis
b) in the x-axis
c) in the y-axis and then in the x-axis

2.1 Angles in Standard Position MHR 81


Example 4
Find an Exact Distance
Allie is learning to play the piano. Her teacher uses a metronome to help
her keep time. The pendulum arm of the metronome is 10 cm long. For
one particular tempo, the setting results in the arm moving back and
forth from a start position of 60 to 120. What horizontal distance does
the tip of the arm move in one beat? Give an exact answer.

Solution
Draw a diagram to model the information. y
B a A
OA represents the start position and OB the end
10 cm
position of the metronome arm for one beat. The
tip of the arm moves a horizontal distance equal
to a to reach the vertical position. 120 60

Find the horizontal distance a: 0 a x

cos 60 = ___
adjacent
hypotenuse
_1 = _a _1
Why is substituted for cos 60?
2 10 2

10 ( )
_
1
2
=a
5=a
Because the reference angle for 120 is 60, the tip moves the
same horizontal distance past the vertical position to reach B.
The exact horizontal distance travelled by the tip of the arm in
one beat is 2(5) or 10 cm.

Your Turn
The tempo is adjusted so that the arm of the metronome swings
from 45 to 135. What exact horizontal distance does the tip of
the arm travel in one beat?

Key Ideas

An angle, , in standard position has its initial arm on the positive


x-axis and its vertex at the origin. If the angle of rotation is
counterclockwise, then the angle is positive.
The reference angle is the acute angle whose vertex is the origin 30
and whose arms are the x-axis and the terminal arm of . 2 45 2
1 3
You can determine exact trigonometric ratios for angles
45
of 30, 45, and 60 using special triangles. 1 60
1

82 MHR Chapter 2
Check Your Understanding

Practise 3. In which quadrant does the terminal arm


1. Is each angle, , in standard position? of each angle in standard position lie?
Explain. a) 48 b) 300
a) b) c) 185 d) 75
y y
e) 220 f) 160
4. Sketch an angle in standard position
with each given measure.

0 x 0 x a) 70 b) 310
c) 225 d) 165
c) d) 5. What is the reference angle for each angle
y y
in standard position?
a) 170 b) 345
c) 72 d) 215

0 x 0 x 6. Determine the measure of the three other
angles in standard position, 0 < < 360,
2. Without measuring, match each angle
that have a reference angle of
with a diagram of the angle in standard a) 45 b) 60
position. c) 30 d) 75
a) 150 b) 180 7. Copy and complete the table. Determine
c) 45 d) 320 the measure of each angle in standard
e) 215 f) 270
position given its reference angle and the
quadrant in which the terminal arm lies.
A y B y
Angle in
Reference Standard
Angle Quadrant Position
0 x 0 x
a) 72 IV
b) 56 II
c) 18 III
C y D y
d) 35 IV

8. Copy and complete the table without
0 x 0 x using a calculator. Express each ratio
using exact values.
sin cos tan
E y F y 30
45

60
0 x 0 x

2.1 Angles in Standard Position MHR 83


Apply 11. A windshield wiper has a length of 50 cm.
9. A digital protractor is used in The wiper rotates from its resting position
woodworking. State the measure of the at 30, in standard position, to 150.
angle in standard position when the Determine the exact horizontal distance
protractor has a reading of 20.4. that the tip of the wiper travels in one
y swipe.
12. Suppose A(x, y) is a y
point on the terminal A(x, y)
arm of AOC in
standard position.
x 0 Cx
a) Determine the
10. Paul and Gail decide to use a Cartesian
coordinates of
plane to design a landscape plan for their points A, A,
yard. Each grid mark represents a distance and A
, where
of 10 m. Their home is centred at the A is the image of A reflected in the
origin. There is a red maple tree at the x-axis
point (3.5, 2). They will plant a flowering A is the image of A reflected in the
dogwood at a point that is a reflection in y-axis
the y-axis of the position of the red maple. A
is the image of A reflected in both
A white pine will be planted so that it is the x-axis and the y-axis
a reflection in the x-axis of the position
b) Assume that each angle is in standard
of the red maple. A river birch will be
position and AOC = . What are the
planted so that it is a reflection in both the
measures, in terms of , of the angles
x-axis and the y-axis of the position of the
that have A, A, and A
on their
red maple.
y
terminal arms?

4
13. A 10-m boom lifts material onto a roof
flowering in need of repair. Determine the exact
dogwood (3.5, 2)
2 red maple vertical displacement of the end of the
boom when the operator lowers it from
-6 -4 -2 0 2 4 6 x 60 to 30.
-2
river birch white pine vertical
displacement
-4 is v1 - v2
10 m v1
v2
60
a) Determine the coordinates of 30
the trees that Paul and Gail wish
to plant.
b) Determine the angles in standard
position if the lines drawn from
the house to each of the trees
are terminal arms. Express your
answers to the nearest degree.
c) What is the actual distance between
the red maple and the white pine?

84 MHR Chapter 2
14. Engineers use a bevel protractor to measure 16. The Aztec people of pre-Columbian
the angle and the depth of holes, slots, and Mexico used the Aztec Calendar. It
other internal features. A bevel protractor consisted of a 365-day calendar cycle and
is set to measure an angle of 72. What a 260-day ritual cycle. In the stone carving
is the measure of the angle in standard of the calendar, the second ring from the
position of the lower half of the ruler, used centre showed the days of the month,
for measuring the depth of an object? numbered from one to 20.
y
Suppose the Aztec Calendar was placed
on a Cartesian plane, as shown.
y

0 x

0 x

15. Researcher Mohd Abubakr developed a


circular periodic table. He claims that his
model gives a better idea of the size of the
elements. Joshua and Andrea decided to
Aztec Calendar
make a spinner for the circular periodic
Stone of the Sun
table to help them study the elements for
a quiz. They will spin the arm and then a) The blue angle marks the passing of
name the elements that the spinner lands 12 days. Determine the measure of
on. Suppose the spinner lands so that it the angle.
forms an angle in standard position of b) How many days would have passed
110. Name one of the elements it may if the angle had been drawn in
have landed on. quadrant II, using the same reference
y angle as in part a)?
Uun
c) Keeping the same reference angle, how
Uuu 110

Pt 109 Mt
111 Au 78
Ir
many days would have passed if the
77
Uu Pd 10
8
b 79 Ag Hs
Hg 46
45 Rh 76

angle had been drawn in quadrant IV?


11 47
Ni Os
2
Cd Cu 28
27 Co 44
80
Ru
7

29
10

Zn
Uu

26
Fe
17. Express each direction as an angle in
75

Bh

48
t
Ti

Re

30
43
In

Tc
25
11

Ga

standard position. Sketch each angle.


Mn
3

81

Al
49

106
31

74
B

2
Uuq

H He 1
42
13

a) N20E b) S50W
Pb

Sg
24
Sn

W
Ge

Mo
5
Si

Cr
C
114

82

50

32

14

x c) N80W d) S15E
23

41

73

105
N
As
P
Sb

7
Uup

V
Nb
Bi

15

Ta
Db
33
51

D i d You K n ow ?
8
83

22
S
115

F
16

40
Se

9
Ti

72
Te

4
Cl
34

Ne
4

10

Be
Zr

10

N
17
Po

Li 21
52

Hf

Br Directions are defined as


Uu

12

Ar Sc
Rf

18

Mg
39
84

35 11
h

I Na
a measure either east or
11

20 57
Y
6

Kr Ca 40
53 36
At K
19
89

La
38

Uu 85
Xe 54
Sr west from north and south,
Ac
37
s Rb
71

56

Rn measured in degrees. N40W


11

Ba
7

W E
Lu
L

86
3
10

55 70
Ce Uuo Cs
88

Yb means to start from north


58

Ra
A

Lr

118 2
69 10
Tn Pr Fr
87

Tm No
90 59

Pa Nd 60
Er
68
10
1
and measure 40 toward
Md
91 67

Pm 61

Ho the west.
0
10

S
66

Sm Eu
62
U Dy Fm
92 63 65
64

Np 93 Gd Tb 99

94
98
Es
Pu Am
95 96
97
Cf
Cm Bk

2.1 Angles in Standard Position MHR 85


Extend 20. Carl and a friend are on the Antique Ferris
18. You can use trigonometric ratios to design Wheel Ride at Calaway Park in Calgary.
robotic arms. A robotic arm is motorized The ride stops to unload the riders. Carls
so that the angle, , increases at a constant seat forms an angle of 72 with a horizontal
rate of 10 per second from an initial angle axis running through the centre of the
of 0. The arm is kept at a constant length Ferris wheel.
of 45 cm to the tip of the fingers. a) If the radius of the Ferris wheel is 9 m
a) Let h represent the height of the robotic and the centre of the wheel is 11 m
arm, measured at its fingertips. When above the ground, determine the height
= 0, h is 12 cm. Construct a table, of Carls seat above the ground.
using increments of 15, that lists b) Suppose the Ferris wheel travels at four
the angle, , and the height, h, for revolutions per minute and the operator
0 90. stops the ride in 5 s.
b) Does a constant increase in the angle i) Determine the angle in standard
produce a constant increase in the position of the seat that Carl is on
height? Justify your answer. at this second stop. Consider the
c) What conjecture would you make horizontal central axis to be the x-axis.
if were extended beyond 90? ii) Determine the height of Carls seat at
the second stop.
rotation seat

radius
45 cm 9 m 72 y height

11 m

12
2 cm

D i d You K n ow ?

The first Ferris wheel was built for the 1853 Worlds
Fair in Chicago. The wheel was designed by George
D id Yo u Know ?
Washington Gale Ferris. It had 36 gondola seats and
A conjecture is a general conclusion based on a reached a height of 80 m.
number of individual facts or results. In 1997, the
American Mathematical Society published Beals 21. An angle in standard position is shown.
Conjecture. It states: If Ax + B y = C z, where A, B,
C, x, y, and z are positive integers and x, y, and z
Suppose the radius of the circle is 1 unit.
are greater than 2, then A, B, and C must have a a) Which distance represents sin ?
common prime factor. Andy Beal has offered a prize
for a proof or counterexample of his conjecture. A OD B CD C OC D BA
b) Which distance represents tan ?
We b Link A OD B CD C OC D BA
y
To learn
earn about Beals
B Conjecture and prize, go to
B
www.mhrprecalc11.ca and follow the links. C

19. Suppose two angles in standard position


0 D A x
are supplementary and have terminal
arms that are perpendicular. What are the
measures of the angles?

86 MHR Chapter 2
Create Connections 24. Daria purchased a new golf club. She
22. A point P(x, y) lies on the terminal arm wants to know the distance that she will
of an angle . The distance from P to the be able to hit the ball with this club. She
origin is r units. Create a formula that links recalls from her physics class that the
x, y, and r. distance, d, a ball travels can be modelled
23. a) Copy and complete the table. Use a by the formula d = V ___
2
cos sin , where
16
calculator and round ratios to four
V is the initial velocity, in feet per second,
decimal places.
and is the angle of elevation.
20 40 60 80
sin
sin (180 - )
sin (180 + )
sin (360 - )
a) The radar unit at the practice range
b) Make a conjecture about the relationships
between sin , sin (180 - ), indicates that the initial velocity is
sin (180 + ), and sin (360 - ). 110 ft/s and that the ball is hit at an
angle of 30 to the ground. Determine
c) Would your conjecture hold true for
the exact distance that Daria hit the ball
values of cosine and tangent? Explain
with this driver.
your reasoning.
b) To get a longer hit than that in part a),
should Daria increase or decrease the
angle of the hit? Explain.
c) What angle of elevation do you think
would produce a hit that travels the
greatest distance? Explain your reasoning.

Project Corner Prospecting

Prospecting is exploring an area for natural resources, such as oil, gas,


minerals, precious metals, and mineral specimens. Prospectors travel
through the countryside, often through creek beds and along ridgelines
and hilltops, in search of natural resources.

We b Link
To search
earch for locations
loc of various minerals in Canada,
go to www.mhrprecalc11.ca and follow the links.

2.1 Angles in Standard Position MHR 87


2.2
Trigonometric Ratios of Any Angle
Focus on . . .
determining the distance from the origin to a point (x, y) on the terminal arm of an angle
determining the value of sin , cos , or tan given any point (x, y) on the terminal arm of angle
determining the value of sin , cos , or tan for = 0, 90, 180, 270, or 360
solving for all values of in an equation involving sine, cosine, and tangent
solving a problem involving trigonometric ratios

D i d You K n ow ?
The Athabasca Oil Sands are located 40 km north of Fort McMurray, AB.
They are the worlds largest source of synthetic crude from oil sands, and Many Canadian
companies are
the greatest single source in Canada. Since the beginning of the first oil very aware of
sands production in 1967, technological advances have allowed for a and sensitive to
tremendous increase in production and safety. concerns about the
impact of mining on
Massive machinery has been developed specifically for the excavation of the environment.
The companies
the oil sands. Power shovels are equipped with a global positioning system
consult with local
(GPS) to make digging more exact. The operator must understand the angles Aboriginal people on
necessary to operate the massive shovel. The design of power shovels uses issues such as the
the laws of trigonometry. re-establishment
of native tree
species, like low-
bush cranberry and
buffalo berry.

Investigate Trigonometric Ratios for Angles Greater Than 90

Materials 1. On grid paper, draw a set of coordinate axes.


grid paper a) Plot the point A(3, 4). In which quadrant does the point A lie?
protractor b) Draw the angle in standard position with terminal arm passing
through point A.

88 MHR Chapter 2
2. Draw a line perpendicular to y
the x-axis through point A. 6
Label the intersection of this A(3, 4)
line and the x-axis as point B. 4

This point is on the initial arm 2 r


of AOB.

a) Use the Pythagorean -6 -4 -2 O 2 B4 6 x
Theorem to determine the -2
length of the hypotenuse, r.
-4
b) Write the primary
trigonometric ratios for . -6

c) Determine the measure of ,


to the nearest degree.
3. How is each primary trigonometric ratio related to the coordinates
of point A and the radius r?
4. a) Reflect point A in the y-axis to obtain point C. Draw a line
segment from point C to the origin. What are the coordinates
of point C?
b) Draw a line perpendicular to the x-axis through point C to create
the reference triangle. Label the intersection of this line and
the x-axis as point D. Use your answers from step 3 to write the
primary trigonometric ratios for COB.
5. a) What is the measure of COB, to the nearest degree?
b) How are COD and COB related?

Reflect and Respond


6. a) Compare the trigonometric ratios for AOB and COB. What are
the similarities and what are the differences?
b) Explain why some trigonometric ratios are positive and some
are negative.
7. a) Reflect point C in the x-axis to obtain point E. Which
trigonometric ratios would you expect to be positive? Which
ones would you expect to be negative? Explain your reasoning.
b) Use the coordinates of point E and your definitions from step 3
to confirm your prediction.
c) Extend this investigation into quadrant IV.
8. Make a table showing the signs of the sine, cosine, and tangent
ratios of an angle, , in each of the four quadrants. Do you notice
a pattern? How could you recognize the sign (positive or negative)
of the trigonometric ratios in the various quadrants?

2.2 Trigonometric Ratios of Any Angle MHR 89


Link the Ideas

Finding the Trigonometric Ratios of Any Angle , where 0 < 360


Suppose is any angle in standard position, and y
P(x, y) is any point on its terminal arm, at a P(x, y)
distance r from the origin. Then, by the
_______ r y
Pythagorean Theorem, r = x 2 + y 2 .

You can use a reference triangle to determine the 0 x x
three primary trigonometric ratios in terms of x, y,
and r.

sin = ___
opposite
cos = ___
adjacent
tan = __
opposite
hypotenuse hypotenuse adjacent
sin = _ cos = _ tan = _
y x y
r r x
The chart below summarizes the signs of the trigonometric ratios in each
quadrant. In each, the horizontal and vertical lengths are considered as
directed distances.

Quadrant II Quadrant I
90 < < 180 0 < < 90
_y
sin = r
_
-x
cos = r
_y
tan = -x
_y
sin = r
_x
cos = r
_y
tan = x
sin > 0 cos < 0 tan < 0 sin > 0 cos > 0 tan > 0

P(-x, y) y y
P(x, y) Why is r always
r r positive?
y R y

R
-x 0 x 0 x x

= 180 - R = R

Quadrant III Quadrant IV


180 < < 270 270 < < 360
-y
_ _
-x -y
_ -y
_ _x -y
_
sin = r cos = r tan = -x sin = r cos = r tan = x
sin < 0 cos < 0 tan > 0 sin < 0 cos > 0 tan < 0

y y

-x x
0 x 0 R x
-y R -y
r r
P(-x, -y) P(x, -y)

= 180 + R = 360 - R

90 MHR Chapter 2
Example 1
Write Trigonometric Ratios for Angles in Any Quadrant
The point P(-8, 15) lies on the terminal arm of an angle, , in standard
position. Determine the exact trigonometric ratios for sin , cos , and
tan .

Solution
Sketch the reference triangle by drawing a P(-8, 15)
y
line perpendicular to the x-axis through the
point (-8, 15). The point P(-8, 15) is in 15
quadrant II, so the terminal arm is in quadrant II. R

-8 0 x
Use the Pythagorean Theorem to determine
the distance,
_______
r, from P(-8, 15) to the origin, (0, 0).
x +y
r = ____________
2 2

r = (-8)2 + (15)2
____
r = 289
r = 17
The trigonometric ratios for can be written as follows:
sin = _ cos = _ tan = _
y x y
r r x
sin = _
15 cos = _-8 tan = _15
17 17 -8
cos = - _ 8 tan = - _15
17 8
Your Turn
The point P(-5, -12) lies on the terminal arm of an angle, , in standard
position. Determine the exact trigonometric ratios for sin , cos ,
and tan .

Example 2
Determine the Exact Value of a Trigonometric Ratio
Determine the exact value of cos 135.

Solution
The terminal arm of 135 lies in quadrant II. y
The reference angle is 180 - 135, or 45.
2
The cosine ratio is negative in quadrant II. 1 135
Why are side 45
__ lengths

cos 135 = - _1__ 1, 1, and 2 used? 0 x


-1
2

Your Turn
Determine the exact value of sin 240.

2.2 Trigonometric Ratios of Any Angle MHR 91


Example 3
Determine Trigonometric Ratios
Suppose is an angle in standard position with terminal arm in
quadrant III, and cos = - _
3 . What are the exact values of sin
4
and tan ?

Solution
Sketch a diagram.
y


-3
0 x
y R
4

Use the definition of cosine to find the exact values of x and r.


cos = _
x
r
cos = - _
3
4
Since the terminal arm is in quadrant III, x is negative. r is always
positive. So, x = -3 and r = 4.
Use x = -3, r = 4 and the Pythagorean Theorem to find y.
x2 + y 2 = r2
(-3)2 + y 2 = 42
9 + y 2 = 16
y 2 = 16 - 9
y 2 = 7 __
__ __ __
y = 7 y = 7 is a solution for y 2 = 7 because (7 )(7 ) = 7
__ __ __
y = -7 is also a solution because (-7 )(-7 ) = 7
__ __
Use x = -3, y = -7 , and r = 4 to Why is -7 used for y here?
write sin and tan .

sin = _ tan = _
y y
r __ x __
sin = _
-7
tan = _
-7
4 __ -3
__
sin = - _
7
tan = _
7
4 3
Your Turn
Suppose is an angle in standard position with terminal arm in
quadrant III, and tan = _
1 . Determine the exact values of sin and cos .
5

92 MHR Chapter 2
Example 4
Determine Trigonometric Ratios of Quadrantal Angles
Determine the values of sin , cos , and tan when the terminal arm
of quadrantal angle coincides with the positive y-axis, = 90. quadrantal angle
an angle in standard
Solution position whose
terminal arm lies on
Let P(x, y) be any point on the positive y-axis. Then, x = 0 and r = y. one of the axes
y examples are 0, 90,
P(0, y) 180, 270, and 360

r=y = 90

0 x

The trigonometric ratios can be written as follows.

sin 90 = _ cos 90 = _ tan 90 = _


y x y
r r x
sin 90 = _ cos 90 = _ tan 90 = _
y 0 y
y y 0
Why is tan 90
sin 90 = 1 cos 90 = 0 tan 90 is undefined
undefined?

Your Turn
Use the diagram to determine the values of sin , cos , and tan for
quadrantal angles of 0, 180, and 270. Organize your answers in a table
as shown below.
90
y
(0, y), r = y

(-x, 0), r = x (x, 0), r = x


180 0
0 x

(0, -y), r = y

270

0 90 180 270
sin 1
cos 0
tan undefined

2.2 Trigonometric Ratios of Any Angle MHR 93


Solving for Angles Given Their Sine, Cosine, or Tangent
Step 1 Determine which quadrants the solution(s) will be in by looking
at the sign (+ or ) of the given ratio.
Why are the trigonometric ratios for
Step 2 Solve for the reference angle. the reference angle always positive?
Step 3 Sketch the reference angle in the appropriate quadrant. Use
the diagram to determine the measure of the related angle in
standard position.

Example 5
Solve for an Angle Given Its Exact Sine, Cosine, or Tangent Value
Solve for .
a) sin = 0.5, __0 < 360

b) cos = - _
3
, 0 < 180
2
Solution
a) Since the ratio for sin is positive, the terminal y
arm lies in either quadrant I or quadrant II.
II I
sin R = 0.5
How do you know R = 30?
R = 30 30 30
0 x
In quadrant I, = 30.
In quadrant II, = 180 - 30 III IV
= 150
The solution to the equation sin = 0.5,
0 < 360, is = 30 or = 150.

b) Since the cosine ratio is negative, the terminal arm must lie in
quadrant II or quadrant III. Given the restriction 0 < 180,
the terminal arm must lie in quadrant II.
Use a 30-60-90 triangle
to determine the reference
angle, R. 2 30
__ 3
cos R = _
3
2 60
R = 30 1
y
Using the reference angle of 30 in quadrant II,
the measure of is 180 - 30 = 150.
__ 2
1
The solution to the equation cos = - _ ,
3 30
2 0 x
- 3
0 < 180, is = 150.

Your Turn
Solve sin = - _1__ , 0 < 360.
2

94 MHR Chapter 2
Example 6
Solve for an Angle Given Its Approximate Sine, Cosine, or
Tangent Value
Given cos = -0.6753, where 0 < 360, determine the measure of
, to the nearest tenth of a degree.

Solution
The cosine ratio is negative, so the angles in standard position lie in
quadrant II and quadrant III.
Use a calculator to determine the angle that has cos R = 0.6753.
R = cos-1 (0.6753) Why is cos-1 (0.6753) the reference angle?
R 47.5
With a reference angle of 47.5, the measures of are as follows:
In quadrant II: In quadrant III:
= 180 - 47.5 = 180 + 47.5
= 132.5 = 227.5

Your Turn
Determine the measure of , to the nearest degree, given sin = -0.8090,
where 0 < 360.

Key Ideas

The primary trigonometric ratios for an angle, , in standard


position that has a point P(x, y) on its terminal arm are
_______
sin = _ _x _y
y
r , cos = r , and tan = x , where r = x + y .
2 2

The table show the signs of the primary trigonometric ratios for an
angle, , in standard position with the terminal arm in the given quadrant.
Quadrant
Ratio I II III IV
sin + + - -
cos + - - +
tan + - + -

If the terminal arm of an angle, , in standard position lies on one of


the axes, is called a quadrantal angle. The quadrantal angles are
0, 90, 180, 270, and 360, 0 360.

2.2 Trigonometric Ratios of Any Angle MHR 95


Check Your Understanding

Practise 4. For each description, in which quadrant


1. Sketch an angle in standard position so does the terminal arm of angle lie?
that the terminal arm passes through a) cos < 0 and sin > 0
each point. b) cos > 0 and tan > 0
a) (2, 6) b) (-4, 2) c) sin < 0 and cos < 0
c) (-5, -2) d) (-1, 0) d) tan < 0 and cos > 0
2. Determine the exact values of the sine, 5. Determine the exact values of sin , cos ,
cosine, and tangent ratios for each angle. and tan if the terminal arm of an angle
a) y b) y in standard position passes through the
given point.
225
60 a) P(-5, 12)
0 x 0 x
b) P(5, -3)
c) P(6, 3)
d) P(-24, -10)
c) y d) y
6. Without using a calculator, state whether
150 each ratio is positive or negative.
90

0 x a) sin 155
0 x
b) cos 320
c) tan 120
d) cos 220
3. The coordinates of a point P on the
terminal arm of each angle are shown. 7. An angle is in standard position such that
Write the exact trigonometric ratios sin , sin = _5.
cos , and tan for each. 13
a) Sketch a diagram to show the two
a) y b) y possible positions of the angle.
P(3, 4)
b) Determine the possible values of , to
the nearest degree, if 0 < 360.
0 x
0 x 8. An angle in standard position has its
P(-12, -5) terminal arm in the stated quadrant.
Determine the exact values for the other
two primary trigonometric ratios for each.
c) y d) y
Ratio Value Quadrant

a) cos = - _
2 II
3
0 x 0 x
b) sin =
_3 I
5

P(8, -15) c) tan = -


_4 IV
P(1, -1) 5

d) sin = - _
1 III
3
e) tan = 1 III

96 MHR Chapter 2
9. Solve each equation, for 0 < 360, 13. Point P(7, -24) is on the terminal arm of
using a diagram involving a special an angle, .
right triangle. a) Sketch the angle in standard position.
a) cos = _ b) cos = - _
1 1__ b) What is the measure of the reference
2 2
__ angle, to the nearest degree?
tan = - _ sin = - _
1__ 3
c) d) c) What is the measure of , to the
3 2
__ nearest degree?
e) tan = 3 f) tan = -1
14. a) Determine sin when the terminal arm
10. Copy and complete the table using the of an angle in standard position passes
coordinates of a point on the terminal arm. through the point P(2, 4).
sin cos tan b) Extend the terminal arm to include
0 the point Q(4, 8). Determine sin for
90 the angle in standard position whose
180 terminal arm passes through point Q.
270 c) Extend the terminal arm to include
360
the point R(8, 16). Determine sin for
the angle in standard position whose
11. Determine the values of x, y, r, sin , cos , terminal arm passes through point R.
and tan in each. d) Explain your results from parts a), b),
a) y and c). What do you notice? Why does
P(-8, 6) this happen?
15. The point P(k, 24) is 25 units from the
R
0 x origin. If P lies on the terminal arm
of an angle, , in standard position,
0 < 360, determine
b) y a) the measure(s) of
b) the sine, cosine, and tangent ratios for

0 R x 16. If cos = _1 and tan = 2__6 , determine


5
the exact value of sin .
17. The angle between
the horizontal and
P(5, -12)
Earths magnetic
field is called the
10
Apply angle of dip. Some
20
12. Point P(-9, 4) is on the terminal arm migratory birds 30
of an angle . may be capable of 40
50
a) Sketch the angle in standard position. detecting changes 60
80 70
in the angle of dip,
b) What is the measure of the reference
which helps them
angle, to the nearest degree?
navigate. The angle of dip at the magnetic
c) What is the measure of , to the equator is 0, while the angle at the North
nearest degree? and South Poles is 90. Determine the
exact values of sin , cos , and tan for
the angles of dip at the magnetic equator
and the North and South Poles.

2.2 Trigonometric Ratios of Any Angle MHR 97


18. Without using technology, determine 21. Explore patterns in the sine, cosine, and
whether each statement is true or false. tangent ratios.
Justify your answer. a) Copy and complete the table started
a) sin 151 = sin 29 below. List the sine, cosine, and tangent
b) cos 135 = sin 225 ratios for in increments of 15 for
0 180. Where necessary, round
c) tan 135 = tan 225
values to four decimal places.
d) sin 60 = cos 330
Angle Sine Cosine Tangent
e) sin 270 = cos 180
0
19. Copy and complete the table. Use exact
15
values. Extend the table to include the
30
primary trigonometric ratios for all angles
in standard position, 90 360, that 45
have the same reference angle as those 60
listed for quadrant I.
b) What do you observe about the
sin cos tan sine, cosine, and tangent ratios
0 as increases?
30 c) What comparisons can you make
45 between the sine and cosine ratios?
60 d) Determine the signs of the ratios as you
90 move from quadrant I to quadrant II.
e) Describe what you expect will happen
20. Alberta Aboriginal Tourism designed
if you expand the table to include
a circular icon that represents both the
quadrant III and quadrant IV.
Mtis and First Nations communities of
Alberta. The centre of the icon represents
the collection of all peoples perspectives Extend
and points of view relating to Aboriginal 22. a) The line y = 6x, for x 0, creates
history, touching every quadrant an acute angle, , with the x-axis.
and direction. Determine the sine, cosine, and tangent
ratios for .
a) Suppose the icon is placed on a
coordinate plane with a reference b) If the terminal arm of an angle, ,
angle of 45 for points A, B, C, and D. lies on the line 4y + 3x = 0, for
Determine the measure of the angles x 0, determine the exact value of
in standard position for points A, B, C, tan + cos .
and D. 23. Consider an angle in standard position
b) If the radius of the circle is 1 unit, with r = 12 cm. Describe how the
determine the coordinates of points A, measures of x, y, sin , cos , and tan
B, C, and D. change as increases continuously from
0 to 90.
B A y

12 cm


0 x
C D

98 MHR Chapter 2
24. Suppose is a positive acute angle and 30. MINI LAB Use dynamic geometry software
cos = a. Write an expression for tan in to explore the trigonometric ratios.
terms of a.
Step 1 a) Draw a circle with a radius of
25. Consider an angle of 60 in standard 5 units and centre at the origin.
position in a circle of radius 1 unit. Points
b) Plot a point A on the circle in
A, B, and C lie on the circumference, as
quadrant I. Join point A and the
shown. Show that the lengths of the sides
origin by constructing a line
of ABC satisfy the Pythagorean Theorem
segment. Label this distance r.
and that CAB = 90.
y
Step 2 a) Record the x-coordinate and the
y-coordinate for point A.
1 A
b) Construct a formula to calculate the
sine ratio of the angle in standard
60 position whose terminal arm passes
C 0 B x through point A. Use the measure
and calculate features of your
software to determine the sine ratio
-1
of this angle.
c) Repeat step b) to determine the
cosine ratio and tangent ratio of
Create Connections the angle in standard position
26. Explain how you can use reference angles whose terminal arm passes through
to determine the trigonometric ratios of point A.
any angle, . Step 3 Animate point A. Use the motion
27. Point P(-5, -9) is on the terminal arm of controller to slow the animation. Pause
an angle, , in standard position. Explain the animation to observe the ratios at
the role of the reference triangle and the points along the circle.
reference angle in determining the value Step 4 a) What observations can you make
of . about the sine, cosine, and tangent
28. Explain why there are exactly two ratios as point A moves around the
non-quadrantal angles between 0 and 360 circle?
that have the same sine ratio. b) Record where the sine and
29. Suppose that is an angle in standard cosine ratios are equal. What
position with cos = - _
1 and is the measure of the angle at
__ 2
sin = - _ , 0 < 360. Determine
3 these points?
2 c) What do you notice about the signs
the measure of . Explain your reasoning,
of the ratios as point A moves
including diagrams.
around the circle? Explain.
d) For several choices for point A,
divide the sine ratio by the cosine
ratio. What do you notice about this
calculation? Is it true for all angles
as A moves around the circle?

2.2 Trigonometric Ratios of Any Angle MHR 99


2.3
The Sine Law
Focus on . . .
using the primary trigonometric ratios to
solve problems involving triangles that
are not right triangles
recognizing when to use the sine law to
solve a given problem
sketching a diagram to represent a
problem involving the sine law
explaining a proof of the sine law
solving problems using the sine law
solving problems involving the
ambiguous case of the sine law

How is an airplane pilot able to make precise landings even at night or


in poor visibility? Airplanes have instrument landing systems that allow
pilots to receive precise lateral and vertical guidance on approach and
landing. Since 1994, airplanes have used the global positioning system
(GPS) to provide the pilot with data on an approach. To understand the
GPS, a pilot must understand the trigonometry of triangulation.
You can use right-triangle trigonometry to solve problems involving right
triangles. However, many interesting problems involve oblique triangles.
Oblique triangles are any triangles that do not contain a right angle. In
this section, you will use right-triangle trigonometry to develop the sine
law. You can use the sine law to solve some problems involving non-
right triangles.

Investigate the Sine Law

Materials 1. In an oblique triangle, the ratio of the sine of an angle to the length of
protractor its opposite side is constant. Demonstrate that this is true by drawing
and measuring any oblique triangle. Compare your results with those
of other students.
2. Draw an oblique triangle. Label its vertices A, B, and C and its side
lengths a, b, and c. Draw an altitude from B to AC and let its height
be h.
B

c
h a

A
b
C

100 MHR Chapter 2


3. Use the two right triangles formed. Write a trigonometric ratio for
sin A. Repeat for sin C. How are the two equations alike?
4. Rearrange each equation from step 3, expressing h in terms of the
side and the sine of the angle.
5. a) Relate the two equations from step 4 to eliminate h and form
one equation.
b) Divide both sides of the equation by ac.

Reflect and Respond


6. The steps so far have led you to a partial equation for the sine law.
a) Describe what measures in a triangle the sine law connects.
b) What components do you need to be able to use the sine law?
7. Demonstrate how you could expand the ratios from step 5 to include
the third ratio, _
sin B .
b
8. Together, steps 5 and 7 form the sine law. Write out the sine law that
you have derived and state it in words.
9. Can you solve all oblique triangles using the sine law? If not, give an
example where the sine law does not allow you to solve for unknown
angle(s) or side(s).

Link the Ideas

You have previously encountered problems involving right triangles


that you could solve using the Pythagorean Theorem and the primary
trigonometric ratios. However, a triangle that models a situation with
unknown distances or angles may not be a right triangle. One method
of solving an oblique triangle is to use the sine law. To prove the sine
law, you need to extend your earlier skills with trigonometry.

D id Yo u K n ow ?

Nasir al-Din al-Tusi, born in the year 1201 C.E.,


began his career as an astronomer in Baghdad.
In On the Sector Figure, he derived the sine law.

2.3 The Sine Law MHR 101


The Sine Law

sine law The sine law is a relationship between the sides and angles in any
the sides of a triangle triangle. Let ABC be any triangle, where a, b, and c represent the
are proportional to the measures of the sides opposite A, B, and C, respectively. Then,
sines of the opposite
angles __
a =_
b =_
c

_ a
=
_ b
=
_ c sin A sin B sin C
sin A sin B sin C
or
__
sin A = _
sin B = _
sin C
a b c
Proof
The symbol means
In ABC, draw an altitude AD BC. A
perpendicular to.
Let AD = h.
c h b
In ABD: In ACD:
sin B = _
h
c sin C = _
h
b B D C
a
h = c sin B h = b sin C

Relate these two equations, because both equal h:


c sin B = b sin C Divide both sides by sin B sin C.
_ c =_ b
sin C sin B
This is part of the sine law.

By drawing the altitude from C and using similar steps, you can
show that
__a =_ b
sin A sin B

Therefore,
__ a =_ b =_ c
sin A sin B sin C
or
__
sin A = _sin B = _
sin C
a b c

Example 1
Determine an Unknown Side Length friends cabin
B
Pudluks family and his friend own 88
cabins on the Kalit River in Nunavut. 1.8 km
Pudluk and his friend wish to determine
the distance from Pudluks cabin to the A
61
C
store on the edge of town. They know that Pudluks communications
the distance between their cabins is 1.8 km. cabin tower
Using a transit, they estimate the measures of the angles between their
cabins and the communications tower near the store, as shown in the
diagram. Determine the distance from Pudluks cabin to the store, to the
nearest tenth of a kilometre.

102 MHR Chapter 2


Solution
Method 1: Use Primary Trigonometric Ratios
Calculate the measure of C. What relationship exists
C = 180 - 88 - 61 for the sum of the interior
angles of any triangle?
C = 31
Draw the altitude of the triangle from B to intersect AC at point D.
Label the altitude h.
The distance from Pudluks cabin to the store friends cabin
is the sum of the distances AD and DC. B

88
From ABD, determine h. 1.8 km
h
sin 61 = ___
opposite
hypotenuse 61 31
A x D y C
sin 61 = _h Pudluks store
1.8 cabin
h = 1.8 sin 61 Check that your calculator is in degree mode.

From ABD, determine x. From BDC, determine y.

cos 61 = ___ tan 31 = __


adjacent opposite
hypotenuse adjacent
_
cos 61 = x _
h
tan 31 = y
1.8
x = 1.8 cos 61 y = __
1.8 sin 61
tan 31
x = 0.872 y = 2.620
Then, AC = x + y, or 3.492.
The distance from Pudluks cabin to the store is approximately 3.5 km.
Method 2: Use the Sine Law
Calculate the measure of C. What is the sum of the interior
angles of any triangle?
C = 180 - 88 - 61
C = 31
List the measures.
A = 61 a= Which pairs of ratios from the sine law
B = 88 b= would you use to solve for b?

C = 31 c = 1.8 km
_
b =_
c Why is this form of the sine law used?
sin B sin C
__ b __
= 1.8 What do you do to each side to isolate b?
sin 88 sin 31

b = __
1.8 sin 88
sin 31
b = 3.492 Compare the two methods. Which do you prefer and why?

The distance from Pudluks cabin to the store is approximately 3.5 km.

Your Turn
Determine the distance from Pudluks friends cabin to the store.

2.3 The Sine Law MHR 103


Example 2
Determine an Unknown Angle Measure
In PQR, P = 36, p = 24.8 m, and q = 23.4 m. Determine the measure
of R, to the nearest degree.

Solution
Sketch a diagram of the triangle. List the measures. Q
P = 36 p = 24.8
Q =  q = 23.4 Which ratios would r
you use? 24.8 m
R =  r=
Since p > q, there is only one possible triangle. 36
P 23.4 m R
Use the sine law to determine Q. Why do you need to determine Q?
__
sin Q _
sin P
q = p
__
sin Q
= __
sin 36
23.4 24.8
sin Q = ___
23.4 sin 36
24.8

(
Q = sin-1 ___ )
23.4 sin 36
24.8
Q = 33.68
Thus, Q is 34, to the nearest degree.
Use the angle sum of a triangle to determine R.
R = 180 - 34 - 36
R = 110
The measure of R is 110, to the nearest degree.

Your Turn
In LMN, L = 64, l = 25.2 cm, and m = 16.5 cm. Determine the
measure of N, to the nearest degree.

The Ambiguous Case


When solving a triangle, you must analyse the given information to
determine if a solution exists. If you are given the measures of two angles
and one side (ASA), then the triangle is uniquely defined. However, if
you are given two sides and an angle opposite one of those sides (SSA),
ambiguous case the ambiguous case may occur. In the ambiguous case, there are three
from the given possible outcomes:
information the no triangle exists that has the given measures; there is no solution
solution for the triangle
is not clear: there might one triangle exists that has the given measures; there is one solution
be one triangle, two
triangles, or no triangle
two distinct triangles exist that have the given measures; there are two
distinct solutions

104 MHR Chapter 2


These possibilities are summarized in the diagrams below.
Suppose you are given the measures of side b
and A of ABC. You can find the height of Why can you use
this equation to
the triangle by using h = b sin A.
find the height?
In ABC, A and side b are constant because they are
given. Consider different possible lengths of side a.
For an acute A, the four possible lengths of side a result in four
different cases.

C C
Recall that
a h = b sin A.
b b a=h
h B What type of
triangle occurs
A in this case?
A B

a<h Why is there no a=h


a < b sin A solution in this a = b sin A
case?
no solution one solution

C C

b a b a' a
h h

A B A B' B

ab h<a<b
Why is there not
one solution another solution with B b sin A < a < b
on the left side of A? two solutions

For an obtuse A, three cases can occur.


C C C
a
B
b a, b a
b

A A B
A, B
a<b a=b
no solution no solution
a>b
one solution

2.3 The Sine Law MHR 105


Example 3
Use the Sine Law in an Ambiguous Case
In ABC, A = 30, a = 24 cm, and b = 42 cm. Determine the measures
of the other side and angles. Round your answers to the nearest unit.

Solution
List the measures.
A = 30 a = 24 cm
B =  b = 42 cm
C =  c=
Because two sides and an angle opposite one of the sides are known, it is
possible that this triangle may have two different solutions, one solution,
or no solution. A is acute and a < b, so check which condition is true.
a < b sin A: no solution Why is the value of b sin A so important?
a = b sin A: one solution
a > b sin A: two solutions
Sketch a possible diagram. Where does the length of CB actually fit?
C

42 cm 24 cm
h
30
A B

Determine the height of the triangle.


sin A = _h
b
h = b sin A
h = 42 sin 30 How do you know the value of sin 30?
h = 21
Since 24 > 21, the case a > b sin A occurs.
Therefore, two triangles are possible. The second
solution will give an obtuse angle for B.
C
Solve for B using the sine law.
42 cm 24 cm
_
sin B = __
sin A h
b a 30
A B
_
sin B = __
sin 30 B'
42 24
sin B = __
42 sin 30
24
B = sin (
-1 __
42 sin 30
24 )
B = 61.044
To the nearest degree, B = 61.
To find the second possible measure of B, use 61 as the reference angle
in quadrant II. Then, B = 180 - 61 or B = 119.

106 MHR Chapter 2


Case 1: B = 61 Case 2: B = 119
C = 180 - (61 + 30) C = 180 - (119 + 30)
C = 89 C = 31
C C

42 cm 89 24 cm 42 cm
h 31 24 cm
30 61 30
A B A
119 B
__
c = __
24 __
c = __
24 Use the sine law to
sin 89 sin 30 sin 31 sin 30 determine the measure
of side c in each case.
__
c = 24 sin 89 __
c = 24 sin 31
sin 30 sin 30
c = 47.992 c = 24.721

The two possible triangles are as follows:


acute ABC: A = 30, B = 61, C = 89, Compare the ratios
_
a
,
sin A
a = 24 cm, b = 42 cm, c = 48 cm _
b
, and
_
c
to check
sin B sin C
obtuse ABC: A = 30, B = 119, C = 31,
your answers.
a = 24 cm, b = 42 cm, c = 25 cm

Your Turn
In ABC, A = 39, a = 14 cm, and b = 10 cm. Determine the measures
of the other side and angles. Express your answers to the nearest unit.

Key Ideas

You can use the sine law to find the measures of sides and angles in a triangle.

For ABC, state the sine law as __


a = __
b =_
c or __
sin A = _
sin B = _
sin C
.
sin A sin B sin C a b c
Use the sine law to solve a triangle when you are given the measures of
 two angles and one side

 two sides and an angle that is opposite one of the given sides

The ambiguous case of the sine law may occur when you are given
two sides and an angle opposite one of the sides.
For the ambiguous case in ABC, when A is an acute angle: C
 a b one solution b a<h
 a = h one solution h = b sin A
A a=h
 a < h no solution
h<a<b
 b sin A < a < b two solutions
ab

For the ambiguous case in ABC, when A is an obtuse angle: C


a, if a < b
 a b no solution
 a > b one solution b
a>b
a=b
A B

2.3 The Sine Law MHR 107


Check Your Understanding

Practise 5. Sketch each triangle. Determine the


Where necessary, round lengths to the nearest measure of the indicated side.
tenth of a unit and angle measures to the a) In ABC, A = 57, B = 73, and
nearest degree. AB = 24 cm. Find the length of AC.
1. Solve for the unknown side or angle b) In ABC, B = 38, C = 56, and
in each. BC = 63 cm. Find the length of AB.
a) __ = __
a 10
c) In ABC, A = 50, B = 50, and
sin 35 sin 40
AC = 27 m. Find the length of AB.
b) __ = __
b 65
sin 48 sin 75 d) In ABC, A = 23, C = 78, and
AB = 15 cm. Find the length of BC.
c) _ = __
sin sin 50
12 65 6. For each triangle, determine whether
d)
__ = __
sin A sin 62 there is no solution, one solution, or
25 32 two solutions.
2. Determine the length of AB in each.
a) In ABC, A = 39, a = 10 cm, and
a) A b) A
b = 14 cm.
52
118 b) In ABC, A = 123, a = 23 cm, and
35 C
b = 12 cm.
44 mm
c) In ABC, A = 145, a = 18 cm, and
45 m
88 b = 10 cm.
B
d) In ABC, A = 124, a = 1 cm, and
C B
b = 2 cm.
3. Determine the value of the marked
unknown angle in each. 7. In each diagram, h is an altitude. Describe
A A how A, sides a and b, and h are related
a) b)
in each diagram.
a) C
28 m 31 m 17.5 m
B 98
b a
h
62 15 m
B C C A B

4. Determining the lengths of all three


b) C
sides and the measures of all three
angles is called solving a triangle. b a a
h
Solve each triangle.
A B
a) C b) A B'
12 m
50 m
A 42 c) C

13 m 67 C b
B 84 a=h
B
A B
c) A 22 d) A 21 cm
48 C d) C
61
29 mm
b h a

A B
39 C
B B

108 MHR Chapter 2


8. Determine the unknown side and angles in 12. A chandelier is suspended from a
each triangle. If two solutions are possible, horizontal beam by two support chains.
give both. One of the chains is 3.6 m long and forms
a) In ABC, C = 31, a = 5.6 cm, and an angle of 62 with the beam. The second
c = 3.9 cm. chain is 4.8 m long. What angle does the
second chain make with the beam?
b) In PQR, Q = 43, p = 20 cm, and
q = 15 cm. beam 62
c) In XYZ, X = 53, x = 8.5 cm, and
z = 12.3 cm. 4.8 m 3.6 m

9. In ABC, A = 26 and b = 120 cm.


Determine the range of values of a for chandelier
which there is
13. Nicolina wants to approximate the
a) one oblique triangle
height of the Francophone Monument in
b) one right triangle Edmonton. From the low wall surrounding
c) two oblique triangles the statue, she measures the angle of
d) no triangle elevation to the top of the monument to be
40. She measures a distance 3.9 m farther
away from the monument and measures
Apply
the angle of elevation to be 26. Determine
10. A hot-air balloon is flying above BC Place
the height of the Francophone Monument.
Stadium. Maria is standing due north
D
of the stadium and can see the balloon
at an angle of inclination of 64. Roy is
due south of the stadium and can see the Francophone
Monument
balloon at an angle of inclination of 49.
26 40
The horizontal distance between Maria and A
3.9 m B C
Roy is 500 m.
a) Sketch a diagram to represent the given
information.
b) Determine the distance that the hot air
balloon is from Maria.
11. The Canadian Coast Guard Pacific Region
is responsible for more than 27 000 km
of coastline. The rotating spotlight from
the Coast Guard ship can illuminate up
to a distance of 250 m. An observer on
the shore is 500 m from the ship. His
line of sight to the ship makes an angle
of 20 with the shoreline. What length of
shoreline is illuminated by the spotlight?
Coast Guard
D i d You K n ow ?

The Francophone Monument located at the


500 m 250 m Legislature Grounds in Edmonton represents
250 m
the union of the fleur de lis and the wild rose.
20 This monument celebrates the contribution of
observer A shoreline D francophones to Albertas heritage.

2.3 The Sine Law MHR 109


14. From the window of his hotel in Saskatoon, 16. A hang-glider is a triangular parachute
Max can see statues of Chief Whitecap of made of nylon or Dacron fabric. The pilot of
the Whitecap First Nation and John Lake, a hang-glider flies through the air by finding
leader of the Temperance Colonists, who updrafts and wind currents. The nose angle
founded Saskatoon. The angle formed by for a hang-glider may vary. The nose angle
Maxs lines of sight to the top and to the for the T2 high-performance glider ranges
foot of the statue of Chief Whitecap is 3. from 127 to 132. If the length of the wing
The angle of depression of Maxs line of is 5.1 m, determine the greatest and least
sight to the top of the statue is 21. The wingspans of the T2 glider.
horizontal distance between Max and the
front of the statue is 66 m.
a) Sketch a diagram to represent this
problem.
b) Determine the height of the statue of
D i d You K n ow ?
Chief Whitecap.
Cochrane, Alberta, located 22 km west of
c) Determine the line-of-sight distance
Calgary, is considered to be the perfect location for
from where Max is standing hang-gliding. The prevailing winds are heated as
at the window they cross the prairie. Then they are forced upward
to the foot of by hills, creating powerful thermals that produce the
long flights so desired by flyers.
the statue.
The Canadian record for the longest hang-gliding
flight is a distance of 332.8 km, flown from east of
Beiseker, Alberta, to northwest of Westlock, in May
1989, by Willi Muller.

17. On his trip to Somerset Island, Nunavut,


Armand joined an informative tour near
Fort Ross. During the groups first stop,
15. The chemical formula for water, H2O, tells Armand spotted a cairn at the top of a hill,
you that one molecule of water is made up a distance of 500 m away. The group made
of two atoms of hydrogen and one atom of a second stop at the bottom of the hill.
oxygen bonded together. The nuclei of the From this point, the cairn is 360 m away.
atoms are separated by the distance shown, The angle between the cairn, Armands
in angstroms. An angstrom is a unit of first stop, and his second stop is 35.
length used in chemistry.
a) Explain why there are two possible
0
locations for Armands second stop.
104.5 0.958 A
b) Sketch a diagram to illustrate each
possible location.
37.75 c) Determine the possible distances between
H H
Armands first and second stops.
a) Determine the distance, in angstroms
D i d You K n ow ?
(), between the two hydrogen atoms.
A cairn is a pile of
b) Given that
stones placed
1 = 0.01 mm, H as a memorial, tomb,
what is the distance or landmark.
between the two H O
hydrogen atoms, in
millimetres?

110 MHR Chapter 2


18. Radio towers, designed to support 21. There are about 12 reported oil spills of
broadcasting and telecommunications, are 4000 L or more each day in Canada. Oil
among the tallest non-natural structures. spills, such as occurred after the train
Construction and maintenance of radio derailment near Wabamun Lake, Alberta,
towers is rated as one of the most can cause long-term ecological damage.
dangerous jobs in the world. To change To contain the spilled oil, floating
the antenna of one of these towers, a crew booms are placed in the water. Suppose
sets up a system of pulleys. The diagram for the cleanup of the 734 000 L of oil
models the machinery and cable set-up. at Wabamun, the floating booms used
Suppose the height of the antenna is 30 m. approximated an oblique triangle with
Determine the total height of the structure. the measurements shown. Determine the
34.5
area of the oil spill at Wabamun.
30 m

102
4.6 km

8.5 km
0.9
22. For each of the following, include a
diagram in your solution.
cable a) Determine the range of values
operator side a can have so that ABC has
two solutions if A = 40 and
627 m
b = 50.0 cm.
19. Given an obtuse ABC, copy and complete
b) Determine the range of values
the table. Indicate the reasons for each step
side a can have so that ABC
for the proof of the sine law.
has no solutions if A = 56 and
A
b = 125.7 cm.
c h b c) ABC has exactly one solution. If
A = 57 and b = 73.7 cm, what are
B D C
a the values of side a for which this
is possible?
Statements Reasons
23. Shawna takes a pathway through Nose
sin C =
_h sin B =
_h
b c Hill Park in her Calgary neighbourhood.
h = b sin C h = c sin B Street lights are placed 50 m apart on the
b sin C = c sin B main road, as shown. The light from each
streetlight illuminates a distance along
_
sin C
=
_
sin B
c b the ground of up to 60 m. Determine the
distance from A to the farthest point on
Extend the pathway that is lit.
20. Use the sine law to prove that if the
Nose Hill Park
measures of two angles of a triangle Pathway
are equal, then the lengths of the sides
opposite those angles are equal. Use a
sketch in your explanation. 21
A 50 m B 50 m C 50 m D
Main Road

2.3 The Sine Law MHR 111


Create Connections b) Use the golden ratio to determine the
24. Explain why the sine law cannot be used exact lengths of the two equal sides.
to solve each triangle. c) If you bisect one base angle of a golden
a) A b) E triangle, you create another golden
78 22 triangle similar to the first, as in Figure 2.
D Determine the length of side CD.
45 Figure 2 A
B 30
57
34
C 36

F
c) J d) P
D

36

36
L 88 C 8 cm B

30 d) This pattern may be repeated, as in


R Q
5 Figure 3. Determine the length of DE.
K
Figure 3 A
25. Explain how you B
could use a right
c 36
ABC to partially a
develop the sine law.
C A
b

26. A golden triangle is an isosceles triangle in D


which the ratio of the length of the longer E
side to the length
__ of the shorter side is the 36
golden ratio, __ : 1. The golden ratio is
5+1
36
2 C 8 cm B
found in art, in math, and in architecture. In
golden triangles, the vertex angle measures e) Describe how the spiral in Figure 4
36 and the two base angles measure 72. is created.
Figure 4 A
a) The triangle in Figure 1 is a golden
triangle. The base measures 8 cm. Use
the sine law to determine the length of 36

the two equal sides of the triangle.


Figure 1 A

36

27. Complete a concept map to show the


C 8 cm B conditions necessary to be able to use
the sine law to solve triangles.
112 MHR Chapter 2
28. MINI LAB Work with a partner to explore Hold one end at the centre of the circle
conditions for the ambiguous case of the and turn the other end through the arc
sine law. of the circle.
a) Can a triangle be formed under
Materials
these conditions?
ruler
B b) Make a conjecture about the number
compass
of triangles formed and the conditions
string
necessary for this situation.
scissors
D Step 4 Extend the circle so that it intersects
A C
line segment AC at two distinct points.
Step 1 Draw a line segment AC. Draw a Cut a piece of string that is the length
second line segment AB that forms an of the radius. Hold one end at the
acute angle at A. Draw a circle, using centre of the circle and turn the other
point B as the centre, such that the end through the arc of the circle.
circle does not touch the line segment a) Can a triangle be formed under
AC. Draw a radius and label the point these conditions?
intersecting the circle D.
b) Make a conjecture about the number
Step 2 Cut a piece of string that is the length of triangles formed and the conditions
of the radius BD. Hold one end at the necessary for this situation.
centre of the circle and turn the other
Step 5 Cut a piece of string that is longer than
end through the arc of the circle.
the segment AB. Hold one end at B and
a) Can a triangle be formed under turn the other end through the arc of a
these conditions? circle.
b) Make a conjecture about the number a) Can a triangle be formed under
of triangles formed and the conditions these conditions?
necessary for this situation.
b) Make a conjecture about the number
Step 3 Extend the circle so that it just touches the of triangles formed and the conditions
line segment AC at point D. Cut a piece of necessary for this situation.
string that is the length of the radius.
Step 6 Explain how varying the measure of
A would affect your conjectures.

Project Corner Triangulation

Triangulation is a method of determining your exact location based on your position


relative to three other established locations using angle measures or bearings.
Bearings are angles measured in degrees from the
north line in a clockwise direction. A bearing usually has forest corner
three digits. For instance, north is 000, east is 090, south
is 180, and southwest is 225. your position

summit
A bearing of 045 is the same as N45E.
How could you use triangulation to help you farm house
determine the location of your resource?

2.3 The Sine Law MHR 113


2.4
The Cosine Law
Focus on . . .
sketching a diagram and solving a problem
using the cosine law
recognizing when to use the cosine law to
solve a given problem
explaining the steps in the given proof of
the cosine law

The Canadarm2, one of the


three components of the Mobile
Servicing System, is a major part of the
mpleted its first official
Canadian space robotic system. It completed
construction job on the Internationall S Space Station
St ti in i July
J l 2001.
2001 The
Th
robotic arm can move equipment and assist astronauts working in
space. The robotic manipulator is operated by controlling the angles
of its joints. The final position of the arm can be calculated by using
the trigonometric ratios of those angles.

Investigate the Cosine Law

Materials 1. a) Draw ABC, where a = 3 cm, A

ruler b = 4 cm, and c = 5 cm.


protractor b) Determine the values of a2, b2, and c2.
b c
c) Compare the values of a2 + b2 and c2.
Which of the following is true?
a2 + b2 = c2
C a B
a2 + b2 > c2
a2 + b2 < c2
d) What is the measure of C?
2. a) Draw an acute ABC. A
b) Measure the lengths of sides a, b, and c.
c) Determine the values of a2, b2, and c2. c
b
d) Compare the values of a + b and c .
2 2 2

Which of the following is true?


B
a2 + b2 > c2 a
a2 + b2 < c2 C

114 MHR Chapter 2


The cosine law relates the lengths of the sides of a given triangle to the
cosine of one of its angles.
3. a) For ABC given in step 1, determine the value of 2ab cos C.
b) Determine the value of 2ab cos C for ABC from step 2.
c) Copy and complete a table like the one started below. Record
your results and collect data for the triangle drawn in step 2
from at least three other people.

Triangle Side Lengths (cm) c2 a2 + b2 2ab cos C


a = 3, b = 4, c = 5
a = , b = , c = 

4. Consider the inequality you found to be true in step 2, for the


relationship between the values of c2 and a2 + b2. Explain how
your results from step 3 might be used to turn the inequality into
an equation. This relationship is known as the cosine law.
5. Draw ABC in which C is obtuse. Measure its side lengths.
Determine whether or not your equation from step 4 holds.

Reflect and Respond


6. The cosine law relates the lengths of the sides of a given triangle to
the cosine of one of its angles. Under what conditions would you use
the cosine law to solve a triangle?
A

c
b

B
a
C

7. Consider the triangle shown.


C

10.4 cm

47
A B
21.9 cm
a) Is it possible to determine the length of side a using the sine
law? Explain why or why not.
b) Describe how you could solve for side a.
8. How are the cosine law and the Pythagorean Theorem related?

2.4 The Cosine Law MHR 115


Link the Ideas

The Cosine Law

cosine law The cosine law describes the relationship between the cosine of an
if a, b, c are the sides of angle and the lengths of the three sides of any triangle.
a triangle and C is the B
angle opposite c, the
cosine law is a c
c2 = a2 + b2 - 2ab cos C

C b A

For any ABC, where a, b, and c are the lengths of the sides opposite
to A, B, and C, respectively, the cosine law states that
c2 = a2 + b2 - 2ab cos C
You can express the formula in different forms
to find the lengths of the other sides of the triangle.
a2 = b2 + c2 - 2bc cos A What patterns do
b2 = a2 + c2 - 2ac cos B you notice?

Proof
In ABC, draw an altitude h.
B

a c
h

C x D b-x A
b

In BCD:
cos C = _
x
a a2 = h2 + x 2
x = a cos C
In ABD, using the Pythagorean Theorem:
c2 = h2 + (b - x)2
c2 = h2 + b2 - 2bx + x 2 Expand the binomial.
c = h + x + b - 2bx
2 2 2 2 Why are the terms rearranged?
c = a + b - 2b(a cos C)
2 2 2 Explain the substitutions.
c = a + b - 2ab cos C
2 2 2

Example 1
Determine a Distance
A surveyor needs to find the length of a swampy area near Fishing Lake,
Manitoba. The surveyor sets up her transit at a point A. She measures
the distance to one end of the swamp as 468.2 m, the distance to the
opposite end of the swamp as 692.6 m, and the angle of sight between
the two as 78.6. Determine the length of the swampy area, to the nearest
tenth of a metre.

116 MHR Chapter 2


Solution A

Sketch a diagram to illustrate the problem. 78.6 468.2 m


692.6 m

Use the cosine law. B


a
a = b + c - 2bc cos A
2 2 2 C
a2 = 692.62 + 468.22 - 2(692.6)(468.2)cos 78.6 Can you use the sine
a2 = 570 715.205
______________
law or the Pythagorean
a = 570 715.205 Theorem to solve for a?
Why or why not?
a = 755.456
The length of the swampy area is 755.5 m, to the nearest tenth of a metre.

Your Turn
Nina wants to find the distance between two points, A and B, on
opposite sides of a pond. She locates a point C that is 35.5 m from A and
48.8 m from B. If the angle at C is 54, determine the distance AB, to the
nearest tenth of a metre.

Example 2
Determine an Angle
The Lions Gate Bridge has been a Vancouver landmark since it
opened in 1938. It is the longest suspension bridge in Western
Canada. The bridge is strengthened by triangular braces. Suppose
one brace has side lengths 14 m, 19 m, and 12.2 m. Determine the
measure of the angle opposite the 14-m side, to the nearest degree.

Solution
Sketch a diagram to illustrate the situation. B

Use the cosine law: c2 = a2 + b2 - 2ab cos C


Method 1: Substitute Directly 19 m
14 m
c = a + b - 2ab cos C
2 2 2

142 = 192 + 12.22 - 2(19)(12.2) cos C


196 = 361 + 148.84 - 463.6 cos C A 12.2 m C
196 = 509.84 - 463.6 cos C
196 - 509.84 = -463.6 cos C
-313.84 = -463.6 cos C
__
-313.84 = cos C
-463.6
(
cos-1 __ )
313.84 = C
463.6
47.393 = C
The measure of the angle opposite the 14-m side is approximately 47.

2.4 The Cosine Law MHR 117


Method 2: Rearrange the Formula to Solve for cos C
c2 = a2 + b2 - 2ab cos C
2ab cos C = a2 + b2 - c2
cos C = ___
a2 + b2 - c2 How can you write a similar formula for A or B?
2ab
cos C = ____
192 + 12.22 - 142
2(19)(12.2)

(
____ + 12.22 - 142
)
2
-1 19
C = cos
2(19)(12.2)
C = 47.393
The measure of the angle opposite the 14-m side is approximately 47.

Your Turn
A triangular brace has side lengths 14 m, 18 m, and 22 m. Determine the
measure of the angle opposite the 18-m side, to the nearest degree.

Example 3
Solve a Triangle
In ABC, a = 11, b = 5, and C = 20. Sketch a diagram and determine
the length of the unknown side and the measures of the unknown angles,
to the nearest tenth.

Solution
Sketch a diagram of the triangle. A
List the measures. 5 20
A =  a = 11 B
11
C
B =  b=5
C = 20 c=
Use the cosine law to solve for c. Could you use the sine law? Explain.
c2 = a2 + b2 - 2ab cos C
c2 = 112 + 52 - 2(11)(5) cos 20
c2 = 42.633
c = 6.529
Did Yo u Know ? To solve for the angles, you could use either the cosine law or the sine law.
For A:
As a general rule,
cos A = ___
b2 + c2 - a2
it is better to use
the cosine law to 2bc
find angles, since 52
+ (6.529)2 - 112
____
cos A = For c, use your
the inverse cosine 2(5)(6.529) calculator value.

( )
function (cos-1) on a
____
5 2
+ (6.529) 2
- 112
calculator will display A = cos-1
an obtuse angle when 2(5)(6.529)
Could you find the
the cosine ratio is A = 144.816
negative. measure of A or C
The measure of A is approximately 144.8. using the sine law? If
Use the angle sum of a triangle to determine C. so, which is better to
find first?
C = 180 - (20 + 144.8)
C = 15.2
118 MHR Chapter 2
The six parts of the triangle are as follows:
A = 144.8 a = 11
B = 15.2 b = 5
C = 20 c = 6.5

Your Turn
In ABC, a = 9, b = 7, and C = 33.6. Sketch a diagram and determine
the length of the unknown side and the measures of the unknown angles,
to the nearest tenth.

Key Ideas

Use the cosine law to find the length of an unknown side of any triangle when you
know the lengths of two sides and the measure of the angle between them.
The cosine law states that for any ABC, the B
following relationships exist:
a c
a2 = b2 + c2 - 2bc cos A
b2 = a2 + c2 - 2ac cos B C A
b
c2 = a2 + b2 - 2ab cos C
Use the cosine law to find the measure of an unknown angle of
any triangle when the lengths of three sides are known.
Rearrange the cosine law to solve for a particular angle.
For example, cos A = a ___
2
- b2 - c2 or cos A = b ___
2
+ c2 - a2
.
-2bc 2bc
Use the cosine law in conjunction with the sine law to solve a triangle.

Check Your Understanding

Practise 2. Determine the measure of the indicated


Where necessary, round lengths to the angle.
nearest tenth of a unit and angles to the a) J b) L
nearest degree, unless otherwise stated. H N
10.4 cm 18 cm
1. Determine the length of the third side of 17 m
each triangle. 10 m L M
21.9 cm
a) A b) M
9 cm I J
11 m
C B
17 14 cm
29 mm
c) P d) C
c) E P A
9 mm 6 mm 31 m
41 13 m
21 m Q R B
L 13 mm N 14 mm 20 m C
123
D 30 m F

2.4 The Cosine Law MHR 119


3. Determine the lengths of the unknown 6. Determine the length of side c in each
sides and the measures of the unknown ABC, to the nearest tenth.
angles. a) B b) A
a) P b) R 6m c
41 cm
c
52 45
C B
30 10 m
A C
29 km 28 km 9.1 cm 26 cm
6.8 cm
7. In a parallelogram, the measure of the
obtuse angle is 116. The adjacent sides,
Q R S 5 cm T containing the angle, measure 40 cm and
4. Make a sketch to show the given 22 cm, respectively. Determine the length
information for each ABC. Then, of the longest diagonal.
determine the indicated value. 8. The longest tunnel in North America
a) AB = 24 cm, AC = 34 cm, and could be built through the mountains of
A = 67. Determine the length of BC. the Kicking Horse Canyon, near Golden,
British Columbia. The tunnel would be on
b) AB = 15 m, BC = 8 m, and B = 24.
the Trans-Canada highway connecting the
Determine the length of AC.
Prairies with the west coast. Suppose the
c) AC = 10 cm, BC = 9 cm, and C = 48. surveying team selected a point A, 3000 m
Determine the length of AB. away from the proposed tunnel entrance
d) AB = 9 m, AC = 12 m, and BC = 15 m. and 2000 m from the tunnel exit. If A is
Determine the measure of B. measured as 67.7, determine the length of
e) AB = 18.4 m, BC = 9.6 m, and the tunnel, to the nearest metre.
AC = 10.8 m. Determine the measure
We b Link
of A.
To learn
earn more about
a the history of the Kicking Horse
f) AB = 4.6 m, BC = 3.2 m, and Pass and proposed plans for a new tunnel, go to
AC = 2.5 m. Determine the measure www.mhrprecalc11.ca and follow the links.
of C.
9. Thousands of Canadians are active
Apply in sailing clubs. In the Paralympic
5. Would you use the sine law or the cosine Games, there are competitions in the
law to determine each indicated side single-handed, double-handed, and
length or angle measure? Give reasons for three-person categories. A sailing race
your choice. course often follows a triangular route
around three buoys. Suppose the distances
a) F b) p
between the buoys of a triangular course
E P
24 m are 8.56 km, 5.93 km, and 10.24 km.
30 km
D Determine the measure of the angle at each
35 m 62 of the buoys.
20 m R 35
p
Q D i d You K n ow ?
F
c) B A Single-handed sailing means that one person sails
the boat. Double-handed refers to two people. Buoys
are floating markers, anchored to keep them in
20 cm place. The oldest record of buoys being used to warn
of rock hazards is in the thirteenth century on the
95 Guadalquivir River near Seville in Spain.
C 22 cm B

120 MHR Chapter 2


10. The Canadian womens national ice hockey 12. An aircraft-tracking station determines the
team has won numerous international distances from a helicopter to two aircraft
competitions, including gold medals at the as 50 km and 72 km. The angle between
2002, 2006, and 2010 Winter Olympics. these two distances is 49. Determine the
A player on the blue line shoots a puck distance between the two aircraft.
toward the 1.83-m-wide net from a point 13. Tony Smith was born in 1912 in South
20.3 m from one goal post and 21.3 m from Orange, New Jersey. As a child, Tony
the other. Within what angle must she suffered from tuberculosis. He spent his
shoot to hit the net? Answer to the nearest time playing and creating with medicine
tenth of a degree. boxes. His sculpture, Moondog, consists of
several equilateral and isosceles triangles
1.83 m
that combine art and math. Use the
information provided on the diagram to
determine the maximum width of Moondog.
29 29
20.3 m 73 73
60 60
21.3 m
60 60 60 60

73.25 73.25
161.3 cm 161.3 cm

33.5 33.5

11. One of the best populated sea-run


brook trout areas in Canada is Lac
Guillaume-Delisle in northern Qubec.
Also known as Richmond Gulf, it is a large
triangular-shaped lake. Suppose the sides
forming the northern tip of the lake are
65 km and 85 km in length, and the angle
at the northern tip is 7.8. Determine the
width of the lake at its base.

Moondog by Tony Smith

14. Julia and Isaac are backpacking in Banff


National Park. They walk 8 km from their
base camp heading N42E. After lunch,
they change direction to a bearing of 137
and walk another 5 km.
a) Sketch a diagram of their route.
b) How far are Julia and Isaac from their
base camp?
c) At what bearing must they travel to
return to their base camp?

2.4 The Cosine Law MHR 121


15. A spotlight is 8 m 18. Distances in the throwing events at the
away from a mirror x Olympic games, traditionally measured
on the floor. A beam with a tape measure, are now found with a
of light shines into 8m piece of equipment called the Total
7m
the mirror, forming 80 Station. This instrument measures the
an angle of 80 with mirror angles and distances for events such as the
the reflected light. shot put, the discus, and the javelin. Use
The light is reflected a distance of 7 m to the measurements shown to determine the
shine onto a wall. Determine the distance distance, to the nearest hundredth of a
from the spotlight to the point where the metre, of the world record for the javelin
light is reflected onto the wall. throw set by Barbora potkov of
16. Erica created this design for part of a the Czech Republic in
company logo. She needs to determine the September 2008. point of
impact
accuracy of the side lengths. Explain how
you could use the cosine law to verify that throwing
the side lengths shown are correct. circle
102 m

22 m 74.63
7 mm
instrument position
27 mm 22 mm
19. The Bermuda Triangle is an unmarked
area in the Atlantic Ocean where there
23 mm 16 mm
have been reports of unexplained
disappearances of boats and planes and
problems with radio communications.
30 mm
The triangle is an isosceles triangle with
17. The sport of mountain biking became vertices at Miami, Florida, San Juan,
popular in the 1970s. The mountain bike Puerto Rico, and at the island of Bermuda.
was designed for off-road cycling. The Miami is approximately 1660 km from
geometry of the mountain bike contains two both Bermuda and San Juan. If the
triangles designed for the safety of the rider. angle formed by the sides of the triangle
The seat angle and the head tube angle are connecting Miami to Bermuda and Miami
critical angles that affect the position of to San Juan is 55.5, determine the distance
the rider and the performance of the bike. from Bermuda to San Juan. Express your
Calculate the interior angles of the frame of answer to the nearest kilometre.
the mountain bike shown. Bermuda
U.S.
head
tube Miami
angle Atlantic
Gulf of Ocean
50 cm Mexico
seat angle
Cuba
54 cm San Juan
Haiti
40 cm
Jamaica Dominican
Republic
Caribbean Sea

South America

122 MHR Chapter 2


20. Della Falls in 22. Justify each step of the proof of the
Strathcona Provincial cosine law.
Park on Vancouver A
Island is the highest
b c
waterfall in Canada. h
A surveyor measures
the angle to the top C x a-x B
D
of the falls to be 61. a
He then moves in a
direct line toward Statement Reason
the falls a distance c 2 = (a - x)2 + h 2
of 92 m. From this c 2 = a 2 - 2ax + x 2 + h 2
closer point, the b2 = x2 + h2
angle to the top c 2 = a 2 - 2ax + b 2
of the falls is 71. _x
Determine the height cos C =
b
of Della Falls. x = b cos C
c 2 = a 2 - 2a(b cos C) + b 2
c 2 = a 2 + b 2 - 2ab cos C

h
Extend
23. Two ships leave port at 4 p.m. One
61 71 is headed N38E and is travelling at
11.5 km/h. The other is travelling at
92 m
13 km/h, with heading S47E. How far
21. The floor of the apart are the two ships at 6 p.m.?
200 ft 343.7 ft
Winnipeg Art Gallery
24. Is it possible to draw a triangle with side
is in the shape of a
375 ft lengths 7 cm, 8 cm, and 16 cm? Explain
triangle with sides
why or why not. What happens when you
measuring 343.7 ft, 375 ft, and 200 ft.
use the cosine law with these numbers?
Determine the measures of the interior
angles of the building. 25. The hour and minute hands of a clock
have lengths of 7.5 cm and 15.2 cm,
respectively. Determine the straight-line
distance between the tips of the hands
at 1:30 p.m., if the hour hand travels
0.5 per minute and the minute hand
travels 6 per minute.
26. Graph A(-5, -4), B(8, 2), and C(2, 7) on
a coordinate grid. Extend BC to intersect
the y-axis at D. Find the measure of the
interior angle ABC and the measure of
the exterior angle ACD.

2.4 The Cosine Law MHR 123


27. Researchers at Queens University use a Create Connections
combination of genetics, bear tracks, and 30. The Delta Regina Hotel is the tallest building
feces to estimate the numbers of polar in Saskatchewan. From the window of
bears in an area and gather information her room on the top floor, at a height of
about their health, gender, size, and age. 70 m above the ground, Rian observes a
Researchers plan to set up hair traps car moving toward the hotel. If the angle
around King William Island, Nunavut. of depression of the car changes from 18
The hair traps, which look like fences, to 35 during the time Rian is observing it,
will collect polar bear hair samples for determine the distance the car has travelled.
analysis. Suppose the hair traps are set up HOTEL

in the form of ABC, where B = 40, 18


c = 40.4 km, and a = 45.9 km. Determine
70 m 35
the area of the region.
g

31. Given ABC where C = 90,


a = 12.2 cm, b = 8.9 cm, complete
the following.
a) Use the cosine law to find c2.
b) Use the Pythagorean Theorem to
find c2.
c) Compare and contrast the cosine law
with the Pythagorean Theorem.
d) Explain why the two formulas are
the same in a right triangle.
28. If the sides of a triangle have lengths 2 m,
32. When solving triangles, the first step is
3 m, and 4 m, what is the radius of the
choosing which method is best to begin
circle circumscribing the triangle?
with. Copy and complete the following
table. Place the letter of the method beside
the information given. There may be more
than one answer.
r
3m A primary trigonometric ratios
4m
B sine law
2m
C cosine law
D none of the above
29. ABC is placed on a Cartesian grid
with BCA in standard position. Point B Concept Summary for Solving a Triangle
has coordinates (-x, y). Use primary Begin by Using
trigonometric ratios and the Pythagorean Given the Method of
Theorem to prove the cosine law. Right triangle
y Two angles and any side
B(-x, y)
Three sides
c Three angles
b
Two sides and the included
a angle
C(0, 0) A(a, 0) x
Two sides and the angle
opposite one of them

124 MHR Chapter 2


33. MINI LAB Materials Step 1 a) Construct ABC with side lengths
ruler a = 4 cm, b = 8 cm, and c = 6 cm.
protractor b) On each side of the triangle,
compasses construct a square.
F
c) Join the outside corners of the
squares to form three new triangles.
G
D Step 2 a) In ABC, determine the measures
of A, B, and C.
B
H b) Explain why pairs of angles, such
4 cm 6 cm as ABC and GBF, have a sum of
180. Determine the measures of
C 8 cm A GBF, HCI, and DAE.
c) Determine the lengths of the third
sides, GF, DE, and HI, of BGF,
ADE, and CHI.
Step 3 For each of the four triangles, draw an
altitude.
a) Use the sine ratio to determine the
I E measure of each altitude.
b) Determine the area of each triangle.
Step 4 What do you notice about the areas of
the triangles? Explain why you think
this happens. Will the result be true for
any ABC?

Project Corner Trilateration

GPS receivers work on the principle of trilateration. The satellites


circling Earth use 3-D trilateration to pinpoint locations. You can Aklavik
use 2-D trilateration to see how the principle works.
Suppose you are 55 km from Aklavik, NT. Knowing this tells you
that you are on a circle with radius 55 km centred at Aklavik. Tuktoyuktuk

If you also know that you are 127 km from Tuktoyuktuk, you
have two circles that intersect and you must be at one of these Aklavik
intersection points.
If you are told that you are 132 km from Tsiigehtchic, a third circle
Tuktoyuktuk
will intersect with one of the other two points of intersection,
telling you that your location is at Inuvik. Inuvik
Aklavik
How can you use the method of trilateration If you know the angle at
Inuvik, how can you determine
to pinpoint the location of your resource? Tsiigehtchic
the distance between
Tuktoyuktuk and Tsiigehtchic?

2.4 The Cosine Law MHR 125


Chapter 2 Review
Where necessary, express lengths to the 3. A heat lamp is placed above a patients
nearest tenth and angles to the nearest arm to relieve muscle pain. According
degree. to the diagram, would you consider the
reference angle of the lamp to be 30?
2.1 Angles in Standard Position, pages 7487 Explain your answer.
1. Match each term with its definition from lamp
the choices below.
y
a) angle in standard position
b) reference angle
c) exact value
d) sine law 30

e) cosine law
skin
f) terminal arm 0 x

g) ambiguous case

A a formula that relates the lengths of the 4. Explain how to determine the measure
sides of a triangle to the sine values of of all angles in standard position,
its angles 0 < 360, that have 35 for their
reference angle.
B a value that is not an approximation
and may involve a radical 5. Determine the exact values of the sine,
cosine, and tangent ratios for each angle.
C the final position of the rotating arm of
an angle in standard position a) 225

D the acute angle formed by the terminal b) 120


arm and the x-axis c) 330
E an angle whose vertex is at the origin d) 135
and whose arms are the x-axis and the
terminal arm
2.2 Trigonometric Ratios of Any Angle,
F a formula that relates the lengths of the
pages 8899
sides of a triangle to the cosine value of
one of its angles 6. The point Q(-3, 6) is on the terminal arm
of an angle, .
G a situation that is open to two or more
interpretations a) Draw this angle in standard position.

2. Sketch each angle in standard position. b) Determine the exact distance from the
State which quadrant the angle terminates origin to point Q.
in and the measure of the reference angle. c) Determine the exact values for sin ,
a) 200 cos , and tan .
b) 130 d) Determine the value of .

c) 20 7. A reference angle has a terminal arm that


passes through the point P(2, -5). Identify
d) 330
the coordinates of a corresponding point
on the terminal arm of three angles in
standard position that have the same
reference angle.

126 MHR Chapter 2


8. Determine the values of the primary 12. Determine the length(s) of the indicated
trigonometric ratios of in each case. side(s) and the measure(s) of the indicated
a) y angle(s) in each triangle.
a) A b) B
44 mm
35
(0, 1)
C 17 m
0 x c

88
B A 42
22 m
C
13. In PQR, P = 63.5, Q = 51.2, and
b) y
r = 6.3 cm. Sketch a diagram and find the
measures of the unknown sides and angle.

14. In travelling to Jasper from Edmonton, you
(-3, 0) 0 x notice a mountain directly in front of you.
The angle of elevation to the peak is 4.1.
When you are 21 km closer to the mountain,
the angle of elevation is 8.7. Determine the
approximate height of the mountain.
9. Determine the exact value of the other two
15. Sarah runs a deep-sea-fishing charter. On
primary trigonometric ratios given each of
one of her expeditions, she has travelled
the following.
40 km from port when engine trouble
a) sin = - _ , cos < 0
3 occurs. There are two Search and Rescue
5
(SAR) ships, as shown below.
b) cos = _ , tan < 0
1
3 Ship A 68 km Ship B
c) tan = _ , sin > 0
12 47 49
5
10. Solve for all values of , 0 < 360,
given each trigonometric ratio value.
a) tan = -1.1918
Sarah
b) sin = -0.3420 a) Which ship is closer to Sarah? Use the
c) cos = 0.3420 sine law to determine her distance from
that ship.
b) Verify your answer in part a) by using
2.3 The Sine Law, pages 100113
primary trigonometric ratios.
11. Does each triangle contain sufficient
16. Given the measure of A and the length of
information for you to determine the
side b in ABC, explain the restrictions
unknown variable using the sine law?
on the lengths of sides a and b for the
Explain why or why not.
problem to have no solution, one solution,
a) b)
114 and two solutions.
3 cm 20 cm
32 cm C
18 a
b a
h

c) A
B
4 cm
7 cm
5

Chapter 2 Review MHR 127


17. A passenger jet is at cruising altitude 21. The 12th hole at a
heading east at 720 km/h. The pilot, golf course is a 375-yd G
wishing to avoid a thunderstorm, changes straightaway par 4.
course by heading N70E. The plane When Darla tees off,
travels in this direction for 1 h, before the ball travels 20 to
turning to head toward the original path. the left of the line from B
375 yd
After 30 min, the jet makes another turn the tee to the hole. The
onto its original path. ball stops 240 yd from
240 yd
a) Sketch a diagram to represent the the tee (point B).
distances travelled by the jet to avoid Determine how far the 20

the thunderstorm. ball is from the centre


of the hole.
b) What heading, east of south, did the
plane take, after avoiding the storm, T
to head back toward the original
22. Sketch a diagram of each triangle
flight path?
and solve for the indicated value(s).
c) At what distance, east of the point
a) In ABC, AB = 18.4 m, BC = 9.6 m,
where it changed course, did the jet
and AC = 10.8 m. Determine the
resume its original path?
measure of A.
b) In ABC, AC = 10 cm, BC = 9 cm, and
2.4 The Cosine Law, pages 114125 C = 48. Determine the length of AB.
18. Explain why each set of information does c) Solve ABC, given that AB = 15 m,
not describe a triangle that can be solved. BC = 8 m, and B = 24.
a) a = 7, b = 2, c = 4 23. Two boats leave a dock at the same time.
b) A = 85, b = 10, C = 98 Each travels in a straight line but in
different directions. The angle between
c) a = 12, b = 20, c = 8
their courses measures 54. One boat
d) A = 65, B = 82, C = 35 travels at 48 km/h and the other travels at
19. Would you use the sine law or the cosine 53.6 km/h.
law to find each indicated side length? a) Sketch a diagram to represent the
Explain your reasoning. situation.
a) Y
b) How far apart are the two boats after
110 x 4 h?
32 24. The sides of a parallelogram are 4 cm
X 24 m Z
and 6 cm in length. One angle of the
b) X
parallelogram is 58 and a second angle
y 4 cm is 122.
a) Sketch a diagram to show the given
88
Z Y information.
8 cm
20. Determine the value of the indicated b) Determine the lengths of the two
variable. diagonals of the parallelogram.
a) B b) C
23.6 cm
26 cm a 28.4 cm
B
53
A C 33.2 cm
36 cm
A

128 MHR Chapter 2


Chapter 2 Practice Test
Multiple Choice Short Answer
For #1 to #5, choose the best answer. 6. The point P(2, b) is on the terminal
arm of an angle, , in standard position.
If cos = _
1. Which angle in standard position has 1
___ and tan is negative, what
a different reference angle than all 10
the others? is the value of b?
A 125 B 155 7. Oak Bay in Victoria, is in the direction of
C 205 D 335 N57E from Ross Bay. A sailboat leaves
Ross Bay in the direction of N79E. After
2. Which angle in standard position does not
sailing for 1.9 km, the sailboat turns and
have a reference angle of 55?
travels 1.1 km to reach Oak Bay.
A 35 B 125
a) Sketch a diagram to represent the
C 235 D 305
situation.
3. Which is the exact value of cos 150?
__ b) What is the distance between Ross Bay
A _1 B
_
3 and Oak Bay?
2 __ 2
8. In ABC, a = 10, b = 16, and A = 30.
C -_ D -_
3 1
2 2 a) How many distinct triangles can be
4. The equation that could be used to drawn given these measurements?
determine the measure of angle is b) Determine the unknown measures in
ABC.
9. Rudy is 20 ft from each goal post when he

shoots the puck along the ice toward the
70 cm goal. The goal is 6 ft wide. Within what
angle must he fire the puck to have a hope
28 of scoring a goal?
34 cm
G
20 ft
A _
sin = __
sin 28
6 ft
70 34 R

B
_
sin
= __
sin 28 20 ft
P
34 70
10. In PQR, P = 56, p = 10 cm, and
C cos = ___
702 + 342 - 282
2(70)(34) q = 12 cm.
D = 34 + 702 - 2(34)(70)cos 28
2 2
a) Sketch a diagram of the triangle.
5. For which of these triangles must you b) Determine the length of the unknown
consider the ambiguous case? side and the measures of the unknown
A In ABC, a = 16 cm, b = 12 cm, and angles.
c = 5 cm.
B In DEF, D = 112, e = 110 km, and
f = 65 km.
C In ABC, B = 35, a = 27 m, and
b = 21 m.
D In DEF, D = 108, E = 52, and
f = 15 cm.

Chapter 2 Practice Test MHR 129


11. In ABC, M is a point on BC such that 15. Describe when to use the sine law and
BM = 5 cm and MC = 6 cm. If AM = 3 cm when to use the cosine law to solve a
and AB = 7 cm, determine the length given problem.
of AC. 16. As part of her landscaping course at the
A
Northern Alberta Institute of Technology,
7 cm
3 cm Justine spends a summer redesigning her
aunts backyard. She chooses triangular
B 5 cm M 6 cm C
shapes for her theme. Justine knows
12. A fence that is 1.4 m tall has started to lean some of the measurements she needs in
and now makes an angle of 80 with the her design. Determine the unknown side
ground. A 2.0-m board is jammed between lengths in each triangle.
the top of the fence and the ground to prop
the fence up.
2.8 m
a) What angle, to the nearest degree, does 66
5.2 m
the board make with the ground?
b) What angle, to the nearest degree, 117 shrubs
3.6 m 59
does the board make with the top of patio

the fence?
c) How far, to the nearest tenth of a metre,
17. The North Shore Rescue (NSR) is a
is the bottom of the board from the base
mountain search and rescue team based
of the fence?
in Vancouver. On one of their training
exercises, the team splits up into two
groups. From their starting point, the
1.4 m groups head off at an angle of 129 to
2.0 m
each other. The Alpha group walks east
for 3.8 km before losing radio contact
80 with the Beta group. If their two-way
radios have a range of 6.2 km, how far
could the Beta group walk before losing
Extended Response radio contact with the Alpha group?
13. Explain, using examples, how to determine
all angles 0 < 360 with a given
reference angle R.
14. A softball diamond is a square measuring
70 ft on each side, with home plate and
the three bases as vertices. The centre of
the pitchers mound is located 50 ft from
home plate on a direct line from home to
second base.
a) Sketch a diagram to represent the given
information.
b) Show that first base and second base are
not the same distance from the pitchers
mound.

130 MHR Chapter 2


Unit 1 Project
Canadas Natural Resources
The emphasis of the Chapter 2 Task is the location of your resource.
You will describe the route of discovery of the resource and the
planned area of the resource.

Chapter 2 Task
We b Link
The Journey to Locate the Resource
To obtain a copy of an
Use the map provided. Include a brief log of the journey leading to exploration map, go to
www.mhrprecalc11.ca
your discovery. The exploration map is the route that you followed to and follow the links.
discover your chosen resource.
With your exploration map, determine the total distance of your
route, to the nearest tenth of a kilometre. Begin your journey at
point A and conclude at point J. Include the height of the Sawback
Ridge and the width of Crow River in your calculations.

Developing the Area of Your Planned Resource

Your job as a resource development officer for the company is to


present a possible area of development. You are restricted by land
boundaries to the triangular shape shown, with side AB of 3.9 km,
side AC of 3.4 km, and B = 60.
Determine all measures of the triangular region that your company
could develop.

Possible Proposed Development


A

3.9 km 3.4 km h

60
B C D

Unit 1 Project MHR 131


Unit 1 Project Wrap-Up
Canadas Natural Resources
You need investment capital to develop your resource. Prepare a
presentation to make to your investors to encourage them to invest in
your project. You can use a written or visual presentation, a brochure, a
video production, a computer slide show presentation, or an interactive
whiteboard presentation.
Your presentation should include the following:
Actual data taken from Canadian sources on the production of your
chosen resource. Use sequences and series to show how production
has increased or decreased over time, and to predict future production
and sales.
A fictitious account of a recent discovery of your resource, including a
map of the area showing the accompanying distances.
A proposal for how the resource area will be developed over the next
few years

132 MHR Unit 1 Project Wrap-Up


Cumulative Review, Chapters 12
Chapter 1 Sequences and Series
1. Match each term to the correct expression. 6. Phytoplankton, or algae, is a nutritional
a) arithmetic sequence supplement used in natural health
programs. Canadian Pacific Phytoplankton
b) geometric sequence
Ltd. is located in Nanaimo, British
c) arithmetic series Columbia. The company can grow 10 t of
d) geometric series marine phytoplankton on a regular 11-day
e) convergent series cycle. Assume this cycle continues.
A 3, 7, 11, 15, 19, a) Create a graph showing the amount of
B 5+1+_
1 +_
1 + phytoplankton produced for the first
5 25 five cycles of production.
C 1 + 2 + 4 + 8 + 16 +
b) Write the general term for the sequence
D 1, 3, 9, 27, 81,
produced.
E 2 + 5 + 8 + 11 + 14 +
c) How does the general term relate to the
2. Classify each sequence as arithmetic or characteristics of the linear function
geometric. State the value of the common described by the graph?
difference or common ratio. Then, write
7. The Living Shangri-La is the tallest
the next three terms in each sequence.
building in Metro Vancouver. The ground
a) 27, 18, 12, 8, floor of the building is 5.8 m high, and
b) 17, 14, 11, 8, each floor above the ground floor is
c) -21, -16, -11, -6, 3.2 m high. There are 62 floors altogether,
including the ground floor. How tall is
d) 3, -6, 12, -24,
the building?
3. For each arithmetic sequence, determine
the general term. Express your answer in
simplified form.
a) 18, 15, 12, 9,

b) 1, _5 , 4, _
11 ,
2 2
4. Use the general term to determine t20 in the
geometric sequence 2, -4, 8, -16, .
5. a) What is S12 for the arithmetic series with
a common difference of 3 and t12 = 31?
b) What is S5 for a geometric series where
t1 = 4 and t10 = 78 732?

Cumulative Review, Chapters 12 MHR 133


8. Tristan and Julie are preparing a math 12. The clock tower on the post office in
display for the school open house. Both Battleford, Saskatchewan, demonstrates
students create posters to debate the the distinctive Romanesque Revival style
following question: of public buildings designed in the early
Does 0.999 . . . = 1? decades of the twentieth century. The
Battleford Post Office is similar in design
Julies Poster
to the post offices in Humboldt and
0.999... 1 Melfort. These three buildings are the only
0.999... = 0.999 999 999 999 9... surviving post offices of this type in the
Prairie Provinces.
The decimal will continue
to infinity and will never a) What is the measure of the angle, ,
reach exactly one. created between the hands of the clock
when it reads 3 oclock?
Tristans Poster b) If the length of the minute hand is
2 ft, sketch a diagram to represent the
0.999... = 1
Rewrite 0.999... in expanded form.
clock face on a coordinate grid with
9 +-
9 +- 9 +... the centre at the origin. Label the
-
10 100 1000 coordinates represented by the tip of
This can be written as a geometric the minute hand.
9 and r =
series where t 1 = -
10 c) What are the exact values for sin ,
cos , and tan at 3 oclock?

a) Finish Tristans poster by determining


the value of the common ratio and
then finding the sum of the infinite
geometric series.
b) Which student do you think
correctly answered the question?

Chapter 2 Trigonometry
9. Determine the exact distance, in simplified
form, from the origin to a point P(-2, 4)
on the terminal arm of an angle.
10. Point P(15, 8) is on the terminal arm of
angle . Determine the exact values for
sin , cos , and tan .
11. Sketch each angle in standard position
and determine the measure of the
reference angle.
a) 40 Battleford post office

b) 120
c) 225
d) 300

134 MHR Cumulative Review, Chapters 12


13. Determine the exact value of each 16. Waterton Lakes National Park in Alberta is
trigonometric ratio. a popular site for birdwatching, with over
a) sin 405 b) cos 330 250 species of birds recorded. Chelsea
spots a rare pileated woodpecker in a
c) tan 225 d) cos 180
tree at an angle of elevation of 52. After
e) tan 150 f) sin 270 walking 16 m closer to the tree,
14. Radio collars are used to track polar bears she determines the new
by sending signals via GPS to receiving angle of elevation
stations. Two receiving stations are 9 km to be 70.
apart along a straight road. At station A, a) Sketch and label
the signal from one of the collars comes a diagram to
from a direction of 49 from the road. At represent the
station B, the signal from the same collar situation.
comes from a direction of 65 from the
b) What is the
road. Determine the distance the polar bear
closest distance
is from each of the stations.
that Chelsea is
15. The Arctic Wind Riders is a program from the bird,
developed to introduce youth in the to the nearest
communities of Northern Canada to the tenth of a
unique sport of Paraski. This sport allows metre?
participants to sail over frozen bays, rivers,
and snowy tundra using wind power.
The program has been offered to close to
17. In RST, RT = 2 m, ST = 1.4 m, and
700 students and young adults. A typical
R = 30. Determine the measure of obtuse
Paraski is shown below. Determine the
S to the nearest tenth of a degree.
measure of angle , to the nearest tenth of
a degree.

4.88 m

29.85 m

29.85 m

Clara Ak
Cl Akulukjuk,
l kj k PPangnirtung,
it N
Nunavut,
t llearning
i tto P
Paraski.
ki

Cumulative Review, Chapters 12 MHR 135


Unit 1 Test
Multiple Choice Numerical Response

For #1 to #5, choose the best answer. Complete the statements in #6 to #8.
1. Which of the following expressions could 6. A coffee shop is holding its annual
represent the general term of the sequence fundraiser to help send a local child to
8, 4, 0, ? summer camp. The coffee shop plans to
A tn = 8 + (n - 1)4 donate a portion of the profit for every
cup of coffee served. At the beginning of
B tn = 8 - (n - 1)4
the day, the owner buys the first cup of
C tn = 4n + 4 coffee and donates $20 to the fundraiser.
D tn = 8(-2)n - 1 If the coffee shop regularly serves another
2. The expression for the 14th term of the 2200 cups of coffee in one day, they must
geometric sequence x, x3, x5, is collect $ per cup to raise $350.
A x13 7. An angle of 315 drawn in standard
position has a reference angle of .
B x14
8. The terminal arm of an angle, , in
C x 27
standard position lies in quadrant IV, and
D x 29 __
it is known that sin = - _ . The measure
3
3. The sum of the series 6 + 18 + 54 + to 2
n terms is 2184. How many terms are in of is .
the series?
A 5 Written Response
B 7 9. Jacques Chenier is one of Manitobas
C 8 premier childrens entertainers. Jacques
was a Juno Award Nominee for his album
D 6
Walking in the Sun. He has performed
4. Which angle has a reference angle of 55? in over 600 school fairs and festivals
A 35 across the country. Suppose there were
B 135 150 people in the audience for his first
performance. If this number increased by 5
C 235
for each of the next 14 performances, what
D 255
__ total number of people attended the first
5. Given the point P(x, 5 ) on the __
terminal 15 of Jacques Cheniers performances?
arm of angle , where sin = _ and
5
10. The third term in an arithmetic sequence
5
90 180, what is the exact value is 4 and the seventh term in the sequence
of cos ? is 24.
A _
3 a) Determine the value of the common
5 difference.
B -_
3__
b) What is the value of t1?
5

C _
2__ c) Write the general term of the sequence.
5 d) What is the sum of the first 10 terms
__
D -_
25 of the corresponding series?
5

136 MHR Unit 1 Test


11. A new car that is worth $35 000 14. A right triangle with a reference angle of
depreciates 20% in the first year and 10% 60 is drawn in standard position on a
every year after that. About how much coordinate grid.
will the car be worth 7 years after it is y
purchased?
12. The Multiple Sclerosis Walk is a significant
contributor to the Multiple Sclerosis
Societys fundraising efforts to support 60
0 x
research. One walker was sponsored
$100 plus $5 for the first kilometre, $10
for the second kilometre, $15 for the a) Apply consecutive rotations of 60
third kilometre, and so on. How far counterclockwise to complete one 360
would this walker need to revolution about the origin.
walk to earn $150? b) Write the sequence that represents the
measures of the angles in standard
position formed by the rotations.
c) Write the general term for the sequence.
15. A circular water sprinkler in a backyard
sprays a radius of 5 m. The sprinkler is
placed 8 m from the corner of the lot.

fence

8m
5m fence
A B D
13. Les Jeux de la Francophonie Canadienne
a) If the measure of CAB is 32, what is
are held each summer to celebrate sport,
leadership, and French culture. Badminton the measure of CDA?
is one of the popular events at the games. b) What length of fence, to the nearest
There are 64 entrants in the boys singles tenth of a metre, would get wet from
tournament. There are two players per the sprinkler?
game, and only the winner advances to the 16. A triangle has sides that measure 61 cm,
next round. The number of players in each 38 cm, and 43 cm. Determine the measure
round models a geometric sequence. of the smallest angle in the triangle.
a) Write the first four terms of the
geometric sequence.
b) Write the general term that could
be used to determine the number of
players in any round of the tournament.
c) How many games must be played
altogether to determine the winner of
the boys singles tournament?

Unit 1 Test MHR 137


Unit 2

Quadratics
Quadratic functions and their
applications can model a large
part of the world around us.
Consider the path of a basketball
after it leaves the shooters
hand. Think about how experts
determine when and where the
explosive shells used in avalanche
control will land, as they attempt
to make snowy areas safe for
everyone. Why do satellite dishes
and suspension bridges have
the particular shapes that they
do? You can model these and
many other everyday situations
mathematically with quadratic
functions. In this unit, you will
investigate the nature of quadratic
equations and quadratic functions.
You will also apply them to
model real-world situations and
solve problems.

Looking Ahead
In this unit, you will solve
problems involving
equations and graphs of
quadratic functions
quadratic equations

138 MHR Unit 2 Quadratics


Unit 2 Project Quadratic Functions in Everyday Life

In this project, you will explore quadratic functions that occur in everyday life such
as sports, science, art, architecture, and nature.

In Chapter 3, you will find information and make notes about quadratic functions
in familiar situations. In Chapter 4, you will focus specifically on the subject of
avalanche control.

At the end of the unit, you will choose between two options:
You may choose to examine real-world situations that you can model using
quadratic functions. For this option, you will mathematically determine the
accuracy of your model. You will also investigate reasons for the quadratic
nature of the situation.
You may choose to apply the skills you have learned in this unit to the subject
of projectile motion and the use of mathematics in avalanche control.

For either option, you will showcase what you have learned about quadratic
relationships by modelling and analysing real situations involving quadratic functions
or equations. You will also prepare a written summary of your observations.

Unit 2 Quadratics MHR 139


CHAPTER

3 Quadratic Functions
Digital images are everywhereon computer screens, digital
cameras, televisions, mobile phones, and more. Digital images are
composed of many individual pixels, or picture elements. Each
pixel is a single dot or square of colour. The total number of pixels
in a two-dimensional image is related to its dimensions. The more
pixels an image has, the greater the quality of the image and the
higher the resolution.

If the image is a square with a side length of x pixels, then you can
represent the total number of pixels, p, by the function p(x) = x2.
This is the simplest example of a quadratic function. The word
quadratic comes from the word quadratum, a Latin word meaning
square. The term quadratic is used because a term like x2
represents the area of a square of side length x.

Quadratic functions occur in a wide variety of real-world


situations. In this chapter, you will investigate quadratic functions
and use them in mathematical modelling and problem solving.

Did Yo u Know ?

The word pixel comes from combining pix for picture


and el for element.
1000 pixels

The term megapixel is used to refer to one million pixels. 1 000 000 pixels
Possible dimensions for a one-megapixel image could be or
1000 pixels by 1000 pixels or 800 pixels by 1250 pixels 1 megapixel
in both cases the total number of pixels is 1 million. Digital
cameras often give a value in megapixels to indicate the
maximum resolution of an image. 1000 pixels

Key Terms
quadratic function vertex form (of a
parabola quadratic function)
vertex (of a parabola) standard form (of a
minimum value quadratic function)
maximum value completing the square
axis of symmetry

140 MHR Chapter 3


640 640 or 409 600 pixels

32 32 or 1024 pixels

Career Link
SpaceShipTwo is a sub-orbital space-plane
designed to carry space tourists at a cost
of hundreds of thousands of dollars per
ride. Designers have developed a craft that
will carry six passengers and two pilots
to a height of 110 km above Earth and
reach speeds of 4200 km/h. Engineers use
quadratic functions to optimize the vehicles
storage capacity, create re-entry simulations,
and help develop the structural design of
the space-plane itself. Flights are due to
begin no earlier than 2011.
8 8 or 64 pixels

We b Link
To learn
earn more about
a aerospace design, go to
www.mhrprecalc11.ca and follow the links.

Chapter 3 MHR 141


3.1
Investigating Quadratic Functions in
Vertex Form
Focus on . . .
identifying quadratic functions in vertex form
determining the effect of a, p, and q on the graph of y = a(x - p)2 + q
analysing and graphing quadratic functions using transformations

The Bonneville Salt Flats is a large


area in Utah, in the United
States, that is a remnant
of an ancient lake from
glacial times. The surface
is extremely flat, smooth,
and hard, making it an ideal
place for researchers, racing
enthusiasts, and automakers
to test high-speed vehicles in a safer manner than on a paved track.
Recently, the salt flats have become the site of an annual time-trial event
for alternative-fuel vehicles. At the 2007 event, one major automaker
achieved a top speed of 335 km/h with a hydrogen-powered fuel-cell car,
the highest-ever recorded land speed at the time for any fuel-cell-powered
vehicle.
Suppose three vehicles are involved in speed tests. The first sits waiting D i d You K n ow ?
at the start line in one test lane, while a second sits 200 m ahead in a
second test lane. These two cars start accelerating constantly at the same The fuel cells used
in this vehicle are
time. The third car leaves 5 s later from the start line in a third lane.
manufactured
The graph shows a function for the distance travelled from the start by Ballard Power
line for each of the three vehicles. How are the algebraic forms of these Systems, based in
Burnaby, British
functions related to each other?
Columbia. They have
d been developing
1000 hydrogen fuel cells for
d = 10t 2 + 200, t 0 d = 10t 2, over 20 years.
t0
800
Distance (m)

600 We b Link
For more inform
information
400
about the Bonneville
d = 10(t - 5)2, Salt Flats and about
200
t5 fuel-cell-powered
vehicles, go to
0 2 4 6 8 10 12 14 t www.mhrprecalc11.ca
Time (s) and follow the links.

142 MHR Chapter 3


Investigate Graphs of Quadratic Functions in Vertex Form

Part A: Compare the Graphs of f(x) = x2 and f(x) = ax2, a 0 Materials


1. a) Graph the following functions on the same set of coordinate grid paper or graphing
technology
axes, with or without technology.
f (x) = x 2 f (x) = -x 2
f (x) = 2x 2 f (x) = -2x 2
f (x) = _
1 x2 f (x) = - _
1 x2
2 2
b) Describe how the graph of each function compares to the graph
of f (x) = x 2, using terms such as narrower, wider, and reflection.
c) What relationship do you observe between the parameter, a, and
the shape of the corresponding graph?
2. a) Using a variety of values of a, write several of your own functions
of the form f (x) = ax 2. Include both positive and negative values.
b) Predict how the graphs of these functions will compare to the
graph of f (x) = x 2. Test your prediction.

Reflect and Respond


3. Develop a rule that describes how the value of a in f (x) = ax 2
changes the graph of f (x) = x 2 when a is
a) a positive number greater than 1
b) a positive number less than 1
c) a negative number

Part B: Compare the Graphs of f(x) = x2 and f(x) = x2 + q


4. a) Graph the following functions on the same set of coordinate axes,
with or without technology.
f (x) = x 2
f (x) = x 2 + 4
f (x) = x 2 - 3
b) Describe how the graph of each function compares to the graph
of f (x) = x 2.
c) What relationship do you observe between the parameter, q, and
the location of the corresponding graph?
5. a) Using a variety of values of q, write several of your own functions
of the form f(x) = x2 + q. Include both positive and negative values.
b) Predict how these functions will compare to f (x) = x 2. Test
your prediction.

Reflect and Respond


6. Develop a rule that describes how the value of q in f (x) = x 2 + q
changes the graph of f (x) = x 2 when q is
a) a positive number b) a negative number

3.1 Investigating Quadratic Functions in Vertex Form MHR 143


Part C: Compare the Graphs of f(x) = x2 and f(x) = (x - p)2
7. a) Graph the following functions on the same set of coordinate axes,
with or without technology.
f (x) = x 2
f (x) = (x - 2)2
f (x) = (x + 1)2
b) Describe how the graph of each function compares to the
graph of f (x) = x 2.
c) What relationship do you observe between the parameter, p,
and the location of the corresponding graph?
8. a) Using a variety of values of p, write several of your own
functions of the form f (x) = (x - p)2. Include both positive
and negative values.
b) Predict how these functions will compare to f (x) = x 2. Test
your prediction.

Reflect and Respond


9. Develop a rule that describes how the value of p in f (x) = (x - p)2
changes the graph of f (x) = x 2 when p is
a) a positive number b) a negative number

Link the Ideas

quadratic function The graph of a quadratic function is a parabola. When using


function notation,
a function f whose
When the graph opens upward, the vertex is the the values for f(x)
value f(x) at x is given
are often considered
by a polynomial of lowest point on the graph. When the graph opens
degree two the same as the
downward, the vertex is the highest point on values for y.
for example, f(x) = x2 is the graph.
the simplest form of a
quadratic function f(x)
4
parabola vertex
the symmetrical curve 2
of the graph of a
quadratic function
-6 -4 -2 0 2 4 6 x
vertex -2
(of a parabola)
vertex -4
the lowest point of
the graph (if the graph
opens upward) or the
highest point of the
graph (if the graph
opens downward)

144 MHR Chapter 3


The y-coordinate of the vertex is called the minimum value if the minimum value
parabola opens upward or the maximum value if the parabola (of a function)
opens downward the least value in the
range of a function
The parabola is symmetric about a line called the axis of symmetry. for a quadratic function
This line divides the function graph into two parts so that the graph that opens upward,
on one side is the mirror image of the graph on the other side. This the y-coordinate of the
vertex
means that if you know a point on one side of the parabola, you can
determine a corresponding point on the other side based on the axis maximum value
of symmetry. (of a function)
The axis of symmetry intersects the parabola at the vertex. the greatest value in
the range of a function
The x-coordinate of the vertex corresponds to the equation of for a quadratic function
the axis of symmetry. that opens downward,
the y-coordinate of the
axis of symmetry vertex
f(x) x=3
14 axis of symmetry
a line through the
12 vertex that divides the
graph of a quadratic
10 function into two
congruent halves
8
the x-coordinate of
(0, 6) 6 (6, 6) the vertex defines the
equation of the axis of
4 symmetry

2
vertex (3, 1)
-4 -2 0 2 4 6 8 10 x

Quadratic functions written in vertex form, f (x) = a(x - p)2 + q, vertex form (of a
are useful when graphing the function. The vertex form tells you quadratic function)
the location of the vertex (p, q) as well as the shape of the parabola the form
and the direction of the opening. y = a(x - p)2 + q, or
f(x) = a(x - p)2 + q,
You can examine the parameters a, p, and q to determine where a, p, and q are
constants and a 0
information about the graph.

3.1 Investigating Quadratic Functions in Vertex Form MHR 145


The Effect of Parameter a in f(x) = ax2 on the Graph of f(x) = x2
Consider the graphs of the following functions:
f (x) = x 2
f (x) = 0.5x 2 The parabola is wider in relation to the y-axis than f (x) = x 2 and
opens upward.

f (x) = -3x 2 The parabola is narrower in relation to the y-axis than f (x) = x 2
and opens downward.

Parameter a determines the f(x)


orientation and shape of the f(x) = x2
8
parabola.
6
The graph opens upward if
a > 0 and downward if a < 0. f(x) = 0.5x2
4
If -1 < a < 1, the parabola is
2
wider compared to the graph
of f (x) = x 2.
-6 -4 -2 0 2 4 6 8x
If a > 1 or a < -1, the -2
parabola is narrower compared
f(x) = -3x2
to the graph of f (x) = x 2. -4

-6

-8

The Effect of Parameter q in f(x) = x2 + q on the Graph of f(x) = x2


Consider the graphs of the following functions:
f (x) = x 2
f (x) = x 2 + 5 The graph is translated 5 units up.
2
f (x) = x - 4 The graph is translated 4 units down.

Parameter q translates the f(x)


f(x) = x2 + 5
parabola vertically q units 8
relative to the graph of
6
f (x) = x 2. f(x) = x2

The y-coordinate of the 4


parabolas vertex is q. 2

-6 -4 -2 0 2 4 6 8x
-2
f(x) = x2 - 4
-4

-6

-8

146 MHR Chapter 3


The Effect of Parameter p in f(x) = (x - p)2 on the Graph of f(x) = x2
Consider the graphs of the following functions:
f (x) = x 2
Since p = +1, the graph is translated 1 unit right.
f (x) = (x - 1)2
2 Since p = -3, the graph is translated 3 units left.
f (x) = (x + 3)
Parameter p translates the f(x)
parabola horizontally p units 8
relative to the graph of
f(x) = x2
f (x) = x 2. 6

The x-coordinate of the 4


f(x) = (x + 3)2
parabolas vertex is p.
2
The equation of the axis of f(x) = (x - 1)2
symmetry is x - p = 0
-8 -6 -4 -2 0 2 4 6 x
or x = p.

Combining Transformations
Consider the graphs of the following functions:
f (x) = x 2
f (x) = -2(x - 3)2 + 1
The parameter a = -2 f(x)
determines that the parabola f(x) = x2
8
opens downward and is
narrower than f (x) = x 2. 6
The vertex of the parabola is 4
located at (3, 1) and represents a
horizontal translation of 3 units 2
(3, 1)
right and a vertical translation
of 1 unit up relative to the graph -2 0 2 4 6 8 10 x
f(x) = -2(x - 3)2 + 1
of f (x) = x 2. -2
The equation of the axis
-4
of symmetry is x - 3 = 0
or x = 3. -6

-8
x=3

In general:
The sign of a defines the direction of opening of the parabola.
When a > 0, the graph opens upward, and when a < 0, the graph
opens downward.
The parameter a also determines how wide or narrow the graph is
compared to the graph of f (x) = x 2.
The point (p, q) defines the vertex of the parabola.
The equation x = p defines the axis of symmetry.

3.1 Investigating Quadratic Functions in Vertex Form MHR 147


Example 1
Sketch Graphs of Quadratic Functions in Vertex Form
Determine the following characteristics for each function.
the vertex
the domain and range
the direction of opening
the equation of the axis of symmetry
Then, sketch each graph.
b) y = - _ (x - 4)2 + 1
a) y = 2(x + 1)2 - 3
1
4
Solution
a) Use the values of a, p, and q to determine some characteristics
of y = 2(x + 1)2 - 3 and sketch the graph.
y = 2(x + 1)2 - 3

a=2 p = -1 q = -3
Since p = -1 and q = -3, the vertex is located at (-1, -3).
Since a > 0, the graph opens upward. Since a > 1, the parabola is
narrower compared to the graph of y = x2.
Since q = -3, the range is {y | y -3, y R}.
The domain is {x | x R}.
Since p = -1, the equation of the axis of symmetry is x = -1.

Method 1: Sketch Using Transformations


Sketch the graph of y = 2(x + 1)2 - 3 by transforming the graph
of y = x 2.
Use the points (0, 0), (1, 1), and (-1, 1) to sketch the graph of y = x2.
Apply the change in width. y
8 y = x2

When using transformations to 6


sketch the graph, you should deal
with parameter a first, since its 4
reference for wider or narrower is y = 2x2
2
relative to the y-axis.

-6 -4 -2 0 2 4 6x

Translate the graph. y


8 y = x2

How are p and q related to the 6


direction of the translations and
the location of the vertex? 4
y = 2x2
2

-6 -4 -2 0 2 4 6x
-2
y = 2(x + 1)2 - 3
(-1, -3)

148 MHR Chapter 3


Method 2: Sketch Using Points and Symmetry
Plot the coordinates of the vertex, (-1, -3), and draw the axis of
symmetry, x = -1.
Determine the coordinates of one other point on the parabola.

The y-intercept is a good choice for another point.


Let x = 0.
y = 2(0 + 1)2 - 3
y = 2(1)2 - 3
y = -1
The point is (0, -1).

For any point other than the vertex, there is a corresponding point
that is equidistant from the axis of symmetry. In this case, the
corresponding point for (0, -1) is (-2, -1).

Plot these two additional points and complete the sketch of


the parabola.
y
8

2
y = 2(x + 1)2 - 3

-6 -4 -2 0 2 4 6x
(-2, -1) (0, -1)
-2
(-1, -3)

_1
b) For the quadratic function y = - (x - 4)2 + 1, a = - , _1
4 4
p = 4, and q = 1.
The vertex is located at (4, 1).
The graph opens downward and is wider than the graph y = x2.
The range is {y | y 1, y R}.
The domain is {x | x R}.
The equation of the axis of symmetry is x = 4.

Sketch the graph of y = - _1 (x - 4)2 + 1 by using the information from


4
the vertex form of the function.

3.1 Investigating Quadratic Functions in Vertex Form MHR 149


Plot the vertex at (4, 1).
Determine a point on the graph. For example, determine the
y-intercept by substituting x = 0 into the function.

y = -_1 (0 - 4)2 + 1
4
y = -_1 (-4)2 + 1
4
y = -4 + 1
y = -3
The point (0, -3) is on the graph.

For any point other than the vertex, there is a corresponding point
that is equidistant from the axis of symmetry. In this case, the
corresponding point of (0, -3) is (7, -3).

Plot these two additional points and complete the sketch of the
parabola.

y How are the values of y affected when a

4 is - _
1?
1
y = - _ (x - 4)2 + 1 4
4 How are p and q related to the direction
2 of the translations and location of the
(4, 1)
vertex?
-2 0 2 4 6 8 10 x
How is the shape of the curve related to
-2 the value of a?
(0, -3) (8, -3)
4 4
-4

-6
x=4

Your Turn
Determine the following characteristics for each function.
the vertex
the domain and range
the direction of opening
the equations of the axis of symmetry
Then, sketch each graph.

a) y = _1 (x - 2)
2
-4
2
2
b) y = -3(x + 1) + 3

150 MHR Chapter 3


Example 2
Determine a Quadratic Function in Vertex Form Given Its Graph
Determine a quadratic function in vertex form for each graph.
a) f(x)
8

-2 0 2 4 6 8 10 12x
-2

-4

b) f(x)
2

-3 -2 -1 0 1 2 3 x
-2

-4

-6

Solution
a) Method 1: Use Points and Substitution
You can determine the equation of the function using the coordinates
of the vertex and one other point.
The vertex is located at (5, -4), so p = 5 and q = -4. The graph opens
upward, so the value of a is greater than 0.
Express the function as
f (x) = a(x - p)2 + q
f (x) = a(x - 5)2 + (-4)
f (x) = a(x - 5)2 - 4
Choose one other point on the graph, such as (2, -1). Substitute the
values of x and y into the function and solve for a.
f (x) = a(x - 5)2 - 4
-1 = a(2 - 5)2 - 4
-1 = a(-3)2 - 4
-1 = a(9) - 4
-1 = 9a - 4
3 = 9a
_1 = a
3
The quadratic function in vertex form is f (x) = _
1 (x - 5)2 - 4.
3

3.1 Investigating Quadratic Functions in Vertex Form MHR 151


Method 2: Compare With the Graph of f (x) = x 2
The vertex is located at (5, -4), so p = 5 and q = -4. The graph
involves a translation of 5 units to the right and 4 units down.
The graph opens upward, so the value of a is greater than 0.
To determine the value of a, undo the translations and compare the
vertical distances of points on the non-translated parabola relative to
those on the graph of f (x) = x 2.

f(x) How are the y-coordinates


of the corresponding points
10
on the two parabolas with a
(3, 9) (3, 9) vertex at (0, 0) related?
8
f(x) = x2
6

4
(3, 3) (3, 3)
2

-6 -4 -2 0 2 4 6 8 10 12x
(8, 1)
-2(2, 1)

-4
(5, 4)

Since the vertical distances are one third as much, the value of a is _ 1.
3
The red graph of f (x) = _
1 x 2 has been stretched vertically by a factor
3
of _1 compared to the graph of f (x) = x 2.
3
Substitute the values a = _1 , p = 5, and q = -4 into the vertex form,
3
f (x) = a(x + p)2 + q.
The quadratic function in vertex form is f (x) = _1 (x - 5)2 - 4.
3

b) You can determine the equation of the function using the coordinates
of the vertex and one other point.
The vertex is located at (0, 3), so p = 0 and q = 3. The graph opens
downward, so the value of a is less than 0.
Express the function as
f (x) = a(x - p)2 + q
f (x) = a(x - 0)2 + 3
f (x) = ax 2 + 3
Choose one other point on the graph, such as (1, 1). Substitute the
values of x and y into the function and solve for a.
f (x) = ax 2 + 3
1 = a(1)2 + 3
1=a+3
-2 = a
The quadratic function in vertex form is f (x) = -2x 2 + 3.

152 MHR Chapter 3


Your Turn
Determine a quadratic function in vertex form for each graph.
a) f(x) b) f(x)
2 8

6
-6 -4 -2 0 2 x
-2 4

-4 2

-6
-2 0 2 4 x

Example 3
Determine the Number of x-Intercepts Using a and q
Determine the number of x-intercepts for each quadratic function.
a) f (x) = 0.8x 2 - 3 b) f (x) = 2(x - 1)2 c) f (x) = -3(x + 2)2 - 1

Solution
You can determine the number of x-intercepts if you know the location
of the vertex and direction of opening. Visualize the general position and
shape of the graph based on the values of a and q.
Determine the number of x-intercepts a quadratic function has
by examining
the value of a to determine if the graph opens upward or downward
the value of q to determine if the vertex is above, below, or on the
x-axis
a) f(x) = 0.8x2 - 3

Value of a Value of q Visualize the Graph Number of x-Intercepts


a>0 q<0 f(x) 2
the graph the vertex crosses the x-axis twice,
opens upward is below the since it opens upward from a
x-axis 0 x vertex below the x-axis

b) f(x) = 2(x - 1)2

Value of a Value of q Visualize the Graph Number of -Intercepts If you know that q is 0,
a>0 q=0 f(x) 1 does it matter what the
the graph the vertex is touches the x-axis once, value of a is?
opens upward on the x-axis since the vertex is on the
x-axis Where on the parabola
is the x-intercept in this
0 x case?

3.1 Investigating Quadratic Functions in Vertex Form MHR 153


c) f(x) = -3(x + 2)2 - 1

Value of a Value of q Visualize the Graph Number of x-Intercepts


a<0 q<0 y 0
the graph the vertex does not cross the x-axis,
Why does the value of p opens is below the 0 x since it opens down from a
not affect the number of downward x-axis vertex below the x-axis
x-intercepts?

Your Turn
Determine the number of x-intercepts for each quadratic function
without graphing.

a) f (x) = 0.5x 2 - 7 b) f (x) = -2(x + 1)2 _1


c) f (x) = - (x - 5)2 - 11
6

Example 4
Model Problems Using Quadratic Functions in Vertex Form
Did Yo u Know ? The deck of the Lions Gate Bridge in Vancouver is suspended from
two main cables attached to the tops of two supporting towers.
The Lions Gate
Bridge carries over
Between the towers, the main cables take the shape of a parabola as
60 000 vehicles they support the weight of the deck. The towers are 111 m tall relative
per day on average. to the waters surface and are 472 m apart. The lowest point of the
In 2009, the lights cables is approximately 67 m above the waters surface.
on the Lions Gate a) Model the shape of the cables with a quadratic function in
Bridge were replaced vertex form.
with a new LED
b) Determine the height above the surface of the water of a point on
lighting system. The
the cables that is 90 m horizontally from one of the towers. Express
change is expected
to reduce the power your answer to the nearest tenth of a metre.
consumption on the
bridge by 90% and
signicantly cut down
on maintenance.

Lions Gate Bridge, Vancouver

Solution
a) Draw a diagram and label it with the given information.

Let the vertex of the parabolic shape be at the Why is this point the simplest
low point of the cables. Consider this point to use as the origin?

to be the origin.

154 MHR Chapter 3


Draw a set of axes. Let x and y represent the horizontal and vertical
distances from the low point of the cables, respectively.

You can write a quadratic function if you know the coordinates of the
vertex and one other point. The vertex is (0, 0), since it is the origin.
Determine the coordinates of the point at the top of each tower from
the given distances.
f(x)
(-236, 44) (236, 44)

(0, 0) x

111 m 67 m
472 m

How can you determine the


coordinates of the tops of the
towers from the given information?
Since the vertex is located at the origin, (0, 0), no horizontal or
vertical translation is necessary, and p and q are both zero. Therefore,
the quadratic function is of the form f (x) = ax 2.
Substitute the coordinates of the top of one of the What other point
towers, (236, 44), into the equation f (x) = ax 2 and could you use?

solve for a.
f (x) = ax 2
44 = a(236)2
44 = a(55 696)
44 = 55 696a
__44 = a
55 696
a is __ 11 in lowest terms.
13 924
Represent the shape of the What would the quadratic function be if the
origin were placed at the waters surface
cables with the following
directly below the lowest point of the cables?
quadratic function.
f (x) = __11 x 2 What would it be if the origin were at water
13 924 level at the base of one of the towers?

b) A point 90 m from one tower is 236 - 90, or 146 m horizontally from


the vertex. Substitute 146 for x and determine the value of f (146).
f (x) = __11 x 2
13 924
f (146) = __ 11 (146)2
13 924
= __11 (21 316)
13 924
= 16.839
This is approximately 16.8 m above the low point in the cables, which
are approximately 67 m above the water.
The height above the water is approximately 67 + 16.8, or 83.8 m.

3.1 Investigating Quadratic Functions in Vertex Form MHR 155


Your Turn
Suppose a parabolic archway has a width of 280 cm
and a height of 216 cm at its highest point above the floor.
a) Write a quadratic function in vertex form that models
216 cm
the shape of this archway.
b) Determine the height of the archway at a point that is
50 cm from its outer edge.
280 cm

Key Ideas

For a quadratic function in vertex form, f (x) = a(x - p)2 + q, a 0, the graph:
 has the shape of a parabola

 has its vertex at (p, q)

 has an axis of symmetry with equation x = p

 is congruent to f (x) = ax 2 translated horizontally by p units

and vertically by q units


Sketch the graph of f (x) = a(x - p)2 + q by
transforming the graph of f (x) = x 2.
 The graph opens upward if a > 0. f(x)
f(x) = ax2, a > 1
 If a < 0, the parabola is reflected in the x-axis;
f(x) = x2
it opens downward.
f(x) = ax2, 0 < a < 1
 If -1 < a < 1, the parabola is wider compared

0 x
to the graph of f (x) = x 2.
f(x) = ax2, -1 < a < 0
 If a > 1 or a < -1, the parabola is narrower
f(x) = ax2, a < -1
compared to the graph of f (x) = x 2.

f(x)
 The parameter q determines the vertical f(x) = x2 + q, q > 0
position of the parabola. f(x) = x2
 If q > 0, then the graph is translated q units up. f(x) = x2 + q, q < 0
 If q < 0, then the graph is translated
0 x
q units down.
f(x) = x2
 The parameter p determines the horizontal f(x)
position of the parabola.
 If p > 0, then the graph is translated p units to
the right.
 If p < 0, then the graph is translated p units to 0 x
the left. f(x) = (x - p)2, p < 0 f(x) = (x - p)2, p > 0

You can determine a quadratic function in vertex form if you


know the coordinates of the vertex and at least one other point.
You can determine the number of x-intercepts of the graph of a quadratic function
using the value of a to determine if the graph opens upward or downward and
the value of q to determine if the vertex is above, below, or on the x-axis.

156 MHR Chapter 3


Check Your Understanding

Practise 5. a) Write a quadratic function in vertex


1. Describe how you can obtain the graph of form for each parabola in the graph.
2
each function from the graph of f (x) = x .
y y2
State the direction of opening, whether it
6
has a maximum or a minimum value, and y1
the range for each. 4
y3
a) f (x) = 7x 2
2
b) f (x) = _1 x 2
y4
6
c) f (x) = -4x 2 -6 -4 -2 0 2 4 6 x
-2
d) f (x) = -0.2x 2
2. Describe how the graphs of the functions -4
in each pair are related. Then, sketch the
graph of the second function in each pair,
b) Suppose four new parabolas open
and determine the vertex, the equation
of the axis of symmetry, the domain and downward instead of upward but have
range, and any intercepts. the same shape and vertex as each
parabola in the graph. Write a quadratic
a) y = x 2 and y = x 2 + 1
function in vertex form for each
b) y = x 2 and y = (x - 2)2 new parabola.
c) y = x 2 and y = x 2 - 4 c) Write the quadratic functions in vertex
d) y = x 2 and y = (x + 3)2 form of four parabolas that are identical
3. Describe how to sketch the graph of each to the four in the graph but translated
function using transformations. 4 units to the left.
a) f (x) = (x + 5)2 + 11 d) Suppose the four parabolas in the graph
are translated 2 units down. Write a
b) f (x) = -3x 2 - 10
quadratic function in vertex form for
c) f (x) = 5(x + 20)2 - 21 each new parabola.
_1
d) f (x) = - (x - 5.6)2 + 13.8 6. For the function f (x) = 5(x - 15)2 - 100,
8
explain how you can identify each of the
4. Sketch the graph of each function. Identify
following without graphing.
the vertex, the axis of symmetry, the
direction of opening, the maximum or a) the coordinates of the vertex
minimum value, the domain and range, b) the equation of the axis of symmetry
and any intercepts. c) the direction of opening
a) y = -(x - 3) + 9 d) whether the function has a maximum
b) y = 0.25(x + 4) + 1 or minimum value, and what that
c) y = -3(x - 1) + 12 value is

d) y = _1 (x - 2) - 2 e) the domain and range


2 f) the number of x-intercepts

3.1 Investigating Quadratic Functions in Vertex Form MHR 157


7. Without graphing, identify the location of d) y
the vertex and the axis of symmetry, the 4
direction of opening and the maximum
or minimum value, the domain and 2

range, and the number of x-intercepts for


each function. -8 -6 -4 -2 0 2 x
-2
a) y = -4x 2 + 14
b) y = (x + 18)2 - 8 -4

c) y = 6(x - 7)2
_1
d) y = - (x + 4)2 - 36 9. Determine a quadratic function in vertex
9 form that has the given characteristics.
8. Determine the quadratic function in vertex
a) vertex at (0, 0), passing through the
form for each parabola.
point (6, -9)
a) y
b) vertex at (0, -6), passing through the
4
point (3, 21)
2 c) vertex at (2, 5), passing through the
point (4, -11)
-6 -4 -2 0 2 x
d) vertex at (-3, -10), passing through the
-2 point (2, -5)
-4
Apply
b) y 10. The point (4, 16) is on the graph of
12 f (x) = x 2. Describe what happens to the
point when each of the following sets of
10
transformations is performed in the order
8 listed. Identify the corresponding point on
the transformed graph.
6
a) a horizontal translation of 5 units to the
4 left and then a vertical translation of
8 units up
2
b) a multiplication of the y-values by a
-4 -2 0 2 4 6x factor of _
1 and then a reflection in the
4
-2
x-axis
c) a reflection in the x-axis and then a
horizontal translation of 10 units to
c) y
the right
10
d) a multiplication of the y-values
8 by a factor of 3 and then a vertical
translation of 8 units down
6
11. Describe how to obtain the graph of
4 y = 20 - 5x 2 using transformations
on the graph of y = x 2.
2
12. Quadratic functions do not all have the
-2 0 2 4 6 x same number of x-intercepts. Is the same
true about y-intercepts? Explain.

158 MHR Chapter 3


13. A parabolic mirror was used to ignite 14. The finance team at an advertising
the Olympic torch for the 2010 Winter company is using the quadratic
Olympics in Vancouver and Whistler, function N(x) = -2.5(x - 36)2 + 20 000
British Columbia. Suppose its diameter is to predict the effectiveness of a TV
60 cm and its depth is 30 cm. commercial for a certain product,
where N is the predicted number of
people who buy the product if the
commercial is aired x times per week.
a) Explain how you could sketch the
graph of the function, and identify
its characteristics.
b) According to this model, what is
the optimum number of times the
commercial should be aired?
c) What is the maximum number of
people that this model predicts will
buy the product?
15. When two liquids that do not mix are
put together in a container and rotated
around a central axis, the surface
created between them takes on a
parabolic shape as they rotate. Suppose
the diameter at the top of such a surface
a) Determine the 60 cm
y is 40 cm, and the maximum depth of
quadratic function the surface is 12 cm. Choose a location
that represents its 30 cm for the origin and write the function
cross-sectional that models the cross-sectional shape of
0 x
shape if the the surface.
lowest point in
the centre of the mirror is considered to
be the origin, as shown.
b) How would the quadratic function be
different if the outer edge of the mirror
were considered the origin? Explain
why there is a difference.
D id Yo u K n ow ?

Before the 2010 Winter Olympics began in


Vancouver and Whistler, the Olympic torch was
carried over 45 000 km for 106 days through
every province and territory in Canada. The torch
was initially lit in Olympia, Greece, the site of
the ancient Olympic Games, before beginning
its journey in Canada. The ame was lit using a
special bowl-shaped reector called a parabolic
mirror that focuses the Suns rays to a single point,
concentrating enough heat to ignite the torch.

3.1 Investigating Quadratic Functions in Vertex Form MHR 159


17. During a game of tennis, Natalie hits the
tennis ball into the air along a parabolic
trajectory. Her initial point of contact with
the tennis ball is 1 m above the ground.
The ball reaches a maximum height of
10 m before falling toward the ground. The
ball is again 1 m above the ground when
it is 22 m away from where she hit it.
Write a quadratic function to represent the
trajectory of the tennis ball if the origin is
on the ground directly below the spot from
which the ball was hit.

D i d You K n ow ?

Tennis originated from a twelth-century French


game called jeu de paume, meaning game of palm
(of the hand). It was a court game where players
hit the ball with their hands. Over time, gloves
covered bare hands and, nally, racquets became
the standard equipment. In 1873, Major Walter
Wingeld invented a game called sphairistike
16. The main section of the (Greek for playing ball), from which modern outdoor
suspension bridge in Parc de la Gorge tennis evolved.
de Coaticook, Qubec, has cables in
the shape of a parabola. Suppose that the 18. Water is spraying from a nozzle in a
points on the tops of the towers where the fountain, forming a parabolic path as it
cables are attached are 168 m apart and travels through the air. The nozzle is 10 cm
24 m vertically above the minimum height above the surface of the water. The water
of the cables. achieves a maximum height of 100 cm
a) Determine the quadratic function in above the waters surface and lands in the
vertex form that represents the shape of pool. The water spray is again 10 cm above
the cables. Identify the origin you used. the surface of the water
b) Choose two other locations for the when it is 120 cm
origin. Write the corresponding horizontally from
quadratic function for the shape of the the nozzle. Write
cables for each. the quadratic
function in
c) Use each quadratic function to
vertex form
determine the vertical height of the
to represent
cables above the minimum at a point
the path of
that is 35 m horizontally from one of
the water if
the towers. Are your answers the same
the origin is
using each of your functions? Explain.
at the surface
D id Yo u Know ? of the water
The suspension bridge in Parc de la Gorge de
directly
Coaticook in Qubec claims to be the longest below the
pedestrian suspension bridge in the world. nozzle.

160 MHR Chapter 3


19. The function y = x 2 + 4 represents a 21. Determine a quadratic function in vertex
translation of 4 units up, which is in form given each set of characteristics.
the positive direction. The function Explain your reasoning.
y = (x + 4)2 represents a translation a) vertex (6, 30) and a y-intercept of -24
of 4 units to the left, which is in the
b) minimum value of -24 and x-intercepts
negative direction. How can you explain
at -21 and -5
this difference?
20. In the movie, Apollo 13, starring Tom
Extend
Hanks, scenes were filmed involving 22. a) Write quadratic functions in vertex form
weightlessness. Weightlessness can be that represent three different trajectories
simulated using a plane to fly a special the basketball shown can follow and
manoeuvre. The plane follows a specific pass directly through the hoop without
inverted parabolic arc followed by an hitting the backboard.
upward-facing recovery arc. Suppose the
b) Which of your three quadratic functions
parabolic arc starts when the plane is at
7200 m and takes it up to 10 000 m and do you think represents the most
then back down to 7200 m again. It covers realistic trajectory for an actual shot?
approximately 16 000 m of horizontal Explain your thoughts.
distance in total. c) What do you think are a reasonable
domain and range in this situation?
a) Determine the quadratic function that
represents the shape of the parabolic h
path followed by the plane if the origin 14
is at ground level directly below where
the plane starts the parabolic arc. 12

b) Identify the domain and range in this 10


Height (ft)

situation.
8
20 Nose Low
6

45 Nose High 4

0 2 4 6 8 10 12 14 16 18d
Distance From Back of Hoop (ft)
D id Yo u K n ow ?
23. If the point (m, n) is on the graph of
Passengers can experience the feeling of zero-g,
f (x) = x 2, determine expressions for the
or weightlessness, for approximately 30 s during
coordinates of the corresponding point on
each inverted parabolic manoeuvre made. During
the recovery arc, passengers feel almost two-g, or the graph of f (x) = a(x - p)2 + q.
almost twice the sensation of gravity. In addition to
achieving weightlessness, planes such as these are
also able to y parabolic arcs designed to simulate
the gravity on the moon (one sixth of Earths) or on
Mars (one third of Earths).

3.1 Investigating Quadratic Functions in Vertex Form MHR 161


Create Connections Create a line-art illustration of an object
24. a) Write a quadratic function that is or design using quadratic and/or linear
related to f (x) = x 2 by a change in functions with restricted domains.
width, a reflection, a horizontal Step 1 Use a piece of 0.5-cm grid paper.
translation, and a vertical translation. Draw axes vertically and horizontally
b) Explain your personal strategy for through the centre of the grid. Label
accurately sketching the function. the axes with a scale.
25. Create your own specific examples of Step 2 Plan out a line-art drawing that you
functions to explain how to determine can draw using portions of the graphs
the number of x-intercepts for quadratic of quadratic and linear functions. As
functions of the form f (x) = a(x - p)2 + q you create your illustration, keep a
without graphing. record of the functions you use. Add
appropriate restrictions to the domain
26. MINI LAB Graphing Materials to indicate the portion of the graph
a function like 0.5-cm grid you want.
y = -x 2 + 9 will paper
Step 3 Use your records to make a detailed
produce a curve that
and accurate list of instructions/
extends indefinitely. If only a portion of
functions (including restrictions) that
the curve is desired, you can state the
someone else could use to recreate
function with a restriction on the
your illustration.
domain. For example, to draw only the
portion of the graph of y = -x 2 + 9 Step 4 Trade your functions/instructions list
between the points where x = -2 and with a partner. See if you can recreate
x = 3, write y = -x 2 + 9, each others illustration using only the
{x | -2 x 3, x R}. list as a guide.

Project Corner Parabolic Shape

Many suspension bridge cables, the arches of bridges, satellite dishes,


reflectors in headlights and spotlights, and other physical objects often
appear to have parabolic shape.
You can try to model a possible quadratic relationship by drawing a set of
axes on an image of a physical object that appears to be quadratic in nature,
and using one or more points on the curve.
What images or objects can you find that might be quadratic?

162 MHR Chapter 3


3.2

Investigating Quadratic Functions in Standard Form


Focus on . . .
identifying quadratic functions in standard form
determining the vertex, domain and range, axis of symmetry, maximum or minimum
value, and x-intercepts and y-intercept for quadratic functions in standard form
graphing and analysing quadratic functions in applied situations

When a player kicks or punts a football into the air, it reaches a maximum height
before falling back to the ground. The moment it leaves the punters foot to the
moment it is caught or hits the ground is called the hang time of the punt. A punter
attempts to kick the football so there is a longer hang time to allow teammates to
run downfield to tackle an opponent who catches the ball. The punter may think
about exactly where or how far downfield the football will land. How can you
mathematically model the path of a football through the air after it is punted?

D id Yo u Kn ow?

The Grey Cup has been the championship trophy for the Canadian Football
League (CFL) since 1954. Earl Grey, the Governor General of Canada at the
time, donated the trophy in 1909 for the Rugby Football Championship
of Canada. Two Grey Cups won have been on the last play of the game:
Saskatchewan in 1989 and Montreal in 2009.

3.2 Investigating Quadratic Functions in Standard Form MHR 163


Investigate Quadratic Functions in Standard Form

Materials Part A: Model the Path of a Football


grid paper Depending upon the situation, the punter may kick the football so that it
will follow a specific path.
1. Work with a partner. Draw a coordinate grid on a sheet of grid paper.
Label the x-axis as horizontal distance downfield and the y-axis
Did Yo u Know ? as height. How do the horizontal distance and height relate to the
In the National kicking of a football?
Football League, 2. On the same grid, sketch out three possible flight paths of
the eld length, not
the football.
including the end
zones, is 100 yd. The 3. Describe the shape of your graphs. Are these shapes similar to other
longest regular students graphs?
season punt record for 4. Describe the common characteristics of your graphs.
the NFL was 98 yd,
by Steve ONeal of the Reflect and Respond
New York Jets, against
the Denver Broncos in 5. How would you describe the maximum or minimum heights of each
1969. of your graphs?
In the Canadian 6. Describe any type of symmetry that you see in your graphs.
Football League, 7. State the domain and range for each of your graphs.
the eld length, not
including the end 8. How do the domain and range relate to the punting of the football?
zones, is 110 yd.
The longest regular
season punt record
for the CFL was
10 20 30 40 50 50 40 30 20 10
108 yd, by Zenon
Andrusyshyn of the
Toronto Argonauts,
against the Edmonton
Eskimos in 1977. 10 20 30 40 50 50 40 30 20 10

Part B: Investigate a Quadratic Function of the Form f(x) = ax2 + bx + c


The path of a football through the air is just one of many real-life
phenomena that can be represented by a quadratic function. A
quadratic function of the form f (x) = ax2 + bx + c is written
standard form (of a in standard form.
quadratic function)
9. Using technology, graph the quadratic function f (x) = -x2 + 4x + 5.
the form
f(x) = ax2 + bx + c or 10. Describe any symmetry that the graph has.
y = ax2 + bx + c,
11. Does the function have a maximum y-value? Does it have a
where a, b, and c are
real numbers and a 0 minimum y-value? Explain.

164 MHR Chapter 3


12. Using technology, graph on a Cartesian plane the functions that
result from substituting the following c-values into the function
f (x) = -x2 + 4x + c.
10
0
-5

13. Using technology, graph on a Cartesian plane the functions that


result from substituting the following a-values into the function
f (x) = ax2 + 4x + 5.
-4
-2
1
2

14. Using technology, graph on a Cartesian plane the functions that


result from substituting the following b-values into the function
f (x) = -x2 + bx + 5.
2
0
-2
-4

Reflect and Respond


15. What do your graphs show about how the function Do any of the
f (x) = ax2 + bx + c is affected by changing the parameter c? parameters affect the
position of the graph?
16. How is the function affected when the value of a is changed?
Do any affect the
How is the graph different when a is a positive number?
shape of the graph?
17. What effect does changing the value of b have
on the graph of the function?

Link the Ideas

The standard form of a quadratic function is f (x) = ax 2 + bx + c or


y = ax 2 + bx + c, where a, b, and c are real numbers with a 0.
a determines the shape and whether the graph opens upward
(positive a) or downward (negative a)
b influences the position of the graph
c determines the y-intercept of the graph

3.2 Investigating Quadratic Functions in Standard Form MHR 165


You can expand f(x) = a(x - p)2 + q and compare the resulting coefficients
with the standard form f(x) = ax2 + bx + c, to see the relationship between
the parameters of the two forms of a quadratic function.
f (x) = a(x - p)2 + q
f (x) = a(x2 - 2xp + p2) + q
f (x) = ax2 - 2axp + ap2 + q
f (x) = ax2 + (-2ap)x + (ap2 + q)
f (x) = ax2 + bx + c
By comparing the two forms, you can see that
b = -2ap or p = _
-b and c = ap2 + q or q = c - ap2.
2a
Recall that to determine the x-coordinate of the vertex, you can use the
equation x = p. So, the x-coordinate of the vertex is x = - _
b.
2a

Example 1
Identify Characteristics of a Quadratic Function in Standard Form
For each graph of a quadratic function, identify the following:
the direction of opening
the coordinates of the vertex
the maximum or minimum value
the equation of the axis of symmetry
the x-intercepts and y-intercept
the domain and range
a) f (x) = x 2 b) f (x) = x 2 - 2x
f(x) f(x)
6 6

4 4

2 2

-4 -2 0 2 4 x -2 0 2 4 6 x

c) f (x) = -x 2 + 2x + 8 d) f (x) = 2x 2 - 12x + 25


f(x) f(x)

8 50

6 40

4 30

2 20

10
-4 -2 0 2 4 6x
-2
-2 0 2 4 6 8x

166 MHR Chapter 3


Solution
a) f (x) = x 2
f(x) opens upward
6 vertex: (0, 0)
minimum value of y of 0 when x = 0
4
axis of symmetry: x = 0
2 y-intercept occurs at (0, 0) and has a
value of 0
-4 -2 0 2 4 x x-intercept occurs at (0, 0) and has a
vertex (0, 0) value of 0
-2
domain: all real numbers, or
{x | x R}
axis of symmetry
x=0 range: all real numbers greater than
or equal to 0, or {y | y 0, y R}

b) f (x) = x 2 - 2x
f(x) opens upward
vertex: (1, -1)
6
minimum value of y of -1 when
4 x=1
axis of symmetry: x = 1
2
y-intercept occurs at (0, 0) and has a
(0, 0) (2, 0)
value of 0
-2 0 2 4 6 x
x-intercepts occur at (0, 0) and (2, 0)
-2
vertex (1, -1) and have values of 0 and 2
domain: all real numbers, or
axis of symmetry
x=1 {x | x R}
range: all real numbers greater than
or equal to -1, or {y | y -1, y R}
c) f (x) = -x 2 + 2x + 8
f(x) vertex (1, 9)
opens downward
vertex: (1, 9)
8
(0, 8) maximum value of y of 9 when x = 1
6 axis of symmetry: x = 1
y-intercept occurs at (0, 8) and has a
4
value of 8
2 x-intercepts occur at (-2, 0) and (4, 0)
(-2, 0) (4, 0) and have values of -2 and 4
-4 -2 0 2 4 6x domain: all real numbers, or
-2 {x | x R}
range: all real numbers less than or
axis of symmetry equal to 9, or {y | y 9, y R}
x=1

3.2 Investigating Quadratic Functions in Standard Form MHR 167


d) f (x) = 2x 2 - 12x + 25
f(x) opens upward
50
vertex: (3, 7)
minimum value of y of 7 when
40 x=3
axis of symmetry: x = 3
30
(0, 25) y-intercept occurs at (0, 25) and
20 has a value of 25
no x-intercepts
10
domain: all real numbers, or
vertex (3, 7)
{x | x R}
-2 0 2 4 6 8x
range: all real numbers greater than
axis of symmetry or equal to 7, or {y | y 7, y R}
x=3

Your Turn
For each quadratic function, identify the following:
the direction of opening
the coordinates of the vertex
the maximum or minimum value
the equation of the axis of symmetry
the x-intercepts and y-intercept
the domain and range
a) y = x 2 + 6x + 5 b) y = -x 2 + 2x + 3
y y
4 4

2 2

-6 -4 -2 0 x -2 0 2 4 x
-2 -2

-4 -4

Example 2
Analysing a Quadratic Function
A frog sitting on a rock jumps into a pond. The height, h, in
centimetres, of the frog above the surface of the water as a function of
time, t, in seconds, since it jumped can be modelled by the function
h(t) = -490t2 + 150t + 25. Where appropriate, answer the following
questions to the nearest tenth.
a) Graph the function.
b) What is the y-intercept? What does it represent in this situation?

168 MHR Chapter 3


c) What maximum height does the frog reach? When
does it reach that height?
d) When does the frog hit the surface of the water?
e) What are the domain and range in this situation?
f) How high is the frog 0.25 s after it jumps?

Solution
a) Method 1: Use a Graphing Calculator
Enter the function and adjust the dimensions of the
graph until the vertex and intercepts are visible.
Why is it not necessary to show the negative
x-intercept?

The shape of the graph might appear to


resemble the path the frog follows through
the air, but it is important to realize that the
graph compares height to time rather than
height to horizontal distance.

Method 2: Use a Spreadsheet


You can generate a table of values using a spreadsheet. From these
values, you can create a graph.
How is the pattern in the heights
connected to shape of the graph?

b) The graph shows that the y-intercept is 25. This is the value of
h at t = 0. It represents the initial height, 25 cm, from which the
frog jumped.

The y-intercept of the graph of h(t) = -490t2 + 150t + 25 is equal to


the value of the constant term, 25.

3.2 Investigating Quadratic Functions in Standard Form MHR 169


c) The coordinates of the vertex
represent the time and height of
the frog at its maximum point
during the jump. The graph
shows that after approximately
0.2 s, the frog achieves a
maximum height of
approximately 36.5 cm.

d) The positive x-intercept represents


the time at which the height is
0 cm, or when the frog hits the
water. The graph shows that the
frog hits the water after
approximately 0.4 s.

e) The domain is the set of all possible values of the independent


variable, or time.
The range is the set of all possible values of the dependent variable,
or height.
The values of time and height cannot be negative in this situation.
The domain is the set of all real numbers from 0 to approximately 0.4,
or {t | 0 t 0.4, t R}.
The range is the set of all real numbers from 0 to approximately 36.5,
or {h | 0 h 36.5, h R}.

f) The height of the frog after 0.25 s


is the h-coordinate when t is 0.25.
The graph shows that after 0.25 s,
the height of the frog is
approximately 31.9 cm.
You can also determine the height
after 0.25 s by substituting 0.25
for t in h(t) = -490t2 + 150t + 25.
h(t) = -490t2 + 150t + 25
h(0.25) = -490(0.25)2 + 150(0.25) + 25
h(0.25) = -30.625 + 37.5 + 25
h(0.25) = 31.875
The height of the frog after 0.25 s is approximately 31.9 cm.

170 MHR Chapter 3


Your Turn
A diver jumps from a 3-m springboard with an initial vertical velocity of
6.8 m/s. Her height, h, in metres, above the water t seconds after leaving the
diving board can be modelled by the function h(t) = -4.9t2 + 6.8t + 3.
a) Graph the function.
b) What does the y-intercept represent?
c) What maximum height does the diver reach? When does she reach
that height?
d) How long does it take before the diver hits the water?
e) What domain and range are appropriate in this situation?
f) What is the height of the diver 0.6 s after leaving the board?

Example 3
Write a Quadratic Function to Model a Situation
A rancher has 100 m of fencing available to
build a rectangular corral.
a) Write a quadratic function in standard
form to represent the area of the corral.
b) What are the coordinates of the vertex?
What does the vertex represent in
this situation?
c) Sketch the graph for the function you
determined in part a).
d) Determine the domain and range for
this situation.
e) Identify any assumptions you
made in modelling this situation
mathematically.

Solution
a) Let l represent the length, w represent the width,
and A represent the area of the corral. A = lw w

The formula A = lw has three variables. To create


l
a function for the area in terms of the width
alone, you can use an expression for the length in terms of the width
to eliminate the length. The formula for the perimeter of the corral is
P = 2l + 2w, which gives the equation 2l + 2w = 100. Solving for l
gives l = 50 - w.

A = lw
A = (50 - w)(w)
A = 50w - w 2 A = 50w - w 2 w
How could you write a similar function
using the length instead of the width?
50 - w

3.2 Investigating Quadratic Functions in Standard Form MHR 171


b) Use the equation x = p to determine the x-coordinate of the vertex.

x=_ -b
2a
x = __
-50
2(-1)
x = 25
Substitute the x-coordinate of the vertex into the function to
determine the y-coordinate.
y = 50x - x 2
y = 50(25) - (25)2
y = 625
The vertex is located at (25, 625). The y-coordinate of the vertex
represents the maximum area of the rectangle. The x-coordinate
represents the width when this occurs.

c) For the function f(x) = 50x - x 2,


the y-intercept is the point (0, 0).
Using the axis of symmetry, a
point symmetric to the y-intercept
is (50, 0). Sketch the parabola
through these points and the
vertex (25, 625).

d) Negative widths, lengths, and areas do not have any meaning


in this situation, so the domain and range are restricted.
The width is any real number from 0 to 50. Although 0 and 50 are
The domain is {w | 0 w 50, w R}. theoretically possible,
can they really be used
The area is any real number from 0 to 625. as dimensions?
The range is {A | 0 A 625, A R}.

e) The quadratic function written in part a) assumes that the rancher will
use all of the fencing to make the corral. It also assumes that any width
or length from 0 m to 50 m is possible. In reality, there may be other
limitations on the dimensions of the corral, such as the available area
and landscape of the location on the ranchers property.

Your Turn
At a childrens music festival, the organizers are roping off a rectangular area
for stroller parking. There is 160 m of rope available to create the perimeter.
a) Write a quadratic function in standard form to represent the area for
the stroller parking.
b) What are the coordinates of the vertex? What does the vertex
represent in this situation?
c) Sketch the graph for the function you determined in part a).
d) Determine the domain and range for this situation.
e) Identify any assumptions you made.

172 MHR Chapter 3


Key Ideas

The standard form of a quadratic function is f (x) = ax 2 + bx + c or


y = ax 2 + bx + c, where a 0.
The graph of a quadratic function is a parabola that
 is symmetric about a vertical line, called the axis of symmetry,

that passes through the vertex


 opens upward and has a minimum value if a > 0

 opens downward and has a maximum value if a < 0

 has a y-intercept at (0, c) that has a value of c

You can determine the vertex, domain and range, direction of opening,
axis of symmetry, x-intercepts and y-intercept, and maximum or
minimum value from the graph of a quadratic function.

y y
axis of
vertex symmetry
maximum
value

x- intercept
x-intercept p 0 x

x-intercept 0 p x-intercept x
axis of y-intercept
symmetry
y-intercept
minimum value vertex

Domain: all real numbers Domain: all real numbers


Range: all real numbers less Range: all real numbers greater
than or equal to the than or equal to the
maximum value of y minimum value of y

For any quadratic function in standard form, the x-coordinate of the


vertex is given by x = - _b.
2a
For quadratic functions in applied situations,
 the y-intercept represents the value of the function when the

independent variable is 0
 the x-intercept(s) represent(s) the value(s) of the independent

variable for which the function has a value of 0


 the vertex represents the point at which the function reaches its

maximum or minimum
 the domain and range may need to be restricted based on the values

that are actually possible in the situation

3.2 Investigating Quadratic Functions in Standard Form MHR 173


Check Your Understanding

Practise c) y
1. Which functions are quadratic? Explain. 12
a) f (x) = 2x 2 + 3x
10
b) f (x) = 5 - 3x
8
c) f (x) = x(x + 2)(4x - 1)
d) f (x) = (2x - 5)(3x - 2) 6

2. For each graph, identify the following: 4


the coordinates of the vertex
2
the equation of the axis of symmetry
the x-intercepts and y-intercept
0 2 4 6 x
the maximum or minimum value and how
it is related to the direction of opening
the domain and range 3. Show that each function fits the definition
of a quadratic function by writing it in
a) y
standard form.
2
a) f (x) = 5x(10 - 2x)

-6 -4 -2 0 2 x b) f (x) = (10 - 3x)(4 - 5x)


-2 4. Create a table of values and then sketch
the graph of each function. Determine the
-4
vertex, the axis of symmetry, the direction
-6 of opening, the maximum or minimum
value, the domain and range, and
-8
any intercepts.
-10 a) f (x) = x 2 - 2x - 3
b) f (x) = -x 2 + 16
b) y
c) p(x) = x 2 + 6x
8
d) g(x) = -2x 2 + 8x - 10
6 5. Use technology to graph each function.
4
Identify the vertex, the axis of symmetry,
the direction of opening, the maximum or
2 minimum value, the domain and range,
and any intercepts. Round values to the
-2 0 2 4 6 8 10 12 x nearest tenth, if necessary.
-2 a) y = 3x 2 + 7x - 6
-4 b) y = -2x 2 + 5x + 3
c) y = 50x - 4x 2
d) y = 1.2x 2 + 7.7x + 24.3

174 MHR Chapter 3


6. The x-coordinate of the vertex is given by 8. How many x-intercepts does each function
x=_
-b . Use this information to determine have? Explain how you know. Then,
2a determine whether each intercept is
the vertex of each quadratic function.
positive, negative, or zero.
a) y = x 2 + 6x + 2
a) a quadratic function with an axis of
b) y = 3x 2 - 12x + 5 symmetry of x = 0 and a maximum
2
c) y = -x + 8x - 11 value of 8
7. A siksik, an Arctic ground squirrel, b) a quadratic function with a vertex at
jumps from a rock, travels through the (3, 1), passing through the point (1, -3)
air, and then lands on the tundra. The c) a quadratic function with a range of
graph shows the height of its jump as a y1
function of time. Use the graph to answer
d) a quadratic function with a y-intercept
each of the following, and identify which
of 0 and an axis of symmetry of x = -1
characteristic(s) of the graph you used in
each case. 9. Consider the function
f (x) = -16x 2 + 64x + 4.
h
a) Determine the domain and range of
30
Height (cm)

the function.
20 b) Suppose this function represents the
height, in feet, of a football kicked into
10
the air as a function of time, in seconds.
What are the domain and range in
0 1 2 3 4 5 t
Time (s) this case?
c) Explain why the domain and range are
a) What is the height of the rock that the
different in parts a) and b).
siksik jumped from?
b) What is the maximum height of the
Apply
siksik? When did it reach that height? 10. Sketch the graph of a quadratic function
c) How long was the siksik in the air? that has the characteristics described in
d) What are the domain and range in this each part. Label the coordinates of three
situation? points that you know are on the curve.
e) Would this type of a) x-intercepts at -1 and 3 and a range of
motion be possible y -4
for a siksik in real b) one of its x-intercepts at -5 and vertex
life? Use your at (-3, -4)
answers to parts c) axis of symmetry of x = 1, minimum
a) to d) to value of 2, and passing through (-1, 6)
explain why
d) vertex at (2, 5) and y-intercept of 1
or why not.

D id Yo u K n ow ?

The siksik is named because of the sound it makes.

3.2 Investigating Quadratic Functions in Standard Form MHR 175


11. Satellite dish antennas have the shape d) When does the spider land on the
of a parabola. Consider a satellite dish ground?
that is 80 cm across. Its cross-sectional e) What domain and range are appropriate
shape can be described by the function in this situation?
d(x) = 0.0125x 2 - x, where d is the depth,
f) What is the height of the spider 0.05 s
in centimetres, of the dish at a horizontal
after it jumps?
distance of x centimetres from one edge of
the dish. D i d You K n ow ?
a) What is the domain of this function? There are an estimated 1400 spider species in
b) Graph the function to show Canada. About 110 of these are jumping spiders.
the cross-sectional shape of the British Columbia has the greatest diversity of
satellite dish. jumping spiders. Although jumping spiders are
relatively small (3 mm to 10 mm in length), they can
c) What is the maximum depth of the jump horizontal distances of up to 16 cm.
dish? Does this correspond to the
maximum value of the function? 13. A quadratic function can model the
Explain. relationship between the speed of a
d) What is the range of the function? moving object and the wind resistance,
e) How deep is the dish at a point 25 cm or drag force, it experiences. For a
from the edge of the dish? typical car travelling on a highway, the
relationship between speed and drag
can be approximated with the function
f (v) = 0.002v 2, where f is the drag force,
in newtons, and v is the speed of the
vehicle, in kilometres per hour.
a) What domain do you think is
appropriate in this situation?
b) Considering your answer to part a),
create a table of values and a graph to
represent the function.
c) How can you tell from your graph that
the function is not a linear function?
How can you tell from your table?
d) What happens to the values of the
drag force when the speed of the
12. A jumping spider jumps from a log
vehicle doubles? Does the drag force
onto the ground below. Its height, h, in
also double?
centimetres, as a function of time, t, in
seconds, since it jumped can be modelled e) Why do you think a driver might
by the function h(t) = -490t2 + 75t + 12. be interested in understanding the
Where appropriate, answer the following relationship between the drag force and
questions to the nearest tenth. the speed of the vehicle?
a) Graph the function. D i d You K n ow ?
b) What does the h-intercept represent? A newton (abbreviated N) is a unit of measure of
c) When does the spider reach its force. One newton is equal to the force required to
maximum height? What is its accelerate a mass of one kilogram at a rate of one
metre per second squared.
maximum height?

176 MHR Chapter 3


14. Assume that you are an advisor to 17. Maria lives on a farm.
business owners who want to analyse She is planning to
x
their production costs. The production build an enclosure for
costs, C, to produce n thousand units her animals that is
of their product can be modelled by the divided into three equal-sized sections, as
function C(n) = 0.3n2 - 48.6n + 13 500. shown in the diagram. She has 280 m of
a) Graph the function and identify the fencing to use.
important characteristics of the graph. a) Write a function that represents the area
b) Write a short explanation of what the of the entire enclosure in terms of its
graph and each piece of information width. How do you know that it fits the
you determined in part a) shows definition of a quadratic function?
about the production costs. b) Graph the function.
15. a) Write a function to represent the c) What are the coordinates of the vertex?
area of the rectangle. Show that What do they represent?
the function fits the definition of a d) What are the domain and range in
quadratic function. this situation?
e) Does the function have a maximum
value? Does it have a minimum value?
x+2 Explain.
f) What assumptions did you make in
your analysis of this situation?
20 - 2x
18. a) Consider the pattern shown in the
b) Graph the function. sequence of diagrams. The area of each
c) What do the x-intercepts represent in small square is 1 square unit.
this situation? How do they relate to Diagram 1 Diagram 2 Diagram 3
the dimensions of the rectangle?
d) What information does the vertex give
about this situation?
e) What are the domain and range? What a) Draw the next three diagrams in the
do they represent in this situation? sequence. What is the total area of each
f) Does the function have a maximum diagram?
value in this situation? Does it have b) Write a function to model the total
a minimum value? area, A, of each diagram in terms of the
g) If you graph the function you wrote diagram number, n.
in part a) with the domain being the c) Is the function linear or quadratic?
set of all real numbers, does it have a Explain why in terms of the diagrams as
minimum value? Explain. well as the function.
16. Does the function d) If the sequence of diagrams continues,
f (x) = 4x 2 - 3x + 2x(3 - 2x) + 1 what is the domain? Are the values in
represent a quadratic function? Show the domain continuous or discrete?
why or why not using several different Explain.
methods.
e) Considering your answer to part b),
graph the function to show the
relationship between A and n.

3.2 Investigating Quadratic Functions in Standard Form MHR 177


19. a) Write a function for the area, A, of a Extend
circle, in terms of its radius, r. 21. A family of functions is a set of functions
b) What domain and range are appropriate that are related to each other in some way.
for this function? a) Write a set of functions for part of the
c) Considering your answer to part b), family defined by f (x) = k(x 2 + 4x + 3)
graph the function. if k = 1, 2, 3. Simplify each equation so
d) What are the intercepts of the graph? that it is in standard form.
What meaning do they have in b) Graph the functions on the same
this situation? grid using the restricted domain of
e) Does this graph have an axis of {x | 0 x 4, x R}.
symmetry? Explain. c) Describe how the graphs are related
20. The stopping distance of a vehicle is the to each other. How are the values of y
distance travelled between the time a related for points on each graph for the
driver notices a need to stop and the time same value of x?
when the vehicle actually stops. This d) Predict what the graph would look like
includes the reaction time before applying if k = 4 and if k = 0.5. Sketch the graph
the brakes and the time it takes to stop in each case to test your prediction.
once the brakes are applied. The stopping e) Predict what the graphs would look
distance, d, in metres, for a certain vehicle like for negative values of k. Test your
can be approximated using the formula prediction.
d(t) = _ vt + _ v2 ,
f) What does the graph look like if k = 0?
3.6 130
where v is the speed of the vehicle, in g) Explain how the members of the
kilometres per hour, before braking, and family of functions defined by
t is the reaction time, in seconds, before f (x) = k(x 2 + 4x + 3) for all
the driver applies the brakes. values of k are related.
a) Suppose the driver of this vehicle has a 22. Milos said, The a in the quadratic function
reaction time of 1.5 s. Write a function f(x) = ax2 + bx + c is like the steepness
to model the stopping distance, d, for of the graph, just like it is for the a in
the vehicle and driver as a function of f(x) = ax + b. In what ways might this
the pre-braking speed, v. statement be a reasonable comparison? In
what ways is it not completely accurate?
b) Create a table of values and graph the
Explain, using examples.
function using a domain of 0 v 200.
23. a) The point (-2, 1) is on the graph
c) When the speed of the vehicle doubles,
of the quadratic function
does the stopping distance also double?
f (x) = -x 2 + bx + 11. Determine
Use your table and graph to explain.
the value of b.
d) Assume that you are writing a
b) If the points (-1, 6) and (2, 3) are on
newspaper or magazine article about
the graph of the quadratic function
safe driving. Write an argument aimed
f (x) = 2x 2 + bx + c, determine the
at convincing drivers to slow down. Use
values of b and c.
your graphs and other results to support
your case.

178 MHR Chapter 3


24. How would projectile motion be different b) A quadratic function has an axis of
on the moon? Consider the following symmetry of x = j and passes through
situations: the point (4j, k). Identify one other
an object launched from an initial height point on the graph.
of 35 m above ground with an initial c) A quadratic function has a range of
vertical velocity of 20 m/s y d and x-intercepts of s and t. What
a flare that is shot into the air with an are the coordinates of the vertex?
initial velocity of 800 ft/s from ground
level Create Connections
a rock that breaks loose from the top 26. For the graph of a given quadratic
of a 100-m-high cliff and starts to fall function, how are the range, direction of
straight down opening, and location of the vertex, axis of
a) Write a pair of functions for each symmetry, and x-intercepts connected?
situation, one representing the motion if
27. MINI LAB Use computer or graphing
the situation occurred on Earth and one
calculator technology to investigate
if on the moon.
how the values of a, b, and c affect the
b) Graph each pair of functions. graph of the function that corresponds to
c) Identify the similarities and differences y = ax2 + bx + c. If you are using graphing/
in the various characteristics for each geometry software, you may be able to use
pair of graphs. it to make sliders to change the values of a,
d) What do your graphs show about the b, and c. The will allow you to dynamically
differences between projectile motion see the effect each parameter has.
on Earth and the moon? Explain. For each step below, sketch one or more
graphs to illustrate your findings.
D id Yo u K n ow ?
Step 1 Change the values of a, b, and c, one at
You can create a function representing the height
a time. Observe any changes that occur
of any projectile over time using the formula
in the graph as a, b, or c is
h(t) = -0.5gt 2 + v0t + h0 , where g is the
acceleration due to gravity, v0 is the initial vertical increased or decreased
velocity, and h0 is the initial height. made positive or negative
The acceleration due to gravity is a measure of how Step 2 How is the y-intercept affected by the
much gravity slows down an object red upward or values of a, b, and c? Do all the values
speeds up an object dropped or thrown downward. affect its location?
On the surface of Earth, the acceleration due to Step 3 Explore how the location of the axis
gravity is 9.81 m/s2 in metric units or 32 ft/s2 in
of symmetry is affected by the values.
imperial units. On the surface of the moon, the
acceleration due to gravity is much less than on
Which values are involved, and how?
Earth, only 1.63 m/s2 or 5.38 ft/s2. Step 4 Explore how the values affect the
steepness of the curve as it crosses the
25. Determine an expression for the y-axis. Do they all have an effect on
coordinates of each missing point this aspect?
described below. Explain your reasoning. Step 5 Observe whether any other aspects of
a) A quadratic function has a vertex at the graph are affected by changes in a,
(m, n) and a y-intercept of r. Identify b, and c. Explain your findings.
one other point on the graph.

3.2 Investigating Quadratic Functions in Standard Form MHR 179


3.3
Completing the Square
Focus on . . .
converting quadratic functions from standard to vertex form
analysing quadratic functions of the form y = ax2 + bx + c
writing quadratic functions to model situations

Every year, staff and students hold a craft


fair as a fundraiser. Sellers are charged
a fee for a table at the fair. As sellers
prepare for the fair, they consider what
price to set for the items they sell. If
items are priced too high, few people
may buy them. If the prices are set too low,
sellers may not take in much revenue even
though many items sell. The key is to find
the optimum price. How can you determine
the price at which to sell items that will
give the maximum revenue?

Investigate Completing the Square

Materials Part A: Comparing Different Forms of a Quadratic Function


grid paper or graphing 1. Suppose that Adine is considering pricing for the mukluks she sells
technology
at a craft fair. Last year, she sold mukluks for $400 per pair, and she
sold 14 pairs. She predicts that for every $40 increase in price, she
will sell one fewer pair. The revenue from the mukluk sales, R(x),
is (Number of Mukluks Sold)(Cost Per Mukluk).
Copy and complete the table to model how Adines total revenue
this year might change for each price increase or decrease of $40.
Continue the table to see what will happen to the total revenue if the
price continues to increase or decrease.
Number of Mukluks Cost Per Mukluk Revenue, R(x)
Sold ($) ($)

14 400 5600
13 440 5720

180 MHR Chapter 3


2. What pattern do you notice in the revenue as the price changes? Why
do you think that this pattern occurs?
3. Let x represent the number of $40 increases. Develop an algebraic
function to model Adines total revenue.
a) Determine an expression to represent the cost of the mukluks.
b) Determine an expression to represent the number of mukluks sold.
c) Determine the revenue function, R(x), where
R(x) = (Number of Mukluks Sold)(Cost Per Mukluk).
d) Expand R(x) to give a quadratic function in standard form.
4. a) Graph the revenue as a function of the number of price changes.
b) What maximum possible revenue can Adine expect?
c) What price would give her the maximum possible revenue?
5. A friend of Adines determined a function in the form
R(x) = -40(x - 2)2 + 5760 where x represents the number of
price decreases.
a) Expand this function and compare it to Adines function. What do
you notice?
b) Which quadratic function allows you to determine the best price
and maximum revenue without graphing or creating a table of
values? Explain.

Reflect and Respond


6. a) Consider the shape of D i d You K n ow?
your graph in step 4.
Mukluks are soft
Why is a quadratic winter boots
function a good model traditionally made
to use in this situation? from animal fur
Why is a linear function and hide by Arctic
not appropriate to Aboriginal peoples.
relate revenue to The Inuit have long
worn and continue
price change?
to wear this type of
b) What assumptions did boot and refer to them
you make in using as kamik.
this model to predict
Adines sales? Why
might her actual sales
at the fair not exactly
follow the predictions
made by this model?

3.3 Completing the Square MHR 181


Materials Part B: Completing the Square
algebra tiles The quadratic function developed in step 3 in Part A is in standard form.
The function used in step 5 is in vertex form. These quadratic functions
are equivalent and can provide different information. You can convert
from vertex to standard form by expanding the vertex form. How can you
convert from standard to vertex form?
7. a) Select algebra tiles to represent the
expression x 2 + 6x. Arrange them into
an incomplete square as shown.
b) What tiles must you add to complete
the square?
c) What trinomial represents the new
completed square?
d) How can you rewrite this trinomial in
factored form as the square of a binomial?
8. a) Repeat the activity in step 7 using each expression in the
list. Record your results in an organized fashion. Include a
diagram of the tiles for each expression.
x2 + 2x
What tiles must you add to each
x2 + 4x expression to make a complete square?
x2 + 8x
x2 + 10x
b) Continue to model expressions until you can clearly describe the
pattern that emerges. What relationship is there between the original
expression and the tiles necessary to complete the square? Explain.
9. Repeat the activity, but this time model expressions that have a
negative x-term, such as x 2 - 2x, x 2 - 4x, x 2 - 6x, and so on.
10. a) Without using algebra tiles, predict what value you need to add to
the expression x2 + 32x to represent it as a completed square. What
trinomial represents this completed square?
b) How can you rewrite the trinomial in factored form as the square
of a binomial?

Reflect and Respond


11. a) How are the tiles you need to complete each square related to
the original expression?
b) Does it matter whether the x-term in the original expression is
positive or negative? Explain.
c) Is it possible to complete the square for an expression with an
x-term with an odd coefficient? Explain your thinking.
12. The expressions x 2 + x +  and (x + )2 both represent the same
perfect square. Describe how the missing values are related to
each other.

182 MHR Chapter 3


Link the Ideas

You can express a quadratic function in standard How can you use the
form, f (x) = ax 2 + bx + c, or in vertex form, values of a, p, and q
to determine whether
f (x) = a(x - p)2 + q. You can determine the shape a function has a
of the graph and direction of opening from the maximum or minimum
value of a in either form. The vertex form has the value, what that
advantage that you can identify the coordinates of value is, and where
it occurs?
the vertex as (p, q) directly from the algebraic form.
It is useful to be able to determine the coordinates
of the vertex algebraically when using quadratic
functions to model problem situations involving
maximum and minimum values.
You can convert a quadratic function in standard form to vertex form
using an algebraic process called completing the square. Completing completing the
the square involves adding a value to and subtracting a value from a square
quadratic polynomial so that it contains a perfect square trinomial. an algebraic process
You can then rewrite this trinomial as the square of a binomial. used to write a
quadratic polynomial in
y = x 2 - 8x + 5 the form a(x - p)2 + q.
y = (x 2 - 8x) + 5 Group the first two terms.
2 Add and subtract the square of half the
y = (x - 8x + 16 - 16) + 5 coefficient of the x-term.
y = (x 2 - 8x + 16) - 16 + 5 Group the perfect square trinomial.
y = (x - 4)2 - 16 + 5 Rewrite as the square of a binomial.
y = (x - 4)2 - 11 Simplify.

In the above example, both the standard form, y = x 2 - 8x + 5, and the


vertex form, y = (x - 4)2 - 11, represent the same quadratic function.
You can use both forms to determine that the graph of the function will
open up, since a = 1. However, the vertex form also reveals without
graphing that the vertex is at (4, -11), so this function has a minimum
value of -11 when x = 4.
y
x y 8
0 5
6
2 7
y = x2 - 8x + 5
4 11 4

6 7
-2 0 2 4 6 8 10 x
8 5
-4

-8

-12
(4, -11)

3.3 Completing the Square MHR 183


Example 1
Convert From Standard Form to Vertex Form
Rewrite each function in vertex form by completing the square.
a) f (x) = x 2 + 6x + 5
b) f (x) = 3x 2 - 12x - 9
c) f (x) = -5x 2 - 70x

Solution
a) Method 1: Model with Algebra Tiles

Select algebra x2 6x 5
tiles to represent
the quadratic
polynomial
x 2 + 6x + 5.

Using the x 2-tile How is the


side length of
and x-tiles, create
the incomplete
an incomplete square related
square to represent to the number
the first two terms. of x-tiles in
Leave the unit tiles the original
expression?
aside for now.
How is the number of unit tiles needed to
complete the square related to the number of
x-tiles in the original expression?

To complete the Why is it


necessary to add
square, add nine
the same number
zero pairs. The of red and white
nine positive unit tiles?
tiles complete the Why are the
square and the nine positive unit tiles
negative unit tiles used to complete
are necessary to the square rather
than the negative
maintain an
ones?
expression equivalent
to the original.

Simplify the
expression by
removing zero
pairs.

184 MHR Chapter 3


You can express the x+3 How are the
tiles in this
completed square
x 3 arrangement
in expanded form equivalent to the
as x 2 + 6x + 9, but original group of
also as the square x tiles?
of a binomial as
x+3
(x + 3)2. The vertex
form of the function 3
is y = (x + 3)2 - 4.
(x + 3)2 -4

Method 2: Use an Algebraic Method


For the function y = x 2 + 6x + 5, the value of a is 1. To complete
the square,
group the first two terms
inside the brackets, add and subtract the square of half the
coefficient of the x-term
group the perfect square trinomial
rewrite the perfect square trinomial as the square of a binomial
simplify
y = x 2 + 6x + 5
y = (x 2 + 6x) + 5
y = (x 2 + 6x + 9 - 9) + 5 Why is the value 9 used here? Why is 9 also subtracted?
y = (x 2 + 6x + 9) - 9 + 5 Why are the first three terms grouped together?
y = (x + 3)2 - 9 + 5 How is the 3 inside the brackets related to the original
function? How is the 3 related to the 9 that was used earlier?
y = (x + 3)2 - 4 How could you check that this is equivalent to the original
expression?

b) Method 1: Use Algebra Tiles


Select algebra tiles to represent the quadratic expression 3x2 - 12x - 9.
Use the x 2-tiles and x-tiles to create three incomplete squares as
shown. Leave the unit tiles aside for now.

Why are three


incomplete
squares created?

Add enough positive unit tiles to complete each square, as well as an


equal number of negative unit tiles.

Why do positive
tiles complete
each square
even though
the x-tiles are
negative?

3.3 Completing the Square MHR 185


Simplify by combining the negative unit tiles.

How are the


tiles in this
arrangement
equivalent to
the original
group of tiles?
(x - 2)2 (x - 2)2 (x - 2)2 -21
3(x - 2)2 - 21

You can express each completed square as x 2 - 4x + 4, but also as


(x - 2)2. Since there are three of these squares and 21 extra negative
unit tiles, the vertex form of the function is y = 3(x - 2)2 - 21.

Method 2: Use an Algebraic Method


To complete the square when the leading coefficient, a, is not 1,
group the first two terms and factor out the leading coefficient
inside the brackets, add and subtract the square of half of the
coefficient of the x-term
group the perfect square trinomial
rewrite the perfect square trinomial as the square of a binomial
expand the square brackets and simplify

y = 3x 2 - 12x - 9
y = 3(x 2 - 4x) - 9 Why does 3 need to be factored from the first
two terms?
y = 3(x 2 - 4x + 4 - 4) - 9 Why is the value 4 used inside the brackets?
y = 3[(x 2 - 4x + 4) - 4] - 9
y = 3[(x - 2)2 - 4] - 9
y = 3(x - 2)2 - 12 - 9 What happens to the square brackets? Why are the
brackets still needed?
y = 3(x - 2)2 - 21 Why is the constant term, -21, 12 less than at the
start, when only 4 was added inside the brackets?

c) Use the process of completing the square to convert to vertex form.

y = -5x 2 - 70x What happens to the x-term when a negative


number is factored?
y = -5(x 2 + 14x)
y = -5(x 2 + 14x + 49 - 49) How does a leading coefficient that is negative
affect the process? How would the result be
y = -5[(x 2 + 14x + 49) - 49]
different if it had been positive?
y = -5[(x + 7)2 - 49]
y = -5(x + 7)2 + 245 Why would algebra tiles not be suitable to use for
this function?

Your Turn
Rewrite each function in vertex form by completing the square.
a) y = x 2 + 8x - 7
b) y = 2x 2 - 20x
c) y = -3x 2 - 18x - 24

186 MHR Chapter 3


Example 2
Convert to Vertex Form and Verify
a) Convert the function y = 4x 2 - 28x - 23 to vertex form.
b) Verify that the two forms are equivalent.

Solution
a) Complete the square to convert to vertex form.

Method 1: Use Fractions


y = 4x 2 - 28x - 23
y = 4(x 2 - 7x) - 23
y = 4 x 2 - 7x + _
[ 7 2- _
7 2 - 23
( ) ( )] Why is the number being
2 2 added and subtracted inside
y = 4 x 2 - 7x + _ - _ - 23
( 49 49
) the brackets not a whole
4 4 number in this case?

y = 4 x 2 - 7x + _
[( 49 - _
) ]
49 - 23
4 4
y = 4[(x - _
7 -_ 2

4]
49 - 23
2)
y = 4(x - _
7 -4 _2

2) ( 494 ) - 23
y = 4(x - _
2
7 - 49 - 23
2)
y = 4(x - _
2
7 - 72
2)

Method 2: Use Decimals


y = 4x 2 - 28x - 23 Do you find it easier to
complete the square using
y = 4(x 2 - 7x) - 23
fractions or decimals? Why?
y = 4[x 2 - 7x + (3.5)2 - (3.5)2] - 23
y = 4(x 2 - 7x + 12.25 - 12.25) - 23
y = 4[(x 2 - 7x + 12.25) - 12.25] - 23
y = 4[(x - 3.5)2 - 12.25] - 23
y = 4(x - 3.5)2 - 4(12.25) - 23
y = 4(x - 3.5)2 - 49 - 23
y = 4(x - 3.5)2 - 72

b) Method 1: Work Backward


y = 4(x - 3.5)2 - 72
y = 4(x 2 - 7x + 12.25) - 72 Expand the binomial square expression.

y = 4x 2 - 28x + 49 - 72 Eliminate the brackets by distributing.

y = 4x 2 - 28x - 23 Combine like terms to simplify.

Since the result is the original How are these steps related to the steps
function, the two forms are used to complete the square in part a)?

equivalent.

3.3 Completing the Square MHR 187


Method 2: Use Technology
Use graphing technology to graph both functions together or
separately using identical window settings.

Since the graphs are identical, the two forms are equivalent.

Your Turn
a) Convert the function y = -3x 2 - 27x + 13 to vertex form.
b) Verify that the two forms are equivalent.

Example 3
Determine the Vertex of a Quadratic Function by Completing
the Square
Consider the function y = 5x 2 + 30x + 41.
a) Complete the square to determine the vertex and the maximum or
minimum value of the function.
b) Use the process of completing the square to verify the relationship
between the value of p in vertex form and the values of a and b in
standard form.
c) Use the relationship from part b) to determine the vertex of the
function. Compare with your answer from part a).
Solution
a) y = 5x 2 + 30x + 41
y = 5(x 2 + 6x) + 41
y = 5(x 2 + 6x + 9 - 9) + 41
y = 5[(x 2 + 6x + 9) - 9] + 41
y = 5[(x + 3)2 - 9] + 41
y = 5(x + 3)2 - 45 + 41
y = 5(x + 3)2 - 4
The vertex form of the function, y = a(x - p)2 + q, reveals
characteristics of the graph.
The vertex is located at the point (p, q). For the function
y = 5(x + 3)2 - 4, p = -3 and q = -4. So, the vertex is located at
(-3, -4). The graph opens upward since a is positive. Since the graph
opens upward from the vertex, the function has a minimum value of
-4 when x = -3.

188 MHR Chapter 3


b) Look back at the steps in completing the square.

y = ax 2 + bx + 41
y = 5x 2 + 30x + 41 b divided by a gives the coefficient of x inside the brackets.
y = 5(x 2 + 6x) + 41 6 is
_
30 _b
, or a .
5

y = 5(x + 3)2 - 4 Half the coefficient of x inside the brackets gives the value
y = 5(x - p)2 - 4 of p in the vertex form.
_b _
3 is half of 6, or half of a , or
b
.
2a

Considering the steps in completing the square, the value of p in


vertex form is equal to - _b . For any quadratic function in standard
2a
form, the equation of the axis of symmetry is x = - _ b.
2a

c) Determine the x-coordinate of the vertex using x = - _


b.
2a
x = -_30
2(5)
x = -_
30
10
x = -3
Determine the y-coordinate by substituting the x-coordinate into
the function.
y = 5(-3)2 + 30(-3) + 41
y = 5(9) - 90 + 41
y = 45 - 90 + 41
y = -4
The vertex is (-3, -4).
This is the same as the coordinates for the vertex determined
in part a).

Your Turn
Consider the function y = 3x 2 + 30x + 41.
a) Complete the square to determine the vertex of the graph of the
function.
b) Use x = - _
b and the standard form of the quadratic function
2a
to determine the vertex. Compare with your answer from
part a).

3.3 Completing the Square MHR 189


Example 4
Write a Quadratic Model Function
The student council at a high school is planning a
fundraising event with a professional
photographer taking portraits
of individuals or groups.
The student council
gets to charge and
keep a session
fee for each
individual or
group photo
session. Last
year, they charged
a $10 session fee
and 400 sessions were
booked. In considering what
price they should charge this year,
student council members estimate that for every
$1 increase in the price, they expect to have 20 fewer
sessions booked.
a) Write a function to model this situation.
b) What is the maximum revenue they can expect based on these
estimates. What session fee will give that maximum?
c) How can you verify the solution?
d) What assumptions did you make in creating and using this
model function?
Solution
a) The starting price is $10/session and the price increases are in
$1 increments.
Let n represent the number of price increases. The new price is $10
plus the number of price increases times $1, or 10 + 1n or, more
simply, 10 + n.
The original number of sessions booked is 400. The new number
of sessions is 400 minus the number of price increases times 20, or
400 - 20n.
Let R represent the expected revenue, in dollars. The revenue is
calculated as the product of the price per session and the number
of sessions.
Revenue = (price)(number of sessions)
R = (10 + n)(400 - 20n)
R = 4000 + 200n - 20n2
R = -20n2 + 200n + 4000

190 MHR Chapter 3


b) Complete the square to determine the maximum revenue and the price
that gives that revenue.
R= -20n2 + 200n + 4000
R= -20(n2 - 10n) + 4000
R= -20(n2 - 10n + 25 - 25) + 4000 Why does changing to vertex form
2 help solve the problem?
R= -20[(n - 10n + 25) - 25] + 4000
R= -20[(n - 5)2 - 25] + 4000 What other methods could you use
2 to find the maximum revenue and
R= -20(n - 5) + 500 + 4000
the price that gives that revenue?
R= -20(n - 5)2 + 4500
The vertex form of the function shows that the vertex is at (5, 4500).
The revenue, R, will be at its maximum value of $4500 when n = 5, or
when there are five price increases of $1. So, the price per session, or
session fee, should be 10 + 5, or $15.

c) You can verify the solution


using technology by graphing the
function expressed in standard
form.
The vertex of the graph is located
at (5, 4500). This verifies that the
maximum revenue is $4500 with
five price increases, or a session
fee of $15.
You can also verify the solution numerically by examining the
function table. The table shows that a maximum revenue of $4500
occurs with five price increases, or a session fee of $15.

A function table is a table of values


generated using a given function.

d) The price the student council sets will affect their revenue from this
fundraiser, as they have predicted in using this model.

This model assumes that the price affects the revenue. The revenue function
in this situation was based on information about the number of sessions
booked last year and predictions on how price changes might affect
revenue. However, other factors might affect revenue this year, such as
how happy people were with their photos last year and whether
they tell others or not
whether the student council advertises the event more this year
whether the photographer is the same or different from last year
the date, time, and duration chosen for the event

3.3 Completing the Square MHR 191


Your Turn
A sporting goods store sells reusable sports water bottles for $8. At this
price their weekly sales are approximately 100 items. Research says that
for every $2 increase in price, the manager can expect the store to sell
five fewer water bottles.
a) Represent this situation with a quadratic function.
b) Determine the maximum revenue the manager can expect based on these
estimates. What selling price will give that maximum revenue?
c) Verify your solution.
d) Explain any assumptions you made in using a quadratic function in
this situation.

Key Ideas

You can convert a quadratic function from standard form to vertex form
by completing the square.
y = 5x 2 - 30x + 7 standard form
y = 5(x 2 - 6x) + 7 Group the first two terms. Factor out the leading coefficient if a 1.
y = 5(x 2 - 6x + 9 - 9) + 7 Add and then subtract the square of half the coefficient of the x-term.
y = 5[(x 2 - 6x + 9) - 9] + 7 Group the perfect square trinomial.
y = 5[(x - 3)2 - 9] + 7 Rewrite using the square of a binomial.
y = 5(x - 3)2 - 45 + 7 Simplify.
y = 5(x - 3)2 - 38 vertex form

Converting a quadratic function to vertex form, y = a(x - p)2 + q, reveals


the coordinates of the vertex, (p, q).
You can use information derived from the vertex form to solve problems
such as those involving maximum and minimum values.

Check Your Understanding

Practise 2. Write each function in vertex form by


1. Use a model to determine the value of completing the square. Use your answer
c that makes each trinomial expression to identify the vertex of the function.
a perfect square. What is the equivalent a) y = x 2 + 8x
binomial square expression for each? b) y = x 2 - 18x - 59
a) x 2 + 6x + c c) y = x 2 - 10x + 31
b) x 2 - 4x + c d) y = x 2 + 32x - 120
c) x 2 + 14x + c
d) x 2 - 2x + c

192 MHR Chapter 3


3. Convert each function to the form 7. For each quadratic function, determine the
2
y = a(x - p) + q by completing the maximum or minimum value.
square. Verify each answer with or a) f (x) = x 2 + 5x + 3
without technology.
b) f (x) = 2x 2 - 2x + 1
a) y = 2x 2 - 12x
c) f (x) = -0.5x 2 + 10x - 3
b) y = 6x 2 + 24x + 17
d) f (x) = 3x 2 - 4.8x
c) y = 10x 2 - 160x + 80
e) f (x) = -0.2x 2 + 3.4x + 4.5
d) y = 3x 2 + 42x - 96
f) f (x) = -2x 2 + 5.8x - 3
4. Convert each function to vertex form
8. Convert each function to vertex form.
algebraically, and verify your answer.
a) y = x 2 + _3 x - 7
a) f (x) = -4x 2 + 16x 2
b) f (x) = -20x 2 - 400x - 243 b) y = -x - _
2 3x
8
c) f (x) = -x 2 - 42x + 500
c) y = 2x - _
2 5x + 1
d) f (x) = -7x 2 + 182x - 70 6
5. Verify, in at least two different ways,
Apply
that the two algebraic forms in each pair
9. a) Convert the quadratic function
represent the same function.
f (x) = -2x 2 + 12x - 10 to vertex form
a) y = x 2 - 22x + 13 by completing the square.
and
b) The graph of f (x) = -2x 2 + 12x - 10
y = (x - 11)2 - 108
is shown. Explain how you can use the
b) y = 4x 2 + 120x graph to verify your answer.
and
y = 4(x + 15)2 - 900 y
f(x) = -2x2 + 12x - 10
c) y = 9x 2 - 54x - 10 8

and 6
y = 9(x - 3)2 - 91
4
d) y = -4x 2 - 8x + 2
and 2
y = -4(x + 1)2 + 6
6. Determine the maximum or minimum -2 0 2 4 6 x
value of each function and the value of -2
x at which it occurs.
a) y = x 2 + 6x - 2 10. a) For the quadratic function
b) y = 3x 2 - 12x + 1 y = -4x 2 + 20x + 37, determine the
maximum or minimum value and
c) y = -x 2 - 10x
domain and range without making a
d) y = -2x 2 + 8x - 3 table of values or graphing.
b) Explain the strategy you used in part a).
11. Determine the vertex of the graph of
f (x) = 12x 2 - 78x + 126. Explain the
method you used.

3.3 Completing the Square MHR 193


12. Identify, explain, and correct the error(s) 15. Sandra is practising at an archery club.
in the following examples of completing The height, h, in feet, of the arrow on one
the square. of her shots can be modelled as a function
a) y = x 2 + 8x + 30 of time, t, in seconds, since it was fired
y = (x 2 + 4x + 4) + 30 using the function h(t) = -16t2 + 10t + 4.
y = (x + 2)2 + 30 a) What is the maximum height of the
b) f (x) = 2x 2 - 9x - 55 arrow, in feet, and when
f (x) 2
= 2(x - 4.5x + 20.25 - 20.25) - 55 does it reach that
f (x) = 2[(x2 - 4.5x + 20.25) - 20.25] - 55 height?
f (x) = 2[(x - 4.5)2 - 20.25] - 55 b) Verify your
f (x) = 2(x - 4.5)2 - 40.5 - 55 solution in two
f (x) = (x - 4.5)2 - 95.5 different ways.
c) y = 8x 2 + 16x - 13
y = 8(x 2 + 2x) - 13
y = 8(x 2 + 2x + 4 - 4) - 13
y = 8[(x 2 + 2x + 4) - 4] - 13
y = 8[(x + 2)2 - 4] - 13
y = 8(x + 2)2 - 32 - 13
y = 8(x + 2)2 - 45
d) f (x) = -3x 2 - 6x
f (x) = -3(x 2 - 6x - 9 + 9) D i d You K n ow ?
f (x) = -3[(x 2 - 6x - 9) + 9]
The use of the bow and arrow dates back before
f (x) = -3[(x - 3)2 + 9] recorded history and appears to have connections
f (x) = -3(x - 3)2 + 27 with most cultures worldwide. Archaeologists can
13. The managers of a business are examining learn great deal about the history of the ancestors of
costs. It is more cost-effective for them todays First Nations and Inuit populations in Canada
through the study of various forms of spearheads
to produce more items. However, if too
and arrowheads, also referred to as projectile points.
many items are produced, their costs
will rise because of factors such as
storage and overstock. Suppose that
they model the cost, C, of producing
n thousand items with the function
C(n) = 75n2 - 1800n + 60 000.
Determine the number of items
produced that will minimize their costs.
14. A gymnast is jumping on a trampoline.
His height, h, in metres, above the floor 16. Austin and Yuri were asked to convert the
on each jump is roughly approximated function y = -6x 2 + 72x - 20 to vertex
by the function h(t) = -5t2 + 10t + 4, form. Their solutions are shown.
where t represents the time, in seconds, Austins solution:
since he left the trampoline. Determine y = -6x 2 + 72x - 20
algebraically his maximum height on y = -6(x 2 + 12x) - 20
each jump. y = -6(x 2 + 12x + 36 - 36) - 20
y = -6[(x 2 + 12x + 36) - 36] - 20
y = -6[(x + 6) - 36] - 20
y = -6(x + 6) + 216 - 20
y = -6(x + 6) + 196

194 MHR Chapter 3


Yuris solution: 18. A concert promoter is planning the ticket
y = -6x 2 + 72x - 20 price for an upcoming concert for a certain
y = -6(x 2 - 12x) - 20 band. At the last concert, she charged
y = -6(x 2 - 12x + 36 - 36) - 20 $70 per ticket and sold 2000 tickets. After
y = -6[(x 2 - 12x + 36) - 36] - 20 conducting a survey, the promoter has
y = -6[(x - 6)2 - 36] - 20 determined that for every $1 decrease
y = -6(x - 6)2 - 216 - 20 in ticket price, she might expect to sell
y = -6(x - 6)2 + 236 50 more tickets.
a) Identify, explain, and correct any errors a) What maximum revenue can the
in their solutions. promoter expect? What ticket price
b) Neither Austin nor Yuri verified their will give that revenue?
answers. Show several methods that b) How many tickets can the promoter
they could have used to verify their expect to sell at that price?
solutions. Identify how each method c) Explain any assumptions the concert
would have pointed out if their promoter is making in using this
solutions were incorrect. quadratic function to predict revenues.
17. A parabolic microphone collects and
focuses sound waves to detect sounds
from a distance. This type of microphone
is useful in situations such as nature
audio recording and sports broadcasting.
Suppose a particular parabolic
microphone has a cross-sectional
shape that can be described by the
function d(x) = 0.03125x 2 - 1.5x,
where d is the depth, in centimetres, of
the microphones dish at a horizontal
distance of x centimetres from one edge
of the dish. Use an algebraic method
to determine the depth of the dish, in
centimetres, at its centre.
Digging Roots, a First Nations band,
from Barriere, British Columbia

19. The manager of a bike store is setting the


price for a new model. Based on past sales
history, he predicts that if he sets the price
at $360, he can expect to sell 280 bikes this
season. He also predicts that for every $10
increase in the price, he expects to sell five
fewer bikes.
a) Write a function to model this situation.
b) What maximum revenue can the
manager expect? What price will give
that maximum?
c) Explain any assumptions involved in
using this model.

3.3 Completing the Square MHR 195


20. A gardener is planting peas in a field. He 22. A set of fenced-in areas, as shown in the
knows that if he spaces the rows of pea diagram, is being planned on an open field.
plants closer together, he will have more A total of 900 m of fencing is available.
rows in the field, but fewer peas will be What measurements will maximize the
produced by the plants in each row. Last overall area of the entire enclosure?
year he planted the field with 30 rows of
plants. At this spacing. he got an average of
x
4000 g of peas per row. He estimates that
for every additional row, he will get 100 g
less per row.
a) Write a quadratic function to model x

this situation.
b) What is the maximum number y y y
of kilograms of peas that the
23. Use a quadratic function model to solve
field can produce? What
each problem.
number of rows gives that
maximum? a) Two numbers have a sum of 29 and a
product that is a maximum. Determine
c) What assumptions
the two numbers and the maximum
are being made in
product.
using this model
to predict the b) Two numbers have a difference of
production of 13 and a product that is a minimum.
the field? Determine the two numbers and the
minimum product.
24. What is the maximum total area that
450 cm of string can enclose if it is used
to form the perimeters of two adjoining
rectangles as shown?

21. A holding pen is being built alongside a


long building. The pen requires only three
fenced sides, with the building forming the
fourth side. There is enough material for
90 m of fencing.
a) Predict what dimensions will give the
maximum area of the pen. Extend
b) Write a function to model the area.
_3
25. Write f (x) = - x 2 + _9 x + _
5 in
4 8 16
c) Determine the maximum possible area. vertex form.
d) Verify your solution in several 26. a) Show the process of completing the
ways, with or without technology. square for the function y = ax2 + bx + c.
How does the solution compare to b) Express the coordinates of the vertex in
your prediction? terms of a, b, and c.
e) Identify any assumptions you made c) How can you use this information to
in using the model function that solve problems involving quadratic
you wrote. functions in standard form?

196 MHR Chapter 3


27. The vertex of a quadratic function in Create Connections
standard form is ( _
-b , f _
( -b )). 29. a) Is the quadratic function
2a 2a f (x) = 4x 2 + 24 written in vertex or in
a) Given the function standard form? Discuss with a partner.
f (x) = 2x 2 - 12x + 22 in standard b) Could you complete the square for this
form, determine the vertex. function? Explain.
b) Determine the vertex by converting
30. Martines teacher asks her to complete
the function to vertex form. the square for the function
c) Show the relationship between the y = -4x 2 + 24x + 5. After looking at
parameters a, b, and c in standard her solution, the teacher says that she
form and the parameters a, p, and q made four errors in her work. Identify,
in vertex form. explain, and correct her errors.
28. A Norman window Martines solution:
has the shape of a y = -4x 2 + 24x + 5
rectangle with a y = -4(x 2 + 6x) + 5
semicircle on the top. y = -4(x 2 + 6x + 36 - 36) + 5
Consider a Norman y = -4[(x 2 + 6x + 36) - 36] + 5
window with a y = -4[(x + 6)2 - 36] + 5
perimeter of 6 m. y = -4(x + 6)2 - 216 + 5
y = -4(x + 6)2 - 211
31. A local store sells T-shirts for $10. At this
a) Write a function to price, the store sells an average of 100
approximate the area of the shirts each month. Market research says
window as a function of that for every $1 increase in the price, the
its width. manager of the store can expect to sell five
fewer shirts each month.
b) Complete the square to
approximate the maximum a) Write a quadratic function to model the
w
possible area of the window revenue in terms of the increase in price.
and the width that gives that area. b) What information can you determine
c) Verify your answer to part b) using about this situation by completing
technology. the square?

d) Determine the other dimensions and c) What assumptions have you made in
draw a scale diagram of the window. Does using this quadratic function to predict
its appearance match your expectations? revenue?

Project Corner Quadratic Functions in Motion

Quadratic functions appear in the shapes of various types of stationary objects,


along with situations involving moving ones. You can use a video clip to show
the motion of a person, animal, or object that appears to create a quadratic
model function using a suitably placed set of coordinate axes.
What situations involving motion could you model using quadratic functions?

3.3 Completing the Square MHR 197


Chapter 3 Review
3.1 Investigating Quadratic Functions in 5. Write a quadratic function in vertex form
Vertex Form, pages 142162 for each graph.
a) y
1. Use transformations to explain how
the graph of each quadratic function 4

compares to the graph of f (x) = x 2. 2


Identify the vertex, the axis of symmetry,
the direction of opening, the maximum -10 -8 -6 -4 -2 0 2 4 x
or minimum value, and the domain and -2
range without graphing.
-4
a) f (x) = (x + 6)2 - 14
b) f (x) = -2x 2 + 19 -6

c) f (x) = _1 (x - 10) 2
+ 100
5
b) y
d) f (x) = -6(x - 4)2
4
2. Sketch the graph of each quadratic
function using transformations. Identify 2
the vertex, the axis of symmetry, the
maximum or minimum value, the domain -2 0 2 4 x
and range, and any intercepts. -2
2
a) f (x) = 2(x + 1) - 8
-4
b) f (x) = -0.5(x - 2)2 + 2
-6
3. Is it possible to determine the number of
x-intercepts in each case without graphing?
Explain why or why not. 6. A parabolic trough is a solar-energy collector.
a) y = -3(x - 5)2 + 20 It consists of a long mirror with a cross-
b) a parabola with a domain of all real section in the shape of a parabola. It works
numbers and a range of {y | y 0, y R} by focusing the Suns rays onto a central
axis running down the length of the trough.
c) y = 9 + 3x 2
Suppose a particular solar trough has width
d) a parabola with a vertex at (-4, -6)
180 cm and depth 56 cm. Determine the
4. Determine a quadratic function with each quadratic function that represents the cross-
set of characteristics. sectional shape of the mirror.
a) vertex at (0, 0), passing through the
point (20, -150)
b) vertex at (8, 0), passing through the
point (2, 54)
c) minimum value of 12 at x = -4 and
y-intercept of 60
d) x-intercepts of 2 and 7 and maximum
value of 25

198 MHR Chapter 3


7. The main span of the suspension bridge 3.2 Investigating Quadratic Functions in
over the Peace River in Dunvegan, Alberta, Standard Form, pages 163179
has supporting cables in the shape of a
9. For each graph, identify the vertex, axis of
parabola. The distance between the towers
symmetry, maximum or minimum value,
is 274 m. Suppose that the ends of the
direction of opening, domain and range,
cables are attached to the tops of the two
and any intercepts.
supporting towers at a height of 52 m
a) y
above the surface of the water, and the
lowest point of the cables is 30 m above 4
the waters surface. 2
a) Determine a quadratic function that
represents the shape of the cables if -4 -2 0 2 4 6 8 x
the origin is at -2
i) the minimum point on the cables
-4
ii) a point on the waters surface
directly below the minimum
point of the cables b) y
iii) the base of the tower on the left 12
b) Would the quadratic function change
10
over the course of the year as the
seasons change? Explain. 8

-10 -8 -6 -4 -2 0 2 x

10. Show why each function fits the definition


of a quadratic function.
a) y = 7(x + 3)2 - 41
8. A flea jumps from the ground to a height
b) y = (2x + 7)(10 - 3x)
of 30 cm and travels 15 cm horizontally
from where it started. Suppose the origin 11. a) Sketch the graph of the function
is located at the point from which the flea f (x) = -2x 2 + 3x + 5. Identify the
jumped. Determine a quadratic function vertex, the axis of symmetry, the
in vertex form to model the height of direction of opening, the maximum
the flea compared to the horizontal or minimum value, the domain and
distance travelled. range, and any intercepts.

D id Yo u K n ow ? b) Explain how each feature can be


identified from the graph.
The average ea can pull 160 000 times its own
mass and can jump 200 times its own length. This
is equivalent to a human being pulling 24 million
pounds and jumping nearly 1000 ft!

Chapter 3 Review MHR 199


12. A goaltender kicks a soccer ball through 15. Without graphing, state the vertex, the axis
the air to players downfield. The of symmetry, the maximum or minimum
trajectory of the ball can be modelled by value, and the domain and range of the
the function h(d) = -0.032d 2 + 1.6d, function f (x) = 4x 2 - 10x + 3.
where d is the horizontal distance, in 16. Amy tried to convert the function
metres, from the person kicking the y = -22x 2 - 77x + 132 to vertex form.
ball and h is the height at that distance,
Amys solution:
in metres.
y = -22x 2 - 77x + 132
a) Represent the function with a graph, y = -22(x 2 - 3.5x) + 132
showing all important characteristics. y = -22(x 2 - 3.5x - 12.25 + 12.25) + 132
b) What is the maximum height of the y = -22(x 2 - 3.5x - 12.25) - 269.5 + 132
ball? How far downfield is the ball y = -22(x - 3.5)2 - 137.5
when it reaches that height? a) Identify, explain, and correct the errors.
c) How far downfield does the ball hit b) Verify your correct solution in several
the ground? different ways, both with and without
d) What are the domain and range in technology.
this situation? 17. The manager of a clothing company is
13. a) Write a function to represent the area analysing its costs, revenues, and profits
of the rectangle. to plan for the upcoming year. Last year,
a certain type of childrens winter coat
was priced at $40, and the company sold
10 000 of them. Market research says that
5x + 15
for every $2 decrease in the price, the
manager can expect the company to sell
500 more coats.
31 - 2x
a) Model the expected revenue
b) Graph the function. as a function of the number of
c) What do the x-intercepts represent in price decreases.
this situation? b) Without graphing, determine the
d) Does the function have a maximum maximum revenue and the price that
value in this situation? Does it have will achieve that revenue.
a minimum value? c) Graph the function to confirm your
e) What information does the vertex give answer.
about this situation? d) What does the y-intercept represent in
f) What are the domain and range? this situation? What do the x-intercepts
represent?
3.3 Completing the Square, pages 180197 e) What are the domain and range in
this situation?
14. Write each function in vertex form, and
f) Explain some of the assumptions that
verify your answer.
the manager is making in using this
a) y = x 2 - 24x + 10
function to model the expected revenue.
b) y = 5x 2 + 40x - 27
c) y = -2x 2 + 8x
d) y = -30x 2 - 60x + 105

200 MHR Chapter 3


Chapter 3 Practice Test
Multiple Choice 5. Which graph shows the function
y = 1 + ax 2 if a < 0?
For #1 to #6, choose the best answer.
A y
1. Which function is NOT a quadratic
function?
A f (x) = 2(x + 1)2 - 7
0 x
B f (x) = (x - 3)(2x + 5)
C f (x) = 5x 2 - 20
D f (x) = 3(x - 9) + 6
2. Which quadratic function represents the B y
parabola shown? 0 x
y
4

-8 -6 -4 -2 0 x
C y
-2

-4

A y = (x + 4)2 + 4
B y = (x - 4)2 + 4 0 x
2
C y = (x + 4) - 4
D y
D y = (x - 4)2 - 4
3. Identify the range for the function
y = -6(x - 6)2 + 6.
A {y | y 6, y R} 0 x

B {y | y 6, y R}
C {y | y -6, y R}
D {y | y -6, y R} 6. What conditions on a and q will give
4. Which quadratic function in vertex form is the function f (x) = a(x - p)2 + q no
equivalent to y = x 2 - 2x - 5? x-intercepts?
A y = (x - 2)2 - 1 A a > 0 and q > 0
B y = (x - 2)2 - 9 B a < 0 and q > 0
C y = (x - 1)2 - 4 C a > 0 and q = 0
D y = (x - 1)2 - 6 D a < 0 and q = 0

Chapter 3 Practice Test MHR 201


Short Answer 10. Sketch the graph of the function
7. Write each quadratic function in vertex
y = 2(x - 1)2 - 8 using transformations.
form by completing the square. Then, copy and complete the table.

a) y = x 2 - 18x - 27 Vertex
Axis of Symmetry
b) y = 3x 2 + 36x + 13
Direction of Opening
c) y = -10x 2 - 40x
Domain
8. a) For the graph shown, give the
Range
coordinates of the vertex, the equation
of the axis of symmetry, the minimum x-Intercepts
or maximum value, the domain and y-Intercept
range, and the x-intercepts.
11. The first three steps in completing the
b) Determine a quadratic function in square below contain one or more errors.
vertex form for the graph.
y = 2x 2 - 8x + 9
y y = 2(x 2 - 8x) + 9
4 y = 2(x 2 - 8x - 64 + 64) + 9
a) Identify and correct the errors.
2
b) Complete the process to determine the
-8 -6 -4 -2 0 x vertex form of the function.
-2 c) Verify your correct solution in several
different ways.
-4
12. The fuel consumption for a vehicle is
related to the speed that it is driven and
9. a) Identify the transformation(s) on the is usually given in litres per one hundred
graph of f (x) = x 2 that could be used to kilometres. Engines are generally more
graph each function. efficient at higher speeds than at lower
i) f (x) = 5x 2 speeds. For a particular type of car driving
at a constant speed, the fuel consumption,
ii) f (x) = x 2 - 20
C, in litres per one hundred kilometres,
iii) f (x) = (x + 11)2 is related to the average driving speed, v,
_1
iv) f (x) = - x 2 in kilometres per hour, by the function
7 C(v) = 0.004v 2 - 0.62v + 30.
b) For each function in part a), state which
a) Without graphing, determine the most
of the following would be different as
efficient speed at which this car should
compared to f (x) = x 2 as a result of
be driven. Explain/show the strategy
the transformation(s) involved, and
you use.
explain why.
b) Describe any characteristics of the graph
i) vertex
that you can identify without actually
ii) axis of symmetry graphing, and explain how you know.
iii) range

202 MHR Chapter 3


13. The height, h, in metres, of a flare 15. A stone bridge has the shape of a parabolic
t seconds after it is fired into the arch, as shown. Determine a quadratic
air can be modelled by the function function to represent the shape of the arch
h(t) = -4.9t2 + 61.25t. if the origin
a) At what height is the flare at its a) is at the top of the opening under the
maximum? How many seconds after bridge
being shot does this occur? b) is on the ground at the midpoint of
b) Verify your solution both with and the opening
without technology. c) is at the base of the bridge on the right
side of the opening
Extended Response d) is on the left side at the top surface of
14. Three rectangular areas are being enclosed the bridge
along the side of a building, as shown. 56 ft
There is enough material to make 24 m
of fencing.
15 ft
12 ft

40 ft

d
16. A store sells energy bars for $2.25. At this
price, the store sold an average of 120 bars
per month last year. The manager has been
told that for every 5 decrease in price,
he can expect the store to sell eight more
a) Write the function that represents bars monthly.
the total area in terms of the a) What quadratic function can you use to
distance from the wall. model this situation?
b) Show that the function fits the b) Use an algebraic method to determine
definition of a quadratic function. the maximum revenue the manager can
c) Graph the function. Explain the expect the store to achieve. What price
strategy you used. will give that maximum?
d) What are the coordinates of the vertex? c) What assumptions are made in this
What do they represent? situation?
e) What domain and range does the
function have in this situation? Explain.
f) Does the function have a maximum
value? Does it have a minimum value?
Explain.
g) What assumptions are made in using
this quadratic function model?

Chapter 3 Practice Test MHR 203


CHAPTER

4 Quadratic
Equations
What do water fountains, fireworks,
satellite dishes, bridges, and model
rockets have in common? They all
involve a parabolic shape. You can
develop and use quadratic equations
to solve problems involving these
parabolic shapes. Quadratic equations
are also used in other situations such as
avalanche control, setting the best ticket
prices for concerts, designing roller
coasters, and planning gardens.

In this chapter, you will relate quadratic


equations to the graphs of quadratic
functions, and solve problems by
determining and analysing quadratic
equations.

Did Yo u Know ?

Apollonius, also known as


the The Greek Geometer
(c. 210 B.C.E.), was the first
mathematician to study
parabolas in depth.

Key Terms
quadratic equation extraneous root
root(s) of an equation quadratic formula
zero(s) of a function discriminant

204 MHR Chapter 4


Career Link
Robotics engineering is a sub-field of
mechanical engineering. A robotics engineer
designs, maintains, and develops new
applications for robots. These applications
range from production line robots to those
used in the medical and military fields,
and from aerospace and mining to walking
machines and tele-operators controlled
by microchips.

A visionary robotics engineer could work


on designing mobile robots, cars that drive
themselves, and parts of space probes.

We b Link
To learn
earn more a
about robotics engineering, go to
www.mhrprecalc11.ca and follow the links.

Chapter 4 MHR 205


4.1
Graphical Solutions of Quadratic Equations
Focus on . . .
describing the relationships between the
roots of a quadratic equation, the zeros
of the corresponding quadratic function,
and the x-intercepts of the graph of the
quadratic function
solving quadratic equations by graphing
the corresponding quadratic function

Water fountains are usually


designed to give a specific
visual effect. For example, the
water fountain shown consists
of individual jets of water that
each arch up in the shape of a
parabola. Notice how the jets
of water are designed to land
precisely on the underwater
spotlights.
How can you design a water fountain ain to do this? Where must you
place the underwater lights so the jets of water land on them? What are
some of the factors to consider when designing a water fountain? How
do these factors affect the shape of the water fountain?

Investigate Solving Quadratic Equations by Graphing

Materials 1. Each water fountain jet creates a parabolic stream of water. You can
grid paper or graphing represent this curve by the quadratic function h(x) = -6(x - 1)2 + 6,
technology where h is the height of the jet of water and x is the horizontal
distance of the jet of water from the nozzle, both in metres.
h

nozzle light x

206 MHR Chapter 4


a) Graph the quadratic function h(x) = -6(x - 1)2 + 6.
b) How far from the nozzle should the underwater lights be placed?
Explain your reasoning.
2. You can control the height and horizontal distance of the jet of
water by changing the water pressure. Suppose that the quadratic
function h(x) = -x2 + 12x models the path of a jet of water at
maximum pressure. The quadratic function h(x) = -3x2 + 12x
models the path of the same jet of water at a lower pressure.
a) Graph these two functions on the same set of axes as in step 1.
b) Describe what you notice about the x-intercepts and height of
the two graphs compared to the graph in step 1.
c) Why do you think the x-intercepts of the graph are called the
zeros of the function?

Reflect and Respond


3. a) If the water pressure in the fountain must remain constant,
how else could you control the path of the jets of water?
b) Could two jets of water at constant water pressure with
different parabolic paths land on the same spot? Explain
your reasoning.

D id Yo u K n ow ?
The Dubai Fountain at the Burj Khalifa in Dubai is the largest in the world. It can
shoot about 22 000 gal of water about 500 ft into the air and features over
6600 lights and 25 colour projectors.

4.1 Graphical Solutions of Quadratic Equations MHR 207


Link the Ideas

quadratic equation You can solve a quadratic equation of the form ax 2 + bx + c = 0 by


a second-degree graphing the corresponding quadratic function, f (x) = ax 2 + bx + c. The
equation with standard solutions to a quadratic equation are called the roots of the equation. You
form ax2 + bx + c = 0, can find the roots of a quadratic equation by determining the x-intercepts
where a 0
of the graph, or the zeros of the corresponding quadratic function.
for example,
2x2 + 12x + 16 = 0 For example, you can solve the quadratic f(x)
equation 2x 2 + 2x - 12 = 0 by graphing 8
root(s) of
an equation the corresponding quadratic function,
f (x) = 2x 2 + 2x - 12. The graph shows that 4
the solution(s) to an (-3, 0)
equation the x-intercepts occur at (-3, 0) and (2, 0) (2, 0)
and have values of -3 and 2. The zeros -4 -2 0 2 4 x
zero(s) of of the function occur when f (x) = 0. So, -4
a function the zeros of the function are -3 and 2. -8
the value(s) of x for Therefore, the roots of the equation
which f(x) = 0
are -3 and 2. -12
related to the f(x) = 2x2 + 2x - 12
x-intercept(s) of the
graph of a function, f(x)
Example 1
Quadratic Equations With One Real Root
What are the roots of the equation -x 2 + 8x - 16 = 0?

Solution
To solve the equation, graph the corresponding quadratic function,
f (x) = -x 2 + 8x - 16, and determine the x-intercepts.
Method 1: Use Paper and Pencil
Create a table of values. Plot the coordinate pairs and use them to sketch
the graph of the function.
Why were these values of x chosen?
x f (x) f(x) How do you
know that there
-2 -36 x
-4 -2 0 2 4 6 8 10 is only one root
-1 -25 -4 for this quadratic
0 -16 equation?
-8
1 -9
2 -4 -12
3 -1
-16
4 0
5 -1 -20

6 -4 -24
7 -9 f(x) = -x2 + 8x - 16
-28
8 -16
9 -25 -32
10 -36

208 MHR Chapter 4


The graph meets the x-axis at the point (4, 0), the vertex of the
corresponding quadratic function.
The x-intercept of the graph occurs at (4, 0) and has a value of 4.
The zero of the function is 4.
Therefore, the root of the equation is 4.

Method 2: Use a Spreadsheet


In a spreadsheet, enter
the table of values shown.
Then, use the spreadsheets
graphing features.
The x-intercept of the graph
occurs at (4, 0) and has a
value of 4.
The zero of the function is 4.
Therefore, the root of the
equation is 4.

Method 3: Use a Graphing Calculator


Graph the function using a graphing calculator. Then, use the trace or
zero function to identify the x-intercept.
Compare the three methods.
Which do you prefer? Why?

The x-intercept of the graph occurs at (4, 0) and has a value of 4.


The zero of the function is 4.
Therefore, the root of the equation is 4.
Check for Methods 1, 2, and 3:
Substitute x = 4 into the equation -x 2 + 8x - 16 = 0.
Left Side Right Side
-x 2 + 8x - 16 0
2
= -(4) + 8(4) - 16
= -16 + 32 - 16
=0
Left Side = Right Side
The solution is correct.

Your Turn
Determine the roots of the quadratic equation x 2 - 6x + 9 = 0.

4.1 Graphical Solutions of Quadratic Equations MHR 209


Example 2
Quadratic Equations With Two Distinct Real Roots
The manager of Jasmines Fine Fashions is investigating the effect that
raising or lowering dress prices has on the daily revenue from dress
sales. The function R(x) = 100 + 15x - x 2 gives the stores revenue R, in
dollars, from dress sales, where x is the price change, in dollars. What
price changes will result in no revenue?

Solution
When there is no revenue, R(x) = 0. To determine the price changes that
result in no revenue, solve the quadratic equation 0 = 100 + 15x - x 2.
Graph the corresponding revenue function. On the What do the values
graph, the x-intercepts will correspond to the price of x that are not the
x-intercepts represent?
changes that result in no revenue.
Method 1: Use Paper and Pencil
Create a table of values. Plot the coordinate pairs and use them to sketch
the graph of the function.
Why do the values of x in the table begin with negative values?

Price Change, x Revenue, R(x) R(x)


-10 -150 R(x) = 100 + 15x - x2
160
-8 -84
120
-6 -26
-4 24 80

-2 66 40
0 100
2 126 -8 -4 0 4 8 12 16 20 x
4 144 -40
6 154
-80
8 156
10 150 -120

12 136 -160
14 114
16 84
How effective is graphing by
18 46 hand in this situation?
20 0
How do you know there are two
22 -54 roots for this quadratic equation?

The graph appears to cross the x-axis at the Why do the roots of the
points (-5, 0) and (20, 0). The x-intercepts of the equation result in no
revenue?
graph, or zeros of the function, are -5 and 20.
Therefore, the roots of the equation are -5 and 20.

210 MHR Chapter 4


Method 2: Use a Spreadsheet
In a spreadsheet, enter the table of values shown.
Then, use the spreadsheets graphing features.

The graph crosses the x-axis at the points (-5, 0) and (20, 0). The
x-intercepts of the graph, or zeros of the function, are -5 and 20.
Therefore, the roots of the equation are -5 and 20.
Method 3: Use a Graphing Calculator
Graph the revenue function using a
graphing calculator. Adjust the
window settings of the graph until
you see the vertex of the parabola
and the x-intercepts. Use the trace
or zero function to identify the
x-intercepts of the graph.
The graph crosses the x-axis at
the points (-5, 0) and (20, 0).
The x-intercepts of the graph, or zeros of the function, are -5 and 20.
Therefore, the roots of the equation are -5 and 20.
Check for Methods 1, 2, and 3:
Substitute the values x = -5 and x = 20 into the equation
0 = 100 + 15x - x 2.
Left Side Right Side Left Side Right Side
0 100 + 15x - x 2 0 100 + 15x - x 2
= 100 + 15(-5) - (-5)2 = 100 + 15(20) - (20)2
= 100 - 75 - 25 = 100 + 300 - 400
=0 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct. A dress price Why is one price change an
increase of $20 or a decrease of $5 will increase and the other a
decrease? Do both price changes
result in no revenue from dress sales. make sense? Why or why not?

4.1 Graphical Solutions of Quadratic Equations MHR 211


Your Turn
The manager at Suzies Fashion Store has determined that the function
R(x) = 600 - 6x 2 models the expected weekly revenue, R, in dollars, from
sweatshirts as the price changes, where x is the change in price, in dollars.
What price increase or decrease will result in no revenue?

Example 3
Quadratic Equations With No Real Roots
Solve 2x 2 + x = -2 by graphing.

Solution
Rewrite the equation in the form ax 2 + bx + c = 0.
2x 2 + x + 2 = 0 Why do you rewrite the equation in the form ax2 + bx + c = 0?

Graph the corresponding quadratic function f (x) = 2x 2 + x + 2.


f(x)
6

2
f(x) = 2x2 + x + 2

-4 -2 0 2 4 6 x
-2

The graph does not intersect the x-axis.


There are no zeros for this function.
Therefore, the quadratic equation has no real roots.

Your Turn
Solve 3m2 - m = -2 by graphing.

212 MHR Chapter 4


Example 4
Solve a Problem Involving Quadratic Equations
The curve of a suspension bridge cable attached between the tops of two
towers can be modelled by the function h(d) = 0.0025(d - 100)2 - 10,
where h is the vertical distance from the top of a tower to the cable and d
is the horizontal distance from the left end of the bridge, both in metres.
What is the horizontal distance between the two towers? Express your
answer to the nearest tenth of a metre.

Solution
At the tops of the towers, h(d) = 0. To determine the locations of the two
towers, solve the quadratic equation 0 = 0.0025(d - 100)2 - 10. Graph the
cable function using graphing technology. Adjust the dimensions of the
graph until you see the vertex of the parabola and the x-intercepts. Use
the trace or zero function to identify the x-intercepts of the graph.
The x-intercepts of the graph occur What does the x-axis
at approximately (36.8, 0) and represent?

(163.2, 0). The zeros of the function


are approximately 36.8 and 163.2.
Therefore, the roots of the equation
are approximately 36.8 and 163.2.
The first tower is located
approximately 36.8 m from
the left end of the bridge.
The second tower is located approximately
163.2 m from the left end of the bridge.
Subtract to determine the distance between the two towers.
163.2 - 36.8 = 126.4
The horizontal distance between the two towers is approximately
126.4 m.

Your Turn
Suppose the cable of the suspension bridge in Example 4 is modelled
by the function h(d) = 0.0025(d - 100)2 - 12. What is the horizontal
distance between the two towers? Express your answer to the nearest
tenth of a metre.

4.1 Graphical Solutions of Quadratic Equations MHR 213


Key Ideas

One approach to solving a quadratic equation of the form ax 2 + bx + c = 0,


a 0, is to graph the corresponding quadratic function, f (x) = ax 2 + bx + c.
Then, determine the x-intercepts of the graph.
The x-intercepts of the graph, or the zeros of the quadratic function,
correspond to the solutions, or roots, of the quadratic equation.
For example, you can solve x 2 - 5x + 6 = 0 by graphing f(x)

the corresponding function, f (x) = x 2 - 5x + 6, and 6


determining the x-intercepts.
4
The x-intercepts of the graph and the zeros of the
2
function are 2 and 3. So, the roots of the equation
(2, 0) (3, 0)
are 2 and 3.
-2 0 2 4 6x
Check: f(x) = x2 - 5x + 6
-2
Substitute the values x = 2 and x = 3 into the
equation x 2 - 5x + 6 = 0.
Left Side Right Side Left Side Right Side
2 2
x - 5x + 6 0 x - 5x + 6 0
= (2)2 - 5(2) + 6 = (3)2 - 5(3) + 6
= 4 - 10 + 6 = 9 - 15 + 6
=0 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct.
The graph of a quadratic function can have zero, one, or two real x-intercepts.
Therefore, the quadratic function has zero, one, or two real zeros, and
correspondingly the quadratic equation has zero, one, or two real roots.

y y y

0 x 0 x 0 x

No real x-intercepts One real x-intercept Two real x-intercepts


No real zeros One real zero Two real zeros
No real root One real root Two distinct real roots

214 MHR Chapter 4


Check Your Understanding

Practise 3. Solve each equation by graphing the


1. How many x-intercepts does each corresponding function.
quadratic function graph have? a) 0 = x 2 - 5x - 24
a) f(x) b) 0 = -2r 2 - 6r
6 c) h2 + 2h + 5 = 0
2
f(x) = x
4 d) 5x 2 - 5x = 30
e) -z2 + 4z = 4
2
f) 0 = t 2 + 4t + 10
-4 -2 0 2 4 x 4. What are the roots of each quadratic
equation? Where integral roots cannot
b) f(x) be found, estimate the roots to the
4 nearest tenth.
f(x) = -x2 - 5x - 4
a) n2 - 10 = 0
-6 -4 -2 0 2 x b) 0 = 3x 2 + 9x - 12
-4
c) 0 = -w 2 + 4w - 3
-8 d) 0 = 2d 2 + 20d + 32

-12 e) 0 = v 2 + 6v + 6
f) m2 - 10m = -21
c) f(x)
12
Apply
8 5. In a Canadian Football League game, the
path of the football at one particular
4 kick-off can be modelled using the
f(x) = x2 + 2x + 4
function h(d) = -0.02d 2 + 2.6d - 66.5,
-6 -4 -2 0 2 x where h is the height of the ball and d is
the horizontal distance from the kicking
d) f(x) teams goal line, both in yards. A value
4 of h(d) = 0 represents the height of the
ball at ground level. What horizontal
-4 0 4 8 12 16 x distance does the ball travel before it hits
-4 the ground?
-8 f(x) = 0.25x2 - 1.25x - 6 6. Two numbers have a sum of 9 and a
product of 20.
a) What single-variable quadratic equation
2. What are the roots of the corresponding in the form ax 2 + bx + c = 0 can be
quadratic equations represented by the used to represent the product of the
graphs of the functions shown in #1? two numbers?
Verify your answers.
b) Determine the two numbers by graphing
the corresponding quadratic function.

4.1 Graphical Solutions of Quadratic Equations MHR 215


7. Two consecutive even integers have a 10. A skateboarder jumps off a ledge
product of 168. at a skateboard park. His path
a) What single-variable quadratic equation is modelled by the function
in the form ax 2 + bx + c = 0 can be h(d) = -0.75d 2 + 0.9d + 1.5, where h
used to represent the product of the is the height above ground and d is the
two numbers? horizontal distance the skateboarder
travels from the ledge, both in metres.
b) Determine the two numbers by graphing
the corresponding quadratic function. a) Write a quadratic equation to represent
the situation when the skateboarder
8. The path of the stream of water
lands.
coming out of a fire hose can be
approximated using the function b) At what distance from the base of
h(x) = -0.09x 2 + x + 1.2, where h the ledge will the skateboarder land?
is the height of the water stream and Express your answer to the nearest
x is the horizontal distance from the tenth of a metre.
firefighter holding the nozzle, both 11. milie Heymans is a three-time
in metres. Canadian Olympic diving medallist.
a) What does the equation Suppose that for a dive off the 10-m
-0.09x 2 + x + 1.2 = 0 represent tower, her height, h, in metres, above
in this situation? the surface of the water is given by the
function h(d) = -2d 2 + 3d + 10, where
b) At what maximum distance from the
d is the horizontal distance from the end
building could a firefighter stand and
of the tower platform, in metres.
still reach the base of the fire with
the water? Express your answer to the a) Write a quadratic equation to represent
nearest tenth of a metre. the situation when milie enters
the water.
c) What assumptions did you make when
solving this problem? b) What is milies horizontal distance
from the end of the tower platform
9. The HSBC Celebration of Light
when she enters the water? Express
is an annual pyro-musical
your answer to the nearest
fireworks competition that
tenth of a metre.
takes place over English Bay
in Vancouver. The fireworks
are set off from a barge so they
land on the water. The path of
a particular fireworks rocket
is modelled by the function
h(t) = -4.9(t - 3)2 + 47, where
h is the rockets height above
the water, in metres, at time, t,
in seconds.
a) What does the equation
0 = -4.9(t - 3)2 + 47
represent in this situation?
D i d You K n ow ?
b) The fireworks rocket stays
lit until it hits the water. milie Heymans, from Montral, Qubec, is only the
For how long is it lit, to the fth Canadian to win medals at three consecutive
nearest tenth of a second? Olympic Games.

216 MHR Chapter 4


12. Matthew is investigating the old 14. The height of a circular
Borden Bridge, which spans the North arch is represented by r
Saskatchewan River about 50 km west of 4h2 - 8hr + s2 = 0, where h
Saskatoon. The three parabolic arches of h is the height, r is the r
the bridge can be modelled using quadratic radius, and s is the span
s
functions, where h is the height of the of the arch, all in feet.
arch above the bridge deck and x is the a) How high must an arch be to have a
horizontal distance of the bridge deck span of 64 ft and a radius of 40 ft?
from the beginning of the first arch, both
b) How would this equation change if all the
in metres.
measurements were in metres? Explain.
First arch:
15. Two new hybrid vehicles accelerate
h(x) = -0.01x 2 + 0.84x
at different rates. The Ultra Ranges
Second arch:
acceleration can be modelled by the
h(x) = -0.01x 2 + 2.52x - 141.12
function d(t) = 1.5t 2, while the Edisons
Third arch:
can be modelled by the function
h(x) = -0.01x 2 + 4.2x - 423.36
d(t) = 5.4t 2, where d is the distance, in
a) What are the zeros of each quadratic metres, and t is the time, in seconds. The
function? Ultra Range starts the race at 0 s. At what
b) What is the significance of the zeros in time should the Edison start so that both
this situation? cars are at the same point 5 s after the race
c) What is the total span of the starts? Express your answer to the nearest
Borden Bridge? tenth of a second.

D i d You K n ow ?

A hybrid vehicle uses two or more distinct


power sources. The most common hybrid uses a
combination of an internal combustion engine and
an electric motor. These are called hybrid electric
vehicles or HEVs.

Create Connections
16. Suppose the value of a quadratic function
is negative when x = 1 and positive when
x = 2. Explain why it is reasonable to
assume that the related equation has a root
between 1 and 2.
17. The equation of the axis of symmetry of
a quadratic function is x = 0 and one of
the x-intercepts is -4. What is the other
x-intercept? Explain using a diagram.
Extend
13. For what values of k does the equation 18. The roots of the quadratic equation
x 2 + 6x + k = 0 have 0 = x 2 - 4x - 12 are 6 and -2. How can
you use the roots to determine the vertex
a) one real root?
of the graph of the corresponding function?
b) two distinct real roots?
c) no real roots?

4.1 Graphical Solutions of Quadratic Equations MHR 217


4.2
Factoring Quadratic Equations
Focus on . . .
factoring a variety of quadratic expressions
factoring to solve quadratic equations
solving problems involving quadratic
equations

Football, soccer, basketball, and


volleyball are just a few examples
of sports that involve throwing,
kicking, or striking a ball. Each time
a ball or projectile sails through the
air, it follows a trajectory that can be
modelled with a quadratic function.
Each of these sports is played on a
rectangular playing area. The playing
area for each sport can be modelled
by a quadratic equation.

Investigate Solving Quadratic Equations by Factoring

Materials 1. For womens indoor competition, the length of the volleyball court
grid paper or graphing is twice its width. If x represents the width, then 2x represents the
technology length. The area of the court is 162 m2.
a) Write a quadratic equation in standard form, A(x) = 0, to represent
the area of the court.
b) Graph the corresponding quadratic function. How many
x-intercepts are there? What are they?
c) From your graph, what are the roots of the quadratic equation
you wrote in part a)? How do you know these are the roots of
the equation?
d) In this context, are all the roots acceptable? Explain.
2. a) Factor the left side of the quadratic equation you wrote in step 1a).
b) Graph the corresponding quadratic function in factored form.
Compare your graph to the graph you created in step 1b).
c) How is the factored form of the equation related to the x-intercepts
of the graph?
d) How can you use the x-intercepts of a graph, x = r and x = s, to
write a quadratic equation in standard form?

218 MHR Chapter 4


3. For mens sitting volleyball, a Paralympic sport,
the length of the court is 4 m more than the
width. The area of the court is 60 m2.
a) If x represents the width, write a quadratic
equation in standard form to represent the
area of the court.
b) Graph the corresponding quadratic
function. How many x-intercepts are there?
What are they?
4. a) Use the x-intercepts, x = r and x = s, of
your graph in step 3 to write the quadratic
equation (x - r)(x - s) = 0.
b) Graph the corresponding quadratic function. Compare your graph
to the graph you created in step 3.

Reflect and Respond


5. How does the factored form of a quadratic equation relate to the D i d You K n ow?
x-intercepts of the graph, the zeros of the quadratic function, and the
Volleyball is the
roots of the equation? worlds number two
6. Describe how you can factor the quadratic equation 0 = x 2 - 5x - 6 participation sport.
to find the roots. Which sport do you
think is number one?
7. The roots of a quadratic equation are 3 and -5. What is a
possible equation?

Link the Ideas

Factoring Quadratic Expressions


To factor a trinomial of the form ax 2 + bx + c, where a 0, first factor
out common factors, if possible.
For example,
4x 2 - 2x - 12 = 2(2x 2 - x - 6)
= 2(2x 2 - 4x + 3x - 6)
= 2[2x(x - 2) + 3(x - 2)]
= 2(x - 2)(2x + 3)
You can factor perfect square trinomials of the forms (ax)2 + 2abx + b2
and (ax)2 - 2abx + b2 into (ax + b)2 and (ax - b)2, respectively.
For example,
4x 2 + 12x + 9 = (2x + 3)(2x + 3) 9x 2 - 24x + 16 = (3x - 4)(3x - 4)
= (2x + 3)2 = (3x - 4)2
You can factor a difference of squares, (ax)2 - (by)2, into (ax - by)(ax + by).
For example,
_4 x 2 - 16y 2 = _2 x - 4y _2 x + 4y
( )( )
9 3 3
4.2 Factoring Quadratic Equations MHR 219
Factoring Polynomials Having a Quadratic Pattern
You can extend the patterns established for factoring trinomials and
a difference of squares to factor polynomials in quadratic form. You
can factor a polynomial of the form a(P)2 + b(P) + c, where P is any
expression, as follows:
Treat the expression P as a single variable, say r, by letting r = P .
Factor as you have done before.
Replace the substituted variable r with the expression P .
Simplify the expression.
For example, in 3(x + 2)2 - 13(x + 2) + 12, substitute r for x + 2
and factor the resulting expression, 3r 2 - 13r + 12.
3r 2 - 13r + 12 = (3r - 4)(r - 3)
Once the expression in r is factored, you can substitute x + 2 back
in for r.
The resulting expression is
[3(x + 2) - 4](x + 2 - 3) = (3x + 6 - 4)(x - 1)
= (3x + 2)(x - 1)
You can factor a polynomial in the form of a difference of squares, as
P 2 - Q 2 = (P - Q)(P + Q) where P and Q are any expressions.
For example,
(3x + 1)2 - (2x - 3)2 = [(3x + 1) - (2x - 3)][(3x + 1) + (2x - 3)]
= (3x + 1 - 2x + 3)(3x + 1 + 2x - 3)
= (x + 4)(5x - 2)

Example 1
Factor Quadratic Expressions
Factor.
a) 2x 2 - 2x - 12
_1
b) x 2 - x - 3
4
c) 9x 2 - 0.64y 2

Solution
a) Method 1: Remove the Common Factor First
Factor out the common factor of 2.
2x 2 - 2x - 12 = 2(x 2 - x - 6)
Find two integers with a product of -6 and a sum of -1.
Factors of -6 Product Sum
1, -6 -6 -5
2, -3 -6 -1
3, -2 -6 1
6, -1 -6 5

220 MHR Chapter 4


The factors are x + 2 and x - 3.
2x 2 - 2x - 12 = 2(x 2 - x - 6)
= 2(x + 2)(x - 3)

Method 2: Factor the Trinomial First by Grouping


To factor, 2x 2 - 2x - 12, find two integers with
a product of (2)(-12) = -24
a sum of -2
The two integers are -6 and 4.
Write -2x as the sum -6x + 4x. D i d You K n ow?
Then, factor by grouping. When the leading
2
2x - 2x - 12 = 2
2x - 6x + 4x - 12 coefcient of a
quadratic polynomial
= 2x(x - 3) + 4(x - 3)
is not an integer, you
= (2x + 4)(x - 3) Factor out the common
can factor out the
= 2(x + 2)(x - 3) factor of 2.
rational number as a

b) Factor out the common factor of _1 first. How does factoring out
common factor.
4 _1 For example,
_1 x 2
-x-3=_
1 (x 2 - 4x - 12) the common factor of
help you?
4 _1 x2 - 5x + 1
4 4 2
=_ _
1 (x + 2)(x - 6) How can you determine 1
the factors for the = (x2 - 10x + 2)
4 2
trinomial x2 - 4x - 12? What do you need
c) The binomial 9x 2 - 0.64y 2 is a difference
_1
to multiply by to
of squares. 2
get 5?
The first term is a perfect square: (3x)2
The second term is a perfect square: (0.8y)2 What do you need
9x 2 - 0.64y 2 = (3x)2 - (0.8y)2 _1
to multiply by to
2
= (3x - 0.8y)(3x + 0.8y) get 1?

Your Turn
Factor.
a) 3x 2 + 3x - 6
b)
_1 x
2
-x-4
2
c) 0.49j 2 - 36k 2

4.2 Factoring Quadratic Equations MHR 221


Example 2
Factor Polynomials of Quadratic Form
Factor each polynomial.
a) 12(x + 2)2 + 24(x + 2) + 9
b) 9(2t + 1)2 - 4(s - 2)2

Solution
a) 12(x + 2)2 + 24(x + 2) + 9

Treat the term x + 2 as a single variable.


Substitute r = x + 2 into the quadratic expression and factor as usual.
12(x + 2)2 + 24(x + 2) + 9 Substitute r for x + 2.
= 12r 2 + 24r + 9
= 3(4r 2 + 8r + 3) Factor out the common factor of 3.
= 3(4r 2 + 2r + 6r + 3) Find two integers with a product of (4)(3) = 12
and a sum of 8. The integers 2 and 6 work.
= 3[(4r 2 + 2r) + (6r + 3)] Factor by grouping.
= 3[2r(2r + 1) + 3(2r + 1)]
= 3(2r + 1)(2r + 3)
= 3[2(x + 2) + 1][2(x + 2) + 3] Replace r with x + 2.
= 3(2x + 4 + 1)(2x + 4 + 3) Simplify.
= 3(2x + 5)(2x + 7)
The expression 12(x + 2)2 + 24(x + 2) + 9 in factored form
is 3(2x + 5)(2x + 7).

b) 9(2t + 1)2 - 4(s - 2)2


Each term of the polynomial is a perfect square.
Therefore, this is a difference of squares of the form
P 2 - Q 2 = (P - Q)(P + Q) where P represents 3(2t + 1) and
Q represents 2(s - 2).

Use the pattern for factoring a difference of squares.


9(2t + 1)2 - 4(s - 2)2
= [3(2t + 1) - 2(s - 2)][3(2t + 1) + 2(s - 2)]
= (6t + 3 - 2s + 4)(6t + 3 + 2s - 4)
= (6t - 2s + 7)(6t + 2s - 1)
The expression 9(2t + 1)2 - 4(s - 2)2 in factored form is
(6t - 2s + 7)(6t + 2s - 1).

Your Turn
Factor each polynomial.
a) -2(n + 3)2 + 12(n + 3) + 14
b) 4(x - 2)2 - 0.25(y - 4)2

222 MHR Chapter 4


Solving Quadratic Equations by Factoring
Some quadratic equations that have real-number solutions can be
factored easily.
The zero product property states that if the product of two real
numbers is zero, then one or both of the numbers must be zero.
This means that if de = 0, then at least one of d and e is 0.
The roots of a quadratic equation occur when the product of the
factors is equal to zero. To solve a quadratic equation of the form
ax 2 + bx + c = 0, a 0, factor the expression and then set either
factor equal to zero. The solutions are the roots of the equation.
For example, rewrite the quadratic equation 3x 2 - 2x - 5 = 0 in
factored form.
3x 2 - 2x - 5 = 0
(3x - 5)(x + 1) = 0
3x - 5 = 0 or x + 1 = 0
x=_ 5 x = -1
3
The roots are _
5 and -1.
3

Example 3
Solve Quadratic Equations by Factoring
Determine the roots of each quadratic equation. Verify your solutions.
a) x 2 + 6x + 9 = 0 b) x2 + 4x - 21 = 0 c) 2x 2 - 9x - 5 = 0

Solution
a) To solve x2 + 6x + 9 = 0, determine the factors and then solve for x.
x2 + 6x + 9 = 0 This is a perfect square trinomial.
(x + 3)(x + 3) = 0
(x + 3) = 0 or (x + 3) = 0 For the quadratic equation to equal 0, one of
x = -3 x=-3 the factors must equal 0.

This equation has two equal real roots. Since both roots are equal, the
roots may be viewed as one distinct real root. Check by substituting
the solution into the original quadratic equation.

For x = -3:
Left Side Right Side
x2 + 6x + 9 0
= (-3)2 + 6(-3) + 9
= 9 - 18 + 9
=0
Left Side = Right Side
The solution is correct. The roots of the equation are -3 and -3, or
just -3.

4.2 Factoring Quadratic Equations MHR 223


b) To solve x2 + 4x - 21 = 0, first determine the factors, and then solve
for x.
x2 + 4x - 21 = 0
Two integers with a product of -21
(x - 3)(x + 7) = 0 and a sum of 4 are -3 and 7.
Set each factor equal to zero and solve for x.
x - 3 = 0 or x + 7 = 0
x=3 x = -7
The equation has two distinct real roots. Check by substituting each
solution into the original quadratic equation.
For x = 3: For x = -7:
Left Side Right Side Left Side Right Side
x2 + 4x - 21 0 x2 + 4x - 21 0
= 32 + 4(3) - 21 = (-7)2 + 4(-7) - 21
= 9 + 12 - 21 = 49 - 28 - 21
=0 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct. The roots of the quadratic equation are
3 and -7.

c) To solve 2x 2 - 9x - 5 = 0, first determine the factors, and then solve


for x.
Method 1: Factor by Inspection
2x 2 is the product of the first terms, and -5 is the product of the
second terms.
2x 2 - 9x - 5 = (2x + )(x + )
The last term, -5, is negative. So, one factor of -5 must be negative.
Try factor pairs of -5 until the sum of the products of the outer and
inner terms is -9x.

Factors of -5 Product Middle Term


(2x - 5)(x + 1) = 2x 2 + 2x - 5x - 5 -3x is not the
-5, 1
= 2x 2 - 3x - 5 correct middle term.

(2x + 1)(x - 5) = 2x 2 - 10x + 1x - 5


1, -5 Correct.
= 2x 2 - 9x - 5

Therefore, 2x 2 - 9x - 5 = (2x + 1)(x - 5).


2x 2 - 9x - 5 = 0
(2x + 1)(x - 5) = 0
Set each factor equal to zero and solve for x.
2x + 1 = 0 or x - 5 = 0
2x = -1 x=5
x=- _
1
2
The roots are - _
1 and 5.
2

224 MHR Chapter 4


Method 2: Factor by Grouping
Find two integers with a product of (2)(-5) = -10 and a sum of -9.

Factors of -10 Product Sum


1, -10 -10 -9
2, -5 -10 -3
5, -2 -10 3
10, -1 -10 9

Write -9x as x - 10x. Then, factor by grouping.


2x 2 - 9x - 5 = 0
2
2x + x - 10x - 5 = 0
(2x 2 + x) + (-10x - 5) = 0
x(2x + 1) - 5(2x + 1) = 0
(2x + 1)(x - 5) = 0
Set each factor equal to zero and solve for x.
2x + 1 = 0 or x - 5 = 0
2x = -1 x=5
x=- _
1
2
The roots are - _1 and 5.
2
Check for both Methods 1 and 2:
The equation has two distinct real roots. Check by substituting each
root into the original quadratic equation.

For x = - _ 1: For x = 5:
2
Left Side Right Side Left Side Right Side
2 2
2x - 9x - 5 0 2x - 9x - 5 0
=2 -( )_
1 2
-9 - _
1
( ) -5 = 2(5)2 - 9(5) - 5
2 2 = 50 - 45 - 5
=2 _ 1 +_
( ) 9 -5 =0
4 2
=_1 +_ 9 -_ 10 Left Side = Right Side
2 2 2
=0
Left Side = Right Side
Both solutions are correct.
The roots of the quadratic equation are - _
1 and 5.
2

Your Turn
Determine the roots of each quadratic equation.
a) x 2 - 10x + 25 = 0
b) x 2 - 16 = 0
c) 3x 2 - 2x - 8 = 0

4.2 Factoring Quadratic Equations MHR 225


Example 4
Apply Quadratic Equations

Did Yo u Know ? Dock jumping is an exciting dog event in which dogs compete for the
longest jumping distance from a dock into a body of water. The path of
Dock jumping
a Jack Russell terrier on a particular jump can be approximated by the
competitions started
in 2000 and have quadratic function h(d) = - _ 3 d2 + _
11 d + 2, where h is the height above
10 10
spread throughout
the surface of the water and d is the horizontal distance the dog travels
the world, with events
from the base of the dock, both in feet. All measurements are taken from
in Canada, United
States, Great Britain, the base of the dogs tail. Determine the horizontal distance of the jump.
Japan, Australia, and
Germany. The current
world record holder
jumped 29 ft 1 in.
(8.86 m).

Solution
When the dog lands in the water, the dogs height above the surface
is 0 m. To solve this problem, determine the roots of the quadratic
equation - _ 3 d2 + _
11 d + 2 = 0.
10 10

-_ 3 d2 + _11 d + 2 = 0
10 10
-_1 (3d 2 11d 20) = 0 Factor out the common factor of - _
1 .
10 10

-_1 (3d + 4)(d 5) = 0


10
3d + 4 = 0 or d5=0 Solve for d to determine the roots of the equation.
3d = 4 d=5 Why does the factor - _ 1 neither result in a root nor
10
d = -_4 affect the other roots of the equation?
3

226 MHR Chapter 4


Since d represents the horizontal distance of the dog from the
base of the dock, it cannot be negative.
So, reject the root - _
4.
3
Check the solution by substituting d = 5 into the original
quadratic equation.
For d = 5:
Left Side Right Side
-_ 3 d2 + _ 11 d + 2 0
10 10
= -_ 3 (5)2 + _11 (5) + 2
10 10
= -_ 15 + _ 11 + _ 4
2 2 2
=0
Left Side = Right Side
The solution is correct.
The dog travels a horizontal distance of 5 ft.

Your Turn
A waterslide ends with the slider dropping into a deep pool of
water. The path of the slider after leaving the lower end of the
slide can be approximated by the quadratic function
h(d) = - _1 d2 - _
1 d + 2, where h is the height above the
6 6
surface of the pool and d is the horizontal distance the slider
travels from the lower end of the slide, both in feet. What is
the horizontal distance the slider travels before dropping into
the pool after leaving the lower end of the slide?

4.2 Factoring Quadratic Equations MHR 227


Example 5
Write and Solve a Quadratic Equation
The length of an outdoor lacrosse
field is 10 m less than twice the
width. The area of the field is
6600 m2. Determine the dimensions
of an outdoor lacrosse field.

Did Yo u Know ?
Solution
Lacrosse is one of the
oldest team sports
Let w represent the width of the field.
d
in North America. Then, the length of the field is 2w - 10.
The game of lacrosse
Use the area formula.
was developed more
A = lw
than 500 years ago
and is referred to 6600 = (2w - 10)(w)
as The Creators 6600 = 2w 2 - 10w
Game. It is based 0 = 2w 2 - 10w - 6600
on the First Nations 0 = 2(w 2 - 5w - 3300)
game baggataway. 0 = w 2 - 5w - 3300
Traditional games 0 = (w - 60)(w + 55)
could go on for days.
Hundreds of players w - 60 = 0 or w + 55 = 0
from different tribes w = 60 w = -55
took turns playing.
Today, amateur and Since the width of the field cannot be negative, w = -55 is
professional teams rejected. The width of the field is 60 m. The length of the field
throughout North is 2(60) - 10 or 110 m.
America play lacrosse.
Check:
The area of the field is (60)(110) or 6600 m2.

Your Turn
The area of a rectangular Ping-
Pong table is 45 ft2. The length
is 4 ft more than the width.
What are the dimensions of
the table?

228 MHR Chapter 4


Key Ideas

You can solve some quadratic equations by factoring.


If two factors of a quadratic equation have a product of zero, then by the
zero product property one of the factors must be equal to zero.
To solve a quadratic equation by factoring, first write the equation in the
form ax2 + bx + c = 0, and then factor the left side. Next, set each factor
equal to zero, and solve for the unknown.
For example,
x 2 + 8x = -12
2
x + 8x + 12 = 0
(x + 2)(x + 6) = 0
x+2=0 or x + 6 = 0
x = -2 x = -6
The solutions to a quadratic equation are called the roots of the equation.
You can factor polynomials in quadratic form.
 Factor trinomials of the form a(P )2 + b(P ) + c, where a 0 and P is any
expression, by replacing the expression for P with a single variable. Then
substitute the expression for P back into the factored expression. Simplify the
final factors, if possible.
For example, factor 2(x + 3)2 - 11(x + 3) + 15 by letting r = x + 3.
2(x + 3)2 - 11(x + 3) + 15 = 2r 2 - 11r + 15
= 2r 2 - 5r - 6r + 15
= (2r 2 - 5r) + (-6r + 15)
= r(2r - 5) - 3(2r - 5)
= (2r - 5)(r - 3)
= [2(x + 3) - 5][(x + 3) - 3]
= (2x + 1)(x)
= x(2x + 1)
 Factor a difference of squares, P 2 - Q 2, where P and Q are any expressions,
as [P - Q][P + Q].

Check Your Understanding

Practise 2. Factor completely.


1. Factor completely. a) 3y 2 + 4y - 7
a) x 2 + 7x + 10 b) 8k 2 - 6k - 5
b) 5z2 + 40z + 60 c) 0.4m2 + 0.6m - 1.8
c) 0.2d 2 - 2.2d + 5.6

4.2 Factoring Quadratic Equations MHR 229


3. Factor completely. 9. Determine the roots of each quadratic
a) x 2 + x - 20 equation. Verify your answers.
b) x 2 - 12x + 36 a) k 2 - 5k = 0

c) _1 x
2
+ 2x + 3 b) 9x 2 = x + 8
4
d) 2x 2 + 12x + 18 c) _8 t + 5 = - _1 t 2
3 3
4. Factor each expression.
d) _
25 y2 - 9 = 0
a) 4y 2 - 9x 2
49
e) 2s2 - 4s = 70
b) 0.36p2 - 0.49q2
f) 4q2 - 28q = -49
c) _1 s
2
-_
9t 2
4 25 10. Solve each equation.
d) 0.16t 2 - 16s2 a) 42 = x 2 - x
5. Factor each expression. b) g2 = 30 - 7g
a) (x + 2)2 - (x + 2) - 42 c) y 2 + 4y = 21
b) 6(x 2 - 4x + 4)2 + (x 2 - 4x + 4) - 1 d) 3 = 6p2 - 7p
c) (4j - 2)2 - (2 + 4j)2 e) 3x 2 + 9x = 30
6. What are the factors of each expression? f) 2z2 = 3 - 5z
a) 4(5b - 3)2 + 10(5b - 3) - 6
b) 16(x 2 + 1)2 - 4(2x)2 Apply
11. A rectangle has dimensions x + 10 and
_1
c) - (2x)2 + 25(2y3)2 2x - 3, where x is in centimetres. The
4
7. Solve each factored equation. area of the rectangle is 54 cm2.
a) (x + 3)(x + 4) = 0

(
b) (x - 2) x + _1 ) = 0 2x - 3
2
c) (x + 7)(x - 8) = 0
d) x(x + 5) = 0 x + 10

e) (3x + 1)(5x - 4) = 0 a) What equation could you use to


f) 2(x - 4)(7 - 2x) = 0 determine the value of x?

8. Solve each quadratic equation by factoring. b) What is the value of x?


Check your answers. 12. An osprey, a fish-eating bird of prey,
a) 10n2 - 40 = 0 dives toward the water to catch a
salmon. The height, h, in metres, of the
b) _1 x
2
+_5x + 1 = 0
osprey above the water t seconds after it
4 4
c) 3w 2 + 28w + 9 = 0 begins its dive can be approximated by
the function h(t) = 5t 2 - 30t + 45.
d) 8y 2 - 22y + 15 = 0
a) Determine the time it takes for the
e) d 2 + _5 d + _3 = 0 osprey to reach a height of 20 m.
2 2
2
f) 4x - 12x + 9 = 0 b) What assumptions did you make?
Are your assumptions reasonable?
Explain.

230 MHR Chapter 4


13. A flare is launched from a boat. The 16. Ted popped a baseball straight up with
height, h, in metres, of the flare above an initial upward velocity of 48 ft/s.
the water is approximately modelled by The height, h, in feet, of the ball above
the function h(t) = 150t - 5t 2, where the ground is modelled by the function
t is the number of seconds after the flare h(t) = 3 + 48t - 16t 2. How long was
is launched. the ball in the air if the catcher catches
a) What equation could you use to the ball 3 ft above the ground? Is your
determine the time it takes for the flare answer reasonable in this situation?
to return to the water? Explain.
b) How many seconds will it take for the
flare to return to the water?

D i d You K n ow ?

Many Canadians have made a positive impact on


Major League Baseball. Players such as Larry Walker
of Maple Ridge, British Columbia, Jason Bay of Trail,
British Columbia, and Justin Morneau of Westminster,
British Columbia have had very successful careers in
baseballs highest league.

17. A rectangle with area of 35 cm2 is formed


by cutting off strips of equal width from a
rectangular piece of paper.

14. The product of two consecutive even x


integers is 16 more than 8 times the
smaller integer. Determine the integers. x x
7 cm
15. The area of a square is tripled by adding
10 cm to one dimension and 12 cm to
x
the other. Determine the side length of
the square. 9 cm

a) What is the width of each strip?


b) What are the dimensions of the
new rectangle?

4.2 Factoring Quadratic Equations MHR 231


18. Without factoring, state if the binomial is 24. An 18-m-tall tree is broken during a
a factor of the trinomial. Explain why or severe storm, as shown. The distance
why not. from the base of the trunk to the point
a) x2 - 5x - 36, x - 5 where the tip touches the ground is
12 m. At what height did the tree break?
b) x2 - 2x - 15, x + 3
c) 6x2 + 11x + 4, 4x + 1
d) 4x2 + 4x - 3, 2x - 1
19. Solve each equation.
a) x(2x - 3) - 2(3 + 2x) = -4(x + 1)
b) 3(x - 2)(x + 1) - 4 = 2(x - 1)2
20. The hypotenuse of
a right triangle
12 m
measures 29 cm. One
x 29 cm
leg is 1 cm shorter than 25. The pressure difference, P, in newtons
the other. What are the per square metre, above and below an
lengths of the legs? airplane wing is described by the formula
x-1 P= _ 1 d (v ) 2 - _
( ) 1 d (v ) 2, where d is the
( )
2 1 2 2

21. A field is in the shape of a right triangle. density of the air, in kilograms per cubic
The fence around the perimeter of the metre; v1 is the velocity, in metres per
field measures 40 m. If the length of the second, of the air passing above; and v2 is
hypotenuse is 17 m, find the length of the the velocity, in metres per second, of the
other two sides. air passing below. Write this formula in
factored form.
22. The width of the top of a notebook
computer is 7 cm less than the length. The 26. Carlos was asked to factor the trinomial
surface area of the top of the notebook is 6x 2 - 16x + 8 completely. His work is
690 cm2. shown below.
a) Write an equation to represent the Carloss solution:
surface area of the top of the notebook 6x 2 - 16x + 8
computer. = 6x 2 - 12x - 4x + 8
= 6x(x - 2) - 4(x - 2)
b) What are the dimensions of the top of
= (x - 2)(6x - 4)
the computer?
Is Carlos correct? Explain.
23. Stephan plans to build a uniform walkway
around a rectangular flower bed that is 27. Factor each expression.
20 m by 40 m. There is enough material a) 3(2z + 3)2 - 9(2z + 3) - 30
to make a walkway that has a total area of b) 16(m2 - 4)2 - 4(3n)2
700 m2. What is the width of the walkway?
c) _1 y
-_ 1 yx + _
2 1 x2
9 3 4
x
d) -28 w + _ + 7 3w - _
2 2 1 2

x x 3 ( ) 3 ( )
20 m
40 m Extend
x 28. A square has an area of
(9x 2 + 30xy + 25y 2) square
centimetres. What is an expression
for the perimeter of the square?

232 MHR Chapter 4


29. Angela opened a surf shop in Tofino, Create Connections
British Columbia. Her accountant models 30. Write a quadratic equation in standard
her profit, P, in dollars, with the function form with the given root(s).
P(t) = 1125(t - 1)2 - 10 125, where t is the a) -3 and 3
number of years of operation. Use graphing
b) 2
or factoring to determine how long it will
take for the shop to start making a profit. c) _2 and 4
3
d) _3 and - _1
5 2
31. Create an example of a quadratic
equation that cannot be solved by
factoring. Explain why it cannot
be factored. Show the graph of the
corresponding quadratic function and
show where the roots are located.
32. You can use the difference of squares
pattern to perform certain mental math
Pete Devries shortcuts. For example,
81 - 36 = (9 - 6)(9 + 6)
D id Yo u K n ow ? = (3)(15)
Pete Devries was the rst Canadian to win an = 45
international surng competition. In 2009, he a) Explain how this strategy works.
outperformed over 110 world-class surfers to
When can you use it?
win the ONeill Cold Water Classic Canada held in
Tono, British Columbia. b) Create two examples to illustrate
the strategy.

Project Corner Avalanche Safety

Experts use avalanche control all over the world above highways, ski resorts,
railroads, mining operations, and utility companies, and anywhere else that
may be threatened by avalanches.
Avalanche control is the intentional triggering of avalanches. People are cleared
away to a safe distance, then experts produce more frequent, but smaller,
avalanches at controlled times.
Because avalanches tend to occur in the same zones and under certain
conditions, avalanche experts can predict when avalanches are likely to occur.
Charges are delivered by launchers, thrown out of helicopters, or delivered
above the avalanche starting zones by an avalanche control expert on skis.
What precautions would avalanche control experts need to take to ensure
public safety?

4.2 Factoring Quadratic Equations MHR 233


4.3
Solving Quadratic Equations
by Completing the Square
Focus on . . .
solving quadratic equations by completing the square

Rogers Pass gets up to 15 m of snow per year. Because of the


steep mountains, over 130 avalanche paths must be monitored
during the winter. To keep the Trans-Canada Highway open,
the Royal Canadian Artillery uses 105-mm howitzers to create
controlled avalanches. The Artillery must aim the howitzer
accurately to operate it safely. Suppose that the quadratic
function that approximates the trajectory of a shell fired by a
howitzer at an angle of 45 is h(x) = - _1 x 2 + 2x + _1 , where
5 20
h is the height of the shell and x is the horizontal distance
from the howitzer to where the shell lands, both in kilometres.
How can this function be used to determine where to place the
howitzer to fire at a specific spot on the mountainside?

Investigate Solving Quadratic Equations by Completing the Square

Materials Sometimes factoring quadratic equations is not practical. In Chapter 3,


grid paper, graphing you learned how to complete the square to analyse and graph quadratic
calculator, or computer functions. You can complete the square to help solve quadratic equations
with graphing software 1 x2 + 2x + _
such as - _ 1 = 0.
5 20
1. Graph the function f (x) = - _ x2 + 2x + _ .
1 1
5 20
2. What are the x-intercepts of the graph? How accurate are your
answers? Why might it be important to determine more accurate
zeros for the function?
3. a) Rewrite the function in the form h(x) = a(x - p)2 + q by
completing the square.
b) Set h(x) equal to zero. Solve for x. Express your answers as
exact values.

Reflect and Respond


4. What are the two roots of the quadratic equation for projectile
motion, 0 = - _ 1 x 2 + 2x + _1 ? What do the roots represent in
5 20
this situation?

234 MHR Chapter 4


5. To initiate an avalanche, the howitzer crew must aim the shell
up the slope of the mountain. The shot from the howitzer lands
750 m above where the howitzer is located. How could the crew
determine the horizontal distance from the point of impact at
which the howitzer must be located? Explain your reasoning.
Calculate the horizontal distances involved in this scenario.
Include a sketch of the path of the projectile.
6. At which horizontal distance from the point of impact would
you locate the howitzer if you were in charge of setting off a
controlled avalanche? Explain your reasoning.

D id Yo u K n ow ?

Parks Canada operates the worlds largest mobile avalanche control program to keep the
Trans-Canada Highway and the Canadian Pacic Railway operating through Rogers Pass.
Taking slope angle
measurement.

Link the Ideas

You can solve quadratic equations of the form ax 2 + bx + c = 0, D i d You K n ow?


where b = 0, or of the form a(x - p)2 + q = 0, where a 0, that have
Around 830 C.E., Abu
real-number solutions by isolating the squared term and taking the square Jafar Muhammad ibn
root of both sides. The square root of a positive real number can be Musa al-Khwarizmi
positive or negative, so there are two possible solutions to these equations. wrote Hisab al-jabr
wal-muqabala. The
To solve x 2 = 9, take the square root of both sides.
word al-jabr from
x 2 = 9 __
___ this title is the basis
x 2 = 9
Read as 3 is a solution to the equation because (3)(3) = 9. of the word we use
x = 3 plus or minus. -3 is a solution to the equation because (-3)(-3) = 9. today, algebra. In his
To solve (x - 1)2 - 49 = 0, isolate the squared term and take the square book, al-Khwarizmi
describes how to
root of both sides.
solve a quadratic
(x - 1)2 - 49 = 0 equation by
(x - 1)2 = 49 completing the square.
x-1 = 7
x = 17
We b Link
x=1+7 or x=1-7
x=8 x = -6 To learn
earn more ab
about
al-Khwarizmi, go to
Check: www.mhrprecalc11.ca
and follow the links.
Substitute x = 8 and x = -6 into the original equation.
Left Side Right Side Left Side Right Side
(x - 1)2 - 49 0 (x - 1)2 - 49 0
2 2
= (8 - 1) - 49 = (-6 - 1) - 49
= 72 - 49 = (-7)2 - 49
= 49 - 49 = 49 - 49
=0 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct. The roots are 8 and -6.
4.3 Solving Quadratic Equations by Completing the Square MHR 235
Many quadratic equations cannot be solved by factoring. In addition,
graphing the corresponding functions may not result in exact solutions.
You can write a quadratic function expressed in standard form,
y = ax 2 + bx + c, in vertex form, y = a(x - p)2 + q, by completing
the square. You can also use the process of completing the square to
determine exact solutions to quadratic equations.

Example 1
Write and Solve a Quadratic Equation by Taking the Square Root
A wide-screen television has a diagonal measure of 42 in. The width of
the screen is 16 in. more than the height. Determine the dimensions of
the screen, to the nearest tenth of an inch.
Solution
Draw a diagram. Let h represent the
height of the screen. Then, h + 16
represents the width of the screen.

42 in.
h

h + 16
Use the Pythagorean Theorem.
h 2 + (h + 16)2 = 422
2 2
h + (h + 32h + 256) = 1764
2h 2 + 32h + 256 = 1764
2h 2 + 32h = 1508
h 2 + 16h = 754 Isolate the variable terms on the left side.
2
h + 16h + 64 = 754 + 64 Add the square of half the coefficient of h to
both sides.
(h + 8)2 = 818 Factor the perfect square trinomial on the
____ left side.
h + 8 = 818 ____ Take the square root of both sides.
h = -8 818
____ ____
h = -8 + 818 or h = -8 - 818
h 20.6 h -36.6
Since the height of the screen cannot be negative, h = -36.6 is an
extraneous root extraneous root.
a number obtained in Thus, the height of the screen is approximately 20.6 in., and the
solving an equation,
which does not satisfy width of the screen is approximately 20.6 + 16 or 36.6 in..
the initial restrictions
on the variable
Hence, the dimensions of a 42-in. television are approximately 20.6 in.
by 36.6 in..
Check: ________
20.62 + 36.62 is 1763.92, and 1763.92 is approximately 42, the diagonal
of the television, in inches.

236 MHR Chapter 4


Your Turn
The circular Canadian two-dollar coin consists of an aluminum and
bronze core and a nickel outer ring. If the radius of the inner core is
0.84 cm and the area of the circular face of the coin is 1.96 cm2,
what is the width of the outer ring?

Example 2
Solve a Quadratic Equation by Completing the Square When a = 1
Solve x 2 - 21 = -10x by completing the square. Can you solve this equation
Express your answers to the nearest tenth. by factoring? Explain.

Solution
x 2 - 21 = -10x
x 2 + 10x = 21
2
x + 10x + 25 = 21 + 25
(x + 5)2 = 46 ___
x+5 = 46
Solve for x.
___ ___
x + 5 = 46 ___
or x + 5 = -46 ___
x = -5 + 46 x = -5 - 46
x = 1.7823 x = -11.7823
___ ___
The exact roots are -5 + 46 and -5 - 46 .
The roots are 1.8 and -11.8, to the nearest tenth.
You can also see the solutions f(x)
to this equation graphically as the 20
x-intercepts of the graph of the
10
function f (x) = x2 + 10x - 21.
(-11.8, 0) (1.8, 0)
These occur at approximately -16 -12 -8 -4 0 4 8 x
(-11.8, 0) and (1.8, 0) and -10
have values of -11.8 and 1.8,
respectively. -20

-30

-40

-50
f(x) = x2 + 10x - 21

Your Turn
Solve p2 - 4p = 11 by completing the square. Express your answers to
the nearest tenth.

4.3 Solving Quadratic Equations by Completing the Square MHR 237


Example 3
Solve a Quadratic Equation by Completing the Square When a 1
Determine the roots of -2x 2 - 3x + 7 = 0, to the nearest hundredth.
Then, use technology to verify your answers.

Solution
-2x 2 - 3x + 7 = 0

x2 + _3x - _7 =0 Divide both sides by a factor of -2.


2 2
x2 + _
3x =_7 Isolate the variable terms on the left side.
2 2
x2 + _
3x + _ =_7 +_ _
9 9 9
Why is added to both sides?
2 16 2 16 16

(x+_ 3 2
) =_65
4 16 ___
x+_ 3 = _ 65
Solve for x.
4 16 ___
x=- __
3 65
4 4
___
x = __
-3 65
4
___ ___
The exact roots are __ and __ .
-3 + 65 -3 - 65
4 4
The roots are 1.27 and -2.77, to the nearest hundredth.

Your Turn
Determine the roots of the equation -2x 2 - 5x + 2 = 0, to the nearest
hundredth. Verify your solutions using technology.

238 MHR Chapter 4


Example 4
Apply Completing the Square
A defender kicks a soccer ball away from her own goal. The path of
the kicked soccer ball can be approximated by the quadratic function
h(x) = -0.06x 2 + 3.168x - 35.34, where x is the horizontal distance
travelled, in metres, from the goal line and h is the height, in metres.
a) You can determine the distance the soccer ball is from the
goal line by solving the corresponding equation,
-0.06x 2 + 3.168x - 35.34 = 0. How far is the soccer ball
from the goal line when it is kicked? Express your answer
to the nearest tenth of a metre.
b) How far does the soccer ball travel before it hits the ground?

Solution
a) Solve the equation -0.06x 2 + 3.168x - 35.34 = 0 by completing
the square.
-0.06x 2 + 3.168x - 35.34 = 0
x 2 - 52.8x + 589 = 0 Divide both sides by a common
factor of -0.06.
x 2 - 52.8x = -589 Isolate the variable terms on
the left side.

x 2 - 52.8x + _ ) = -589 + ( _
52.8 2 2
52.8 Complete the square on the
( 2 2 ) left side.
x 2 - 52.8x + 696.96 = -589 + 696.96
(x - 26.4)2 = 107.96
_______
x - 26.4 = 107.96 Take the square root of both
sides.
_______ _______
x - 26.4 = 107.96 _______ or x - 26.4 = -107.96 _______
Solve for x.
x = 26.4 + 107.96 x= 26.4 - 107.96
x = 36.7903 x = 16.0096
The roots of the equation are approximately 36.8 and 16.0.
The ball is kicked approximately 16.0 m from the goal line.

b) From part a), the soccer ball is kicked approximately 16.0 m from the
goal line. The ball lands approximately 36.8 m from the goal line.
Therefore, the soccer ball travels 36.8 - 16.0, or 20.8 m, before it hits
the ground.

Your Turn
How far does the soccer ball in Example 4 travel if the function that
models its trajectory is h(x) = -0.016x 2 + 1.152x - 15.2?

4.3 Solving Quadratic Equations by Completing the Square MHR 239


Key Ideas

Completing the square is the process of rewriting a quadratic polynomial


from the standard form, ax 2 + bx + c, to the vertex form, a(x - p)2 + q.
You can use completing the square to determine the roots of a quadratic
equation in standard form.
For example,
2x 2 - 4x - 2 = 0
x 2 - 2x - 1 = 0 Divide both sides by a common factor of 2.
x 2 - 2x = 1 Isolate the variable terms on the left side.
2
x - 2x + 1 = 1+1 Complete the square on the left side.
(x - 1)2 = 2 __
x-1= 2 Take the square root of both sides.
__ __
x-1= 2 or
__
x-1= -2 __
Solve for x.
x = 1 + 2 x = 1 - 2
x 2.41 x -0.41
Express roots of quadratic equations as exact roots or as decimal approximations.

Check Your Understanding

Practise 3. Write each equation in the form


1. What value of c makes each expression a a(x - p)2 + q = 0.
perfect square? a) x 2 - 12x + 9 = 0
a) x 2 + x + c b) 5x 2 - 20x - 1 = 0
b) x 2 - 5x + c c) -2x 2 + x - 1 = 0
c) x 2 - 0.5x + c d) 0.5x 2 + 2.1x + 3.6 = 0
d) x 2 + 0.2x + c e) -1.2x 2 - 5.1x - 7.4 = 0
e) x 2 + 15x + c
f) _1 x
2
+ 3x - 6 = 0
2
f) x - 9x + c 2
4. Solve each quadratic equation.
2. Complete the square to write each
Express your answers as exact roots.
quadratic equation in the form
a) x 2 = 64
(x + p)2 = q.
b) 2s2 - 8 = 0
a) 2x 2 + 8x + 4 = 0
b) -3x 2 - 12x + 5 = 0 c) _1 t
2
- 1 = 11
3
c) _1 x 2
- 3x + 5 = 0 d) -y 2 + 5 = -6
2

240 MHR Chapter 4


5. Solve. Express your answers as exact roots. 9. Evan passes a flying disc to a teammate
a) (x - 3)2 = 4 during a competition at the Flatland
Ultimate and Cups Tournament in
b) (x + 2)2 = 9
Winnipeg. The flying disc follows the path
(d + _21 ) = 1
2
c) h(d) = -0.02d 2 + 0.4d + 1, where h is the
height, in metres, and d is the horizontal
d) (h - _ ) = _
2
3 7
4 16 distance, in metres, that the flying disc

e) (s + 6)2 = _3 has travelled from the thrower. If no one


4 catches the flying disc, the height of the
2
f) (x + 4) = 18 disc above the ground when it lands can be
6. Solve each quadratic equation by modelled by h(d) = 0.
completing the square. Express your a) What quadratic equation can you use to
answers as exact roots. determine how far the disc will travel if
2
a) x + 10x + 4 = 0 no one catches it?
b) x 2 - 8x + 13 = 0 b) How far will the disc travel if no one
catches it? Express your answer to the
c) 3x 2 + 6x + 1 = 0
nearest tenth of a metre.
d) -2x 2 + 4x + 3 = 0
e) -0.1x 2 - 0.6x + 0.4 = 0
f) 0.5x 2 - 4x - 6 = 0
7. Solve each quadratic equation by
completing the square. Express your
answers to the nearest tenth.
a) x 2 - 8x - 4 = 0
b) -3x 2 + 4x + 5 = 0

c) _1 x
2
- 6x - 5 = 0
2
d) 0.2x 2 + 0.12x - 11 = 0
_2
e) - x 2 - x + 2 = 0
3 D i d You K n ow ?
f) _3 x 2
+ 6x + 1 = 0
4 Each August, teams compete in the Canadian
Ultimate Championships for the national title in ve
Apply different divisions: juniors, masters, mixed, open, and
8. Dinahis rectangular dog kennel measures womens. This tournament also determines who will
represent Canada at the next world championships.
4 ft by 10 ft. She plans to double the area
of the kennel by extending each side by an
equal amount. 10. A model rocket is launched from
a platform. Its trajectory can be
a) Sketch and label a diagram to represent
approximated by the function
this situation.
h(d) = -0.01d 2 + 2d + 1, where h is
b) Write the equation to model the the height, in metres, of the rocket and
new area. d is the horizontal distance, in metres,
c) What are the dimensions of the new the rocket travels. How far does the
dog kennel, to the nearest tenth of rocket land from its launch position?
a foot? Express your answer to the nearest
tenth of a metre.

4.3 Solving Quadratic Equations by Completing the Square MHR 241


11. Brian is placing a photograph behind 15. Determine the roots of ax 2 + bx + c = 0
a 12-in. by 12-in. piece of matting. He by completing the square. Can you
positions the photograph so the matting use this result to solve any quadratic
is twice as wide at the top and bottom equation? Explain.
as it is at the sides. 16. The sum of the first n terms, Sn, of
The visible area of the photograph is an arithmetic series can be found
54 sq. in. What are the dimensions of using the formula
the photograph? Sn = _n [2t + (n - 1)d], where t is
2 1 1

the first term and d is the common


2x
difference.
a) The sum of the first n terms in the
arithmetic series
x x
12 in. 6 + 10 + 14 + is 3870.
Determine the value of n.
b) The sum of the first n consecutive
natural numbers is 780. Determine
2x
the value of n.
12 in. 17. A machinist in a fabrication shop needs
to bend a metal rod at an angle of 60 at
12. The path of debris from fireworks
a point 4 m from one end of the rod so
when the wind is about 25 km/h can that the ends of the rod are 12 m apart,
be modelled by the quadratic function as shown.
h(x) = -0.04x 2 + 2x + 8, where h is the
height and x is the horizontal distance
4m 12 m
travelled, both measured in metres. How
far away from the launch site will the
60
debris land? Express your answer to the
x
nearest tenth of a metre.
a) Using the cosine law, write a quadratic
equation to represent this situation.
Extend
b) Solve the quadratic equation. How
13. Write a quadratic equation with the
long is the rod, to the nearest tenth
given roots.
__ __ of a metre?
a) 7 and -7
__ __
b) 1 + 3 and 1 - 3 Create Connections
___ ___
c) __
5 + 11
and __
5 - 11 18. The solution to x 2 = 9 is x = 3.
__
The
2 2 solution to the equation x = 9 is x = 3.
14. Solve each equation for x by completing Explain why the solutions to the two
the square. equations are different.
a) x 2 + 2x = k
b) kx 2 - 2x = k
c) x 2 = kx + 1

242 MHR Chapter 4


19. Allison completed the square to determine 20. Compare and contrast the following
the vertex form of the quadratic function strategies for solving x 2 - 5x - 6 = 0.
y = x 2 - 6x - 27. Her method is shown. completing the square
Allisons method: graphing the corresponding function
y = x 2 - 6x - 27 factoring
y = (x 2 - 6x) - 27 21. Write a quadratic function in the form
y = (x 2 - 6x + 9 - 9) - 27 y = a(x - p)2 + q satisfying each of the
y = [(x - 3)2 - 9] - 27 following descriptions. Then, write the
y = (x - 3)2 - 36 corresponding quadratic equation in the
Riley completed the square to begin to solve form 0 = ax 2 + bx + c. Use graphing
the quadratic equation 0 = x 2 - 6x - 27. technology to verify that your equation
His method is shown. also satisfies the description.
Rileys method: a) two distinct real roots
0 = x 2 - 6x - 27 b) one distinct real root, or two equal
27 = x 2 - 6x real roots
27 + 9 = x 2 - 6x + 9 c) no real roots
36 = (x - 3)2
6 = x - 3
Describe the similarities and differences
between the two uses of the method of
completing the square.

Project Corner Avalanche Blasting

An avalauncher is a two-chambered compressed-gas cannon used in avalanche


control work. It fires projectiles with trajectories that can be varied by altering
the firing angle and the nitrogen pressure.
The main disadvantages of avalaunchers, compared to powerful artillery such as
the howitzer, are that they have a short range and poor accuracy in strong winds.
Which would you use if you were an expert initiating a controlled avalanche
near a ski resort, a howitzer or an avalauncher? Why?

Howitzer Avalauncher

4.3 Solving Quadratic Equations by Completing the Square MHR 243


4.4
The Quadratic Formula
Focus on . . .
developing the quadratic formula
solving quadratic equations using the quadratic formula
using the discriminant to determine the nature of the roots of a quadratic equation
selecting an appropriate method for solving a quadratic equation
solving problems involving quadratic equations

You can solve quadratic equations graphically, by factoring, by determining the square
root, and by completing the square. Are there other ways? The Greek mathematicians
Pythagoras (500 B.C.E.) and Euclid (300 B.C.E.) both derived geometric solutions to a
quadratic equation. A general solution for quadratic equations y C
using numbers was derived in about 700 C.E. by the Hindu B

mathematician Brahmagupta. The general formula used today 8


A
was derived in about 1100 C.E. by another Hindu mathematician,
4
Bhaskara. He was also the first to recognize that any positive
number has two square roots, one positive and one negative. x
-8 -4 0 4 8 12
For each parabola shown, how many roots does the related -4
quadratic equation have?

Investigate the Quadratic Formula

By completing the square, you can develop a formula that allows you to
solve any quadratic equation in standard form.
1. Copy the calculations. Describe the steps in the following example
quadratic formula of the quadratic formula.
a formula for 2x 2 + 7x + 1 =0
x2 + _7x + _
determining the roots 1
of a quadratic equation =0
2 2
of the form
ax 2 + bx + c = 0, a 0 x2 + _
7x = -_ 1
________ 2 2
x2 + _7x + _ = -_ 1 + _
___
-b b2 - 4ac 7 2 7 2
x=
2a 2 ( )4 2 4 ( )
x+ 7
( ) _ 2
=- _ 8 +_ 49
4 16 16
x+ 7
( ) _ =_
2
41
4 16 ___
x+_ 7= _ 41

4 16 ___
x=- _
_7 41
4 4
___
x= __
-7 41
4
2. Repeat the steps using the general quadratic equation in standard
form ax 2 + bx + c = 0.
244 MHR Chapter 4
Reflect and Respond
3. a) Will the quadratic formula work for any quadratic equation
written in any form?
b) When do you think it is appropriate to use the quadratic formula
to solve a quadratic equation?
c) When is it appropriate to use a different method, such as graphing
the corresponding function, factoring, determining the square root,
or completing the square? Explain.
4. What is the maximum number of roots the quadratic formula will
give? How do you know this?
5. Describe the conditions for a, b, and c that are necessary for the
________
quadratic formula, x = ___ , to result in only one
-b b2 - 4ac
2a
possible root.
6. Is there a condition relating a, b, and c that will result in no real
solution to a quadratic equation? Explain.

Link the Ideas

form ax 2 + bx + c = 0, a 0,
You can solve quadratic equations of the ________
using the quadratic formula, x = ___ .
-b b2 - 4ac
2a
For example, in the quadratic equation 3x 2 + 5x - 2 = 0,
a = 3, b = 5, and c = -2.
Substitute these values into the quadratic formula.
________
x= ___
-b b2 - 4ac
2a
_____________

x= ____
-5 52 - 4(3)(-2)
2(3)
________
x= ___
-5 25 + 24
6
___
x= __
-5 49
6
x= __7
-5
6
Determine the two roots. y

x = __ or x = __
-5 + 7 -5 - 7 4
6 6
x=_ 1 x=_ -12 2
3
x = -2
6
(-2, 0) ( 13_ , 0)
-4 -2 0 2 4 6 x
The roots are _
1 and -2.
-2
3 y = 3x2 + 5x - 2
-4

4.4 The Quadratic Formula MHR 245


Check:

Substitute x = _
1 and x = -2 into the original equation.
3
Left Side Right Side Left Side Right Side
3x 2 + 5x - 2 0 3x 2 + 5x - 2 0
=3 _ +5 _ -2
1 2
1 = 3(-2)2 + 5(-2) - 2
( )
3 3 ( ) = 12 - 10 - 2
_
1
= + - _
5 _
6 =0
3 3 3 Left Side = Right Side
=0
Left Side = Right Side
Both solutions are correct. The roots of the equation are _
1 and -2.
3
You can determine the nature of the roots for a quadratic equation by the
discriminant value of the discriminant.
the expression When the value of the discriminant is positive, b2 - 4ac > 0, there are
b2 - 4ac located under
the radical sign in the two distinct real roots.
quadratic formula When the value of the discriminant is zero, b2 - 4ac = 0, there is one
use its value to distinct real root, or two equal real roots.
determine the nature
of the roots for a When the value of the discriminant is negative, b2 - 4ac < 0, there are
quadratic equation no real roots.
ax2 + bx + c = 0, a 0
You can see that this is true by testing the three different types of values
of the discriminant in the quadratic formula.

Example 1
Use the Discriminant to Determine the Nature of the Roots
Use the discriminant to determine the nature of the roots for
each quadratic equation. Check by graphing.
a) -2x 2 + 3x + 8 = 0
b) 3x 2 - 5x = -9
c)
_1 x 2
- 3x + 9 = 0
4
Solution
To determine the nature of the roots for each equation, substitute
the corresponding values for a, b, and c into the discriminant
expression, b2 - 4ac.
a) For -2x 2 + 3x + 8 = 0, a = -2, b = 3, and c = 8.
b2 - 4ac = 32 - 4(-2)(8)
b2 - 4ac = 9 + 64
b2 - 4ac = 73
Since the value of the discriminant is positive, there are
two distinct real roots.

246 MHR Chapter 4


The graph of the corresponding y
quadratic function, y = -2x2 + 3x + 8, y = -2x2 + 3x + 8
8
confirms that there are two distinct
x-intercepts. 4

-2 0 2 4 6 8x
-4

-8

b) First, rewrite 3x 2 - 5x = -9 in the form ax 2 + bx + c = 0.


3x 2 - 5x + 9 = 0
For 3x 2 - 5x + 9 = 0, a = 3, b = -5, and c = 9.
b2 - 4ac = (-5)2 - 4(3)(9)
b2 - 4ac = 25 - 108
b2 - 4ac = -83
Since the value of the discriminant is negative, there are no real roots.
The square root of a negative number does not result in a real number.
The graph of the corresponding y
quadratic function, y = 3x 2 - 5x + 9, 12
shows that there are no x-intercepts.
8
y = 3x2 - 5x + 9
4

-1 0 1 2 3 x

c) For _1 x
2
- 3x + 9 = 0, a = _
1 , b = -3, and c = 9.
4 4
b2 - 4ac = (-3)2 - 4 _
1 (9)
( )
4
b2 - 4ac = 9 - 9
b2 - 4ac = 0
Since the value of the discriminant is zero, there is one distinct real
root, or two equal real roots.
y
1
The graph of the corresponding y = _ x2 - 3x + 9
4
quadratic function, y = _1 x 2 - 3x + 9,
12
4
confirms that there is only one 8
x-intercept because it touches the
x-axis but does not cross it. 4

-4 0 4 8 12 x

Your Turn
Use the discriminant to determine the nature of the roots for each
quadratic equation. Check by graphing.
b) 3x 2 + 4x + _ = 0
a) x 2 - 5x + 4 = 0
4 c) 2x 2 - 8x = -9
3

4.4 The Quadratic Formula MHR 247


Example 2
Use the Quadratic Formula to Solve Quadratic Equations
Use the quadratic formula to solve each quadratic equation.
Express your answers to the nearest hundredth.
a) 9x 2 + 12x = -4
b) 5x 2 - 7x - 1 = 0

Solution
a) First, write 9x 2 + 12x = -4 in the form ax 2 + bx + c = 0.
9x 2 + 12x + 4 = 0
For 9x 2 + 12x + 4 = 0, a = 9, b = 12, and c = 4.
________
x= ___
-b b2 - 4ac
2a____________
x = ____
-12 122 - 4(9)(4)
2(9)
__________
x= ____
-12 144 - 144
18
__
x= __
-12 0
Since the value of the discriminant is
18 zero, there is only one distinct real root,
or two equal real roots.
x=_ -12
18
x = -_2
3
Check:
Substitute x = - _
2 into the original equation.
3
Left Side Right Side
9x 2 + 12x -4

= 9 -_
( )2 2 + 12 - _
2
( )
3 3
=9 _
4
( ) -8 How could you use technology to
9 check your solution graphically?
=4-8
= -4
Left Side = Right Side

The root is - _
2 , or approximately -0.67.
3

248 MHR Chapter 4


b) For 5x 2 - 7x - 1 = 0, a = 5, b = -7, and c = -1.
________
x= ___
-b b2 - 4ac
2a ________________

x= ______
-(-7) (-7)2 - 4(5)(-1)
2(5)
________
x= ___
7 49 + 20
10
___
x= __
7 69 Since the value of the discriminant is positive,
10 there are two distinct real roots.
___ ___
x = __ x = __
7 + 69 7 - 69
or
10 10
x = 1.5306 x = -0.1306
___ ___
The roots are __
7 + 69
and __ , or approximately 1.53
7 - 69
10 10
and -0.13.

Check:
The graph of the corresponding function, y = 5x 2 - 7x - 1,
shows the zeros at approximately (-0.13, 0) and (1.53, 0).

Therefore, both solutions are correct.

Your Turn
Determine the roots for each quadratic equation. Express your answers to
the nearest hundredth.
a) 3x 2 + 5x - 2 = 0

b)
_
t2
-t-_
5 =0
2 2

4.4 The Quadratic Formula MHR 249


Example 3
Select a Strategy to Solve a Quadratic Equation
a) Solve 6x 2 - 14x + 8 = 0 by
i) graphing the corresponding function
ii) factoring the equation
iii) completing the square
iv) using the quadratic formula
b) Which strategy do you prefer? Justify your reasoning.

Solution
a) i) Graph the function
f (x) = 6x 2 - 14x + 8, and then
determine the x-intercepts.
The x-intercepts are 1
and approximately 1.33.
Therefore, the roots are 1 and
approximately 1.33.

ii) Factor the equation.


6x 2 - 14x + 8 = 0
3x 2 - 7x + 4 = 0 By inspection, 3x2 - 7x + 4 = (3x - )(x - ).
(3x - 4)(x - 1) = 0 What factors of 4 give the correct middle term?

3x - 4 = 0 or x-1=0
3x = 4 x=1
x=_ 4
3
iii) Complete the square.
6x 2 - 14x + 8 =0
x2 - _ 7x + _ 4 =0
3 3
x 2 - _x= -_
7 4
3 3
x2 - _7x + _ 49= -_4 +_ 49
3 36 3 36
(x-_ )=_
7 2 1
6 36 ___
x-_ = _
7 1

6 36
x=_7 _ 1
6 6

x=_
7 +_
1 or x=_
7 -_
1
6 6 6 6
x=_
8 x=_
6
6 6
x=_
4 x=1
3

250 MHR Chapter 4


iv) Use the quadratic formula. For 6x 2 - 14x + 8 = 0, a = 6, b = -14,
and c = 8.
________
x= ___
-b b2 - 4ac
2a _______________
x= ______
-(-14) (-14)2 - 4(6)(8)
2(6)
__________
x= ____
14 196 - 192
__12
x= __
14 4
12
x= __
14 2
12

x= __
14 + 2
or x = __
14 - 2
12 12
x=_16 x=_ 12
12 12
_
x= 4 x=1
3
Check for methods ii), iii), and iv):
Substitute x = _ 4 and x = 1 into the equation 6x 2 - 14x + 8 = 0.
3
For x = _ 4: For x = 1:
3
Left Side Right Side Left Side Right Side
6x 2 - 14x + 8 0 6x 2 - 14x + 8 0
=6 _
4
( )
2
- 14 _
4
( ) +8 = 6(1)2 - 14(1) + 8
3 3 = 6 - 14 + 8
=6 _ 16 - _
( ) 56 + _24 = -8 + 8
9 3 3
= _
32 - _56 + _
24 =0
3 3 3 Left Side = Right Side
=- _
24 + _
24
3 3
=0
Left Side = Right Side
Both solutions are correct. The roots are _
4 and 1.
3
b) While all four methods produce the same solutions, factoring is
probably the most efficient strategy for this question, since the
quadratic equation is not difficult to factor. If the quadratic equation
could not be factored, either graphing using technology or using the
quadratic formula would be preferred. Using the quadratic formula
will always produce an exact answer.

Your Turn
Which method would you use to solve 0.57x 2 - 3.7x - 2.5 = 0?
Justify your choice. Then, solve the equation, expressing your
answers to the nearest hundredth.

4.4 The Quadratic Formula MHR 251


Example 4
Apply the Quadratic Formula
Leah wants to frame an oil original painted on canvas measuring 50 cm by
60 cm. Before framing, she places the painting on a rectangular mat so that
a uniform strip of the mat shows on all sides of the painting. The area of the
mat is twice the area of the painting. How wide is the strip of exposed mat
showing on all sides of the painting, to the nearest tenth of a centimetre?

Solution
Draw a diagram.
x
Let x represent the width of the strip of exposed
mat showing on all sides of the painting. Then,
the length of the mat is 2x + 60 and the width of
the mat is 2x + 50. x 60 cm x

Use the area formula.


Let A represent the area of the mat. 50 cm
A = lw
x
2(60)(50) = (2x + 60)(2x + 50)
6000 = 4x 2 + 220x + 3000 Round Bale by Jill Moloy
Lethbridge, Alberta
0 = 4x 2 + 220x - 3000
0 = 4(x 2 + 55x - 750)
0 = x 2 + 55x - 750
Substitute into the quadratic formula.
________
x= ___
-b b2 - 4ac
2a _________________

x = ______
-(55) (55)2 - 4(1)(-750)
2(1)
_____
x = ___
-55 6025

2 _____ _____
x= ___
-55 + 6025
or x= ___
-55 - 6025
2 2
x = 11.310 x = -66.310
So, x 11.3 or x -66.3.
Since x > 0, reject x -66.3. Therefore, the width of the strip of
exposed mat is approximately 11.3 cm. The approximate dimensions
of the mat are 2(11.3) + 60 by 2(11.3) + 50 or 82.6 cm by 72.6 cm. The
approximate area of the mat is 82.6 72.6 or 5996.76 cm2, which is
about 6000 cm2, twice the area of the painting.

Your Turn
A picture measures 30 cm by 21 cm. You crop the picture by removing
strips of the same width from the top and one side of the picture. This
reduces the area to 40% of the original area. Determine the width of the
removed strips.

252 MHR Chapter 4


Key Ideas

ax 2 + bx + c = 0, a 0,
You can solve a quadratic equation of the form________

for x using the quadratic formula x = ___ .


-b b2 - 4ac
2a
Use the discriminant to determine the nature of the roots of a quadratic equation.
 When b2 - 4ac > 0, there are two y
distinct real roots. The graph of
the corresponding function has
two different x-intercepts.

0 x

 When b2 - 4ac = 0, there is one y


distinct real root, or two equal
real roots. The graph of the
corresponding function has one
x-intercept.
0 x

 When b2 - 4ac < 0, there are y


no real roots. The graph of the
corresponding function has no
x-intercepts.

0 x

You can solve quadratic equations in a variety of ways. You may prefer
some methods over others depending on the circumstances.

4.4 The Quadratic Formula MHR 253


Check Your Understanding

Practise 5. Determine the roots of each quadratic


1. Use the discriminant to determine the equation. Express your answers as exact
nature of the roots for each equation. values and to the nearest hundredth.
Do not solve the equations. Check your a) 3x 2 + 6x + 1 = 0
answers graphically.
b) h2 + _h - _1 = 0
2
a) x - 7x + 4 = 0 6 2
c) 0.2m2 = -0.3m + 0.1
b) s2 + 3s - 2 = 0
d) 4y 2 + 7 - 12y = 0
c) r 2 + 9r + 6 = 0
2 e) _x + 1 = _
7x 2

d) n - 2n + 1 = 0 2 2
2
e) 7y + 3y + 2 = 0 f) 2z2 = 6z - 1

f) 4t 2 + 12t + 9 = 0 6. Marge claims that the most efficient way to


solve all quadratic equations is to use the
2. Without graphing, determine the number
quadratic formula. Do you agree with her?
of zeros for each function.
Explain with examples.
a) f (x) = x 2 - 2x - 14
7. Solve using an appropriate method.
b) g(x) = -3x 2 + 0.06x + 4
Justify your choice of method.
c) f (x) = _
1x 2
- 3x + 9 a) n2 + 2n - 2 = 0
4
d) f (v) = -v 2 + 2v - 1 b) -y 2 + 6y - 9 = 0

e) f (x) = _1 x 2
-x+_
5 c) -2u2 + 16 = 0
2 2 d) _
x -_2
x =1
2 3
f) g(y) = -6y 2 + 5y - 1
e) x 2 - 4x + 8 = 0
3. Use the quadratic formula to solve each
quadratic equation. Express your answers Apply
as exact roots. 8. To save materials, Choma decides to build
a) 7x 2 + 24x + 9 = 0 a horse corral using the barn for one side.
2
b) 4p - 12p - 9 = 0 He has 30 m of fencing materials and
c) 3q2 + 5q = 1 wants the corral to have an area of 100 m2.
What are the dimensions of the corral?
d) 2m2 + 4m - 7 = 0
e) 2j 2 - 7j = -4
f) 16g2 + 24g = -9
4. Use the quadratic formula to solve each barn
equation. Express your answers to the
nearest hundredth.
a) 3z2 + 14z + 5 = 0
b) 4c2 - 7c - 1 = 0
corral
c) -5u2 + 16u - 2 = 0
d) 8b2 + 12b = -1
e) 10w 2 - 45w = 7
f) -6k 2 + 17k + 5 = 0

254 MHR Chapter 4


9. A mural is being painted on an outside 12. An open-topped box is being made from
wall that is 15 m wide and 12 m tall. A a piece of cardboard measuring 12 in. by
border of uniform width surrounds the 30 in. The sides of the box are formed
mural. The mural covers 75% of the area of when four congruent squares are cut from
the wall. How wide is the border? Express the corners, as shown in the diagram. The
your answer to the nearest hundredth of base of the box has an area of 208 sq. in..
a metre.
x
10. Subtracting a number from half its square
gives a result of 11. What is the number?
12 in.
Express your answers as exact values and
to the nearest hundredth.
11. The mural Northern Tradition and
30 in.
Transition, located in the Saskatchewan
Legislature, was painted by Mtis artist a) What equation represents the surface
Roger Jerome to honour the province area of the base of the box?
of Saskatchewans 100th anniversary b) What is the side length, x, of the square
in 2005. The mural includes a cut from each corner?
parabolic arch. The approximate shape
c) What are the dimensions of the box?
of the arch can be modelled by the
function h(d) = -0.4(d - 2.5)2 + 2.5, 13. A car travelling at a speed of
where h is the height of the arch, in v kilometres per hour needs a stopping
metres, and d is the distance, in metres, distance of d metres to stop without
from one end of the arch. How wide is the skidding. This relationship can be
arch at its base? modelled by the function
d(v) = 0.0067v 2 + 0.15v. At what speed
D id Yo u K n ow ? can a car be travelling to be able to stop
Roger Jerome included the arch shape to symbolize in each distance? Express your answer
the unity of northern and southern Saskatchewan. to the nearest tenth of a kilometre
per hour.
a) 42 m
b) 75 m
c) 135 m
14. A study of the air quality in a particular
city suggests that t years from now, the
level of carbon monoxide in the air, A, in
parts per million, can be modelled by the
function A(t) = 0.3t 2 + 0.1t + 4.2.
a) What is the level, in parts per million,
of carbon monoxide in the air now, at
t = 0?
b) In how many years from now will
the carbon monoxide level be 8 parts
Northern Tradition and Transition by Roger Jerome per million? Express your answer to the
nearest tenth of a year.

4.4 The Quadratic Formula MHR 255


15. A sporting goods store sells 90 ski jackets 19. In the diagram, the square has side lengths
in a season for $275 each. Each $15 of 6 m. The square is divided into three
decrease in the price results in five more right triangles and one acute isosceles
jackets being sold. What is the lowest price triangle. The areas of the three right triangles
that would produce revenues of at least are equal.
$19 600? How many jackets would be sold x
at this price?
16. Two guy wires are attached to the top of a x
telecommunications tower and anchored
6m
to the ground on opposite sides of the
tower, as shown. The length of the guy
wire is 20 m more than the height of the
tower. The horizontal distance from the 6m
base of the tower to where the guy wire
a) Determine the exact value of x.
is anchored to the ground is one-half the
height of the tower. How tall is the tower, b) What is the exact area of the acute
to the nearest tenth of a metre? isosceles triangle?
20. Two small private planes take off from
the same airport. One plane flies north
at 150 km/h. Two hours later, the second
plane flies west at 200 km/h. How long
after the first plane takes off will the two
planes be 600 km apart? Express your
answer to the nearest tenth of an hour.

Create Connections
21. Determine the error(s) in the following
solution. Explain how to correct the
Extend
solution.
17. One root of the equation
2x 2 + bx - 24 = 0 is -8. What Solve -3x 2 - 7x + 2 = 0.
________________

Line 1: x = _____
are the possible values of b and -7 (-7)2 - 4(-3)(2)
the other root? 2(-3)
________
18. A cylinder has a height of 5 cm and Line 2: x = ___
-7 49 - 24
-6
a surface area of 100 cm2. What is the ___
radius of the cylinder, to the nearest Line 3: x = __
-7 25
-6
tenth of a centimetre?
Line 4: x = __
-7 5
-6
Line 5: So, x = 2 or x = _ 1.
3
22. Pierre calculated the roots
___ of a quadratic
5 cm
equation as x = __
3 25
.
2
a) What are the x-intercepts of the graph of
the corresponding quadratic function?
b) Describe how to use the x-intercepts
to determine the equation of the axis
of symmetry.

256 MHR Chapter 4


23. You have learned to solve quadratic 24. Create a mind map of how the concepts
equations by graphing the corresponding you have learned in Chapters 3 and 4 are
function, determining the square roots, connected. One is started below. Make
factoring, completing the square, and a larger version and add any details that
applying the quadratic formula. In what help you.
circumstances would one method of
y
solving a quadratic equation be preferred
over another?
Quadratic Quadratic
r 0 s t x
Functions Equations

Project Corner Contour Maps

Contour lines are lines on a map that connect points of We b Link


equal elevation.
To explore generating
gene
Contour maps show the elevations above sea level and the a profile view, go to
www.mhrprecalc11.ca
surface features of the land using contour lines. and follow the links.

A profile view shows how the elevation changes when a


line is drawn across part of a contour map.

4.4 The Quadratic Formula MHR 257


Chapter 4 Review
4.1 Graphical Solutions of Quadratic 5. The path of a soccer ball can
Equations, pages 206217 be modelled by the function
h(d) = -0.1d 2 + 0.5d + 0.6, where h
1. Solve each quadratic equation by
is the height of the ball and d is the
graphing the corresponding quadratic
horizontal distance from the kicker,
function.
both in metres.
a) 0 = x 2 + 8x + 12
a) What are the zeros of the function?
b) 0 = x 2 - 4x - 5
b) You can use the quadratic equation
c) 0 = 3x 2 + 10x + 8 0 = -0.1d 2 + 0.5d + 0.6 to determine
2
d) 0 = -x - 3x the horizontal distance that a ball
e) 0 = x 2 - 25 travels after being kicked. How far did
the ball travel downfield before it hit
2. Use graphing technology to determine
the ground?
which of the following quadratic
equations has different roots from the
other three.
A 0 = 3 - 3x - 3x 2
B 0 = x2 + x - 1
C 0 = 2(x - 1)2 + 6x - 4
D 0 = 2x + 2 + 2x 2
3. Explain what must be true about the
graph of the corresponding function for a
quadratic equation to have no real roots.
4. A manufacturing company produces key
rings. Last year, the company collected
data about the number of key rings
produced per day and the corresponding
profit. The data can be modelled by 4.2 Factoring Quadratic Equations,
the function P(k) = -2k 2 + 12k - 10, pages 218233
where P is the profit, in thousands of
dollars, and k is the number of key rings, 6. Factor.
in thousands. a) 4x 2 - 13x + 9
a) Sketch a graph of the function. b) _1 x
2
-_3x - 2
2 2
b) Using the equation
c) 3(v + 1)2 + 10(v + 1) + 7
-2k 2 + 12k - 10 = 0, determine the
number of key rings that must be d) 9(a2 - 4)2 - 25(7b)2
produced so that there is no profit or 7. Solve by factoring. Check your solutions.
loss. Justify your answer. a) 0 = x 2 + 10x + 21

b) _1 m
2
+ 2m - 5 = 0
4
c) 5p2 + 13p - 6 = 0
d) 0 = 6z2 - 21z + 9

258 MHR Chapter 4


8. Solve. 4.3 Solving Quadratic Equations by
2
a) -4g + 6 = -10g Completing the Square, pages 234243
b) 8y 2 = -5 + 14y 13. Determine the value of k that makes each
c) 30k - 25k = 9 2 expression a perfect square trinomial.
d) 0 = 2x2 - 9x - 18 a) x 2 + 4x + k

9. Write a quadratic equation in standard b) x 2 + 3x + k


form with the given roots. 14. Solve. Express your answers as
a) 2 and 3 exact values.
b) -1 and -5 a) 2x2 - 98 = 0

c) _3 and -4 b) (x + 3)2 = 25
2 c) (x - 5)2 = 24
10. The path of a paper airplane can
d) (x - 1)2 = _5
be modelled approximately by the 9
function h(t) = - _
1 t 2 + t + 3, where 15. Complete the square to determine the roots
4 of each quadratic equation. Express your
h is the height above the ground, in
answers as exact values.
metres, and t is the time of flight, in
a) -2x 2 + 16x - 3 = 0
seconds. Determine how long it takes
for the paper airplane to hit the ground, b) 5y 2 + 20y + 1 = 0
h(t) = 0. c) 4p2 + 2p = -5
11. The length of the base of a rectangular 16. In a simulation, the path of a new aircraft
prism is 2 m more than its width, and after it has achieved weightlessness
the height of the prism is 15 m. can be modelled approximately by
a) Write an algebraic expression for the h(t) = -5t 2 + 200t + 9750, where h is the
volume of the rectangular prism. altitude of the aircraft, in metres, and t is
b) The volume of the prism is
the time, in seconds, after weightlessness
2145 m3. Write an equation to model is achieved. How long does the aircraft
the situation. take to return to the ground, h(t) = 0?
Express your answer to the nearest tenth
c) Solve the equation in part b) by
of a second.
factoring. What are the dimensions
17. The path of a snowboarder after jumping
of the base of the rectangular prism?
from a ramp can be modelled by the
function h(d) = - _
12. Solve the quadratic equation 1 d 2 + 2d + 1, where h
x 2 - 2x - 24 = 0 by factoring and by 2
is the height above the ground and d is
graphing. Which method do you prefer
the horizontal distance the snowboarder
to use? Explain.
travels, both in metres.
a) Write a quadratic equation you would
solve to determine the horizontal
distance the snowboarder has travelled
when she lands.
b) What horizontal distance does the
snowboarder travel? Express your
answer to the nearest tenth of a metre.

Chapter 4 Review MHR 259


4.4 The Quadratic Formula, pages 244257 c) Determine the expression that models
18. Use the discriminant to determine the the revenue, R, for the ferry, which is
nature of the roots for each quadratic the product of the number of people
equation. Do not solve the equation. using the ferry per day and the fare
per person.
a) 2x 2 + 11x + 5 = 0
d) Determine the number of fare decreases
b) 4x 2 - 4x + 1 = 0
that result in a revenue of $9246.
c) 3p2 + 6p + 24 = 0
d) 4x 2 + 4x - 7 = 0
19. Use the quadratic formula to determine the
roots for each quadratic equation. Express
your answers as exact values.
a) -3x 2 - 2x + 5 = 0
b) 5x 2 + 7x + 1 = 0
c) 3x 2 - 4x - 1 = 0
d) 25x 2 + 90x + 81 = 0
20. A large fountain in a park has 35 water
jets. One of the streams of water
shoots out of a metal rod and follows a
parabolic path. The path of the stream of
water can be modelled by the function
h(x) = -2x 2 + 6x + 1, where h is the
height, in metres, at any horizontal
distance x metres from its jet.
a) What quadratic equation would you
solve to determine the maximum
horizontal distance the water jet
can reach? 22. Given the quadratic equation in standard
b) What is the maximum horizontal form, ax 2 + bx + c = 0, arrange the
distance the water jet can reach? following algebraic steps and explanations
Express your answer to the nearest in the order necessary to derive the
tenth of a metre. quadratic formula.
21. A ferry carries people to an island airport. Algebraic Steps Explanations
_________
It carries 2480 people per day at a cost of
x+
_
b
=
__
b - 4ac
2
Complete the
$3.70 per person. Surveys have indicated 2a 4a2 square.
that for every $0.05 decrease in the fare,
(x + _ __
2
b - 4ac
2
Solve for x.
2a )
b
=
40 more people will use the ferry. Use x 4a 2

to represent the number of decreases in _b


x2 + a x = - _
c Subtract c from
a both sides.
the fare.
Take the square
a) Write an expression to model the fare ax2 + bx = -c root of both side.
per person.
_b _
x2 + a x +
b2
=
_
b2 _c
-a
Divide both
b) Write an expression to model the 4a2 4a2 sides by a.
number of people that would use the ________ Factor the
ferry per day. x=
___
-b b2 - 4ac perfect square
2a trinomial.

260 MHR Chapter 4


Chapter 4 Practice Test
Multiple Choice 5. The number of baseball games, G, that
must be scheduled in a league with
For #1 to #5, choose the best answer.
n teams can be modelled by the function
1. What points on the graph of this quadratic G(n) = __
n2 - n , where each team plays
function represent the locations of the 2
every other team exactly once. Suppose
zeros of the function?
a league schedules 15 games. How many
y
teams are in the league?
10
A 5
8 B 6

6 C 7
D 8
4

2 Short Answer
6. Determine the roots of each quadratic
-2 0 2 4 6 8 x
equation. If the quadratic equation does
-2
not have real roots, use a graph of the
-4 corresponding function to explain.
a) 0 = x 2 - 4x + 3
b) 0 = 2x 2 - 7x - 15
A (0, 5) and (1, 0)
c) 0 = -x 2 - 2x + 3
B (0, 1) and (0, 5)
7. Solve the quadratic equation
C (1, 0) and (5, 0)
0 = 3x 2 + 5x - 1 by completing
D (5, 0) and (0, 1)
the square. Express your answers
2. What is one of the factors of x 2 - 3x - 10? as exact roots.
A x+5 B x-5 8. Use the quadratic formula to determine
C x - 10 D x + 10 the roots of the equation x 2 + 4x - 7 = 0.
3. What integral values of k will make Express your answers as exact roots in
2x 2 + kx - 1 factorable? simplest radical form.
A -1 and 2 B -2 and 2 9. Without solving, determine the nature of
the roots for each quadratic equation.
C -2 and 1 D -1 and 1
a) x 2 + 10x + 25 = 0
4. The roots, to the nearest hundredth, of
1 x2 + x + _
0 = -_ 7 are b) 2x 2 + x = 5
2 2 c) 2x 2 + 6 = 4x
A 1.83 and 3.83
d) _2 x 2
+_
1x - 3 = 0
B -1.83 and 3.83 3 2
C 1.83 and -3.83
D -1.83 and -3.83

Chapter 4 Practice Test MHR 261


10. The length of the hypotenuse of a right 14. The parks department is planning a new
triangle is 1 cm more than triple that flower bed. It will be rectangular with
of the shorter leg. The length of the dimensions 9 m by 6 m. The flower bed
longer leg is 1 cm less than triple that will be surrounded by a grass strip of
of the shorter leg. constant width with the same area as the
a) Sketch and label a diagram with flower bed.
expressions for the side lengths. x
b) Write an equation to model the
situation. x x
6m
c) Determine the lengths of the sides
of the triangle. 9m
x
Extended Response
a) Write a quadratic equation to model
11. A pebble is tossed upward from a scenic the situation.
lookout and falls to the river below. The
b) Solve the quadratic equation. Justify
approximate height, h, in metres, of the
your choice of method.
pebble above the river t seconds after
being tossed is modelled by the function c) Calculate the perimeter of the outside
h(x) = -5t 2 + 10t + 35. of the path.

a) After how many seconds does the


pebble hit the river? Express your
answer to the nearest tenth of
a second.
b) How high is the scenic lookout
above the river?
c) Which method did you choose
to solve the quadratic equation?
Justify your choice.
12. Three rods measure 20 cm, 41 cm,
and 44 cm. If the same length is cut
off each piece, the remaining lengths
can be formed into a right triangle.
What length is cut off?
13. A rectangular piece of paper has a
perimeter of 100 cm and an area of
616 cm2. Determine the dimensions
of the paper.

262 MHR Chapter 4


Unit 2 Project Wrap-Up
Quadratic Functions in Everyday Life
You can analyse quadratic functions and their related equations to solve
problems and explore the nature of a quadratic. A quadratic can model the
curve an object follows as it flies through the air. For example, consider
the path of a softball, a tennis ball, a football, a baseball, a soccer ball, or a
basketball. A quadratic function can also be used to design an object that
has a specific curved shape needed for a project.
Quadratic equations have many practical applications. Quadratic equations
may be used in the design and sales of many products found in stores.
They may be used to determine the safety and the life expectancy of a
product. They may also be used to determine the best price to charge to
maximize revenue.
Complete one of the following two options.

Option 1 Quadratic Functions in Everyday Life Option 2 Avalanche Control


Research a real-life situation that may be Research a ski area in Western Canada that
modelled by a quadratic function. requires avalanche control.
Search the Internet for two images or video Determine the best location or locations to
clips, one related to objects in motion and position avalanche cannons in your resort.
one related to fixed objects. These items Justify your thinking.
should show shapes or relationships that are Determine three different quadratic functions
parabolic. that can model the trajectories of avalanche
Model each image or video clip with a control projectiles.
quadratic function, and determine how Graph each function. Each graph should
accurate the model is. illustrate the specific coordinates of where
Research the situation in each image or video the projectile will land.
clip to determine if there are reasons why it Write a one-page report to accompany
should be quadratic in nature. your graphs. Your report should include
Write a one-page report to accompany your the following:
functions. Your report should include the  the location(s) of the avalanche control

following: cannon(s)
 where quadratic functions and equations  the intended path of the controlled

are used in your situations avalanche(s)


 when a quadratic function is a good model  the location of the landing point for

to use in a given situation each projectile


 limitations of using a quadratic function as

a model in a given situation

Unit 2 Project Wrap-Up MHR 263


Cumulative Review, Chapters 34
Chapter 3 Quadratic Functions 5. Rewrite each function in the form
y = a(x - p)2 + q. Compare the graph of
1. Match each characteristic with the correct
each function to the graph of y = x 2.
quadratic function.
a) y = x 2 - 10x + 18
Characteristic
b) y = -x 2 + 4x - 7
a) vertex in quadrant III
c) y = 3x 2 - 6x + 5
b) opens downward
c) axis of symmetry: x = 3 d) y = _1 x
2
+ 4x + 20
4
d) range: {y | y 5, y R} 6. a) The approximate height, h, in metres,
Quadratic Function of an arrow shot into the air with an
initial velocity of 20 m/s after t seconds
A y = -5(x - 2)2 - 3
can be modelled by the function
B y = 3(x + 3)2 + 5 h(t) = -5t 2 + 20t + 2. What is the
C y = 2(x + 2)2 - 3 maximum height reached by the arrow?
D y = 3(x - 3)2 - 5 b) From what height was the arrow shot?

2. Classify each as a quadratic function or a c) How long did it take for the arrow to hit
function that is not quadratic. the ground, to the nearest second?
a) y = (x + 6) - 1
Chapter 4 Quadratic Equations
b) y = -5(x + 1)2
________ 7. Copy and complete the sentence, filling
c) y = (x + 2)2 + 7
in the blanks with the correct terms:
d) y + 8 = x 2 zeros, x-intercepts, roots.
3. Sketch a possible graph for a quadratic When solving quadratic equations, you
function given each set of characteristics. may consider the relationship among
a) axis of symmetry: x = -2 the  of a quadratic equation, the
range: {y | y 4, y R}  of the corresponding quadratic
b) axis of symmetry: x = 3 function, and the  of the graph of
range: {y | y 2, y R} the quadratic function.
c) opens upward, vertex at (1, -3), one 8. Factor each polynomial expression.
x-intercept at the point (3, 0) a) 9x 2 + 6x - 8
4. Identify the vertex, domain, range, b) 16r 2 - 81s2
axis of symmetry, x-intercepts, and c) 2(x + 1)2 + 11(x + 1) + 14
y-intercept for each quadratic function.
d) x 2y 2 - 5xy - 36
a) f (x) = (x + 4)2 - 3
e) 9(3a + b)2 - 4(2a - b)2
b) f (x) = -(x - 2)2 + 1
f) 121r 2 - 400
c) f (x) = -2x2 - 6
9. The sum of the squares of three
d) f (x) = _ (x + 8)2 + 6
1 consecutive integers is 194. What
2 are the integers?

264 MHR Cumulative Review, Chapters 34


10. The Empress Theatre, in Fort Macleod, 13. Name the method you would choose to solve
is Albertas oldest continually operating each quadratic equation. Determine the roots
theatre. Much of the theatre is the same of each equation and verify the answer.
as when it was constructed in 1912, a) 3x 2 - 6 = 0
including the 285 original seats on the
b) m2 - 15m = -26
main floor. The number of rows on the
main floor is 4 more than the number of c) s2 - 2s - 35 = 0
seats in each row. Determine the number d) -16x 2 + 47x + 3 = 0
of rows and the number of seats in 14. Use the discriminant to determine
each row. the nature of the roots for each
11. An outdoor hot tub has a diameter of quadratic equation.
2 m. The hot tub is surrounded by a a) x 2 - 6x + 3 = 0
circular wooden deck, so that the deck b) x 2 + 22x + 121 = 0
has a uniform width. If the top area of
c) -x 2 + 3x = 5
the deck and the hot tub is 63.6 m2, how
wide is deck, to the nearest tenth of 15. James Michels was raised in Merritt,
a metre? British Columbia, and is a member of
the Penticton Mtis Association. James
apprenticed with Coast Salish artist
Joseph Campbell and now produces
2m
intricate bentwood boxes.
For one particular bentwood box, the
side length of the top square piece is 1 in.
longer than the side length of the bottom.
12. Dallas solves the quadratic equation Their combined area is 85 sq. in..
2x 2 - 12x - 7 = 0 by completing a) Write a quadratic equation to determine
the square. Doug solves the the dimensions of each square piece.
quadratic equation by using the b) Select an algebraic method and solve
quadratic formula. The solution for for the roots of the quadratic equation.
each student is shown. Identify the
c) What are the dimensions of the top and
errors, if any, made by the students
bottom of the box?
and determine the correct solution.
d) Explain why one of the roots from
Dallass solution:
part b) is extraneous.
2(x 2 - 12x) = 7
2
2(x - 12x + 36) = 7 + 36
2(x - 6)2 = 43 ___
x=6 _ 43

2
Dougs solution:
_________________

x= _____
-12 (-12)2 - 4(2)(-7)
___ 2(2)
x= ___
-12 80
4 ___
x = -3 20 __ Natural Wolf
x = -3 25 by James Michels

Cumulative Review, Chapters 34 MHR 265


Unit 2 Test
Multiple Choice 5. Michelle wants to complete the square
to identify the vertex of the graph of the
For #1 to #5, choose the best answer. quadratic function y = -3x 2 + 5x - 2.
1. The graph of which function is congruent Her partial work is shown.
to the graph of f (x) = x 2 + 3 but translated Step 1: y = -3 x 2 + _
( 5x - 2
)
vertically 2 units down? 3
A f (x) = x 2 + 1 Step 2: y = -3 x 2 + _
( 5x + _ 25 - 2 - _
) 25
3 36 36
B f (x) = x 2 - 1
(
Step 3: y = -3 x + _
5
)
2
- _
97
6 36
C f (x) = x 2 + 5
Identify the step where Michelle made
D f (x) = (x - 2)2 + 3 her first error, as well as the correct
2. The equation of the quadratic function in coordinates of the vertex.
A Step 1, vertex - _ , - _
the form y = a(x - p)2 + q with a vertex 5 97
at (-1, -2) and passing through the point
( 6 36)
B Step 1, vertex _ , _
(1, 6) is 5 1
A y = 4(x + 1)2 - 2
( 6 12 )
B y = 4(x - 1)2 - 2 C Step 2, vertex ( _
5 ,_ 1
)
6 12
D Step 2, vertex - _ , - _
C y = 2(x - 1)2 - 2 5 25
D y = 2(x + 1)2 - 2
( 6 12)
3. The graph of y = ax 2 + q intersects the
Numerical Response
x-axis in two places when
A a > 0, q > 0 Copy and complete the statements in #6 to #8.
B a < 0, q < 0 6. The value of the discriminant for the
C a > 0, q = 0 quadratic function y = -3x 2 - 4x + 5 is .
D a > 0, q < 0 7. The manager of an 80-unit apartment
4. When y = 2x 2 - 8x + 2 is written in the complex is trying to decide what rent to
form y = a(x - p)2 + q, the values of p charge. At a rent of $200 per week, all
and q are the units will be full. For each increase
in rent of $20 per week, one more unit
A p = -2, q = -6
will become vacant. The manager should
B p = 2, q = -6 charge  per week to maximize the
C p = 4, q = 0 revenue of the apartment complex.
D p = -2, q = 6 8. The greater solution to the quadratic
equation 9x 2 + 4x - 1 = 0, rounded
to the nearest hundredth, is .

266 MHR Unit 2 Test


Written Response 11. The bottom of a jewellery box is made
from a square piece of cardboard by cutting
9. You create a circular piece of art for a
2-cm squares from each corner and turning
project in art class. Your initial task is to
up the sides, as shown in the figure below.
paint a background circle entirely in blue.
The volume of the open box is 128 cm2.
Suppose you have a can of blue paint that
What size of cardboard is needed?
will cover 9000 cm2.
a) Determine the radius, to the nearest 2 cm

tenth of a centimetre, of the largest


2 cm
circle you can paint.
b) If you had two cans of paint, what
would be the radius of the largest circle
you could paint, to the nearest tenth of
a centimetre? 12. The side lengths of the tops of three
c) Does the radius of the largest circle decorative square tables can be described
double when the amount of paint as three consecutive integers. The
doubles? combined area of the table tops is
10. Suppose Clair hits a high pop-up with an
677 sq. in..
initial upward velocity of 30 m/s from a) Write a single-variable quadratic
a height of 1.6 m above the ground. The equation, in simplified form, to
height, h, in metres, of the ball, t seconds determine the side length of each
after it was hit can be modelled by the square tabletop.
function h(t) = -4.9t 2 + 30t + 1.6. b) Algebraically determine the roots
a) What is the maximum height the ball of the quadratic equation.
reaches? Express your answer to the c) What are the side lengths of the
nearest tenth of a metre. tabletops?
b) The pitcher caught the ball at a height d) Why would you not consider both of
of 1.1 m. How long was the ball in the roots of the quadratic equation
the air? Express your answer to the when determining a possible
nearest tenth of a second. side length?

Unit 2 Test MHR 267


Unit 3

Functions and
Equations
Linear relations have numerous
applications in the world.
However, mathematicians and
scientists have found that many
relationships in the natural
world cannot be explained with
linear models. For example,
meteorology, astronomy, and
population ecology require
more complex mathematical
relations to help understand and
explain observed phenomena.
Similarly, structural engineers and
business people need to analyse
non-linear data in their everyday
working lives. In this unit, you
will learn about four types of
functions and equations used to
model some of the most complex
behaviours in our world.

Looking Ahead
In this unit, you will solve
problems involving
radical expressions and
equations
rational expressions and
equations
absolute value functions
and equations
reciprocal functions

268 MHR Unit 3 Functions and Equations


Unit 3 Project Space: Past, Present, Future

In this project, you will explore a variety of functions and equations, including
radical, rational, absolute value, and reciprocal, and how they relate to our
understanding of space and its exploration.

In Chapter 5, you will gather information about our galaxy. In Chapter 6, you will
gather information about peculiarities in space, such as the passage of time and
black holes. In Chapter 7, you will explore space tourism.

At the end of the unit, you will choose at least one of the following three options:
Examine an application of radicals in space or in the contributions of an
astronomer. Investigate why a radical occurs in the mathematics involved in the
contribution of the astronomer.
Research an application of rational expressions in space and investigate why a
rational expression models a particular situation.
Apply the skills you have learned about absolute value functions and reciprocal
functions to graphic design.

In the Project Corner box at the end of some sections, you will find information
and notes about outer space. You can use this information to gather data and facts
about your chosen option.

Unit 3 Functions and Equations MHR 269


CHAPTER

5 Radical
Expressions
and Equations
Radical equations can be used to model a
variety of relationshipsfrom tracking storms to
modelling the path of a football or a skier through
the air. Radical expressions and equations allow
mathematicians and scientists to work more
accurately with numbers. This is important when
dealing with large numbers or relations that are
sensitive to small adjustments. In this chapter, you
will work with a variety of radical expressions
and equations including very large radicals as
you analyse the cloud formations on the surface
of Saturn.

Did Yo u Know ?

Weather contour graphs are 3-D graphs that show levels of


atmospheric pressure, temperature, precipitation, or ocean heat.
The formulas used in these graphs involve squares and square
roots. Computers analyse contour graphs of the atmosphere to
track weather patterns. Meteorologists use computers and satellite
radar to track storms and forecast the weather.

Key Terms
rationalize radical equation
conjugates

270 MHR Chapter 5


Career Link
Meteorologists study the forces that shape
weather and climate. They use formulas that
may involve square roots and cube roots
to help describe and predict storms and
weather patterns. Atmospheric scientists are
meteorologists who focus on the atmosphere
and investigate the effects of human
activities, such as producing pollution, on
the atmosphere. Most meteorologists in
Canada work for the federal government,
and many study at the University of British
Columbia or the University of Alberta.

We b Link
To learn
earn more about
a meteorologists and atmospheric
scientists, go to www.mhrprecalc11.ca and follow
the links.

Chapter 5 MHR 271


5.1
Working With Radicals
Focus on . . .
converting between mixed radicals and entire radicals
comparing and ordering radical expressions
identifying restrictions on the values for a variable in a
radical expression
simplifying radical expressions using addition and subtraction

The packaging industry is huge. It involves design and


production, which affect consumers. Graphic designers and
packaging engineers apply mathematics skills to designing,
constructing, and testing various forms of packaging. From
pharmaceuticals to the automobile industry, consumer
products are usually found in packages.

Investigate Radical Addition and Subtraction

Materials Two glass vases are packaged in opposite corners of a box with a square
1-cm grid paper base. A cardboard divider sits diagonally between the vases. Make a
scissors model of the box using grid paper.
1. a) Use an 8 cm by 8 cm square of 1-cm grid paper. Construct a
square-based prism without a top. The side length of the base
should be double the height of the sides of the box.
b) What is the exact diagonal distance across the base of the model?
Explain how you determined the distance.
2. The boxes are aligned on display shelves in rows
of 2, 4, and 6 boxes each. The boxes are placed
corner to corner. What are the exact lengths of
the possible rows? Use addition statements to
represent your answers. Verify your answers.
3. Suppose____
several classmates place three model boxes along a shelf
that is 450 cm long.
a) If the boxes are placed side by side, will they fit on the shelf? If
so, what distance along the shelf will be occupied? What distance
will be unoccupied?
b) Will the boxes fit along the shelf
if they are placed corner to
corner, with the diagonals
forming a straight line? If so, 450 cm
what distance on the shelf will be
occupied? What distance will be unoccupied?

272 MHR Chapter 5


4. Write an addition and subtraction statement using only mixed
radicals for each calculation in step 3b). A mixed radical is the
n __
product of a monomial and a radical. In r x , r is the coefficient,
n is the index, and x is the radicand.

Reflect and Respond


5. Develop a general equation that represents the addition of radicals.
Compare your equation and method with a classmates. Identify any
rules for using your equation.
__ __ __ __ __
6. Use integral values of a to verify that a + a + a + a = 4 a .

Link the Ideas

Like Radicals
Radicals with the same Pairs of Like Radicals Pairs of Unlike Radicals
radicand and index are __ __ __ __
5 7 and - 7 2 5 and 2 3
called like radicals.
_2 ____
3
5x and
2
3
5x2
____ 4
___
5a and 5a
5
___

When adding and 3

subtracting radicals, How are like radicals similar to like terms?


only like radicals can
be combined. You may need to convert radicals to a different form
(mixed or entire) before identifying like radicals.

Restrictions on Variables
If a radical represents a real number and has an even index, the radicand
must be non-negative.
______
The radical 4 - x has an even index. So, 4 - x must be greater than
or equal to zero.
4-x0
4-x+x0+x Isolate the variable by applying algebraic operations
4x to both sides of the inequality symbol.
______
The radical 4 - x is only defined as a real number if x is less than or
equal to four. You can check this by substituting values for x that are
greater than four, equal to four, and less than four.

5.1 Working With Radicals MHR 273


Example 1
Convert Mixed Radicals to Entire Radicals
Express each mixed radical in entire radical form. Identify the values of
the variable for which the radical represents a real number.
__ __ 3
____
a) 7 2 b) a4 a c) 5b 3b2

Solution
__
a) Write the coefficient 7 as a square root: 7 = 72 .
Then, multiply the radicands of the square roots.
__ __ __
72 ( 2 )
7 2 = _____
72(2)
= _____
49(2)
= ___
= 98 How could you verify the answer?
____
b) Express the coefficient a4 as a square root: a4 = (a4)2 .
Multiply the radicals.
__ ____ __
(a4)2 ( a )
a4 a = _______
(a4)2(a)
= _____
a8(a)
= __
= a9

For the radical in the original expression to be a real number, the radicand
must be non-negative. Therefore, a is greater than or equal to zero.

c) Write the entire coefficient, 5b, as a cube root.


_____
3
(5b)3
5b = ____
3
= 53b3
Multiply
____
the ____
radicands____
of the cube roots.
5b 3b = ( ________
5 b )( 3b )
3 3 3
2 3 3 2
3
53b3(3b2)
= ______
3
= 375b5 Why can a radical with
an odd index have a
Since the index of the radical is an odd number, radicand that is positive,
the variable, b, can be any real number. negative, or zero?

Your Turn
Convert each mixed radical to an entire radical. State the values of the
variable for which the radical is a real number.
__ __ 3
___
a) 4 3 b) j 3 j c) 2k2( 4k )

Radicals in Simplest Form


A radical is in simplest form if the following are true.
The radicand does not contain a fraction or any factor which may
be removed.
The radical is not part of the denominator of a fraction.
___
For example, 18 is not in simplest
___
form because 18 has a square factor
__
of
9, which can be removed. 18 is equivalent to the simplified form 3 2 .

274 MHR Chapter 5


Example 2
Express Entire Radicals as Mixed Radicals
Convert each entire radical to a mixed radical in simplest form.
____ 4
__ _____
a) 200 b) c9 c) 48y5

Solution
a) Method 1: Use the Greatest Perfect-Square Factor D i d You K n ow?
The following
____
perfect squares are factors of 200: 1, 4, 25, and 100.
The radical symbol
Write 200 as a product using the greatest perfect-square factor. represents only the
____ ______
200 100(2)__
= ____ positive square root.
= 100__
( 2 ) So, even though
= 10 2 (-10)
____
2
= 100,
100 10.
____
100 = +10
Method 2: Use Prime Factorization ____
Express the radicand as a product of prime factors. The index is two. - 100 = -10 ___
In general, x 2 = x
So, combine pairs of identical factors.
____ ____________ only when x is positive.
200 = 2(2)(2)(5)(5)
________
= 22(2)(5__
2
)
= 2(5)
__
2
= 10 2

b) Method 1: Use Prime Factorization


4
__ ____________________
4
c9 = c(c)(c)(c)(c)(c)(c)(c)(c) What number tells you how many
________ identical factors to combine?
4 4 4
= c (c )(c)
4 __
= c(c) c
4 __
= c 2( c)

Method 2: Use Powers


4
__ _9
c9 = c 4 How will you decide what fractions
_8 + _1 to use for the sum?
=c 4 4

_8 _1
= c 4 (c 4 )
_1
= c2(c 4 )
4 __
= c2( c)
For the radical to represent a real number, c 0 because the index is
an even number.
_____
c) 48y 5
Determine the greatest perfect-square factors for the numerical and
variable parts.
_____ ___________
48y 5 = 16(3)(y
___
4
)(y) How can you determine the values of the variables
= 4y 2 3y for which the radical is defined as a real number?

Your Turn
Express each entire radical as a mixed radical in simplest form.
Identify any restrictions on the values for the variables.
___ 4
___ _______
a) 52 b) m7 c) 63n7p4

5.1 Working With Radicals MHR 275


D i d Yo u K n ow ?

A bentwood box is made from a single piece of wood. Heat


and moisture make the wood pliable, so it can be bent into a box.
First Nations peoples of the Pacic Northwest have traditionally
produced these boxes for storage, and some are decorated as
symbols of wealth.

Formline Revolution Bentwood Chest


by Corey Moraes, Tsimshian artist

Example 3
Compare and Order Radicals
Five bentwood boxes, each in the shape of a cube have
the following diagonal lengths, in centimetres.
_1 __ ____ __
4(13)2 8 3 14 202 10 2
Order the diagonal lengths from least to greatest without
using a calculator.

Solution
Express the diagonal lengths as entire radicals.
_1 ___ __ __ __ ____
4(13)2 = 4
__13 ___ 82 ( 3 )
8 3 = _____ 142
14 = ____
= 42 ( 13 ) 82(3)
= _____ = 196
______
= 42(13)
______ 64(3)
= ____
= 16(13)
____ = 192
= 208
____ __ ____ __
202 is already 102 ( 2 )
10 2 = ______
written as an entire 100(2)
= ____
radical. = 200

Compare
____
the five radicands
____ ____
and order
____
the numbers.
____
192 < 196 < 200 < 202 < 208
__ __ ____
The diagonal lengths from least to greatest are 8 3 , 14, 10 2 , 202 ,
_1
and 4(13)2 .

Your Turn
Order__the following
__ ___
numbers from least to greatest:
5, 3 3 , 2 6 , 23

Example 4
Add and Subtract Radicals
Simplify radicals and combine like terms.
___ __
a) 50___
+ 3 2 __ ___ ___
b) -___
27 + 3 5 - 80 - 2 12
___
c) 4c - 4 9c , c 0

276 MHR Chapter 5


Solution
___ __ _____ __
a) 50 + 3 2 = 25(2)
__
+ 3__2 __ __
= 5 __
2 + 3 2 How is adding 5 2 and 3 2 similar
= 8 2 to adding 5x and 3x?

___ __ ___ ___


b) 27 + 3 5 - __80 -____________
- _______ 2 12 _______
= - 3(3)(3)
__
+ __
3 5 -__
2(2)(2)(2)(5)
__
- 2 2(2)(3) How can you identify
3 + 3
= -3 __ 5 - 4 5 - 4 3 which radicals to
__ combine?
= -7 3 - 5
___ ___ __ __ __ __ __
c) 4c - 4 9c = 4 ( c ) - 4 9 ( c ) Why is __
4 not equal to 2?
__ __ Why is 9 not equal to 3?
= 2 c - 12 c
__
= -10 c
Your Turn
Simplify radicals and combine like terms.
__ __ ___ __ ____ ____
a) 2 7 + 13 7 b) 24 - 6 c) 20x - 3 45x , x 0

Example 5
Apply Addition of Radical Expressions
Consider the design shown for a skateboard
ramp. What is the exact distance across the base? 40 cm
30 cm
30 30

Solution
Redraw each triangle and use trigonometry to determine
the lengths, x and y, of the two bases.

40 cm 30 cm
30 30
x y
Recall the ratios of
tan 30 = _40
x tan 30 = _30
y the side lengths 2 60
1
_1__ = _
40 _1__ = _
30 of a 30-60-90
triangle. 30
3 x __ 3 y __ 3
x = 40 3 y = 30 3
Determine the
__
total length
__
of the bases.
x + y = 40 __
3 + 30 3
= 70 3
__
The distance across the entire base is exactly 70 3 cm.

Your Turn
What is the exact length of AB? 12 m 2 2m

45 30
A B

5.1 Working With Radicals MHR 277


Key Ideas

You can compare and order radicals using a variety of strategies:


 Convert unlike radicals to entire radicals. If the radicals have the same
index, the radicands can be compared.
 Compare the coefficients of like radicals.
 Compare the indices of radicals with equal radicands.
When adding or subtracting radicals, combine coefficients of like radicals.
r __ r __ r __
In general, m a + n a = (m + n) a , where r is a natural number, and m, n,
and a are real numbers. If r is even, then a 0.
A radical is in simplest form if the radicand does not contain a fraction
or any factor which may be removed, and the radical is not part of the
denominator of a fraction.
___ _____
For example, 5 40 = 5 __
4(10) ___
= 5 4 ( 10 )
___
= 5(2) 10
___
= 10 10
When a radicand contains variables, identify the values of the variables that
make the radical a real number by considering the index and the radicand:
 If the index is an even number, the radicand must be non-negative.
___
For example, in 3n , the index is even. So, the radicand must
be non-negative.
3n 0
n0
 If the index is an odd number, the radicand may be any real number.
3 __
For example, in x , the index is odd. So, the radicand, x, can
be any real numberpositive, negative, or zero.

Check Your Understanding

Practise 2. Express each radical as a mixed radical


1. Copy and complete the table. in simplest form.
___ ___
Mixed Radical Entire Radical a) 56 b) 3 75
___ ____
3
Form Form c) 24 d) c3d 2 , c 0, d 0
__
4 7 3. Write each expression in simplest form.
___
50 Identify the values of the variable for
__
-11 8 which the radical represents a real number.
____ ____ _____
3
- 200 a) 3 8m4 b) 24q5
5
_______
c) -2 160s5t 6

278 MHR Chapter 5


4. Copy and complete the table. State the Apply
values of the variable for which the radical 11. The air pressure, p, in millibars (mbar)
represents a real number. at the centre of a hurricane, and wind
speed, w, in metres per second, of the
Mixed Radical Entire Radical
Form Form hurricane_________
are related by the formula
__ w = 6.3 1013 - p . What is the exact
3n 5
3
______ wind speed of a hurricane if the air
-432
pressure is 965 mbar?
_
1 ___
7a
3

2a
3
______
128x4

5. Express each pair of terms as like


radicals. Explain your strategy.
__ ____
a) 15 5 and 8 125
______ ____
b) 8 112z 8 and 48 7z 4
4
___ 4
______
c) -35 w 2 and 3 81w 10
3
__ 3
___
d) 6 2 and 6 54
6. Order each set of numbers from least
to greatest.
__ __
a) 3 6 , 10, and 7 2
__

_72
__ __
b) -2 3 , -4, -3 2 , and -2
3
___
3 3
__ __
c) 21 , 3 2 , 2.8, 2 5
7. Verify your answer to #6b) using a
different method.
8. Simplify each expression.
__ __ __ 12. Saskatoon artist Jonathan Forrests
a) - 5 + 9 5 - 4 5
__ __ painting, Clincher, contains geometric
b) 1.4 2 + 9 2 - 7 shapes. The isosceles right triangle
___ ___
4 4
c) 11 - 1 - 5 11 + 15 at the top right has legs that measure
_9 ___ approximately 12 cm. What is the length
10 - _ 10 + _
__ 5 ___ 1 __
d) - 6 + 6 of the hypotenuse? Express your answer
2 2 3
9. Simplify. as a radical in simplest form.
___ ___
a) 3 75 - 27
___ __ ___
b) 2 18 + 9 7 - 63
___ ___
c) -8 45 + 5.1 - 80 + 17.4
____
d) _2 ___
81 + __ - 4 99 + 5 11
3 375 ___ ___ 3

3 4
10. Simplify each expression. Identify any
restrictions on the values for the variables.
__ __
a) 2 a3 + 6 a3
___ ___ __
b) 3 2x + 3 8x - x
3
_____ 3
_____
c) -4 625r + 40r 4
______
d)
w _
3
_____
-64 +
3
512w3 __ - _2 ____ ___
50w - 4 2w Clincher, by Jonathan Forrest Saskatoon, Saskatchewan
5 5 5

5.1 Working With Radicals MHR 279


13. The distance, d, in millions of kilometres, 16. You can use Herons formula to
between a planet and the Sun is a function determine the area of a triangle given
of the length, n, in Earth-days, of the _____ all three side lengths. The formula is
____________________
3
planets year. The formula is d = 25n2 . A = s(s - a)(s - b)(s - c) , where s
The length of 1 year on Mercury is represents the half-perimeter of the
88 Earth-days, and the length of 1 year triangle and a, b, and c are the three
on Mars is 704 Earth-days. side lengths. What is the exact area of
Use the subtraction a triangle with sides of 8 mm, 10 mm,
of radicals to and 12 mm? Express your answer as an
determine the entire radical and as a mixed radical.
difference between 17. Suppose an ant travels in a straight line
the distances of across the Cartesian plane from (3, 4) to
Mercury and Mars (6, 10). Then, it travels in a straight line
from the Sun. from (6, 10) to (10, 18). How far does
Express your answer the ant travel? Express your answer in
in exact form. Planet Venus exact form.
D id Yo u Know ? 18. Leslies backyard is in the shape of a
square. The area of her entire backyard
Distances in space are frequently measured in
astronomical units (AU). The measurement 1 AU
is 98 m2. The green square, which
represents the average distance between the Sun contains a tree, has an area of 8 m2.
and Earth during Earths orbit. According to NASA, What is the exact perimeter of one of
the average distance between Venus and Earth is the rectangular flowerbeds?
0.723 AU.

14. The speed, s, in metres per second, of


a tsunami is related to the depth, d,
in metres, of the water through which
it travels. This relationship can be____
modelled with the formula s = 10d ,
d 0. A tsunami has a depth of 12 m.
What is the speed as a mixed radical
and an approximation to the nearest
metre per second? 19. Kristen shows her solution to a radical
15. A square is inscribed in a circle. problem below. Brady says that Kristens
The area of the circle is 38 m . 2 final radical is not in simplest form. Is
he correct? Explain your reasoning.
Kristens Solution
___ _____ ___ ___
y 4y 3 + 64y 5 = y 4y 3
___+ 4y 4y
3
Acircle = 38 m2 3
= 5y 4y
20. Which __expression is not equivalent
to 12 6 ?
____ ___ ___ ___
a) What is the exact length of the 2 216 , 3 96 , 4 58 , 6 24
diagonal of the square? Explain how you know without using
b) Determine the exact perimeter technology.
of the square.

280 MHR Chapter 5


Extend Create Connections
21. A square, ABCD, has a perimeter of 4 m. 23. What are the exact values of the
CDE is an equilateral triangle inside common difference and missing
the square. The intersection of AC and terms in the following arithmetic
DE occurs at point F. What is the exact sequence? Justify your work.
___ __
length of AF? 27 , , , 9 3
B C
24. Consider the following set of radicals:
___ ___ ___ _1
-3 12 , 2 75 , - 27 , 108 2
E Explain how you could determine the
answer to each question without using
F
a calculator.
a) Using only two of the radicals, what
A D
is the greatest sum?
22. A large circle has centre C and diameter
AB. A smaller circle has centre D and b) Using only two of the radicals, what
diameter BC. Chord AE is tangent to the is the greatest difference?
smaller circle. If AB = 18 cm, what is 25. Support each equation using examples.
the exact length of AE? a) (-x)2 = x2
__
b) x2 x

C D
A B

Project Corner The Milky Way Galaxy

Our solar system is located in the Milky Way galaxy,


which is a spiral galaxy.
A galaxy is a congregation of billions of stars, gases,
and dust held together by gravity.
The solar system consists of the Sun, eight planets and
their satellites, and thousands of other smaller heavenly
bodies such as asteroids, comets, and meteors.
The motion of planets can be described by Keplers
three laws.
Keplers third law states that the ratio of the squares of
the orbital periods of any two planets is equal to the
ratio of the cubes of their semi-major axes. How could
you express Keplers third law using radicals? Explain
this law using words and diagrams.

5.1 Working With Radicals MHR 281


5.2
Multiplying and Dividing
Radical Expressions
Focus on . . .
performing multiple operations on radical expressions
rationalizing the denominator
solving problems that involve radical expressions

In the early 1980s, the Voyager spacecraft first


relayed images of a special hexagonal cloud pattern
at the north end of Saturn. Due to Saturns lengthy
year (26.4 Earth-years), light has not returned to its
north pole until recently. The space probe Cassini
has recently returned images of Saturns north pole.
Surprisingly, the hexagonal cloud feature appears to
have remained in place over nearly three decades.
Scientists are interested in the physics behind this
unusual feature of Saturn.

Investigate Radical Multiplication and Division

Materials Part A: Regular Hexagons and Equilateral Triangles


regular hexagon 1. Divide a regular hexagon into six identical equilateral triangles.
template or compass
and ruler to construct 2. Suppose the perimeter of the hexagon is 12 cm. Use trigonometry
regular hexagons to determine the shortest distance between parallel sides of the
ruler hexagon. Express your answer as a mixed radical and an entire
radical. What are the angle measures of the triangle you used?
Include a labelled diagram.
3. Use another method to verify the distance in step 2.
4. The distance between ____________
parallel sides of the hexagonal cloud
pattern on Saturn is 468 750 000 km. Determine the distance,
in kilometres, along one edge of the cloud pattern.

Reflect and Respond


5. Verify your answer to step 4.

282 MHR Chapter 5


Part B: Isosceles Right Triangles
and Rectangles
Saturn is more than nine times as
far from our Sun as Earth is. At
that distance, the Cassini probe is
too far from the Sun (1.43 billion
kilometres) to use solar panels to
operate. However, some spacecrafts
and some vehicles do use solar
panels to generate power. The
vehicle in the photograph uses solar
panels and was developed at the
University of Calgary.
Consider the following diagram
involving rectangular solar panels
and isosceles right triangular
solar panels.

__
6. The legs of the three congruent isosceles triangles are 3 m long.
Determine the dimensions and areas of the two rectangles.
7. What is the exact length of the hypotenuse of the large right
triangle? Express your answer in mixed radical form and in
entire radical form.
8. Verify your answer to step 7.

Reflect and Respond


9. Consider the two special triangles used in parts A and B. Use
trigonometry to relate the angles and ratios of the exact side
lengths in lowest terms?
10. Generalize a method for multiplying or dividing any two
radicals. Test your method using two examples.
11. Suppose you need to show a classmate how to multiply
and divide radicals. What radicals would you use in your
example? Why?

5.2 Multiplying and Dividing Radical Expressions MHR 283


Link the Ideas

Multiplying Radicals
When multiplying radicals, multiply the coefficients and multiply the
radicands. You can only multiply radicals if they have the same index.
__ ___ _______
(2 7 )(4 75 ) = (2)(4)
____
(7)(75)
= 8 ________
525
= 8 (25)(21)
___
Which method of simplifying a radical is being used?
= 8(5) 21
___
= 40 21
Radicals
__
can
___
be simplified
__
before multiplying:
_______
(2 7 )(4 75 ) = (2 7 )(4 (25)(3) )
__ __
= (2 7 )[(4)(5)( 3 )]
__ __
= (2 7 )(20______
3 )
= (2)(20)
___
(7)(3)
= 40 21

__ k
__ k
___
k
In general, (m a )(n b ) = mn ab , where k is a natural number, and
m, n, a, and b are real numbers. If k is even, then a 0 and b 0.

Example 1
Multiply Radicals
Multiply. Simplify the products where possible.
___ __
a) (-3 2x )(4 6 ), x 0
__ __ __
b) 7 3 (5 5 - 6 3 )
__ __ ___
c) (8 2 - 5)(9 5 + 6 10 )
3
___ 3 ___ 3
___
d) 9 2w ( 4w + 7 28 ), w 0

Solution
___ __ _______
a) (-3 2x )(4 6 ) = -3(4) (2x)(6)
_________
= -12 (2x)(2)(3)
___
= -12(2) 3x
___
= -24 3x
__ __ __ __ __ __ __
b) 7 3 (5 5 - 6 3 ) = 7 3___
(5 5 ) - 7__3 (6 3 ) Use the distributive property.
= 35 ___
15 - 42 9
= 35 ___
15 - 42(3)
= 35 15 - 126
__ __ ___
c) (8 __2 - __
5)(9 5 +__
6 10
___
) __ ___
= 8 2___
(9 5 ) + 8___
2 (6 10 ) - 5(9 5 ) - 5(6 10 )
__ ___ Use the distributive
= 10 + 48 ______
72 ___ 20 - 45 5 -__ 30 10 ___ property.
= 72 ___
10 + 48 __
(4)(5) - 45
__
5 - 30 10
___
Simplify the radicals.
= 72 ___
10 + 96 __
5 - 45 5 - 30 10

Collect terms with like
= 42 10 + 51 5 radicals.

284 MHR Chapter 5


___ ___ ___ _______ _______
3 3 3 3 3
d) 9 2w ( 4w + 7 28 ) = 9 2w(4w) + 63 2w(28)
3
____ 3
____
= 9 8w 2 + 63 56w
3
___ 3
___
= 18 w 2 + 126 7w
Your Turn
Multiply. Simplify where possible.
__ __
a) 5 3 ( 6 )
3
___ 3 __ 3
__
b) -2 11 (4 2 - 3 3 )
__ __ ___
c) (4 2 + 3)( 7 - 5 14 )
____ ___ __
d) -2 11c (4 2c3 - 3 3 ), c 0

Example 2
Apply Radical Multiplication
An artist creates a pattern similar
to the one shown, but he frames an
equilateral triangle inside a square
instead of a circle. The area of the
square is 32 cm2.
a) What is the exact perimeter of the
triangle?
b) Determine the exact height of the
triangle.
c) What is the exact area of the triangle?
Express all answers in simplest form.

Solution
Create a sketch of the problem.

Asquare = 32 cm2

___
a) The side length of the square is 32 cm.
___
Therefore, the base of the triangle is 32 cm long.
Simplify the side length.
___ _____
32 = 16(2) How could you determine the greatest
__
= 4 2 perfect-square factor of 32?

Determine
__
the __perimeter of the triangle.
3(4 2 ) = 12 2

__
The perimeter of the triangle is 12 2 cm.

5.2 Multiplying and Dividing Radical Expressions MHR 285


b) Construct the height, h, in the diagram.

Method 1: Use the Pythagorean Theorem


Since the height bisects the base of the
B
equilateral triangle, there is a __
right ABC.
The lengths of the legs are 2 2 and

__
h, and
the length of the hypotenuse is 4 2 , all 4 2 cm 4 2 cm
in centimetres.
__ 2 __ h
h2 + (2 2 ) = (4 2 )2
h2 + 4(2) = 16(2)
h2 + 8 = 32
A C
h2 = 24 __ 4 2 cm
h = 2 6
__
The height of the triangle is 2 6 cm. Why is only the positive root considered?

Method 2: Use Trigonometry


Identify ABC as a 30-60-90 triangle.
B
sin 60 = _ h __
__ 4 2
_3
=_ h __ 4 2 cm
30

2 4 2
__ __
h
__
4 2 ( 3 )
=h
2 __
2 6 = h 60
__ A C
The height of the triangle is 2 6 cm.

c) Use the formula for the area of a triangle, A = _1 bh.


2
A=_ 1 ( ___ __
32 )(2 6 )
2 _______
A = ____
(32)(6)
A = 192__
A = 8 3 __
The area of the triangle is 8 3 cm2.

Your Turn
___
An__isosceles triangle has a base of 20 m. Each of the equal sides is
3 7 m long. What is the exact area of the triangle?

Dividing Radicals
When dividing radicals, divide the coefficients and then divide the
radicands. You can only divide radicals that have the same index.
__ __
_ 3
4 6
__ = 2
_6 3
3
2 3 3
3
__
= 2 2
__ __
In general, __ _
m _
k
m a a , where k is a natural number, and m, n, a,
k
__ =
n b n b
k

and b are real numbers. n 0 and b 0. If k is even, then a 0 and


b > 0.

286 MHR Chapter 5


Rationalizing Denominators
To simplify an expression that has a radical in the denominator,
you need to rationalize the denominator. rationalize
For an expression with a monomial square-root denominator, convert to a rational
number without
multiply the numerator and denominator by the radical term changing the value
from the denominator. of the expression
__ If the radical is in the
_
5 __ = _
5 __ _
2 3
3
__
2 3 3 ( )
__
Why is this product equivalent to the original expression? denominator, both
the numerator and
denominator must be
= __
5__3 __
multiplied by a quantity
2 __
3 ( 3 ) that will produce a
= _
5 3 rational denominator.
6
For a binomial denominator that contains a square root, multiply both
the numerator and denominator by a conjugate of the denominator. conjugates
two binomial factors
The product of a pair of conjugates is a difference of squares. whose product is the
difference of two
(a - b)(a + b) = a2 - b2 squares
__ __ __ __ __ __ __ __ __ __
( u + v )( u - v ) = ( u )2 + ( v )( u ) - ( v )( u ) - ( v )2 the binomials
=u-v (a + b) and (a - b)
__ are conjugates since
In the radical expression, __
5 3 __ __
, the conjugates of 4 - 6 are their product is
__ __ 4 - 6 a2 - b2
4 + 6 and -4 - 6 . If you multiply either of these expressions
with the denominator, the product will be a rational number.
__ __ __
__ = __
5 3 __ __
5 3 __
4- 6 ( 4 - 6 )( 4 + 6 )
4 + 6

__
__

___

= ___
20 3 + 5__18
4 - ( 6 )2
2
__ ____

= ___
20 3 + 5 9(2)
16 - 6
__ __
= ___
20 3 + 15 2
10
__ __
= ___
4 3 + 3 2 Express in simplest form.
2

Example 3
Divide Radicals
Simplify each expression.
_____ ___
a) __
24x 2
___ , x > 0 b) __
4 5n
__ , n 0
3x 3 2
___
c) __
__11 d) __
4 11
__ , y 0
3
5 +7 y 6

5.2 Multiplying and Dividing Radical Expressions MHR 287


Solution
_____ _____
_____ = _
24x2 24x2
a)
3x 3x
___

= 8x
___
= 2 2x
___ ___ __
__ __ = __
4 5n
__ _
b)
3 2
4 5n 2
__
3 2 2
____
( ) Rationalize the denominator.

= __
4 10n
3(2)
____
= __
2 10n

3
__ __
__ = __ __
c) __11
5
__11
+7
5 - 7
__
( 5 + 7 5 - 7
__
)( ) How do you determine a conjugate of 5 + 7?

= ___
11( 5 - 7)

__
( 5 )2 - 72
__
= ___
11( 5 - 7)
5 - 49
__
= ___
11( 5 - 7)
-44
__
= __
-( 5 - 7)
4__
= __
7 - 5
4
The solution can be verified using decimal approximations.
Initial expression: Final expression:
__
____11 1.19098 __
7 - 5
1.19098
5 + 7 4
___ ___ __ 2
4 11 (__
6 )
(( ) )
3

d) __
4 11
__ =
__ __ __ How does the index help you determine
3 3 3 2
y 6 y 6 6 what expression to use when rationalizing
___ 3 __ 3 __ the denominator?
= ___
4 11 ( 6 )( 6 )
__ 3 __ 3 __
3
y 6 ( 6 )( 6 )
___ 3 ___
= ___
4 11 ( 36 )
y(6)
___ 3 ___
= ___
2 11 ( 36 )
3y

Your Turn
Simplify each quotient. Identify the values of the variable
for which the expression is a real number.
___
a) __ 51
2 __
b) __
-7
___
3
3 2 9p
c) __
__2 d) __
6
___
3 5 - 4 4x + 1

288 MHR Chapter 5


Key Ideas

When multiplying radicals with identical indices, multiply the coefficients


and multiply the radicands:
__ ___
k __ k k
(m a )(n b ) = mn ab
where k is a natural number, and m, n, a, and b are real numbers.
If k is even, then a 0 and b 0.
When dividing two radicals with identical indices, divide the coefficients
and divide the radicands:
k __ __
__
m a _
m k_a
k

n b
__ = n b
where k is a natural number, and m, n, a, and b are real numbers.
n 0 and b 0. If k is even, then a 0 and b > 0.
When multiplying radical expressions with more than one term, use the
distributive property and then simplify.
To rationalize a monomial denominator, multiply the numerator and
denominator by an expression that produces a rational number in the
denominator.
__ __
_
2 __
5
__5

( )
4 4
( n ) 2( n )
__ 5 __ 5 4
=
n ( n ) n
To simplify an expression with a square-root binomial in the denominator,
rationalize the denominator using these steps:
 Determine a conjugate of the denominator.
 Multiply the numerator and denominator by this conjugate.
 Express in simplest form.

Check Your Understanding

Practise
1. Multiply. Express all products in 2. Multiply using the distributive property.
simplest form. Then, simplify.
__ __ ___ __
a) 2 5 (7 3 ) a) 11 (3 - 4 7 )
___ __ __ __ __ ___
b) - 32 (7 2 ) b) - 2 (14 5 + 3 6 - 13 )
___ 4 __ __ __
2 48 ( 5 )
4
c) c) y (2 y + 1), y 0
____ ____ __ ___
d) 4 19x ( 2x2 ), x0 d) z 3 (z 12 - 5z + 2)
_____ ____
3
e) 54y 7 6y 4 ( 3
) 3. Simplify. Identify the values of the
__ variables for which the radicals
_t ), t 0
__
f) 6t 3t2 ( 4
represent real numbers.
__ __
a) -3( 2 - 4) + 9 2
__ __
b) 7(-1 - 2 6 ) + 5 6 + 8
__ __ ___ __
(
c) 4 5 3j + 8 - 3 15j + 5
___
)
3 __
d) 3 - 4k (12 + 2 8 )
3

5.2 Multiplying and Dividing Radical Expressions MHR 289


4. Expand and simplify each expression. 9. Determine a conjugate for each
__ __
a) (8 7 + 2)( 2 - 3) binomial. What is the product of
__ __ each pair of conjugates?
b) (4 - 9 5 )(4 + 9 5 ) __
__ ___ __ ___ a) 2 3 + 1
c) ( 3 + 2 15 )( 3 - 15 ) ___
__ ___ 2 b) 7 - 11
d) ( 3
6 2 - 4 13 ) __ __
__ __ __ c) 8 z - 3 7 , z 0
__ ___
e) (- 6 + 2)(2 2 - 3 5 + 1) d) 19 h + 4 2h , h 0
5. Expand and simplify. State any restrictions 10. Rationalize each denominator. Simplify.
on the values for the variables.
__ ___ a) __
5 __
a) (15 c + 2)( 2c - 6) 2 - 3
____ ___ __
b) __
b) (1 - 10 8x3 )(2 + 7 5x ) 7__2
____ ____ 6 + 8
c) (9 2m - 4 6m )2 __
c) __
___ ___ ____ - 7 __
d) (10r - 4 4r )(2 6r 2 + 3 12r )
3 3 3 __
5 - 2 2
__ ___
d) __
6. Divide. Express your answers in 3 + 13
__ ___
simplest form. 3 - 13
___
a) _
80
___ 11. Write each fraction in simplest form.
10
___ Identify the values of the variables for
b) __ 12
-2 __ which each fraction is a real number.
a) __
4 3
___ __4r
c) __ 22
3 ___ 6 r + 9
___
11
______ b) __3n
18____
d) __ 135m
3 _____
,m>0
5 24n
21m 3
c) __
8 __
7. Simplify. 4- 6t
___
______ _____
____
9 432p - 7 27p 5 5
d) __
5 3y
___
a) _____ ,p>0 10 +2
33p4
___ 12. Use the distributive
___
property to simplify
b) __
6 4v
3

____ , v > 0
7 __
(c + c c )(c + 7 3c ), c 0.
3
14v

8. Rationalize each denominator. Express Apply


each radical in simplest form. 13. Malcolm tries to rationalize the

a) _
20 denominator in the expression
10
___
__ 4 __ as shown below.
___ 3 - 2 2
b)
-__
21
____ , m >0 a) Identify, explain, and correct any errors.
7m
_____ b) Verify your corrected solution.
c) - _2 _
5 ,u>0
3 12u Malcolms solution: __
__ 4 __ = __ __
)( 3 + 2 2 )
___ 4 __ 3 + 2 2
d) 20 _
3 6t
5 3 - 2 2 3 - 2 2 ( ____

__

= ___
12 + 8 4(2)
9 - 8 __
= 12 + 16 2

290 MHR Chapter 5


14. In a golden rectangle, the ratio of the 16. Jonasie and Iblauk are planning a
side dimensions is __
__2 . Determine skidoo race for their community of
5
-1 Uqsuqtuuq or Gjoa Haven, Nunavut.
an equivalent expression with a rational They sketch the triangular course on
denominator. a Cartesian plane. The area of 1 grid
15. The period, T, in seconds, of a pendulum square represents 9245 m2. What is
is related to its length, L, in metres. The the exact length of the red track?
period is the time to complete one full y
cycle and can be approximated
___
with the
4
formula T = 2 _ L .
10 2
a) Write an equivalent formula with a
rational denominator. -4 -2 0 2 4 x
b) The length of the pendulum in the -2
HSBC building in downtown Vancouver
is 27 m. How long would the pendulum __ __
__ __ __
take to complete 3 cycles? 17. Simplify ( 2 - 3 )( 2 - 3 ).
1 + 5

1 - 5
__

18. In a scale model of a cube, the ratio of


the volume of the model to the volume of
the cube is 1 : 4. Express your answers to
each of the following questions as mixed
radicals in simplest form.
a) What is the edge length of the actual
cube if its volume is 192 mm3?
b) What is the edge length of the model
cube?
c) What is the ratio of the edge length of
the actual cube to the edge length of
the model cube?
___
19. Lev simplifies the expression, __
2x 14
_______ .
3
- 5x
He determines the restrictions on the
values for x as follows:
3 - 5x > 0
-5x > -3
x >_ 3
5
a) Identify, explain, and correct any errors.

D id Yo u K n ow ? b) Why do variables involved in radical


expressions sometimes have restrictions
The pendulum in the HSBC building in downtown
on their values?
Vancouver has a mass of approximately 1600 kg. It
is made from buffed aluminum and is assisted at the c) Create an expression involving radicals
top by a hydraulic mechanical system. that does not have any restrictions.
Justify your response.

5.2 Multiplying and Dividing Radical Expressions MHR 291


20. Olivia simplifies the following expression. Create Connections
Identify, explain, and correct any errors in 28. Describe the similarities and differences
her work. between multiplying and dividing radical
___ ___ __
___ expressions and multiplying and dividing
= ___ _
2c - c__25 (2c - c 25 ) 3
3
__
__
3 ( )
3
___
__
polynomial expressions.
29. How is rationalizing a square-root binomial
= ___
3 (2c - c 25 )
3 denominator related to the factors of a
__
= ___ 3 (2c
5c) difference of squares? Explain, using an
__ 3 __ example.
= __
3 (7c)
or __
3 (-3c)
30. A snowboarder departs from a jump. The
3 __ 3 quadratic function that approximately
= __
7c 3
or -c 3
__
relates height above landing area, h, in
3
metres, and time in air, t, in seconds, is
21. What is the volume of the right
h(t) = -5t2 + 10t + 3.
triangular prism?
a) What is the snowboarders height above
the landing area at the beginning of
the jump?
b) Complete the square of the expression
5 7 cm 7 14 cm on the right to express the function in
vertex form. Isolate the variable t.
3 2 cm
c) Determine the exact height of the
snowboarder halfway through the jump.
Extend
22. A cube is inscribed in a sphere with
radius 1 m. What is the surface area
of the cube?
23. Line___
segment
___
AB has endpoints
___ ___
A( 27 , - 50 ) and B(3 48 , 2 98 ).
What is the midpoint of AB?
24. Rationalize the denominator of
__
(3( x )-1 - 5)-2. Simplify the expression.
25. a) What are the exact roots of the
quadratic equation x2 + 6x + 3 = 0?
b) What is the sum of the two roots
from part a)?
c) What is the product of the two roots?
d) How are your answers from
parts b) and c) related to the
original equation? D i d You K n ow ?
__
26. Rationalize the denominator of _
c
a
_. n Maelle Ricker from North Vancouver won a gold
r
medal at the 2010 Vancouver Olympics in snowboard
27. What is the exact surface area of the cross. She is the rst Canadian woman to win a gold
right triangular prism in #21? medal at a Canadian Olympics.

292 MHR Chapter 5


___ ___
31. Are m = __
-5 + 13
and m = __
-5 - 13
6 6 33. MINI LAB
solutions of the quadratic equation, Step 1 Copy and complete the table of values
3m2 + 5m + 1 = 0? Explain your for each equation using technology.
reasoning. __
y= x y = x2
32. Two stacking bowls are in the shape of
x y x y
hemispheres. They have radii that can
____ ______ 0 0
be represented by _
33V and __
2 V4
- 1,
3
1 1
where V represents the volume of 2 2
the bowl. 3 3
a) What is the ratio of the larger 4 4
radius to the smaller radius in
Step 2 Describe any similarities and
simplest form?
differences in the patterns of
b) For which volumes is the ratio numbers. Compare your answers
a real number? with those of a classmate.
Step 3 Plot the points for both functions.
Compare the shapes of the two graphs.
How are the restrictions on the variable
for the radical function related to the
quadratic function?

Project Corner Space Exploration

Earth has a diameter of about 12 800 km and a mass of about


6.0 1024 kg. It is about 150 000 000 km from the Sun.
Artificial gravity is the emulation in outer space of the effects
of gravity felt on a planetary surface.
When travelling into space, it is necessary to overcome the
force of gravity. A spacecraft leaving Earth must reach a
gravitational escape velocity greater than 11.2 km/s. Research
the formula for calculating the escape velocity. Use the
formula to determine the escape velocities for the Moon
and the Sun.

5.2 Multiplying and Dividing Radical Expressions MHR 293


5.3
Radical Equations
Focus on . . .
solving equations involving square roots
determining the roots of a radical equation algebraically
identifying restrictions on the values for the variable in a radical equation
modelling and solving problems with radical equations

How do the length and angle of elevation of a ramp


affect a skateboarder? How do these measurements
affect the height at the top of a ramp? The relationships
between measurements are carefully considered when
determining safety standards for skate parks, playground
equipment, and indoor rock-climbing walls. Architects
and engineers also analyse the mathematics involved
in these relationships when designing factories and
structures such as bridges.

Did Yo u Know ?

Shaw Millenium Park, in Calgary, Alberta, is the largest skate park in


North America. It occupies about 6000 m2, which is about the same area
as a CFL football eld.

Investigate Radical Equations

Materials 1. To measure vertical distances, place a metre stick vertically


three metre sticks against a wall. You may need to tape it in place. To measure
grid paper horizontal distances, place another metre stick on the ground
at the base of the first metre stick, pointing out from the wall.
2. Lean a metre stick against the vertical metre stick. Slide the top
of the diagonal metre stick down the wall as the base of it moves
away from the wall. Move the base a horizontal distance, h, of
10 cm away from the wall. Then, measure the vertical distance,
v, that the top of the metre stick has slid down the wall.
3. Create a table and record values of v for 10-cm increments of h,
up to 100 cm.
Horizontal Distance From Vertical Distance Down
Wall, h (cm) Wall, v (cm)
0
10
20

294 MHR Chapter 5


4. Analyse the data in the table to determine
whether the relationship between v and h
is linear or non-linear. Explain how you
determined your answer.
5. Refer to the diagram. If the diagonal metre
stick moves v centimetres down and h
centimetres away from the wall, determine
the dimensions of the right triangle.

100 cm
100 cm

6. Write an equation describing v as a function


of h. Use your equation to verify two
measurements from your table in step 3.

Reflect and Respond


7. Estimate the value of h, to the nearest centimetre, when
v = 25 cm. Verify your estimate using a metre stick.
8. As the base of the____
metre stick passes ____
through the horizontal
interval from (5 199 - 5) cm to (5 199 + 5) cm, what is the radical equation
vertical change? an equation with
radicals that have
9. How is solving a radical equation similar to solving a linear
variables in the
equation and a quadratic equation? Compare your answers radicands
with those of a classmate.

Link the Ideas

When solving a radical equation, remember to:


identify any restrictions on the variable
identify whether any roots are extraneous by determining whether
the values satisfy the original equation

5.3 Radical Equations MHR 295


Example 1
Solve an Equation With One Radical Term
_______
a) State the restrictions on x in 5 + 2x - 1 = 12 if the radical is a
real number.
_______
b) Solve 5 + 2x - 1 = 12.

Solution
Did Yo u Know ? a) For the radical to be a real number, the radicand, 2x - 1, must be
greater than or equal to zero because the index is even. Isolate the
When multiplying or
dividing both sides
variable by performing the same operations on both sides.
of an inequality by 2x - 1 0
a negative number, 2x 1
x_
you need to reverse 1
the direction of the 2
inequality symbol.
For example, For the radical to represent a real number, the variable x must be any
3 - 5n 0 real number greater than or equal to _1.
-5n - 3 2
_-5n

_-3
-5 -5 b) Isolate the radical expression. Square both sides of the equation.
n
_3 Then, solve for the variable.
5 _______
Check the solution by 5+ 2x - 1
_______
= 12
isolating the variable 2x - 1 = 7
_______ 2
in a different way or ( 2x - 1 ) = (7)2 What does squaring both sides do?
by substituting values 2x - 1 = 49
for the variable.
2x = 50
x= 25
The value of x meets the restriction in part a).

Check that x = 25 is a solution to the original equation.


Left Side_______ Right Side
2x - 1
5 + _________ 12
= 5 + _______
2(25) - 1
= 5 + ___
50 - 1
= 5 + 49
=5+7
= 12

Left Side = Right Side


Therefore, the solution is x = 25.

Your Turn ___

Identify any restrictions on y in -8 + _


3y
5
= -2 if the radical is a real
number. Then, solve the equation.

296 MHR Chapter 5


Example 2
Radical Equation With an Extraneous Root
______
What are the restrictions on n if the equation n - 5 - n = -7 involves
real numbers? Solve the equation.

Solution
5-n0 Why must the radicand be non-negative?
5n
The value______
of n can be any real number less than or equal to five.
n - 5 - n = -7 ______
Why, in this case, is the radical isolated
n + 7 = 5______
-n on the right side of the equal sign?
2
(n + 7)2 = ( 5 - n )
2
n + 14n + 49 = 5 - n
n2 + 15n + 44 = 0
Select a strategy to solve the quadratic equation.
Method 1: Factor the Quadratic Equation
n2 + 15n + 44 = 0
(n + 11)(n + 4) = 0 How can you use the zero product property?
n + 11 = 0 or n + 4 = 0
n = -11 n = -4 ________
Method 2: Use the Quadratic Formula, x = ____
-b b2 - 4ac
_____________
2a

n = _____
2
-15 15 - 4(1)(44)
How can you identify the values for a, b, and c?
2(1)
__________
n = ____
-15 225 - 176
2
n= __
-15 + 7
or n = __
-15 - 7
2 2
n = -4 n = -11
______
Check n = -4 and n = -11 in the original equation, n - 5 - n = -7.
For n = -4: For n = -11:
Left Side______ Right Side Left Side______ Right Side
n - 5 _________
-n -7 n - 5 -__________
n -7
= -4 - 5 - (-4) = -11 - 5 - (-11)
= -4 - 3 = -11 - 4
= -7 = -15
Left Side = Right Side Left Side Right Side

The solution is n = -4. The value n = -11 is extraneous. Extraneous


roots occur because squaring both sides and solving the quadratic
equation may result in roots that do not satisfy the original equation.

Your Turn
_______
State the restrictions on the variable in m - 2m + 3 = 6 if the equation
involves real numbers. Then, solve the equation.

5.3 Radical Equations MHR 297


Example 3
Solve an Equation With Two Radicals
___ _______
Solve 7 + 3x = 5x + 4 + 5, x 0. Check your solution.

Solution
Isolate one radical and then square both sides.
___ _______
7 + ___
3x = 5x + 4 +
_______
5
2 + 3x = 5x + 4 Why is it beneficial to isolate
___ _______
(2 + 3x )2 the more complex radical first?
= ( 5x + 4 )2
___
4 + 4 3x + 3x = 5x + 4
Isolate the remaining radical, square both sides, and solve.
___
4 3x = 2x
___
(4 3x )2 = (2x)2
16(3x) = 4x 2
48x = 4x 2
0 = 4x 2 - 48x
0 = 4x(x - 12)
4x = 0 or x - 12 = 0
x=0 x = 12
Check x = 0 and x = 12 in the original equation.
For x = 0:
Left Side___ Right Side
_______
3x
7 + ____ 5x + 4 + 5
________
= 7 + __3(0) = 5(0) + 4 + 5
= 7 + 0 =2+5
=7 =7
Left Side = Right Side
For x = 12:
Left Side___ Right Side
_______
3x
7 + _____ 5x + 4 + 5
_________
= 7 + ___
3(12) 5(12) + 4 + 5
= ___
= 7 + 36 = 64 + 5
= 13 = 13
Left Side = Right Side
The solutions are x = 0 and x = 12.

Your Turn
Solve 3 + j + 2j - 1 = 5, j _
_____ ______
1.
2

298 MHR Chapter 5


Example 4
Solve Problems Involving Radical Equations
What is the speed, in metres per second, of a 0.4-kg football
that has 28.8 J of kinetic energy? Use the kinetic energy
formula, Ek = _1 mv2, where E represents the kinetic energy,
2 k

in joules; m represents mass, in kilograms; and v


represents speed, in metres per second.

Solution
Method 1: Rearrange the Equation
Ek = _
1 mv2
2
_2Ek 2
m =v
____
2Ek
_
Why is the symbol
m =v included in this step?

Substitute m = 0.4 and Ek = 28.8 into


____
2E
the radical equation, v = _m .
k

________

v= __
2(28.8)
0.4
Why is only the positive
root considered?
v = 12
The speed of the football is 12 m/s.
Method 2: Substitute the Given Values and Evaluate
Ek = _1 mv2
2
28.8 = _1 (0.4)v2
2
144 = v2
12 = v
The speed of the Why is only the positive
football is 12 m/s. root considered?

Your Turn
Josh is shipping several small musical instruments in
a cube-shaped box, including a drumstick which just
fits diagonally in the box. Determine the formula for
the length, d, in centimetres, of the drumstick in
terms of the area, A, in square centimetres, of one
face of the box. What is the area of one face of a
cube-shaped box that holds a drumstick of length
23.3 cm? Express your answer to the nearest square
centimetre.

5.3 Radical Equations MHR 299


Key Ideas

You can model some real-world relationships with radical equations.


When solving radical equations, begin by isolating one of the radical terms.
To eliminate a square root, raise
______
both sides of the equation to the exponent
two. For example, in 3 = c + 5 , square both sides.
______ 2
32 = ( c + 5 )
9=c+5
4=c
To identify whether a root is extraneous, substitute the value into the
original equation. Raising both sides of an equation to an even exponent
may introduce an extraneous root.
When determining restrictions on the values for variables, consider the
following:
 Denominators cannot be equal to zero.
 For radicals to be real numbers, radicands must be non-negative if the
index is an even number.

Check Your Understanding

Practise 4. Solve each radical equation. Verify


Determine any restrictions on the values your solutions.
__
for the variable in each radical equation, a) z + 8 = 13

unless given. __
b) 2 - y = -4
1. Square each expression. ___
___ c) 3x - 8 = -6
a) 3z , z 0 _____
______ d) -5 = 2 - -6m
_____
b) x - 4 , x 4
______ 5. In the solution to k + 4 = -2k ,
c) 2 x + 7 , x -7 identify whether either of the values,
d) -4 9 - 2y ,
_______
_9 y k = -8 or k = -2, is extraneous. Explain
2 your reasoning.
2. Describe the steps to solve the equation
__ 6. Isolate each radical term. Then, solve
x + 5 = 11, where x 0.
the equation.
3. Solve each radical equation. Verify your ______
a) -3 n - 1 + 7 = -14, n 1
solutions and identify any extraneous
roots.
_______
b) -7 - 4 2x - 1 = 17, x _1
___ ______ 2
a) 2x = 3 c) 12 = -3 + 5 8 - x , x8
_____
b) -8x = 4
_______
c) 7 = 5 - 2x

300 MHR Chapter 5


7. Solve each radical equation. 13. Collision investigators can approximate
_______
a) m2 - 3 = 5 the initial velocity, v, in kilometres per
_________ hour, of a car based on the length, l, in
b) x2 + 12x = 8
________ metres, of _the skid mark. The formula
_q + 11 = q - 1
2
c) v = 12.6 l + 8, l 0, models the
2 ______ relationship. What length of skid is
d) 2n + 2 n2 - 7 = 14 expected if a car is travelling 50 km/h
8. Solve each radical equation. when the brakes are applied? Express your
_______
a) 5 + 3x - 5 = x answer to the nearest tenth of a metre.
_________
b) x2 + 30x = 8
______
c) d + 5 = d - 1
______

d) _
j+1
3
+ 5j = 3j - 1
9. Solve each radical equation.
___ __
a) 2k = 8
_____ _____
b) -3m
__
= -7m

_2j =
____
c) 5 200
__ ___
d) 5 + n = 3n

10. Solve.
______ _______
a) z + 5 = 2z - 1 14. In 1805, Rear-Admiral Beaufort created
_______ _________
b) 6y - 1 = -17 + y 2 a numerical scale to help sailors quickly
______ _____ assess the strength of the wind. The
c) 5r - 9 - 3 = r + 4 - 2
_______ ______ integer scale ranges from 0 to 12. The wind
d) x + 19 + x - 2 = 7 scale, B, is related to the wind velocity, v,
in kilometres per hour, by the formula
________
Apply B = 1.33 v + 10.0 - 3.49, v -10.
11. By inspection, determine which one of
a) Determine the wind scale for a wind
the following equations will have an velocity of 40 km/h.
extraneous root. Explain your reasoning.
_______ b) What wind velocity results in a wind
3y - 1 - 2 = 5 scale of 3?
______
4 - m + 6 = -9
______
x + 8 + 9 = 2

12. The following steps_______


show how Jerry solved
the equation 3 + x + 17 = x. Is his
work correct? Explain your reasoning and
provide a correct solution if necessary.
Jerrys Solution
_______
3 + _______
x + 17 x=
x + 17 x-3
=
_______
( x + 17 )2 x2 - 32
=
x + 17 x2 - 9
=
0 x2 - x - 26
= We b Link
________
x= ___
1 1 + 104
To learn
earn more a
about the Beaufort scale, go to
2
____ www.mhrprecalc11.ca and follow the links.
x = __
1 105

2
5.3 Radical Equations MHR 301
15. The mass, m, in 18. The distance d, in kilometres, to the
kilograms, that a horizon from a height, h, in kilometres, can
________
beam with a fixed be modelled by the formula d = 2rh + h2 ,
width and length where r represents Earths radius, in
can support is kilometres. A spacecraft is 200 km above
related to its Earth, at point S. If the distance to the
thickness, t, in horizon from the spacecraft is 1609 km,
centimetres. The what is the radius of Earth?
formula is S
___
t=_ 1 _
m , m 0.
5 3 h
d
If a beam is 4 cm
thick, what mass
r
can it support?
r
16. Two more than the square root of a
number, n, is equal to the number. Model
this situation using a radical equation.
Determine the value(s) of n algebraically.
17. The speed, v, in metres per second, of Extend
water being pumped into the air to fight a 19. Solve for___
a in the equation
___
fire is the square root of twice the product 3x = ax + 2, a 0, x > 0.
of the maximum height, h, in metres, and 20. Create a radical equation that results in
the acceleration due to gravity. At sea the following types of solution. Explain
level, the acceleration due to gravity is how you arrived at your equation.
9.8 m/s2.
a) one extraneous solution and no
a) Write the formula that models the valid solutions
relationship between the speed and
b) one extraneous solution and one
the height of the water.
valid solution
b) Suppose the speed of the water being
21. The time, t, in seconds, for an object to fall
pumped is 30 m/s. What expected
to the ground is related to its height, h, in
height will the spray reach?
metres, above the ground. The formulas
____ for
c) A local fire department needs to buy a
determining this time are tm = _h

for the
pump that reaches a height of 60 m. An ____ 1.8
moon and tE = _
advertisement for a pump claims that it h for Earth. The same
can project water at a speed of 35 m/s. 4.9
Will this pump meet the departments object is dropped from the same height on
requirements? Justify your answer. both the moon and Earth. If the difference
in times for the object to reach the ground
is 0.5 s, determine the height from which
the object was dropped. Express your
answer to the nearest tenth of a metre.
22. Refer to #18. Use the formula
________
d = 2rh + h2 to determine the height
of a spacecraft above the moon, where
the radius is 1740 km and the distance
to the horizon is 610 km. Express your
answer to the nearest kilometre.

302 MHR Chapter 5


23. The profit, P, in dollars, of a business can 27. MINI LAB A continued radical is a series
be expressed as P = -n2 + 200n, where n of nested radicals that may be infinite but
represents the number of employees. has a finite rational result. Consider the
a) What is the maximum profit? How following continued radical:
many employees are required for ________________________
__________________
____________
_______
this value? 6 + 6 + 6 + 6 +
b) Rewrite the equation by isolating n. Step 1 Using a calculator or spreadsheet
c) What are the restrictions on the radical software, determine a decimal
portion of your answer to part b)? approximation for the expressions
in the table.
d) What are the domain and range for
the original function? How does your Number
answer relate to part c)? of Nested Decimal
Radicals Expression Approximation
________
__
Create Connections 1 6 + 6
24. Describe the similarities and differences _____________
________
__
between solving a quadratic equation and 2 6 + 6 + 6
___________________
_____________
________
solving a radical equation. 6 + 6 + 6 + 6
__
3
25. Why are extraneous roots sometimes
4
produced when solving radical equations?
5
Include an example and show how the root
6
was produced.
7
26. An equation to determine the annual
growth rate, r, of a population of moose 8

in Wells Gray Provincial Park, British 9


Columbia, over a 3-year period is
___ Step 2 From your table, predict the value of
3 Pf
r = -1 + _ , Pf 0, Pi > 0. In the
the expression
________________________
__________________
____________
Pi _______
6 + 6 ________________________
+ 6 + 6 + .
equation, Pi represents the initial __________________
____________
_______
population 5 years ago and Pf represents Step 3 Let x = 6 + 6 + 6 + 6 + .
the final population after 3 years. Solve the equation algebraically.
a) If Pi = 320 and Pf = 390, what is the Step 4 Check your result with a classmate.
annual growth rate? Express your Why does one of the roots need to be
answer as a percent to the nearest tenth. rejected?
b) Rewrite the equation by isolating Pf . Step 5 Generate another continued radical
c) Determine the four populations of expression that will result in a finite
moose over this 3-year period. real-number solution. Does your
d) What kind of sequence does the set of answer have a rational or an irrational
populations in part c) represent? root?
Step 6 Exchange your radical expression
in step 5 with a classmate and solve
their problem.

5.3 Radical Equations MHR 303


Chapter 5 Review
5.1 Working With Radicals, pages 272281 8. The city of Yorkton, Saskatchewan, has an
1. Convert each mixed radical to an entire area of 24.0 km2. If this city were a perfect
radical. square, what would its exact perimeter be?
__ Express your answer as a mixed radical in
a) 8 5
5
__ simplest form.
b) -2 3
__
c) 3y 3 7
3
___
d) -3z( 4z )
2. Convert each entire radical to a mixed
radical in simplest form.
___
a) 72
___
b) 3 40
_____
c) 27m2 , m 0
_______ 9. State whether each equation is true or
3
d) 80x5y 6
false. Justify your reasoning.
3. Simplify.
___ ___ a) -32 = 9
a) - 13 + 2 13
__ ____ b) (-3)2 = 9
b) 4 7 - 2 112 __
3 3
__ ___ c) 9 = 3
c) - 3 + 24
4. Simplify radicals and collect like terms.
State any restrictions on the values for 5.2 Multiplying and Dividing Radical
the variables. Expressions, pages 282293
_____ ____ ___ ______
a) 4 45x3 - 27x + 17 3x - 9 125x3 10. Multiply. Express each product as
____
b) _2 ____
44a + 144a - __
______ 11a 3 a radical in simplest form.
5 2 __ __
5. Which of the following expressions is a) 2 ( 6 )
__ ___ __
not equivalent to 8 7 ?
b) (-3f 15 )(2f 3 5 )
____ ____ ___ ___ 4
__ 4
___
2 112 , 448 , 3 42 , 4 28 c) ( 8 )(3 18 )
Explain how you know without using 11. Multiply and simplify. Identify any
technology. restrictions on the values for the
6. Order the following numbers from least variable in part c).
__ ___ ___ __ __
to greatest: 3 7 , 65 , 2 17 , 8 a) (2 - 5 )(2 + 5 )
__ __
7. The speed, v, in kilometres per hour, of a b) (5 3 - 8 )2
car before a collision can be approximated __ ___
from the length, d, in metres, of the skid
c) (a + 3 a )(a + 7 4a )
___ ___
12. Are x = __ and x = __
mark left by the tire. On a dry day, one 5 + 17 5 - 17
formula that approximates this speed is
_____ 2 2
v = 169d , d 0. a conjugate pair? Justify your answer.
a) Rewrite the formula as a mixed radical. Are they solutions of the quadratic
b) What is the approximate speed of a equation x 2 - 5x + 2 = 0? Explain.
car if the skid mark measures 13.4 m?
Express your answer to the nearest
kilometre per hour.

304 MHR Chapter 5


13. Rationalize each denominator. 5.3 Radical Equations, pages 294303
__
a) _
6
___ 18. Identify the values of x for which the
12 radicals are defined. Solve for x and
b) _
-1
___ verify your answers.
3
25 __
____ a) - x = -7

_
2
2a , a 0 ______
c) -4 b) 4 - x = -2
9 ___
14. Rationalize each denominator. State c) 5 - 2x = -1
___
any restrictions on the values for the
variables.
d) 1 + _
7x = 8
3
19. Solve each radical equation. Determine any
a) __
-2 __
restrictions on the values for the variables.
4 - 3 _______ ________
__ a) 5x - 3 = 7x - 12
b) __
7 ______
__ __
2 5 - 7 b) y - 3 = y - 3
________
c) __
18_____ c) 7n + 25 - n = 1
_______
-_
6 + 27m ____
m = 3m - 4
__ d) 8_______
3
d) __
a + b
__ 3
e) 3x - 1 + 7 = 3
a - b
15. What is the exact perimeter of 20. Describe the steps in your solution to
the triangle? #19c). Explain why one of the roots
y was extraneous.
6 21. On a calm day, the distance, d, in
kilometres, that the coast guard crew on
4
the Coast Guard cutter Vakta can see to
2 the horizon depends on their height, h,
in metres,
____
above the water. The formula
-6 -4 -2 0 2 4 6 x
d= _
3h
, h 0 models this relationship.
-2
2
What is the height of the crew above the
-4 water if the distance to the horizon is
7.1 km?
-6

16. Simplify.
__ __
__ 3 __
a) ( -5
__
6
7
)( 3 21 )
- ___

__
b) (__
2a a __
9 )( - 8a )
12 3


___

17. The area of a rectangle is 12


__
square
units. The width is (4 - 2 ) units. D i d You K n ow ?
Determine an expression for the length
The Vakta is a 16.8-m cutter used by Search and
of the rectangle in simplest radical form.
Rescue to assist in water emergencies on Lake
Winnipeg. It is based in Gimli, Manitoba.

Chapter 5 Review MHR 305


Chapter 5 Practice Test
Multiple Choice 8. Express as a radical in simplest form.
___ ___
For #1 to #6, choose the best answer. ___
(2 5n )(3 8n )
__ , n 0.
3
__ 1 - 12 2 ______
1. What is the entire radical form of -3( 2 )? 9. Solve 3 - x = x2 - 5 . State any
3
___ 3
_____
A 54 B -54 extraneous roots that you found.
3
_____ 3
___ Identify the values of x for which the
C -18 D 18
radical is defined.
2. What _____
is the condition on the variable
in 2 -7n for the radicand to be a real
_______ _______
10. Solve 9y + 1 = 3 + 4y - 2 , y _1 .
2
number? Verify your solution. Justify your
A n7 B n -7 method. Identify any extraneous roots
that you found.
C n0 D n0 ____
11. Masoud started to simplify 450 by
3. What ___
is the simplest
___
form of the sum rewriting ____________
450 as a product of prime
-2x 6x + 5x 6x , x 0? factors: 2(3)(3)(5)(5) . Explain how he can
___ ____
A 3 6x B 6 12x convert his expression to a mixed radical.
___ ___
C 3x 6x D 6x 12 12. For sailboats to travel into the wind, it is
____ ___ sometimes necessary to tack, or move in a
4. What is the product of 540 and 6y ,
zigzag pattern. A sailboat in Lake Winnipeg
y 0, in simplest form?
____ ___ travels 4 km due north and then 4 km due
A 3y 360 B 6y 90 west. From there the boat travels 5 km due
____ ____
C 10 32y D 18 10y north and then 5 km due west. How far is
the boat from its starting point? Express
5. Determine_______
any root of the equation,
your answer as a mixed radical.
x+7= 23 - x , where x 23.
A x = 13
B x = -2
C x = 2 and 13
D x = -2 and -13
__
6. Suppose _ _ is written in simplest form
5 3
__
7 2
as a b , where a is a real number and b is
an integer. What is the value of b?
A 2 B 3
13. You wish to rationalize the denominator
C 6 D 14
in each expression. By what number will
you multiply each expression? Justify your
Short Answer answer.
a) _
4__
7. Order the following numbers from least
6
to greatest:
b) __
___ __ __ ____ 22
______
3 11 , 5 6 , 9 2 , 160 y - 3
c) _
2
3
__
7

306 MHR Chapter 5


14. For diamonds of comparable quality, Extended Response
the cost, C, in dollars, is related to 17. A 100-W light bulb operates with a
the mass, m, in carats, by the formula current of 0.5 A. The formula relating
_____
m = _
C , C 0. What is the cost of current, I, in amperes (A); power, P,
700 in watts (W); and resistance, R, in
___
a 3-carat diamond?
_P
D id Yo u K n ow ?
ohms (), is I =
R .

a) Isolate R in the formula.


Snap Lake Mine is 220 km northeast of Yellowknife,
Northwest Territories. It is the rst fully underground b) What is the resistance in the
diamond mine in Canada. light bulb?
18. Sylvie built a model of a cube-shaped
house.
a) Express the edge length of a cube
in terms of the surface area using a
radical equation.
b) Suppose the surface area of the cube in
Sylvies model is 33 cm2. Determine the
exact edge length in simplest form.
c) If the surface area of a cube doubles,
by what scale factor will the edge
length change?
15. Teya tries to rationalize the denominator in
__ __
the expression __
5 2 + 3 19. Beverley invested $3500 two years
__ __ . Is Teya correct?
4 2 - 3 ago. The investment earned compound
If not, identify and explain any errors she interest annually according to the
made. formula A = P(1 + i)n. In the formula,
A represents the final amount of the
Teyas Solution
__ __ __ __ __ __ investment, P represents the principal
__
5 2 __ = __
+ 3
__ __
__
4 2 - 3
5 2
__
(4
+ 3 4 2
__
2 - 3
__
+ 3
__
__
)( 4 2
__
+ 3 )
__
or initial amount, i represents the
interest rate per compounding period,
= _____
20 4 + 5 6
+ + 9 4 6 and n represents the number of
32 - 3 compounding periods. The current
__
= ___
40 + +3 9 6 amount of her investment is $3713.15.
32 -__3
a) Model Beverleys investment using
= __
43 + 9 6
the formula.
29
16. A right triangle has one leg that measures b) What is the interest rate? Express
1 unit. your answer as a percent.

a) Model the length of the hypotenuse


using a radical equation.
b) The length of the hypotenuse is
11 units. What is the length of the
unknown leg? Express your answer
as a mixed radical in simplest form.

Chapter 5 Practice Test MHR 307


CHAPTER

6 Rational
Expressions
and Equations
Rational expressions are used in medicine, lighting,
economics, space travel, engineering, acoustics, and
many other fields. For example, the rings of Saturn
have puzzled astronomers since Galileo discovered
them with his telescope in 1610. In October 2009,
12 years after the launch of the Cassini-Huygens
project, scientists at the NASA Jet Propulsion
Laboratory determined that Saturns famous rings
are neither as thin nor as flat as previously thought.
Why do you think it took so long for NASA to
gather and analyse this information?

In this chapter, you will learn about the algebra


of rational expressions and equations. Compare
the skills you learn in the chapter with those you
learned in the arithmetic of fractions. They are
very similar.

Did Yo u Know ?

The Cassini-Huygens project is a joint NASA and


European Space Agency (ESA) robotic spacecraft
mission to Saturn. The spacecraft was launched in
1997 and arrived to start its orbits around Saturn in
2004. The mission may continue until 2017.

Key Terms
rational expression
non-permissible value
rational equation

308 MHR Chapter 6


Career Link
You can use mathematical modelling to analyse
problems in economics, science, medicine, urban
planning, climate change, manufacturing, and space
exploration. Building a mathematical model is
normally a multi-stage process that involves writing
equations, using them to predict what happens,
experimenting to see if the prediction is correct,
modifying the equations, and so on.

Marcel Tolkowsky, a 21-year-old Belgian mathematician,


revolutionized the diamond-cutting industry in 1919
when he used mathematical modelling to calculate the
formula for the ideal proportions in a cut diamond.
By reducing the process to a mathematical formula,
diamond-cutting is now more automated.

We b Link
To learn
earn more about
a fields involving mathematical
modelling, go to www.mhrprecalc11.ca and follow
the links.

Chapter 6 MHR 309


6.1
Rational Expressions
Focus on . . .
determining non-permissible values for a rational expression
simplifying a rational expression
modelling a situation using a rational expression

Many day-to-day applications use rational expressions. You can rational expression
determine the time it takes to travel across Canada by dividing an algebraic fraction with a
the distance travelled, d, by the rate of speed at which you are numerator and a denominator
travelling, r. Light intensity and the intensity of sound can be that are polynomials
1
k , where k is a examples are _ x,
described mathematically as ratios in the form _
d2 m
__ ___ y 2
- 1
,
constant and d is the distance from the source. When would it m + 1 y 2 + 2y + 1
be important to know the intensity of light or sound? x2 - 4 is a rational expression
with a denominator of 1
What other formulas are rational expressions?

Concert stage

Investigate Rational Expressions

Materials 1. Consider the polynomial expression 3x 2 + 12x.


algebra tiles a) Use algebra tiles to model the polynomial.
b) Arrange the tiles in a rectangle to represent the length of each side
as a polynomial.

310 MHR Chapter 6


c) Use the model from part b) to write a simplified How can you verify that your
3x2 + 12x answer is equivalent to the rational
form of the rational expression __ . expression? Explain your reasoning.
3x
d) Are these two expressions always equivalent?
Why or why not?
2. Whenever you are working with algebraic fractions, it is important D i d You K n ow?
to determine any values that must be excluded.
An algebraic fraction
a) You can write an unlimited number of arithmetic fractions, or is the quotient of two
a , where a and b are integers.
rational numbers, of the form _
algebraic expressions.
b Examples of algebraic
What integer cannot be used for b? -4
fractions are __ ,
x-2
2
b) What happens in each of the following expressions when x = 3 _t x
, 0, _5 , and
5 _______
3y
is substituted?
3x + 1
__
x-7 . All rational
i) __ x2
x-3 expressions are
algebraic fractions
x-7
ii) __ but not all algebraic
x2 - 9
fractions are rational
iii) ___
x-7
expressions.
x2 - 4x + 3
3. What value(s) cannot be used for x in each of the following
algebraic fractions?
6-x
a) __
2x
b) __
3
x-7
c) ___
4x - 1
(x - 3)(2x + 1)

Reflect and Respond


4. a) What is the result when zero is divided by any non-zero number?
b) Why is division by zero undefined?
5. Write a rule that explains how to determine any values that a variable
cannot be, for any algebraic fraction.
6. What operation(s) can you use when you are asked to express a rational
number in lowest terms? Give examples to support your answer.
7. Describe two ways in which arithmetic fractions and algebraic
fractions are similar. How do they differ?
8. a) What is the value of any rational expression in which the
numerator and denominator are the same non-zero polynomials?
b) What is the value of a fraction in which the numerator and
denominator are opposite integers?
x-3
c) What is the value of the rational expression __ for x 3?
3-x
Explain.

6.1 Rational Expressions MHR 311


Link the Ideas

Non-Permissible Values
Whenever you use a rational expression, you must identify any
non-permissible values that must be excluded or are considered non-permissible
value values. Non-permissible values are all values that make the
any value for a denominator zero.
variable that makes an
expression undefined
in a rational expression,
a value that results in a Example 1
denominator of zero
x+2
Determine Non-Permissible Values
in __ , you must
x-3
For each rational expression, determine all non-permissible values.
exclude the value for
which x - 3 = 0, which 5t 3x 2p - 1
is x = 3 a) _2 b) __ c) ___
4sr x(2x - 3) p2 - p - 12
Solution
To determine non-permissible values, set the denominator equal to
zero and solve.
5t
a) _2
4sr
Determine the values for which 4sr 2 = 0.
4s = 0 or r 2 = 0
s = 0 or r = 0
The non-permissible values are s = 0 and r = 0. The rational
expression _ 5t is defined for all real numbers except s = 0 and r = 0.
4sr 2
This is written as _5t , r 0, s 0.
4sr 2
b) __
3x
x(2x - 3)
Determine the values for which x(2x - 3) = 0. Does it matter whether
x = 0 or 2x - 3 = 0 the numerator becomes
3 zero? Explain.
x=_
2
The non-permissible values are 0 and _ 3.
2
2p - 1
c) ___2
p - p - 12
Determine the values for which p2 - p - 12 = 0.
(p - 4)(p + 3) = 0 Factor p 2 - p - 12.
p = 4 or p = -3
The non-permissible values are 4 and -3.
Your Turn
Determine the non-permissible value(s) for each rational expression.
4a x-1 2y 2
a) _ b) ___ c) __
3bc (x + 2)(x - 3) y2 - 4

312 MHR Chapter 6


Equivalent Rational Expressions
You can multiply or divide a rational expression by 1 and not change its
value. You will create an equivalent expression using this property. For
example, if you multiply _ 7s , s 2, by _
s
s-2 s , you are actually multiplying
by 1, provided that s 0.

7s (7s)(s)
s = __
(_ )
s-2 s ( _
) s(s - 2)
= __ 7s2 , s 0, 2 Why do you need to
s(s - 2) specify that s 0?

The rational expressions _ 7s , s 2, and __ 7s2 ,


s-2 s(s - 2)
s 0, 2, are equivalent.

Similarly, you can show that _7s , s 2, What was done to the first D i d You K n ow?
s-2 rational expression to get
7s(s + 2) the second one? Statements such as
and ___ , s 2, are equivalent.
(s - 2)(s + 2) x = 2 and x = -2
can be abbreviated as
x = 2.
Simplifying Rational Expressions
Writing a rational number in lowest terms and simplifying
a rational expression involve similar steps.
1
(3)(3)
9 = __
_ How could you use models
12 (3)(4) to determine the rational
1 expression in simplest form?
3
=_
4
1 1

_ (m2)(m)(t)
m3t = __ Why is 0 a non-permissible
2 4
mt 2 3
(m )(t)(t ) value for the variable m in the
1 1 simplified rational expression?
m , m 0, t 0
=_3
t
To simplify a rational expression, divide both the numerator and
denominator by any factors that are common to the numerator and
the denominator.
AB = _
A _
B and _
A = 1.
Recall that _
AC A C A ( )( )
AB = _
So, _ B , where A, B, and C are polynomial factors.
AC C

When a rational expression is in simplest form, or its lowest terms, the


numerator and denominator have no common factors other than 1.

6.1 Rational Expressions MHR 313


Example 2
Simplify a Rational Expression
Simplify each rational expression.
State the non-permissible values.
3x - 6
a) ___
2
2x + x - 10
1-t
b) __
t2 - 1

Solution
3x - 6
a) ___
2
2x + x - 10
Factor both the numerator and the Why should you determine any
denominator. Consider the factors non-permissible values before
simplifying?
of the denominator to find the
non-permissible values before
simplifying the expression.
How do you obtain 2 and - _5 as
3x - 6
___ 3(x - 2)
2
= ___ 2
2x + x - 10 (x - 2)(2x + 5) the non-permissible values?
1
3(x - 2)
= ___
(x - 2)(2x + 5)
1
How could you show that the
= __3 , x 2, - _
5 initial rational expression and the
2x + 5 2 simplified version are equivalent?

1-t
b) __
2
t -1

Method 1: Use Factoring -1


1 - t = ___
__ 1-t Factor the denominator. Realize that the
t2 - 1 (t - 1)(t + 1) numerator is the opposite (additive inverse)
-1(t - 1) of one of the factors in the denominator.
= ___ Factor -1 from the numerator.
(t - 1)(t + 1)
1
-1(t - 1)
= ___
(t - 1)(t + 1)
1

-1 , t 1
=_
t+1

314 MHR Chapter 6


Method 2: Use the Property of 1
1 - t = ___
__ 1-t Factor the denominator. How are the numerator
t2 - 1 (t - 1)(t + 1) and the factor (t 1) in the denominator related?
___ -1(1 - t)
= Multiply the numerator and the denominator by -1.
-1(t - 1)(t + 1)
1
t-1
= ___
-1(t - 1)(t + 1)
1

1
= __
-1(t + 1)
=_-1 , t 1
t+1

Your Turn
Simplify each rational expression.
What are the non-permissible values?
2
2y + y - 10
a) ___
2
y + 3y - 10
6 - 2m
b) __2
m -9

Example 3
Rational Expressions With Pairs of Non-Permissible Values
16x2 - 9y 2
Consider the expression __ .
8x - 6y
a) What expression represents the non-permissible values for x?
b) Simplify the rational expression.
c) Evaluate the expression for x = 2.6 and y = 1.2.
Show two ways to determine the answer.

Solution
16x2 - 9y 2
a) __
8x - 6y
Determine an expression for x for
which 8x - 6y = 0.
6y 3y
x = _ or _
8 4
3y
x cannot have a value of _ or the denominator will
4
be zero and the expression will be undefined. The What is an expression
3y for the non-permissible
expression for the non-permissible values of x is x = _ . values of y?
4
3, 1 , _
3, 2 ,
Examples of non-permissible values include _
4 (
2 )( )
9 , 3 , and so on.
(_
4 )
6.1 Rational Expressions MHR 315
16x2 - 9y 2 (4x - 3y)(4x + 3y)
b) __ = ____ Factor the numerator and the
8x - 6y 2(4x - 3y) denominator.
1
(4x - 3y)(4x + 3y) What are you assuming when you divide
= ____ both the numerator and the denominator
2(4x - 3y) by 4x - 3y?
1

4x + 3y 3y
= __ , x _
2 4

c) First, check that the values x = 2.6 and y = 1.2 are permissible.
Left Side Right Side
x 3y
_
= 2.6 4
3(1.2)
= __
4
= 0.9
Left Side Right Side
3y
Thus, x _ for x = 2.6 and y = 1.2, so the values are permissible.
4
Method 1: Substitute Into the Original Rational Expression
16x2 - 9y 2
__ 16(2.6) 2 - 9(1.2) 2
= ____
8x - 6y 8(2.6) - 6(1.2)
=_95.2
13.6
=7

Method 2: Substitute Into the Simplified Rational Expression

4x + 3y
__ 4(2.6) + 3(1.2)
= ___
2 2
14
=_
2
=7
The value of the expression when x = 2.6 and y = 1.2 is 7.

Your Turn
16x2 - 9y 2
Use the rational expression __ to help answer the following.
8x - 6y
a) What is the non-permissible value for y if x = 3?
b) Evaluate the expression for x = 1.5 and y = 2.8.
c) Give a reason why it may be beneficial to simplify a rational
expression.

316 MHR Chapter 6


Key Ideas
p
A rational expression is an algebraic fraction of the form _
q , where p and q
are polynomials and q 0.
A non-permissible value is a value of the variable that causes an
expression to be undefined. For a rational expression, this occurs
when the denominator is zero.
Rational expressions can be simplified by:
 factoring the numerator and the denominator
 determining non-permissible values
 dividing both the numerator and denominator by all common factors

Check Your Understanding

Practise 3. What value(s) of the variable, if any,


1. What should replace  to make the make the denominator of each expression
expressions in each pair equivalent? equal zero?
3  -4
a) _
a) _ , _ x
5 30
3c - 1
2 
b) _ , _ , x 0 b) __
5 35x c-1
y
4 44
c) _ , _ c) __
 77 y+5
m+3
x + 2 4x + 8
d) __ , __ , x 3 d) __
x-3  5
3(6) 3 __
e) 2
1
e) _ , _ d -1
(6) 8
x-1
__
1  , y 2 f)
f) __ , __
2
x2 + 1
y-2 y -4
4. Determine the non-permissible value(s)
2. State the operation and quantity that must for each rational expression. Why are
be applied to both the numerator and the these values not permitted?
denominator of the first expression to
a) __
3a
obtain the second expression. 4-a
3p2q _ 3p 2e + 8
a) _ , b) __ e
pq2 q
2 2x - 8 3(y + 7)
b) __ , __ c) ___
2
x + 4 x - 16 (y - 4)(y + 2)
-4(m - 3) __ -7(r - 1)
___
c) __ 2
, -4 d)
(r - 1)(r + 3)
m -9 m+3
2
1 y + y 2k + 8
d) __ , __ e) __ 2
y - 1 y3 - y k
6x - 8
f) ___
(3x - 4)(2x + 5)

6.1 Rational Expressions MHR 317


5. What value(s) for the variables must Apply 2
x + 2x - 15
be excluded when working with each 9. Since ___ can be written
x-3
rational expression?
(x - 3)(x + 5)
4r 2 2t + t 2 as ___ , you can say
a) _3 b) __ x-3
8r t2 - 1
x2 + 2x - 15
3g that ___ and x + 5 are
c) __
x-2 d) __ x-3
10 - 5x g 3 - 9g equivalent expressions. Is this statement
6. Simplify each rational expression. State always, sometimes, or never true? Explain.
any non-permissible values for the 10. Explain why 6 may not be the only
variables. non-permissible value for a rational
2c(c - 5)
a) __ expression that is written in simplest
3c(c - 5) y
form as __ . Give examples to support
3w (2w + 3) y-6
b) ___
2w (3w + 2) your answer.
(x - 7)(x + 7) 11. Mike always looks for shortcuts. He claims,
c) ___
(2x - 1)(x - 7) It is easy to simplify expressions such
5 - x because the top and bottom are
as __
5(a - 3)(a + 2)
d) ___ x-5
10(3 - a)(a + 2) opposites of each other and any time you
7. Consider the rational expression divide opposites the result is 1. Is Mike
2
x -1
___ . correct? Explain why or why not.
x2 + 2x - 3
12. Suppose you are tutoring a friend in
a) Explain why you cannot divide out
simplifying rational expressions. Create
the x2 in the numerator with the x2 in
three sample expressions written in the
the denominator.
ax2 + bx + c
b) Explain how to determine the form ___ where the numerators
dx2 + ex + f
non-permissible values. State the and denominators factor and the
non-permissible values. expressions can be simplified. Describe
c) Explain how to simplify a rational the process you used to create one of your
expression. Simplify the rational expressions.
expression. 13. Shali incorrectly simplifies a rational
8. Write each rational expression in simplest expression as shown below.
form. State any non-permissible values for g2 - 4 (g - 2)(g + 2)
__
the variables. = ___
2g - 4 2(g - 2)
6r 2p3 g + 2
a) _ = __
4rp4 2
3x - 6 =g+1
b) __
10 - 5x What is Shalis error? Explain why the step
b 2 + 2b - 24 is incorrect. Show the correct solution.
c) ___
2b 2 - 72
14. Create a rational expression with
2
10k + 55k + 75 variable p that has non-permissible
d) ____
2
20k - 10k - 150 values of 1 and -2.
x-4
e) __
4-x
5(x2 - y 2)
f) ___
x - 2xy + y 2
2

318 MHR Chapter 6


15. The distance, d, can be determined using 18. Write an expression in simplest form for
the formula d = rt, where r is the rate of the time required to travel 100 km at each
speed and t is the time. rate. Identify any non-permissible values.
a) If the distance is represented by a) 2q kilometres per hour
2n2 + 11n + 12 and the rate of speed b) (p - 4) kilometres per hour
is represented by 2n2 - 32, what is an 19. A school art class is planning a day trip
expression for the time? to the Glenbow Museum in Calgary. The
b) Write your expression from part a) cost of the bus is $350 and admission is
in simplest form. Identify any $9 per student.
non-permissible values. a) What is the total cost for a class of
16. You have been asked to draw the largest 30 students?
possible circle on a square piece of paper. b) Write a rational expression that could
The side length of the piece of paper is be used to determine the cost per
represented by 2x. student if n students go on the trip.
a) Draw a diagram showing your circle on c) Use your expression to determine the
the piece of paper. Label your diagram. cost per student if 30 students go.
b) Create a rational expression comparing D i d You K n ow ?
the area of your circle to the area of the
piece of paper. The Glenbow Museum in Calgary is one of western
Canadas largest museums. It documents life in
c) Identify any non-permissible values for western Canada from the 1800s to the present day.
your rational expression. Exhibits trace the traditions of the First Nations
peoples as well as the hardships of ranching and
d) What is your rational expression in
farming in southern Alberta.
simplest form?
e) What percent of the paper is included
in your circle? Give your answer to the
nearest percent.
17. A chemical company is researching
the effect of a new pesticide on crop
yields. Preliminary results show that the
extra yield per hectare is given by the
900p
expression __ , where p is the mass of
2+p
pesticide, in kilograms. The extra yield
is also measured in kilograms.
a) Explain whether the non-permissible
value needs to be considered in this
situation.
b) What integral value for p gives the
least extra yield?
c) Substitute several values for p and
determine what seems to be the
greatest extra yield possible.

First Nations exhibit at Glenbow Museum

6.1 Rational Expressions MHR 319


5
20. Terri believes that __ can be expressed 25. The work shown to simplify each
m+5
1 . rational expression contains at least
in simplest form as __
m+1 one error. Rewrite each solution,
a) Do you agree with Terri? Explain correcting the errors.
in words. 6x2 - x - 1 = (2x
a) ___ ___ + 1)(3x - 1)
2
b) Use substitution to show 9x - 1 (3x + 1)(3x - 1)
2x + 1
__ 1
whether __ 5 1
and __ are = , x -_
m+5 m+1 3x + 1 3
equivalent or not. 2n2 + n - 15 (n + 3)(2n - 5)
b) ___ 2
= ___
21. Sometimes it is useful to write more 5n - 2n n(5 - 2n)
complicated equivalent rational (n + 3)(2n - 5)
= ___
3x is -n(2n - 5)
expressions. For example, _ n+3
4 = __
3x2 - 6x , x 2.
15x and to __ -n
equivalent to _
20 4x - 8 n
= -
__ 3 5
_
3x n , n 0, 2
a) How can you change _ into its
4
equivalent form, 15x
_ ? Extend
20
3x 26. Write in simplest form. Identify any
b) What do you need to do to _ to
4 non-permissible values.
3x2 - 6x ?
get __ (x + 2)2 - (x + 2) - 20
4x - 8 a) _____
x2 - 9
22. Write a rational expression equivalent
4(x - 9) - (x + 3)2
2 2
x - 2 that has
to __ b) ____
3 x2 + 6x + 9
a) a denominator of 12 (x - x)2 - 8(x2 - x) + 12
2
c) _____
b) a numerator of 3x - 6
(x2 - 4)2 - (x - 2)2
(x2 + 4x + 4)2 - 10(x2 + 4x + 4) + 9
c) a denominator of 6x + 15 d) _______
(2x + 1)2 - (x + 2)2
23. Write a rational expression that satisfies
27. Parallelogram ABFG has an area of
each set of conditions.
(16x2 - 1) square units and a height of
a) equivalent to 5, with 5b as the
(4x - 1) units. Parallelogram BCDE has
denominator an area of (6x2 - x - 12) square units
x+1
b) equivalent to __ , with a and a height of (2x - 3) units. What is an
3
denominator of 12a2b expression for the area of ABC? Leave
a-b your answer in the form ax2 + bx + c.
c) equivalent to __ , with a numerator What are the non-permissible values?
7x
of 2b - 2a
G F
24. The area of right PQR is
(x2 - x - 6) square units, and the
length of side PQ is (x - 3) units. E

Side PR is the hypotenuse.


A
B
a) Draw a diagram of PQR.
b) Write an expression for the length
of side QR. Express your answer in
simplest form. D
c) What are the non-permissible values?
C

320 MHR Chapter 6


28. Carpet sellers need to know if a partial Create Connections
roll contains enough carpet to complete an 29. Write a rational expression using one
order. Your task is to create an expression variable that satisfies the following
that gives the approximate length of carpet conditions.
on a roll using measurements from the end a) The non-permissible values are
of the roll. -2 and 5.
b) The non-permissible values are
1 and -3 and the expression is
__x in simplest form. Explain
x-1
how you found your expression.
30. Consider the rational expressions
y-3
__ 2y 2 - 5y - 3 1.
and ___ , y - _
4 8y + 4 2
a) Substitute a value for y to show that
the two expressions are equivalent.
b) Use algebra to show that the
expressions are equivalent.
c) Which approach proves the two
expressions are equivalent? Why?
a) Let t represent the thickness of the
31. Two points on a coordinate grid are
carpet and L the length of carpet on a
represented by A(p, 3) and
roll. What is an expression for the area
B(2p + 1, p - 5).
of the rolled edge of the carpet?
a) Write a rational expression for the slope
b) Draw a diagram showing the carpet
of the line passing through A and B.
rolled on a centre tube. Label the radius
Write your answer in simplest form.
of the centre tube as r and the radius of
the entire carpet roll as R. What is an b) Determine a value for p such that the
expression for the approximate area of line passing through A and B has a
the edge of the carpet on the roll? Write negative slope.
your answer in factored form. c) Describe the line through A and B for
c) Write an expression for the length of any non-permissible value of p.
carpet on a roll of thickness t. What 32. Use examples to show how writing a
conditions apply to t, L, R, and r? fraction in lowest terms and simplifying
a rational expression involve the same
mathematical processes.

6.1 Rational Expressions MHR 321


6.2
Multiplying and Dividing
Rational Expressions
Focus on . . .
comparing operations on rational expressions to the same
operations on rational numbers
identifying non-permissible values when performing
operations on rational expressions
determining the product or quotient of rational expressions
in simplest form

Aboriginal House at the University of Manitoba


earned gold LEED status in December 2009 for
combining aboriginal values and international
environmental practices. According to Elder Garry
Robson, the cultural significance of the building
has many layers. Elder Robson says, Once youve
learned one (layer), then you learn another and
another and so on.
Aboriginal House,
How does Elder Robsons observation apply in mathematics?
University of Manitoba

Did Yo u Know ?

The Leadership in Energy and Environmental Design (LEED) rating system is a nationally accepted
standard for constructing and operating green buildings. It promotes sustainability in site
development, water and energy efciency, materials selection, and indoor environmental quality.

Investigate Multiplying and Dividing Rational Expressions

3
Materials 1. Determine the product _ ( 4 )( _12 ). Describe a pattern that could be used
grid paper to numerically determine the answer.
2. Multiplying rational expressions follows the same pattern as
multiplying rational numbers. Use your pattern from step 1 to help
x+3 x+1
you multiply __ and __ .
2 4
2 1
3. Determine the value of _ _ . Describe a pattern that could be used
3 6
as a method to divide rational numbers.

322 MHR Chapter 6


x - 3 __
4. Apply your method from step 3 to express __
x in
2
x -9 x+3
simplest form. Do you think your method always works? Why?
5. What are the non-permissible values for x in step 4? Explain
how to determine the non-permissible values.
Reflect and Respond
6. Explain how you can apply the statement once youve learned one,
then you learn another and another to the mathematics of rational
numbers and rational expressions.
7. Describe a process you could follow to find the product in simplest
form when multiplying rational expressions.
8. Describe a process for dividing rational expressions and expressing
the answer in simplest form. Show how your process works using
an example.
9. Explain why it is important to identify all non-permissible values
before simplifying when using rational expressions.

Link the Ideas

Multiplying Rational Expressions


When you multiply rational expressions, you follow procedures
similar to those for multiplying rational numbers.
(5)(4)
( _58 )( _4 = __
15 ) (8)(15)
(5)(4)
= ___
(2)(4)(3)(5)
1 1
(5)(4)
= __
2(4)(3)(5)
1 1
1
=_
6

4x 2
y2 (4x2)(y 2)
( )( )
_
3xy
_
8x
= __
(3xy)(8x)
1 1 y
4x2y 2
= __
24x2y
6 1 1
y
= _ , x 0, y 0
6
Values for the variables that result in any denominator of zero are non-
permissible. Division by zero is not defined in the real-number system.

6.2 Multiplying and Dividing Rational Expressions MHR 323


Example 1
Multiply Rational Expressions
Multiply. Write your answer in simplest form.
Identify all non-permissible values.
2
a 2
___ - a - 12 a
___- 4a + 3
2
a -9 a2 - 4a

Solution
Factor each numerator and denominator.

a 2
___ - a - 12 a2
___- 4a + 3 (a - 4)(a + 3) (a - 3)(a - 1)
2 2
= ___ ___
a -9 a - 4a (a - 3)(a + 3) a(a - 4)
(a - 4)(a + 3)(a - 3)(a - 1)
= ______
(a - 3)(a + 3)(a)(a - 4)
1 1 1
(a - 4)(a + 3)(a - 3)(a - 1)
= ______
(a - 3)(a + 3)(a)(a - 4)
1 1 1
a-1
= __
a
The non-permissible values are a = -3, 0, 3, and 4,
since these values give zero in the denominator of at
least one fraction, and division by zero is not permitted
in the real numbers.
2
Where is the best place
a 2
___ - a - 12 a
___- 4a + 3 a - 1 , a -3, 0, 3, 4
= __ to look when identifying
2
a -9 a2 - 4a a non-permissible values
in products of rational
expressions?
Your Turn
Express each product in simplest form.
What are the non-permissible values?
d
a) _ __
2rh
2r d-2
2
y -9 r2 - r
b) __
3
__
r -r y+3

324 MHR Chapter 6


Dividing Rational Expressions
Dividing rational expressions follows similar procedures to those for
dividing rational numbers.
Method 1: Use a Common Denominator
5 _
_ 1 =_ 10 _1 3x2
_ x
_ 3x2
_ xy
= _2
3 6 6 6 y 2
y y 2
y
2
= 10
_ 3x
_
= xy
1
= 10 =_3x , x 0, y 0 Why is x = 0 a
y non-permissible
Method 2: Multiply by the Reciprocal value?
5 _
_ 1 =_ 5 _6 3x2
_ x 3x2 y
_=_ _
3 6 3 1 y 2
y y2 x
= 10 =_3x , x 0, y 0
y

Example 2
Divide Rational Expressions D i d You K n ow?

Determine the quotient in simplest form. A complex rational


Identify all non-permissible values. expression contains
a fraction in both
__ x2 + x - 6
x2 - 4 ___ the numerator
2 2
x - 4x x + x - 20 and denominator.
The expression in
Solution Example 2 could
also be written as
2
2 x +x-6
x - 4 ___
__ the complex rational
2 2
x - 4x x + x - 20 expression
x2 - 4
__
(x + 2)(x - 2) (x + 3)(x - 2) x2 - 4x
= ___ ___ Factor. ___
x(x - 4) (x + 5)(x - 4) x2 + x - 6
___
x2 + x - 20
(x + 2)(x - 2) (x + 5)(x - 4) Use similar procedures for dividing
= ___ ___
x(x - 4) (x + 3)(x - 2) rational expressions as for dividing
fractions. Recall that dividing by a
1 1
(x + 2)(x - 2)(x + 5)(x - 4) fraction is the same as multiplying
= ______ by its reciprocal.
x(x - 4)(x + 3)(x - 2)
1 1

(x + 2)(x + 5) What was done to get this simpler


= ___ , x -5, -3, 0, 2, 4
x(x + 3) answer?

The non-permissible values for x are Which step(s) should you look at to
determine non-permissible values?
5, -3, 0, 2, and 4.

Your Turn
Simplify. What are the non-permissible values?
2
2
c___ + 8c + 7
- 6c - 7 c___
2
c - 49 c 2 + 7c

6.2 Multiplying and Dividing Rational Expressions MHR 325


Example 3
Multiply and Divide Rational Expressions
Simplify. What are the non-permissible values?
2
2m
___ 4m2 - 9 (3 - 2m)
- 7m - 15 __
2
2m - 10m 6

Solution
2
2m
___ 4m2 - 9 (3 - 2m)
- 7m - 15 __
2
2m - 10m 6
(2m + 3)(m - 5) (2m - 3)(2m + 3) Apply the order
= ____ ____ (3 - 2m) of operations.
2m(m - 5) 6
(2m + 3)(m - 5) 6 -1(2m - 3) How do you know
= ____ ____ ___ that 3 2m and
2m(m - 5) (2m - 3)(2m + 3) 1
-1(2m - 3) are
1 1 3 1
(2m + 3)(m - 5)(6)(-1)(2m - 3) equivalent?
= ______
2m(m - 5)(2m - 3)(2m + 3)
1 1 1 1
3 , m -_
= -_ 3
3 , 0, 5, _ Where do these non-permissible values come from?
m 2 2
3 , 0, and 5.
The non-permissible values for m are _
2
Your Turn
Simplify. Identify all non-permissible values.
3x + 12
___ 2x - 6
12 __
__
2
3x - 5x - 12 3x + 4 x+4

Key Ideas

Multiplying rational expressions is similar to multiplying rational numbers. Factor


each numerator and denominator. Identify any non-permissible values. Divide both the
numerator and the denominator by any common factors to create a simplified expression.
9 =_
2 _
_ (3)(3)
2 __ 2 __
__ 2 (b
b2 - 9 = __ ___- 3)(b + 3)
3 8 3 2(4) b-3 4b b-3 4b
1 1 1 1
(2)(3)(3) 2(b - 3)(b + 3)
= __ = ___
(3)(2)(4) 4b(b - 3)
1 1 2 1
3 b+3
=_ = __ , b 0, 3
4 2b
Dividing rational expressions is similar to dividing fractions. Convert
division to multiplication by multiplying by the reciprocal of the divisor.
_ 4 =_
2 _ 9
2 _ 2(x - 1)
__ (x - 1)(x + 1) 2(x - 1) 5
___ = __ ___
3 9 3 4 3 5
(x - 1)(x + 1) 3
When dividing, no denominator can equal zero. In _ C =_
A _ D , the
A _
B D B C
non-permissible values are B = 0, C = 0, and D = 0.

326 MHR Chapter 6


Check Your Understanding

Practise 7. Show how to simplify each rational


1. Simplify each product. Identify all expression or product.
non-permissible values. 3-p
a) __
12m2f 15c p-3
a) __ _
5cf 4m 7k -1
b) __ __
1
3k 1 - 7k
3(a - b) (a - 5)(a + 5)
b) ___ ___ 8. Express each quotient in simplest form.
(a - 1)(a + 5) 15(a - b)
Identify all non-permissible values.
(y - 7)(y + 3) 4(2y + 3) 2w 2 - w - 6 2w + 3
c) ___ ___ a) ___ __
(2y - 3)(2y + 3) (y + 3)(y - 1) 3w + 6 w+2
2
v - 5 v___
b) __
- 2v - 15
2. Write each product in simplest form. v v3
Determine all non-permissible values. 2 2
9x - 1
c) __ ___
3x - 5x - 2
d 2 - 100
a) __ __
36 x+5 2-x
144 d + 10 2
8y - 2y - 3 2y 2 - 3y - 2 3 - 4y
a+3 a2 - 1 d) ___ ___ __
b) __ __ 2
y -1 2y - 2 y+1
a+1 a2 - 9
2
4z - 25 z-4 9. Explain why the non-permissible values
c) ___ __
2z2 - 13z + 20 4z + 10 x+1
x - 5 __
in the quotient __ are
x+3 x-2
2p2 + 5p - 3 p2 - 1 2p - 3
d) ___ __ ___ 3, -1 and 2.
2p - 3 6p - 3 p2 + 2p - 3
3. What is the reciprocal of each rational Apply
expression? 10. The height of a stack of plywood is
2 2x - 1 represented by __n2 - 4 . If the number
a) _ b) __ n+1
t 3
-8 2p -3 of sheets is defined by n - 2, what
c) __ d) __ expression could be used to represent
3-y p-3
the thickness of one sheet? Express
4. What are the non-permissible values in
your answer in simplest form.
each quotient?
4t2
a) _ _2
2t
3s s
2 2
3r
r - 7r _
b) __
2
r - 49 r+7
5
c) __ __
10 (n - 1)
n+1 n2 - 1
2x - 6
5. What is the simplified product of __
x+3
x+3
and __ ? Identify any non-permissible
2
values.
6. What is the simplified quotient of
2
__y y
and __ ? Identify any
2
y -9 y-3
non-permissible values.

6.2 Multiplying and Dividing Rational Expressions MHR 327


11. Write an expression involving a product or 13. Simplifying a rational expression is similar
a quotient of rational expressions for each to using unit analysis to convert from one
situation. Simplify each expression. unit to another. For example, to convert
a) The Mennonite Heritage Village in 68 cm to kilometres, you can use the
Steinbach, Manitoba, has a working following steps.
windmill. If the outer end of a windmill
x - 3 metres per
(68 cm) __ 1m
( 1 km
__
100 cm 1000 m )( )
blade turns at a rate of __
5 = (68 cm) __ 1m
100 cm ( __ 1 km
1000 m ) ( )
minute, how far does it travel in 1 h?
= ___ 68 km
(100)(1000)
= 0.000 68 km
Therefore, 68 cm is equivalent to
0.000 68 km. Create similar ratios that
you can use to convert a measurement
in yards to its equivalent in centimetres.
Use 1 in. = 2.54 cm. Provide a
specific example.
14. Tessa is practising for a quiz. Her work on
one question is shown below.
c+6
c 2 - 36 __
__
2c 8c 2
2c c+6
= ___ __
(c - 6)(c + 6) (2c)(4c)
1 1
2c c+6
= ___ __
b) A plane travels from Victoria to (c - 6)(c + 6) (2c)(4c)
1 1
Edmonton, a distance of 900 km, 1
= __
600 hours. What is the average
in __ 4c(c - 6)
n+1
speed of the plane? a) Identify any errors that Tessa made.

c) Simione is shipping b) Complete the question correctly.


his carving to a buyer c) How does the correct answer compare
in Winnipeg. He with Tessas answer? Explain.
makes a rectangular 15. Write an expression to represent the length
box with a length of of the rectangle. Simplify your answer.
(2x - 3) metres
and a width of
x 2- 2x - 3
___________
(x + 1) metres. A = x 2- 9
x+ 1
The volume of
the box is
(x2 + 2x + 1) cubic metres. What is an 16. What is an expression for the area of
expression for the height of the box? PQR? Give your answer in simplest form.
3m + 1 P
12. How does the quotient of __
m-1
3m + 1
and __ compare to the quotient x +2
_____
m2 - 1 x-8
3m + 1 3m + 1
of __ and __ ? Is this always true
m2 - 1 m-1 Q R
x 2- 7x - 8
___________
or sometimes true? Explain your thinking.
x 2- 4

328 MHR Chapter 6


17. You can manipulate variables in a formula Extend
by substituting from one formula into 19. Normally, expressions such as x2 - 5 are
another. Try this on the following. Give all not factored. However, you could express
__ __
answers in simplest form. 2 ( ) (
x - 5 as x - 5 x + 5 .
)
P
a) If K = _ and m = _
h
2m w , express K in a) Do you__agree that
__
x2 - 5 and
terms of P, h, and w. (x - 5 )(x + 5 ) are equivalent?
2 Explain why or why not.
b) If y = _ and x = dr, express y in terms
d b) Show how factoring could be
of , r, and x.
used to__simplify the product
c) Use the formulas v = wr and a = w 2r to
determine a formula for a in terms of v (x + 3 __
__
2 )(x2 - 7__ .
x - 3 x - 7 )
and w. 2
x - 7__
c) What is the simplest form of __
18. The volume, V, of a gas increases or x - 7
decreases with its temperature, T, if you rationalize the denominator?
according to Charless law by the How does this answer compare to the
V T x2 - 7__ that you obtained by
value of __
formula _1 = _1 . Determine V1 if x - 7
V2 T2
2
factoring in part b)?
n - 16
V2 = __ , T1 = __ n - 1,
n-1 3 20. Fog can be cleared from airports, highways,
n + 4 and harbours using fog-dissipating
and T2 = __ .
6 materials. One device for fog dissipation
Express your answer in simplest form. launches canisters of dry ice to a height
defined by __V 2 sin x , where V is the exit
D id You K n ow? 2g
velocity of the canister, x is the angle of
Geostrophic winds are driven by pressure differences
elevation, and g is the acceleration due
that result from temperature differences. Geostrophic
to gravity.
winds occur at altitudes above 1000 m.
a) What approximate height is achieved
by a canister with V = 85 m/s, x = 52,
and g = 9.8 m/s2?
b) What height can be achieved if
x+3
V = __ metres per second and
x-5
x = 30?

Hurricane Bonnie

Fog over Vancouver

6.2 Multiplying and Dividing Rational Expressions MHR 329


Create Connections 23. Consider ABC as shown.
21. Multiplying and dividing rational A
expressions is very much like
multiplying and dividing rational c
b
numbers. Do you agree or disagree
with this statement? Support your
answer with examples. B a C
22. Two points on a coordinate grid are
a) What is an expression for tan B?
represented by M(p - 1, 2p + 3) and
sin B
b) What is an expression for __ ?
N(2p - 5, p + 1). cos B
a) What is a simplified rational Use your knowledge of rational
expression for the slope of the line expressions to help you write the
passing through M and N? answer in simplest form.
b) Write a rational expression for the c) How do your expressions for tan B
slope of any line that is perpendicular sin B compare? What can you
and __
to MN. cos B
conclude from this exercise?

Project Corner Space Anomalies

Time dilation is a phenomenon described


by the theory of general relativity. It is the
difference in the rate of the passage of time, and
it can arise from the relative velocity of motion
between observers and the difference in their
distance from a gravitational mass.
A planetary year is the length of time it takes
a planet to revolve around the Sun. An Earth
year is about 365 days long.
There is compelling evidence that a super-
massive black hole of more than 4 million
solar masses is located near the Sagittarius A*
region in the centre of the Milky Way galaxy.
To predict space weather and the effects of
solar activity on Earth, an understanding of
both solar flares and coronal mass ejections
is needed. Black hole near Sagittarius A*
What other types of information about the universe would
be useful when predicting the future of space travel?

330 MHR Chapter 6


6.3
Adding and Subtracting
Rational Expressions
Focus on . . .
connecting addition and subtraction of rational expressions
to the same operations with rational numbers
identifying non-permissible values when adding and
subtracting rational expressions
determining, in simplified form, the sum or difference of rational
expressions with the same denominators or with different denominators
Canada-France-Hawaii Telescope
Rational expressions are important in photography and in
D i d You K n ow ?
understanding telescopes, microscopes, and cameras. The
lens equation can be written as _ 1 =_ 1 +_1 , where f is the The Canada-France-Hawaii Telescope
f u v (CFHT) is a non-prot partnership that
focal length, u is the distance from the object to the lens, and operates a 3.6-m telescope atop Mauna Kea
v is the distance of the image from the lens. How could you in Hawaii. CFHT has played an important
simplify the expression on the right of the lens equation? role in studying black holes.

Investigate Adding and Subtracting Rational Expressions

1. Determine each sum or difference using diagrams or manipulatives.


Describe a pattern that could be used to find the numerical answer.
Give answers in lowest terms.
1
a) _ + _
5 5
b) _ - _
3
8 8 6 8
2. Use your pattern(s) from step 1 to help you add or subtract each
of the following. Express answers in simplest form. Identify any
non-permissible values.
7x + 1 5x - 2 x 3 5 3
a) __ x + __ x b) __ - __ c) __ - __
x-3 x-3 x-2 x+2
3. Substitute numbers for x in step 2a) and c) to see if your answers
are reasonable. What value(s) cannot be substituted in each case?
4. Identify similarities and differences between the processes you used
in parts b) and c) in step 2.

Reflect and Respond


5. Describe a process you could use to find the answer in simplest form
when adding or subtracting rational expressions.
6. Explain how adding and subtracting rational expressions is related to
adding and subtracting rational numbers.

6.3 Adding and Subtracting Rational Expressions MHR 331


Link the Ideas

Adding or Subtracting Rational Expressions


To add or subtract rational expressions, follow procedures similar to
those used in adding or subtracting rational numbers.

Case 1: Denominators Are the Same


If two rational expressions have a common denominator, add or subtract
the numerators and write the answer as a rational expression with the
new numerator over the common denominator.

Case 2: Denominators Are Different


To add or subtract fractions when the denominators are different, you
must write equivalent fractions with the same denominator.
__ 10 - __ 3 = __ 10 - __3 Why is it helpful to factor each
3x - 12 x-4 3(x - 4) x-4 denominator?
10 3(3)
= __ - __
3(x - 4) (x - 4)(3)
= 10
__ - 9
3(x - 4)
= __ 1 ,x4
3(x - 4)
When adding or subtracting rational expressions, you can use any
equivalent common denominator. However, it is usually easier to
use the lowest common denominator (LCD).
3 4 Why is it easier to use the lowest
What is the LCD for __ + ___ ? common denominator? Try it with
x2 - 9 x2 - 6x + 9
and without the LCD to compare.
Factor each denominator.
3
___ 4
+ ___
(x - 3)(x + 3) (x - 3)(x - 3)

The LCD must contain the greatest number of any factor that appears in
the denominator of either fraction. If a factor appears once in either or
both denominators, include it only once. If a factor appears twice in any
denominator, include it twice.
The LCD is (x + 3)(x - 3)(x - 3).

332 MHR Chapter 6


Example 1
Add or Subtract Rational Expressions With Common Denominators
Determine each sum or difference. Express each answer in simplest form.
Identify all non-permissible values.
2a a-1
a) _ - __
b b
2x 8
b) __ + __
x+4 x+4
2
x 3x 10
c) __ + __ - __
x-2 x-2 x-2

Solution
2a a-1 2a - (a - 1)
a) _ - __ = ___ Why is a - 1 placed in brackets?
b b b
2a
___-a+1
=
b
a+1
__
= ,b0
b
The non-permissible value is b = 0.

2x 8 2x + 8
b) __ + __ = __
x+4 x+4 x+4
1
2(x + 4)
= __ Factor the numerator.
x+4
1

= 2, x -4 How could you verify this answer?


The non-permissible value is x = 4.

x2 3x 10 x2 + 3x - 10
c) __ + __ - __ = ___
x-2 x-2 x-2 x-2
1
(x - 2)(x + 5)
= ___
x-2
1

= x + 5, x 2
The non-permissible value is x = 2.

Your Turn
Determine each sum or difference. Express each answer in simplest form.
Identify all non-permissible values.
m - __
a) _
m+1
n n
10m - 1
b) __ - __
8 - 2m
4m - 3 4m - 3
2x2 - x
c) ___ + ___ - ___
3 - 6x 8
(x - 3)(x + 1) (x - 3)(x + 1) (x - 3)(x + 1)

6.3 Adding and Subtracting Rational Expressions MHR 333


Example 2
Add or Subtract Rational Expressions With Unlike Denominators
Simplify. Express your answers in simplest form.
2x 4
a) _ + _2 - 3, x 0, y 0
xy x
y 2 - 20 y-2
b) __ + __ , y 2
y2 - 4 y+2
1+_ 1
c) __ , x 0, x 1
x
x- x 1
_

Solution
a) The LCD is x2y. Write each term as an equivalent rational expression
with this denominator.
2x + _
_ 4 -3=_ 2x(x) _4(y) 3(x2y)
__
+ -
xy x2 xy(x) x2(y) x2y
2
2
2x + _ 4y 3x y
=_ -_
x2 y x2y x2y
2x2 + 4y - 3x2y
= ___
x2y
2
4 - 3 = 2x
2x + _ + 4y - 3x2y
Therefore, _ ___ , x 0, y 0
xy x2 x2y
b) Factor the first denominator, and then express each rational
expression as an equivalent expression with the common
denominator (y 2)(y + 2).
y 2 - 20
__ y-2
+ __
2
y -4 y+2
2
y - 20 (y - 2)
= ___ + __
(y - 2)(y + 2) (y + 2)
2
y - 20 (y - 2)(y - 2)
= ___ + ___
(y - 2)(y + 2) (y + 2)(y - 2)
y 2 - 20 + (y - 2)(y - 2)
= _____
(y - 2)(y + 2)
y 2 - 20 + (y 2 - 4y + 4)
= _____
(y - 2)(y + 2)
y 2 - 20 + y 2 - 4y + 4
= _____
(y - 2)(y + 2)
2
2y - 4y - 16
= ___
(y - 2)(y + 2)
1
2(y - 4)(y + 2)
= ___
(y - 2)(y + 2)
1
2(y - 4)
= __
y-2
y 2 - 20 y-2 2(y - 4)
Therefore, __ + __ = __ , y 2.
y2 - 4 y+2 y-2

334 MHR Chapter 6


1
_ x+1
__
1+ x
c) __ = __
x Find a common denominator in both the numerator
1
x-_
2
x -1
__ and the denominator of the complex fraction.
x x
x+1 x2 - 1
= __x
__
x
x+1
= __ What was done to arrive at this rational expression?
x2 - 1
1
x+1
= ___ The complex rational expression could also be
(x - 1)(x + 1)
1 simplified by multiplying the numerator and the
1
= __ denominator by x, which is the LCD for all the
x-1 rational expressions. Try this. Which approach do
you prefer? Why?

1+ x1
_
Therefore, __ 1 , x 0, 1.
= __
1
x-_ x-1
x
Your Turn
Simplify. What are the non-permissible values?

a) __
4 3
+ __
2
p -1 p+1
b) __
x - 1 - ___x-2
x2 + x - 6 x2 + 4x + 3
4
2-_
y
__
c)
4
y-_
y

Key Ideas

You can add or subtract rational expressions with the same denominator by
adding or subtracting their numerators.
x - 4 = 2x
2x - 1 - __
__ - 1 - (x - 4)
____
x+5 x+5 x+5
2x
___-1-x+4
=
x+5
x+3
__
= , x -5
x+5
You can add or subtract rational expressions with unlike denominators after you
have written each as an equivalent expression with a common denominator.
Although more than one common denominator is always possible, it is often
easier to use the lowest common denominator (LCD).

6.3 Adding and Subtracting Rational Expressions MHR 335


Check Your Understanding

Practise 6. Add or subtract. Give answers in simplest


1. Add or subtract. Express answers form. Identify all non-permissible values.
in simplest form. Identify any a) __
8 - __ 5
non-permissible values. x2 - 4 x+2
11x 4x b) ___
1 + __3
a) _ - _
6 6 x2 - x - 12 x+3
_7 3
_ 3x
c) __ - __
x
b) x + x
x+2 x-2
5t + 3 3t + 5 5 1 y-4
c) __ + __ d) __ - _ - __
10 10 y+1 y y2 + y
2
m
d) __ + __
m 2h + ___
h 3
m+1 m+1 e) __
2 2
- __
h -9 h + 6h + 9 h-3
a2 a
e) __ - __ - __
12
f) __
2 + ___ 3
a-4 a-4 a-4
x2 + x - 6 x3 + 2x2 - 3x
3x - 7 6x + 7
2. Show that x and __ + __ are 7. Simplify each rational expression, and
9 9
equivalent expressions. then add or subtract. Express answers in
3. Simplify. Identify all non-permissible simplest form. Identify all non-permissible
values. values.
1 4 3x + 15 4x2 - 1
a) ___ - __ a) __2
+ ___2
(x - 3)(x + 1) (x + 1) x - 25 2x + 9x - 5
x-5 2x +1 2x
b) ___
x-8
- ___
b) ___ + __
3 2 2
x2 + 8x - 20 x2 - 4 x + x - 6x x - 5x - 24
4. Identify two common denominators n+3 6
c) ___ + ___
for each question. What is the LCD in n2 - 5n + 6 n2 - 7n + 12
each case? 2w w-6
d) ___
2
- ___
2
x-3 x-2 w + 5w + 6 w + 6w + 8
a) __ - __
6 4
2
b) _2 + __
3 Apply
5ay 10a2y 8. Linda has made an error in simplifying the
4
c) __2 - __
7 following. Identify the error and correct
9-x 3+x the answer.
5. Add or subtract. Give answers in simplest __ 6 4 7
+ __ - __
form. Identify all non-permissible values. x-2 x2 - 4 x+2
1
a) _ + _
2 6(x + 2) + 4 - 7(x - 2)
3a 5a = _____
(x - 2)(x + 2)
3
b) _ + _
1 6x + 12 + 4 - 7x - 14
2x 6 = _____
(x - 2)(x + 2)
c) 4 - _
6
-x + 2
5x = ___
4z 9x (x - 2)(x + 2)
d) _ _
xy - yz -x + 5
9. Can the rational expression ___
2s 1
e) _2 + _ - _3
6 (x - 5)(x + 5)
5t 10t 15t be simplified further? Explain.
6xy 2x + 1
f) _ -_
a2 b ab2y

336 MHR Chapter 6


10. Simplify. State any non-permissible values. 12. A right triangle has legs of length
6 x and __
_ x - 1 . If all measurements
2-_ 2 4
a) __
x
are in the same units, what is a
1 - 92
_
x simplified expression for the length
3 +_
_ 3 of the hypotenuse?
b) __
2 t 13. Ivan is concerned about an underweight
_ t -_ 1
t+6 t calf. He decides to put the calf on a
healthy growth program. He expects the
_ 3
3 - __ calf to gain m kilograms per week and
m 2m + 3
___ 200 kg in total. However, after some time
c)
3 + __
_ 1
2 on the program, Ivan finds that the calf has
m 2m + 3
been gaining (m + 4) kilograms per week.
1 + __
__ 1
a) Explain what each of the following
x+4
____x-4
d) rational expressions tells about the
__x 1
+ __
2
x - 16 x+4 200 and __
situation: _ 200 .
m m+4
11. Calculators often perform calculations b) Write an expression that shows the
in a different way to accommodate the difference between the number of weeks
machines logic. For each pair of rational Ivan expected to have the calf on the
expressions, show that the second program and the number of weeks the
expression is equivalent to the first one. calf actually took to gain 200 kg.
AD + C
_ c) Simplify your rational expression from
a) _A + ; B
_C __ part b). Does your simplified expression
B D D
still represent the difference between

[ ]
AB + C D
b) AB + CD + EF;
(_
D
___ +E
) F
the expected and actual times the
F calf took to gain 200 kg? Explain how
you know.
14. Suppose you can type an average of
n words per minute.
a) What is an expression for the number
of minutes it would take to type an
assignment with 200 words?
b) Write a sum of rational expressions to
represent the time it would take you to
type three assignments of 200, 500, and
1000 words, respectively.
c) Simplify the sum in part b). What does
the simplified rational expression tell
you?
d) Suppose your typing speed decreases
by 5 words per minute for each new
assignment. Write a rational expression
to represent how much longer it would
take to type the three assignments.
Express your answer in simplest form.

6.3 Adding and Subtracting Rational Expressions MHR 337


15. Simplify. Identify all non-permissible 17. Create a scenario involving two or more
values. rational expressions. Use your expressions
x-2 x2 - 2x - 3 x2 + 2x to create a sum or difference. Simplify.
a) __ + ___ __
x+5 x2 - x - 6 x2 - 4x Explain what the sum or difference
2x2 - x x2 - x - 12 x-1 represents in your scenario. Exchange your
b) __
2
___
2
- __ work with another student in your class.
x + 3x 2x - 3x + 1 x+2
2
Check whether your classmates work
x-2 2 x + 2x
x - 2x - 3 __
c) __ - ___ is correct.
x+5 2
x -x-6 2
x - 4x
2 18. Math teachers can identify common
x+1 x - 4 2x
2 + 7x + 3
d) __ - __ ___
errors that students make when adding or
x+6 x2 + 2x 2x2 + x
subtracting rational expressions. Decide
16. A cyclist rode the first 20-kilometre whether each of the following statements
portion of her workout at a constant speed. is correct or incorrect. Fix each incorrect
For the remaining 16-kilometre portion statement. Indicate how you could avoid
of her workout, she reduced her speed by making each error.
2 km/h. Write an algebraic expression for a b a-b
the total time of her bike ride. a) _ - _ = __
b a ab
ca + cb a+b
b) __ = __
c + cd d
a 6 -
c) _ - __ = __
b a-6-b
4 4 4
1
d) __
b
__
1-_a =
1-a
b
1 -1
e) __ = __
a-b a+b
19. Keander thinks that you can split up
a rational expression by reversing
the process for adding or subtracting
fractions with common denominators.
One example is shown below.
3x - 7
__ 3x - _7
x =_ x x
=3-_ 7
x
a) Do you agree with Keander? Explain.
b) Keander also claims that by using this
method, you can arrive at the rational
expressions that were originally
added or subtracted. Do you agree or
disagree with Keander? Support your
decision with several examples.

338 MHR Chapter 6


20. A formula for the total resistance, R, in Extend
ohms (), of an electric circuit with three a b
21. Suppose that _ = _ , where a, b, c, and d
resistors in parallel is R = ___ 1 , c d
1 +_
_ 1 +_ 1 are real numbers. Use both arithmetic and
R1 R2 R3 a a-b
algebra to show that _ = __ is true.
where R1 is the resistance of the first c c-d
resistor, R2 is the resistance of the second 22. Two points on a coordinate grid are
p-1 p
resistor, and R3 is the resistance of the
third resistor, all in ohms.
(
represented by A __ , _ and
2 3 )
p 2p - 3
a) What is the total resistance if the
3 (
B _ , __ .
4 )
resistances of the three resistors are 2 ,
3 , and 4 , respectively? a) What is a simplified rational expression
for the slope of the line passing through
b) Express the right side of the formula in
A and B?
simplest form.
b) What can you say about the slope of AB
c) Find the total resistance for part a)
when p = 3? What does this tell you
using your new expression from part b).
about the line through A and B?
d) Which expression for R did you find
easier to use? Explain. c) Determine whether the slope of AB is
positive or negative when p < 3 and p
is an integer.
Resistor
d) Predict whether the slope of AB is
R1 positive or negative when p > 3 and
p is an integer. Check your prediction
using p = 4, 5, 6, , 10. What did
Resistor you find?
R2 23. What is the simplified value of the
following expression?
p q
Resistor
Resistor (__ __
p-x + q-x + r-x
_ r
)
x x x
R3 - __ ( __
p-x + q-x + r-x
_
)
Battery
Create Connections
24. Adding or subtracting rational expressions
ALKALINE follows procedures that are similar to
BATTERY
those for adding or subtracting rational
numbers. Show that this statement is
D id Yo u K n ow ? true for expressions with and without
The English physicist James Joule (18181889) common denominators.
showed experimentally that the resistance, R, of a
P
resistor can be calculated as R = _2 , where P is the
I
power, in watts (W), dissipated by the resistor and
I is the current, in amperes (A), owing through the
resistor. This is known as Joules law. A resistor has a
resistance of 1 if it dissipates energy at the rate of
1 W when the current is 1 A.

6.3 Adding and Subtracting Rational Expressions MHR 339


25. Two students are asked to find a fraction 28. MINI LAB In this section, you have added
halfway between two given fractions. and subtracted rational expressions to get a
After thinking for a short time, one of single expression. For example,
the students says, Thats easy. Just find 3 - __ 2 = ___ x+5
__ . What if
the average. x-4 x-1 (x - 4)(x - 1)
a) Show whether the students suggestion you are given a rational expression and
is correct using arithmetic fractions. you want to find two expressions that can
b) Determine a rational expression halfway be added to get it? In other words, you are
3 7 reversing the situation.
between _ _
a and 2a . Simplify your ___ x+5 A + __ B
answer. Identify any non-permissible = __
(x - 4)(x - 1) x-4 x-1
values.
Step 1 To determine A, cover its denominator
26. Mila claims you can add fractions with the in the expression on the left, leaving
same numerator using a different process. x+5
you with __ . Determine the
1
_ 1
_ _ 1 x-1
4 + 3 = _ 12 x+5
__
value of when x = 4, the
7 x-1
7 non-permissible value for the factor
=_
12 of x - 4.
where the denominator in the first step is x+5
__ 4+5 You can often do this
4 3. = __
calculated as __ x-1 4-1 step mentally.
4+3 =3
Is Milas method correct? Explain using
This means A = 3.
arithmetic and algebraic examples.
Step 2 Next, cover (x - 1) in the expression
27. An image found by a convex lens is
1 =_ 1 +_ 1, on the left and substitute x = 1
described by the equation _ x+5
f u v into __ to get 2. This means
where f is the focal length (distance from x-4
B = -2.
the lens to the focus), u is the distance
from the object to the lens, and v is the Step 3 Check that it works. Does
__3 - __ 2 = ___ x+5
distance from the image to the lens. All ?
x-4 x-1 (x - 4)(x - 1)
distances are measured in centimetres.
a) Use the mathematical ideas from this Step 4 What are the values for A and B in the
u+v
1 = __ following?
section to show that _ .
f uv 3x - 1
a) ___ = __ + __
A B
b) What is the value of f when u = 80 and (x - 3)(x + 1) x-3 x+1
v = 6.4? 6x + 15 A B
b) ___ = __ + __
1 u+v (x + 7)(x - 2) x+7 x-2
c) If you know that _ = __ , what is a
f uv Step 5 Do you believe that the method
rational expression for f?
in steps 1 to 3 always works, or
f sometimes works? Use algebraic
reasoning to show that if
F F ___ x+5 A + __ B ,
= __
(x - 4)(x - 1) x-4 x-1
then A = 3 and B = 2.
u v

340 MHR Chapter 6


6.4
Rational Equations
Focus on . . .
identifying non-permissible values in a rational equation
determining the solution to a rational equation algebraically
solving problems using a rational equation

Harbour of ancient Alexandria


Diophantus of Alexandria is often called the father of new algebra. He is best
known for his Arithmetica, a work on solving algebraic equations and on the theory
of numbers. Diophantus extended numbers to include negatives and was one of the
first to describe symbols for exponents. Although it is uncertain when he was born,
we can learn his age when he died from the following facts recorded about him:
his boyhood lasted _ 1 of his life; his beard grew after _
1 more; he
6 12
married after _1 more; his son was born 5 years later; the son lived to
7
half his fathers age and the father died 4 years later.
How many years did Diophantus live?

Investigate Rational Equations

Work with a partner on the following.


1. An equation can be used to solve the riddle about Diophantus life.
Use x to represent the number of years that he lived.
a) Determine an expression for each unknown part of the riddle.
What expression would represent his boyhood, when his beard
began to grow, when he married, and so on?
b) How could you represent 5 years later?
c) What is an equation representing his entire life?
2. Begin to solve your equation.
a) What number could you multiply each expression by to make
each denominator 1? Perform the multiplication.
b) Solve the resulting linear equation.
c) How old was Diophantus when he died? Check your answer with
that of a classmate.

Reflect and Respond


3. Describe a process you could use to solve an equation involving
rational expressions.
4. Show similarities and differences between adding and subtracting
rational expressions and your process for solving an equation
involving them.

6.4 Rational Equations MHR 341


Link the Ideas

Solving Rational Equations

rational equation Rational equations can be used to solve several different kinds of
an equation containing problems, such as work-related problems, where two people or
at least one rational machines work together at different rates to complete a task.
expression
examples are Working with a rational equation is similar to working with rational
x-3 expressions. A significant difference occurs because in an equation,
x = __ and
x+1 what you do to one side you must also do to the other side.
x
_ 7
-_=3
4 x To solve a rational equation,
factor each denominator
identify the non-permissible values
multiply both sides of the equation by the lowest common denominator
solve by isolating the variable on one side of the equation
check your answers

x -_
To solve _ 7 = 3, use the lowest common denominator to express
4 x
each denominator as 1. The lowest common denominator (LCD) for this
equation is 4x. Proceed by multiplying both sides of the equation by
the LCD.
x -_ 7 = 4x(3), x 0
(
4x _
4 )
x
x - 4x _ 7 = 4x(3)
( )
4x _
4 ()
x
Multiply each term on both sides of the equation by
4x. Simplify each term.
x2 - 28 = 12x
x2 - 12x - 28 = 0
(x - 14)(x + 2) = 0
So, x = 14 or x = 2. How can you check that these answers are correct?

It is important to realize that non-permissible values are identified from


the original equation and that these values cannot be solutions to the
final equation.

Example 1
Solve a Rational Equation
Solve the following equation. What values are non-permissible?
__ 2 + __ 10 = __ 1
z2 - 4 6z + 12 z-2

342 MHR Chapter 6


Solution
__ 2 + __10 1
= __
z2 - 4 6z + 12 z-2
Factor each denominator.
2
___ 10
+ __ 1
= __ How can you find the LCD from the factors in the denominators?
(z - 2)(z + 2) 6(z + 2) z-2

From the factors, the non-permissible values are +2 and -2.

10 1

1 1
[
(z - 2)(z + 2)(6) ___ 2 + __
(z - 2)(z + 2) 6(z + 2)
1 1
]
= (z - 2)(z + 2)(6) _
1
z-2 [ ]
2 10 1
[
(z - 2)(z + 2)(6) ___
(z - 2)(z + 2)
1 1
]
+ (z - 2)(z + 2)(6) __
[
6(z + 2) ]
= (z - 2)(z + 2)(6) _
1 1
z-2 (
1
)
(6)(2) + (z - 2)(10) = (z + 2)(6)
12 + 10z - 20 = 6z + 12 What was done
4z = 20 in each step?

z = 5
Check:
Substitute z = 5 into the original equation.
Left Side Right Side
__ 2 + __ 10 __1
z2 - 4 6z + 12 z-2
= __ 2 + __ 10 = __1
52 - 4 6(5) + 12 5-2
2 +_ 10 =_1
=_ 3
21 42
=_ 2 +_ 5
21 21
=_ 7
21
=_1
3
Left Side = Right Side
The non-permissible values are -2 and 2. The solution cannot be one
of the non-permissible values. Since 5 is not one of the non-permissible
values, the solution is z = 5.

Your Turn
Solve the equation. What are the non-permissible values?
__9 - __ 4 = ___ 18
y-3 y-6 y2 - 9y + 18

6.4 Rational Equations MHR 343


Example 2
Solve a Rational Equation With an Extraneous Root
Solve the equation. What are the non-permissible values?
k+1
4k - 1 - __
__ k 2 - 4k + 24
= ___ 2
k+2 k-2 k -4
Solution
k+1
4k - 1 - __
__ k 2 - 4k + 24
= ___
k+2 k-2 k2 - 4
The factors in the denominators are k + 2 and k - 2.
The non-permissible values are 2 and 2. Describe what is done in the
first two steps below.

1 1
(
k+2
k+1
4k - 1 - _
(k - 2)(k + 2) __
k-2 )
= (k - 2)(k + 2) ___
1
[
k 2 - 4k + 24
(k - 2)(k + 2)
1
]
[ (kk --2)(k + 2) ]
2
(k - 2)(k + 2)( 4k - 1 ) - (k - 2)(k + 2)(
k - 2)
__ k+1
_ ___4k + 24
= (k - 2)(k + 2)
k+2
1 1 1 1
2
(k - 2)(4k - 1) - (k + 2)(k + 1) = k - 4k + 24
4k 2 - 9k + 2 - (k 2 + 3k + 2) = k 2 - 4k + 24
4k 2 - 9k + 2 - k 2 - 3k - 2 = k 2 - 4k + 24
2k 2 - 8k - 24 = 0
2(k 2 - 4k - 12) = 0
2(k - 6)(k + 2) = 0
(k - 6)(k + 2) = 0
So, k - 6 = 0 or k + 2 = 0.
k = 6 or k = -2
Without further checking, it appears the solutions are -2 and 6. However,
-2 is a non-permissible value and is called an extraneous solution.
Check: Substitute k = 6 into the original equation.
Left Side Right Side
2
4k - 1 - __
__ k+1 k___- 4k + 24
k+2 k-2 k2 - 4
2
4(6) - 1 6+1 6 - 4(6) + 24
= __ - __ = ___
6+2 6-2 62 - 4
23 - _ 7 =_36
=_ 32
8 4
23 - _ 14 =_9
=_ 8
8 8
=_9
8
Left Side = Right Side What happens if you check
using k = 2?
Therefore, the solution is k = 6.

Your Turn
Solve. What are the non-permissible values?
3x - __
__ 5 = __ -25
x+2 x-3 x2 - x - 6

344 MHR Chapter 6


Example 3
Use a Rational Equation to Solve a Problem
Two friends share a paper route. Sheena can deliver the papers in
40 min. Jeff can cover the same route in 50 min. How long, to the
nearest minute, does the paper route take if they work together?

Solution
Make a table to organize the information.

Time to Deliver Fraction of Work Fraction of Work


Papers (min) Done in 1 min Done in t minutes
1
Sheena 40 _
40 ( 401 )(t) or 40t
_ _

1
_ t
_
Jeff 50
50 50
1
_ t
_
Together t or 1
t t

From the table, the equation for Sheena and Jeff to complete the
work together is _ t +_ t = 1. Why could this equation also
40 50 be called a linear equation?
The LCD is 200.
t + 200 _ t = 200(1)
200 _ ( )
40 ( )
50
5t + 4t = 200
9t = 200
t=_200 or approximately 22.2
9
Check:
Substitute t = _ 200 into the original equation.
9
Left Side Right Side
t
_ + _ t 1
40 50
200 200
= ( ) ( )
_
_
9
40
+
_
_ 9
50
200 _ 1 + _ 200 _ 1
( )( ) ( )( )
= _
9 40 9 50
=_ 5 +_ 4
9 9
=1
Left Side = Right Side

There are no non-permissible values and the value t = _200 checks.


9
Sheena and Jeff deliver the papers together in approximately 22 min.

Your Turn
Stella takes 4 h to paint a room. It takes Jose 3 h to paint the same area.
How long will the paint job take if they work together?

6.4 Rational Equations MHR 345


Example 4
Use a Rational Equation to Solve a Problem
The Northern Manitoba
Trappers Festival, held in
The Pas, originated in 1916.
A championship dog race has
always been a significant part of
the festivities. In the early days,
the race was non-stop from
The Pas to Flin Flon and back.
In one particular race, the total
distance was 140 mi. Conditions were
excellent on the way to Flin Flon. However, bad weather caused the
winners average speed to decrease by 6 mph on the return trip. The total
1 h. What was the winning dog teams average
time for the trip was 8 _
2
speed on the way to Flin Flon?

Solution
distance .
Use the formula distance = rate time, or time = __
rate
Let x represent the average speed, in miles per hour, on the trip from
The Pas to Flin Flon.

Distance (mi) Rate (mph) Time (h)


70
_
Trip to Flin Flon 70 x x
__70
Return from Flin Flon 70 x-6
x-6
1 17
Total 8 _ or _
2 2

Flin Flon Flin Flon


d = 70
d = 70 r=x-6
r=x d
d t=_
t=_ r
r 70
= _____
70
= __ x-6
x
The Pas The Pas
70 + __
70 = _
17 What is the LCD for this equation?
_
x x-6 2 What are the non-permissible values?
70 70 17
2(x)(x - 6) _
x
+ (
__
x-6 ) ( )
= 2(x)(x - 6) _
2
1 1 1
70 + 2(x)(x - 6) __
2(x)(x - 6)( _x) ( x 70- 6 ) = 2(x)(x - 6)( _
17
2)
1 1 1
2(x - 6)(70) + 2(x)(70) = (x)(x - 6)(17)
140x - 840 + 140x = 17x2 - 102x
0 = 17x2 - 382x + 840
Use the quadratic formula to solve the equation.

346 MHR Chapter 6


________
-b
___ b2 - 4ac
x=
2a ____________________
-(-382)
_______ (-382)2 - 4(17)(840)
x=
_______2(17)
382
___ 88 804
x=
34
382
__ 298
x=
34
382 + 298 382 - 298
x = __ or x = __ How else might you have solved the
34 34
42
_ quadratic equation? Explain how you
x = 20 or x= know. Try it.
17
42
Check: Substitute x = 20 and x = _ into the original equation.
17
Left Side Right Side Left Side Right Side
70 + __
_ 70 17 = 8.5
_ 70 + __
_ 70 17 = 8.5
_
x x-6 2 x x-6 2
= 70
_ + __70 _70 __70
= +
20 20 - 6 42
_ 42 - 6
_
7
_ 70
_ 17 17
= +
2 14
= 3.5 + 5 =_ 70 + __ 70
42
_ 42 - _
_ 102
= 8.5 17 17 17
Left Side = Right Side =_ 70 - _ 70
42
_ 60
_
17 17
17 - 70 _ 17
( )
= 70 _
42 ( )
60
= 170
_ - 119
_
6 6
= 8.5
Left Side = Right Side

Although both solutions have been verified and both are permissible, the
42 is inappropriate for this context because if this speed was
solution _
17
reduced by 6 mph, then the speed on the return trip would be negative.
Therefore, the only solution to the problem is 20 mph.
The winning dog teams average speed going to Flin Flon was 20 mph.

Your Turn
A train has a scheduled run of 160 km between two cities in
Saskatchewan. If the average speed is decreased by 16 km/h, the
1 h longer. What is the average speed of the train?
run will take _
2

6.4 Rational Equations MHR 347


Key Ideas

You can solve a rational equation by multiplying both sides by a common denominator.
This eliminates the fractions from the equation. Then, solve the resulting equation.
When solving a word problem involving rates, it is helpful to use a table.
Check that the potential roots satisfy the original equation, are not non-permissible
values, and, in the case of a word problem, are realistic in the context.

Check Your Understanding

Practise Apply
1. Use the LCD to eliminate the fractions 5. A rectangle has the dimensions shown.
from each equation. Do not solve.
2
_
x-1 2x - 5 5 x
a) __ - __ = _ + _ x
3 4 12 6
3-x
____
2x + 3 1 7
b) __ + _ = __ x2
x+5 2 2x + 10
5 =2
4x - __ a) What is an expression for the difference
c) __
2 between the length and the width of the
x -9 x+3
rectangle? Simplify your answer.
2. Solve and check each equation. Identify all
non-permissible values. b) What is an expression for the area of
f+3 f-2 the rectangle? Express the answer in
a) _ - _ = 2 simplest form.
2 3
3 - y 1 1 c) If the perimeter of the rectangle is
b) __ + _ = _
3y 4 2y 28 cm, find the value(s) for x.
9 4 18
c) __ - __ = ___ 6. Solve. Round answers to the nearest
2
w-3 w-6 w - 9w + 18 hundredth.
3. Solve each rational equation. Identify all 26 3
a) __ = 1 + __
non-permissible values. b+5 b-2
6 t c
b) __ - 3 = __
-6
a) _ + _ = 4 c+2 c2 - 4
t 2
6 c+3 7. Experts claim that the golden rectangle
b) __ = __ -5 is most pleasing to the eye. It has
c-3 c2 - 9
d 2-d 1 dimensions that satisfy the equation
c) __ = ___ + __ l = __l+w
d+4 d 2 + 3d - 4 d-1 _ , where w is the width and
x2 + x + 2 w l
d) __ - x = __
x2 - 5
l is the length.
x+1 x2 - 1
According to this relationship, how long
4. Joline solved the following rational should a rectangular picture frame be if its
equation. She claims that the solution width is 30 cm? Give the exact answer and
is y = 1. Do you agree? Explain. an approximate answer, rounded to the
-3y
__ 6y - 9
__ nearest tenth of a centimetre.
y-1 +6= y-1
8. The sum of two numbers is 25. The sum
1 . Determine the
of their reciprocals is _
4
two numbers.
348 MHR Chapter 6
9. Two consecutive numbers are represented 13. Two hoses together fill a pool in 2 h. If
by x and x + 1. If 6 is added to the first only hose A is used, the pool fills in 3 h.
number and two is subtracted from the How long would it take to fill the pool if
second number, the quotient of the new only hose B were used?
numbers is _9 . Determine the numbers 14. Two kayakers paddle 18 km downstream
2
algebraically. with the current in the same time it takes
them to go 8 km upstream against the
10. A French club collected the same amount
current. The rate of the current is 3 km/h.
from each student going on a trip to
Le Cercle Molire in Winnipeg. When a) Complete a table like the following
six students could not go, each of the in your notebook. Use the formula
remaining students was charged an extra distance = rate time.
$3. If the total cost was $540, how many Distance Rate Time
students went on the trip? (km) (km/h) (h)
D id Yo u K n ow ? Downstream
Upstream
Le Cercle Molire is the oldest continuously running
theatre company in Canada, founded in 1925. It is b) What equation could you use to find the
located in St. Boniface, Manitoba, and moved into its rate of the kayakers in still water?
new building in 2009.
c) Solve your equation.

11. The sum of the reciprocals of two d) Which values are non-permissible?
11 . What are
consecutive integers is _ D i d You K n ow ?
30
the integers? When you are travelling with the current, add the
12. Suppose you are running water into a tub. speed of the current to your rate of speed. When you
The tub can be filled in 2 min if only the are travelling against the current, subtract the speed
of the current.
cold tap is used. It fills in 3 min if only
the hot tap is turned on. How long will
it take to fill the tub if both taps are on
simultaneously?
a) Will the answer be less than or greater
than 2 min? Why?
b) Complete a table in your notebook
similar to the one shown.

Fraction
Time to Fraction Filled
Fill Tub Filled in x
(min) in 1 min minutes
Cold Tap
Hot Tap
1
_ x
_
Both Taps x x x or 1

c) What is one equation that represents


both taps filling the tub?
d) Solve your equation to determine the
time with both taps running.
Kyuquot Sound, British Columbia

6.4 Rational Equations MHR 349


15. Nikita lives in Kindersley, Saskatchewan. 17. Ted is a long-distance driver. It took
With her old combine, she can harvest her him 30 min longer to drive 275 km
entire wheat crop in 72 h. Her neighbour on the Trans-Canada Highway west of
offers to help. His new combine can do Swift Current, Saskatchewan, than it took
the same job in 48 h. How long would it him to drive 300 km east of Swift Current.
take to harvest the wheat crop with both He averaged 10 km/h less while travelling
combines working together? west of Swift Current due to more severe
16. Several cows from the Qamanirjuaq snow conditions. What was Teds average
Caribou Herd took 4 days longer to travel speed for each part of the trip?
70 km to Forde Lake, Nunavut, than it 18. Two friends can paddle a canoe at a rate
took them to travel 60 km north beyond of 6 km/h in still water. It takes them 1 h
Forde Lake. They averaged 5 km/h less to paddle 2 km up a river and back again.
before Forde Lake because foraging was Find the speed of the current.
better. What was their average speed 19. Suppose you have 21 days to read a
for the part beyond Forde Lake? Round 518-page novel. After finishing half the
your answer to the nearest tenth of a book, you realize that you must read
kilometre per hour. 12 pages more per day to finish on time.
What is your reading rate for the first half
of the book? Use a table like the following
to help you solve the problem.

Reading Rate Number


in Pages of Pages Number
per Day Read of Days
First
Half
Second
Half

20. The concentration, C, of salt in a solution


is determined by the formula C = __ A ,
s+w
where A is the constant amount of salt, s is
the initial amount of solution, and w is the
amount of water added.
Caribou migrating across the tundra, Hudson Bay a) How much water must be added to a
1-L bottle of 30% salt solution to get a
D id Yo u Know ? 10% solution?
The Qamanirjuaq (ka ma nir you ak) and Beverly b) How much water must be added to a
barren ground caribou herds winter in the same areas half-litre bottle of 10% salt solution to
of northern Manitoba, Saskatchewan, Northeast get a 2% solution?
Alberta, and the Northwest Territories and migrate
north in the spring into different parts of Nunavut
for calving. Extend
1
_ 1
-_
1 4
21. If b = _ and __ = _ , solve for a.
a b
We b Link a 1 1
_ + _ 5
Thiss is the caribou
carib herd that Inuit depended on in a b
Farley Mowats book People of the Deer. For more
information, go to www.mhrprecalc11.ca and follow
the links.

350 MHR Chapter 6


22. A number x is the harmonic mean of a 25. a) A laser printer prints 24 more sheets
1 is the average of _
and b if _ 1 and _1. per minute than an ink-jet printer. If it
x a b takes the two printers a total of 14 min
a) Write a rational equation for the to print 490 pages, what is the printing
statement above. Solve for x. rate of the ink-jet printer?
b) Find two numbers that differ by 8 and
D i d You K n ow ?
have a harmonic mean of 6.
Is a paperless ofce possible? According to Statistics
D id Yo u K n ow ? Canada, our consumption of paper for printing and
writing more than doubled between 1983 and 2003
The distance that a spring
to 91 kg, or about 20 000 pages per person per year.
stretches is represented by the
This is about 55 pages per person per day.
formula d = km, where d is the
distance, in centimetres, m is the
mass, in grams, and k is a constant. b) Examine the data in Did You Know?
Is your paper use close to the national
When two springs with constants k
and j are attached to one another,
average? Explain.
the new spring constant, c, can be found using the c) We can adopt practices to conserve
1 1 1 paper use. Work with a partner to
formula _ = _ + _ . The new spring constant is
c k j
the harmonic mean of the spring constants for the identify eco-responsible ways you can
separate springs. conserve paper and ink.
26. Suppose there is a quiz in your mathematics
23. Sometimes is it helpful to solve for a class every week. The value of each quiz
specific variable in a formula. For example, is 50 points. After the first 6 weeks, your
if you solve for x in the equation average mark on these quizzes is 36.
1 -_
_ 1 = a, the answer is x = __ y
x y . a) What average mark must you receive on
ay + 1
the next 4 quizzes so that your average
a) Show algebraically how you could
1 -_1 = a. Show two is 40 on the first 10 quizzes? Use a
solve for x if _
x y rational equation to solve this problem.
different ways to get the answer. b) There are 15 quizzes in your
1
b) In the formula d = v0t + _ gt 2, solve mathematics course. Show if it is
2
for v0. Simplify your answer. possible to have an average of 90% on
your quizzes at the end of the course if
c) Solve for n in the formula I = __ .
E
r your average is 40 out of 50 on the first
R+_ n 10 quizzes.
Create Connections 27. Tyler has begun to solve a rational
24. a) Explain the difference between rational equation. His work is shown below.
expressions and rational equations. __2 - 3 = __ 5x
Use examples. x-1 x+1
2(x + 1) - 3(x + 1)(x - 1) = 5x(x - 1)
b) Explain the process you would use to
2x + 2 - 3x2 + 1 = 5x2 - 5x
solve a rational equation. As a model,
0 = 8x2 - 7x - 3
describe each step you would use to solve
the following equation. a) Re-work the solution to correct any
5 - __ 1 = __ 1 errors that Tyler made.
_
x x-1 x-1 b) Solve for x. Give your answers as exact
c) There are at least two different ways to values.
begin solving the equation in part b). c) What are the approximate values of x,
Identify a different first step from how to the nearest hundredth?
you began your process in part b).

6.4 Rational Equations MHR 351


Chapter 6 Review
6.1 Rational Expressions, pages 310321 6. a) Explain how to determine
a
1. A rational number is of the form _ , where non-permissible values for a
b rational expression. Use an
a and b are integers.
example in your explanation.
a) What integer cannot be used for b?
Why? b) Simplify. Determine all non-permissible
values for the variables.
b) How does your answer to part a)
3x2 - 13x - 10
i) ___
relate to rational expressions? Explain 3x + 2
using examples. 2
a - 3a
ii) __
2. You can write an unlimited number of 2
a -9
equivalent expressions for any given
3y - 3x
rational expression. Do you agree or iii) __
4x - 4y
disagree with this statement? Explain. 2
81x - 36x + 4
3. What are the non-permissible values, if iv) ___
18x - 4
any, for each rational expression?
7. A rectangle has area x2 1 and
5x2 x2 - 1
a) _ b) __ width x 1.
2y x+1
2 7 a) What is a simplified expression for
27x - 27
c) __ d) ___
3 (a - 3)(a + 2) the length?
-3m +1 t+2 b) Identify any non-permissible values.
e) ___ f) __
2m2 - m - 3 2t 2 - 8 What do they mean in this context?
4. What is the numerical value for each
rational expression? Test your result using
6.2 Multiplying and Dividing Rational
some permissible values for the variable.
Expressions, pages 322330
Identify any non-permissible values.
2s - 8s 8. Explain how multiplying and dividing
a) __
s rational expressions is similar to
5x
__ - 3 multiplying and dividing fractions.
b)
3 - 5x Describe how they differ. Use examples
2-b to support your response.
c) __
4b - 8 9. Simplify each product. Determine all
5. Write an expression that satisfies the given non-permissible values.
conditions in each case. 2p 10q
a) _ _
x-3
a) equivalent to __ , with a r 8p
5 1
denominator of 10x b) 4m3t __4
16mt
x - 3 , with a numerator
b) equivalent to __ 3a + 3b 4
x2 - 9 c) __ __
8 a+b
of 1
x2 - 4 __ 2x2 + 10x
c - 2d
c) equivalent to __ , with a numerator d) __2
3f x + 25 x2 + 2x
of 3c - 6d d 2 + 3d + 2 2d + 6
e) ___ ___ 2
m+1 2d + 2 d + 5d + 6
d) equivalent to __ , with
m+4 y 2
- 8y - 9 y 2 - 9y + 8 y 2 - 25
f) ___ ___ __
non-permissible values of 4 2
y - 10y + 9 2
y -1 5-y

352 MHR Chapter 6


10. Divide. Express answers in simplest form. 6.3 Adding and Subtracting Rational
Identify any non-permissible values. Expressions, pages 331340
a) 2t _
1
13. Determine a common denominator for
4
each sum or difference. What is the lowest
a3 a3
b) _4 _3
b b common denominator (LCD) in each case?
7 -35 What is the advantage of using the LCD?
__
c) 2 __
x - y2 x-y 4
a) _ + _
3
5x 10x
3a + 9 a2 + 6a + 9
d) __ ___ 5 2 1
a-3 a-3 b) __ + __ - __
x-2 x+1 x-2
e) ___
3x - 2 ___9x2 - 4 _1
x3 + 3x2 + 2x 3x2 + 8x + 4 x 14. Perform the indicated operations. Express
answers in simplest form. Identify any
2
4-x
__ non-permissible values.
f) __
6
x-2 m
a) _ + _
3 2m - _
b) _
m
__ x x
2 5 5
x y x-2 x+1
11. Multiply or divide as indicated. Express c) __ + __ d) __ - __
x+y x+y 3 3
answers in simplest form. Determine all x y
non-permissible values. e) __ - __
x2 - y 2 y 2 - x2
9 3
a) _ _
m
_ 15. Add or subtract. Express answers
2m m 3
in simplest form. Identify any
x2 - 3x + 2 x+3 1
b) ___ __ __ non-permissible values.
x2 - 4 x2 + 3x x+2
4x - 3
a) __ - __
x-2
a-3 30 5a - 20
c) __ __ __ 6 4
2
a-4 a+3 a -9 2y - 1 y - 2 y-8
b) __ + __ - __
3x + 12 x - 3 __15 3y 2y 6y
d) ___ __
3x2 - 5x - 12 x+4 3x + 4 9 7
c) __ + __
x-3 x2 - 9
12. The volume of a rectangular
a
d) __ - __
a2 - 3a
prism is (2x3 + 5x2 - 12x) cubic 2
a+3 a +a-6
centimetres. If the length of the prism
e) __ a - 22ab 2 + __
__ b
is (2x - 3) centimetres and its width a-b a -b a+b
is (x + 4) centimetres, what is an 2x x 1
expression for the height of the prism? f) __ + ___ - __
4x2 - 9 2x2 + 5x + 3 2x - 3
16. The sum of the reciprocals of two numbers
will always be the same as the sum of the
(x + 4) centimetres
numbers divided by their product.
(2x - 3) centimetres a) If the numbers are represented by a and
b, translate the sentence above into an
equation.
b) Use your knowledge of adding rational
expressions to prove that the statement
is correct by showing that the left side
is equivalent to the right side.

Chapter 6 Review MHR 353


17. Three tests and one exam are given in a 20. Solve each rational equation. Identify all
course. Let a, b, and c represent the marks non-permissible values.
of the tests and d be the mark from the s-3
a) _ = 2
final exam. Each is a mark out of 100. In s+3
the final mark, the average of the three x+2
__ x+3
b) = __
tests is worth the same amount as the 3x + 2 x-1
z - 2
c) __ + _ = _
1 -4
exam. Write a rational expression for the
z 5 5z
final mark. Show that your expression is __3m 3m
__ -1
d) +2=
a + b + c + 3d m-3 m+3
equivalent to ___ . Choose a
6 x 3
e) __ = __ - 3
sample of four marks and show that the x-3 x-3
simplified expression works. x-2
f) __ = _ + __
1 x-3
2x + 1 2 2x
18. Two sisters go to an
3
g) __ + __ = __
5 3x -1
auction sale to buy x+2 x-3 x2 - x - 6
some antique chairs.
21. The sum of two numbers is 12. The sum
They intend to pay no 3 . What are the
more than c dollars for of their reciprocals is _
8
a chair. Beth is worried numbers?
she will not get the 22. Matt and Elaine, working together, can
chairs. She bids $10 paint a room in 3 h. It would take Matt 5 h
more per chair than to paint the room by himself. How long
she intended and would it take Elaine to paint the room
spends $250. Helen is by herself?
more patient and buys 23. An elevator goes directly
chairs for $10 less per chair than she from the ground up to the
intended. She spends $200 in total. observation deck of the
a) Explain what each of the following Calgary Tower, which is at
expressions represents from 160 m above the ground.
the information given about the The elevator stops at the top
auction sale. for 36 s before it travels
i) c + 10 ii) c - 10 directly back down to the
200 250 ground. The time for the round
iii) __ iv) __
c - 10 c + 10 trip is 2.5 min. The elevator
200
v) __ + __
250 descends at 0.7 m/s faster than
c - 10 c + 10 it goes up.
b) Determine the sum of the rational
a) Determine an equation that
expressions in part v) and simplify could be used to find the
the result. rate of ascent of the elevator.
b) Simplify your
6.4 Rational Equations, pages 341351 equation to the form
19. What is different about the processes ax2 + bx + c = 0, where
used to solve a rational equation from a, b, and c are integers, and
those used to add or subtract rational then solve.
expressions? Explain using examples. c) What is the rate of ascent
in kilometres per hour, to
the nearest tenth?

354 MHR Chapter 6


Chapter 6 Practice Test
Multiple Choice 9. Create an equation you could use to solve
the following problem. Indicate what
For #1 to #5, choose the best answer.
your variable represents. Do not solve
1. What are the non-permissible values for your equation.
x(x + 2) A large auger can fill a grain bin in 5 h less
the rational expression ___ ?
(x - 3)(x + 1) time than a smaller auger. Together they
A 0 and -2 B -3 and 1 fill the bin in 6 h. How long would it take
C 0 and 2 D 3 and -1 the larger auger, by itself, to fill the bin?
2. Simplify the rational expression
2
x - 7x + 6
___
2
for all permissible values of x.
x - 2x - 24
x+1 x-1
A __ B __
x-4 x+4
x+1
__ x
__-1
C D
x+4 x-4
8 5y 5
3. Simplify _ + _ - _ for all permissible
3y 4 8
values of y.
30y 2 - 15y + 64 30y 2 + 79
A ____ B __
24y 24y
2
15y + 64 5y + 3
C __ D __
24y 24y
3x
4. Simplify __
- 12 x - 4
__ , x 0 and x 4.
9x2 3x
A _
1 B _
16
x 10. List similarities and differences between
3x
-12 the processes of adding and subtracting
C x D __ rational expressions and solving rational
x-4
6 4
5. Solve _ = _ , t 3 and t -4. equations. Use examples.
t-3 t+4
A -_
1 B -1
2 Extended Response
5 x+3
C -6 D -18 11. Solve 2 - __ = __ . Identify all
x2 - x - 6 x+2
non-permissible values.
Short Answer
12. The following rational expressions form an
6. Identify all non-permissible values. 3 - x , __ 5x + 3
2x - 1 , __
arithmetic sequence: __ .
3x - 5 ___
__ 2x - 6 x-3 x 2x 5x
__ Use common differences to create a
x2 - 9 3x2 - 2x - 5 x+3
rational equation. Solve for x.
7. If both rational expressions are defined and
equivalent, what is the value of k? 13. A plane is flying from Winnipeg to Calgary
2x2
+ kx - 10 2x - 5 against a strong headwind of 50 km/h. The
___ = __
plane takes _1 h longer for this flight than
2x2 + 7x + 6 2x + 3
2
8. Add or subtract as indicated. Give your it would take in calm air. If the distance
answer in simplest form. from Winnipeg to Calgary is 1200 km, what
5y
_ 1 y+1 is the speed of the plane in calm air, to the
+ __ - __
6 y-2 3y - 6 nearest kilometre per hour?

Chapter 6 Practice Test MHR 355


CHAPTER

7 Absolute Value and


Reciprocal Functions
Suppose you and your friend each live 2 km from your school,
but in opposite directions from the school. You could represent
these distances as 2 km in one direction and -2 km in the other
direction. However, you would both say that you live the same
distance, 2 km, from your school. The absolute value of the
distance each of you lives from your school is 2 km. Can you
think of other examples where you would use an absolute value?

Currency exchange is an example of a reciprocal relationship. If


1 euro is equivalent to 1.3 Canadian dollars, what is 1 Canadian
dollar worth in euros? If you take a balloon underwater, you can
represent the relationship between its shrinking volume and the
increasing pressure of the air inside the balloon as a reciprocal
function.
Depth (m) Pressure (atm) Air Volume (m3)
0 1 1
1
_
10 2
Is this depth change 2
20 m or -20 m? 1
_
20 3
Which value would 3
you use? Why? 1
_
30 4
4
1
_
40 5
5

In this chapter, you will learn about absolute value and


reciprocal functions. You will also learn how they are used
to solve problems.

We b Link
The relationship between the pressure and the volume of a confined gas
held at a constant temperature is known as Boyles law. To learn more about
Boyles law, go to www.mhrprecalc11.ca and follow the links.

Key Terms
absolute value absolute value equation
absolute value function reciprocal function
piecewise function asymptote
invariant point

356 MHR Chapter 7


Career Link
The job of a commercial diver is exciting,
dangerous, technically challenging,
and extremely important. Divers must
undergo both theoretical and practical
training involving physics, chemistry,
and mathematics.

We b Link
To learn
earn more about
a the job of a commercial diver,
go to www.mhrprecalc11.ca and follow the links.

The Newtsuit, a one-person submarine, is


the invention of Dr. Phil Nuytten, a Mtis
scientist from Vancouver, British Columbia.

Chapter 7 MHR 357


7.1
Absolute Value
Focus on . . .
determining the absolute values of numbers and expressions
explaining how the distance between two points on a number line can be
expressed in terms of absolute value
comparing and ordering the absolute values of real numbers in a given set

The hottest temperature ever recorded in Saskatoon, Saskatchewan, D i d You K n ow ?


was 40.6 C on June 5, 1988. The coldest temperature, -50.0 C, was In 1962 in Pincher
recorded on February 1, 1893. You can calculate the total temperature Creek, Alberta, a
difference as chinook raised the
temperature by 41 C
-50.0 - 40.6 = d or 40.6 - (-50.0) = d (from -19 C to
-90.6 = d 90.6 = d +22 C) in 1 h. This is
a Canadian record for
Generally, you use the positive value, 90.6 C, when describing the
temperature change
difference. Why do you think this is the case? Does it matter which in a day.
value you use when describing this situation? Can you describe a
situation where you would use the negative value?

Delta Bessborough Hotel, Saskatoon, Saskatchewan

358 MHR Chapter 7


Investigate Absolute Value

1. Draw a number line on grid paper that is approximately 20 units Materials


long. Label the centre of the number line as 0. Label the positive grid paper
and negative values on either side of zero, as shown. ruler

-7 -6 -5 -4 -3 -2 -1 0 1 2 3 4 5 6 7

2. Mark the values +4 and -4 on your number line. Describe their


distances from 0.
3. a) Plot two points to the right of zero. How many units are between
the two points?
b) Calculate the distance between the two points in two different ways.
4. Repeat step 3 using two points to the left of zero.
5. Repeat step 3 using one point to the right of zero and one point to
the left.
6. What do you notice about the numerical values of your calculations
and the number of units between each pair of points you chose in
steps 3, 4, and 5?
7. What do you notice about the signs of the two calculated distances
for each pair of points in steps 3, 4, and 5?

Reflect and Respond


8. Identify three different sets of points that have a distance of 5 units
between them. Include one set of points that are both positive,
one set of points that are both negative, and one set containing a
positive and a negative value. How did you determine each set
of points?
9. Explain why the distance from 0 to +3 is the same as the distance
from 0 to -3. Why is the distance referred to as a positive number?

7.1 Absolute Value MHR 359


Link the Ideas

absolute value For a real number a, the absolute value is written as |a| and is a
positive number.
a, if a 0
|a| = { -a, if a < 0 Two vertical bars around a number or expression are used to
represent the absolute value of the number or expression.
For example,
The absolute value of a positive number is the positive number.
|+5| = 5
The absolute value of zero is zero.
|0| = 0
The absolute value of a negative number is the negative of that
number, resulting in the positive value of that number.
|-5| = -(-5)
=5
Absolute value can be used to represent the distance of a number
from zero on a real-number line.
|-5| = 5 |+5| = 5

-6 -5 -4 -3 -2 -1 0 1 2 3 4 5 6
In Chapter
___ 5, you learned
that x 2 = x only when x 5 units 5 units
is positive.

How can you use this In general, the absolute value of a real number a is defined as
fact and the definition of a, if a 0
absolute
___value to show
that x 2 = |x|?
|a| = {-a, if a < 0

Example 1
Determining the Absolute Value of a Number
Evaluate the following.
a) |3|
b) |-7|

Solution
a) |3| = 3 since |a| = a for a 0.

b) |-7| = -(-7)
=7
since |a| = -a for a < 0.

Your Turn
Evaluate the following.
a) |9|
b) |-12|

360 MHR Chapter 7


Example 2
Compare and Order Absolute Values
Write the real numbers in order from least to greatest.
|-6.5|, 5, |4.75|, -3.4, - _
12 , |-0.1|, -0.01, -2 _
| | 1
| |
5 2
Solution
First, evaluate each number and express it in decimal form.
6.5, 5, 4.75, -3.4, 2.4, 0.1, -0.01, 2.5
Then, rearrange from least to greatest value.
-3.4, -0.01, 0.1, 2.4, 2.5, 4.75, 5, 6.5
Now, show the original numbers in order from least to greatest.
-3.4, -0.01, |-0.1|, - _
12 , -2 _
| 1 , |4.75|, 5, |-6.5|
|| |
5 2
Your Turn
Write the real numbers in order from least to greatest.
13 , |-0.5|, -1.25, -3 _
|3.5|, -2, |-5.75|, 1.05, - _ 1
4 | | 3 | |
Absolute value symbols should be treated in the same manner as
brackets. Evaluate the absolute value of a numerical expression by first
applying the order of operations inside the absolute value symbol, and
then taking the absolute value of the result.

Example 3
Evaluating Absolute Value Expressions
Evaluate the following.
a) |4| - |-6| b) 5 - 3|2 - 7| c) |-2(5 - 7)2 + 6|

Solution
a) |4| - |-6| = 4 - 6
= -2

b) 5 - 3|2 - 7| = 5 - 3|-5|
= 5 - 3(5)
= 5 - 15
= -10

c) |-2(5 - 7)2 + 6| = |-2(-2)2 + 6| Apply the order of


= |-2(4) + 6| operations to evaluate
the expression inside the
= |-8 + 6| absolute value symbol.
= |-2|
= 2
Your Turn
Evaluate the following.
a) |-4| - |-3| b) |-12 + 8| c) |12(-3) + 52|

7.1 Absolute Value MHR 361


Example 4
Change in Stock Value
On stock markets, individual stock and bond values fluctuate a great
deal, especially when the markets are volatile. A particular stock on the
Toronto Stock Exchange (TSX) opened the month at $13.55 per share,
dropped to $12.70, increased to $14.05, and closed the month at $13.85.
Determine the total change in the value of this stock for the month. This
total shows how active the stock was that month.

Solution
Represent the stock values by V1 = 13.55, V2 = 12.70, V3 = 14.05, and
V4 = 13.85. Calculate each change in stock value using |Vi + 1 - Vi|,
where i = 1, 2, 3.
Did Yo u Know ? Calculate each change in stock value and find Does the order in
the sum of these changes. which the values are
Calculate the net subtracted matter?
change of a stock as |V2 - V1| + |V3 - V2| + |V4 - V3|
the closing value of = |12.70 - 13.55| + |14.05 - 12.70| + |13.85 - 14.05|
the stock minus the
= |-0.85| + |+1.35| + |-0.20|
opening value.
= 0.85 + 1.35 + 0.20
Net change = 2.40
= $13.85 - $13.55
= $0.30 The total change in stock value for the month Why would an investor find
the volatility of a particular
is $2.40.
stock useful when making
investment decisions?
Your Turn
Wesley volunteers at a local hospital because he is interested in a career
in health care. One day, he takes the elevator from the first floor up to the
sixth floor to see his supervising nurse. His list of tasks for that day sends
him down to the second floor to work in the gift shop, up to the fourth
floor to visit with patients, and down to the first floor to greet visitors
and patients. What is the total change in floors for Wesley that day?

362 MHR Chapter 7


Key Ideas

The absolute value of a real number a is defined as

|a| = { a,-a,if ifa a<0 0


Geometrically, the absolute value of a real number a, written as |a|, is its
distance from zero on the number line, regardless of direction.
Determine the absolute value of a numerical expression by
 evaluating the numerical expression inside the absolute value symbol
using the order of operations
 taking the absolute value of the resulting expression

Check Your Understanding

Practise 6. Determine the value of each absolute


1. Evaluate. value expression.
a) |9| b) |0| a) 2|-6 - (-11)|
c) |-7| d) |-4.728| b) |-9.5| - |12.3|

e) |6.25| f) |-5 _21 | c) 3 | _12 | + 5|- _34 |


2. Order the numbers from least to greatest. d) |3(-2)2 + 5(-2) + 7|
|0.8|, 1.1, |-2|, _
3 , -0.4, -1 _1 , -0.8
5 | | 4 | | e) |-4 + 13| + |6 - (-9)| - |8 - 17| + |-2|

3. Order the numbers from greatest to least.


Apply
-2.4, |1.3|, - _7 , -1.9, |-0.6|, 1 _
| | 1 , 2.2
| | 7. Use absolute value symbols to write an
5 10
4. Evaluate each expression.
expression for the length of each horizontal
or vertical line segment. Determine each
a) |8 - 15| b) |3| - |-8| length.
c) |7 - (-3)| d) |2 - 5(3)| a) A(8, 1) and B(3, 1)
5. Use absolute value symbols to write an b) A(12, 9) and B(-8, 9)
expression for the distance between each
c) A(6, 2) and B(6, 9)
pair of specified points on the number
line. Determine the distance. d) A(-1, -7) and B(-1, 15)
A B C D e) A(a, y) and B(b, y)
-6.7 -3.4 0 2.1 5.8 f) A(x, m) and B(x, n)
a) A and C b) B and D
c) C and B d) D and A

7.1 Absolute Value MHR 363


8. Southern Alberta often experiences dry 10. The Alaska Highway runs from Dawson
chinook winds in winter and spring Creek, British Columbia, to Delta Junction,
that can change temperatures by a large Alaska. Travel guides along the highway
amount in a short time. On a particular mark historic mileposts, from mile 0
day in Warner, Alberta, the temperature in Dawson Creek to mile 1422 in Delta
was -11 C in the morning. A chinook Junction. The table shows the Ramsay
wind raised the temperature to +7 C by familys trip along this highway.
afternoon. The temperature dropped to Mile
-9 C during the night. Use absolute value Destination Number
symbols to write an expression for the total Starting
Charlie Lake campground 51
change in temperature that day. What is the Point
total change in temperature for the day? Tuesday Liard River, British Columbia 496

D id Yo u Know ? Wednesday Whitehorse, Yukon Territory 918


Thursday Beaver Creek,
A First Nations legend of the Statimc Nation of 1202
Yukon Territory
British Columbia says that a girl named Chinook-Wind
married Glacier and moved to his country. In this Haines Junction,
1016
Yukon Territory
foreign land, she longed for her home and sent a
message to her people. They came to her rst in Friday Delta Junction, Alaska 1422
a vision of snowakes, then rain, and nally as a
Use an expression involving absolute value
melting glacier that took her home.
symbols to determine the total distance, in
miles, that the Ramsay family travelled in
9. Suppose a straight stretch of highway
these four days.
running west to east begins at the town of
Allenby (0 km). The diagram shows the
distances from Allenby east to various
towns. A new grain storage facility is to
be built along the highway 24 km east
of Allenby. Write an expression using
absolute value symbols to determine the
total distance of the grain storage facility
from all seven towns on the highway
for this proposed location. What is the
distance?
0 10 17 30 42 55 72
Allenby Crawley Denford Essex Fortier Grey
Birkend Ridge

D i d You K n ow ?

In 1978, the mileposts along the Canadian section


were replaced with kilometre posts. Some mileposts
at locations of historic signicance remain, although
reconstruction and rerouting mean that these markers
no longer represent accurate driving distances.

364 MHR Chapter 7


11. When Vanessa 14. The Yukon Quest dog sled race runs
Date Balance
checks her bank between Fairbanks, Alaska, and
Oct. 4 $359.22
account on-line, Whitehorse, Yukon Territory, a distance
Oct. 12 $310.45
it shows the of more than 1000 mi. It lasts for 2 weeks.
Oct. 17 $295.78 The elevation at Fairbanks is 440 ft, and
following
balances: Oct. 30 $513.65 the elevation at Whitehorse is 2089 ft.
Nov. 5 $425.59
Circle City
a) Use an absolute value expression to Central Eagle
Mile 101 Dawson City
determine the total change in Vanessas North
Slavens
Cabin Pelly Crossing
Pole
bank balance during this period.

Alaska
Chena Hot

Yukon
Carmacks
Scroggie
Springs Creek McCabe
Fairbanks
b) How is this different from the net Creek

Braeburn
change in her bank balance? Rosebud
Eagle
American
Summit
King Solomons
Dome Whitehorse
Summit 4002 ft
Summit 3420 ft
3640 ft
12. In physics, the amplitude of a wave is 3685 ft

2250 ft
measured as the absolute value of the 2326 ft
2089 ft
1558 ft 1722 ft
difference between the crest height and the 440 ft
1550 ft 935 ft
597 ft
880 ft
1050 ft

trough height of the wave, divided by 2.


|crest height - trough height|
Amplitude = ______ a) Determine the net change in elevation
2
from Fairbanks to Whitehorse.
crest
b) The race passes through Central, at an
elevation of 935 ft; Circle City, whose
one cycle elevation is 597 ft; and Dawson City,
at an elevation of 1050 ft. What is the
amplitude total change in elevation from Fairbanks
trough
to Whitehorse, passing through
Determine the amplitude of waves these cities?
with the following characteristics.
D i d You K n ow ?
a) crest at height 17 and trough at height 2
The Yukon Quest has run every year since 1984. The
b) crest at height 90 and trough at
race follows the historic Gold Rush and mail delivery
height -90
dog sled routes from the turn of the 20th century.
c) crest at height 1.25 and trough at In even-numbered years, the race starts in Fairbanks
height -0.5 and ends in Whitehorse. In odd-numbered years, the
race starts in Whitehorse and ends in Fairbanks.
13. The Festival du Voyageur is an annual
Francophone winter festival held in
Manitoba. One of the outdoor events at the
festival is a snowshoe race. A possible trail
Extend
15. A trading stock opens the day at a value of
for the race is 2 km long, with the start at
$7.65 per share, drops to $7.28 by noon,
0 km; checkpoints at 500 m, 900 m, and
then rises to $8.10, and finally falls an
1600 m; and the finish at 2 km. Suppose
unknown amount to close the trading day.
a race organizer travels by snowmobile
If the absolute value of the total change for
from the start to the 1600-m checkpoint,
this stock is $1.55, determine the amount
back to the 900-m checkpoint, then out
that the stock dropped in the afternoon
to the finish line, and finally back to the
before closing.
500-m checkpoint. Use an absolute value
expression to determine the total distance
travelled by the race organizer, in metres
and in kilometres.

7.1 Absolute Value MHR 365


16. As part of a scavenger hunt, Toby collects 20. In the Millikan oil drop experiment, oil
items along a specified trail. Starting at drops are electrified with either a positive
the 2-km marker, he bicycles east to the or a negative charge and then sprayed
7-km marker, and then turns around and between two oppositely charged metal
bicycles west back to the 3-km marker. plates. Since an individual oil drop will
Finally, Toby turns back east and bicycles be attracted by one plate and repelled by
until the total distance he has travelled is the other plate, the drop will move either
15 km. upward or downward toward the plate
a) How many kilometres does Toby travel of opposite charge. If the charge on the
in the last interval? plates is reversed, the oil drop is forced
to reverse its direction and thus stay
b) At what kilometre marker is Toby at the
suspended indefinitely.
end of the scavenger hunt?
cover
17. Mikhala and Jocelyn are examining
some effects of absolute value on the
sum of the squares of the set of values oil
spray
{-2.5, 3, -5, 7.1}. Mikhala takes the microscope
several d
absolute value of each number and then
thousand
squares it. Jocelyn squares each value and volts
then takes the absolute value.
uniform electric field
a) What result does each student get?
Suppose an oil drop starts out at 45 mm
b) Explain the results.
below the upper plate, moves to a point
c) Is this always true? Explain. 67 mm below the upper plate, then to a
18. a) Michel writes the expression |x - 5|, point 32 mm from the upper plate, and
where x is a real number, without the finally to a point 58 mm from the upper
absolute value symbol. His answer is plate. What total distance does the oil
shown below. drop travel during the experiment?

|x - 5| = { x-(x- 5,- 5),


if x - 5 0
if x - 5 < 0 Create Connections
x - 5, if x 5 21. Describe a situation in which the
|x - 5| = { absolute value of a measurement is
5 - x, if x < 5
preferable to the actual signed value.
Explain the steps in Michels solution.
22. When an object is thrown into the air,
b) If x is a real number, then write each
it moves upward, and then changes
of the following without the absolute
direction as it returns to Earth. Would
value symbol.
it be more appropriate to use signed
i) |x - 7| ii) |2x - 1| values (+ or -) or the absolute value for
iii) |3 - x| iv) |x2 + 4| the velocity of the object at any point in
19. Julia states, To determine the absolute its flight? Why? What does the velocity
value of any number, change the sign of of the object at the top of its flight have
the number. Use an example to show to be?
that Julia is incorrect. In your own
words, correctly complete the statement,
To determine the absolute value of a
number, .

366 MHR Chapter 7


23. A school volleyball team has nine players. 24. When writing a quadratic function
The heights of the players are 172 cm, in vertex form, y = a(x - p)2 + q, the
181 cm, 178 cm, 175 cm, 180 cm, 168 cm, vertex of the graph is located at (p, q).
177 cm, 175 cm, and 178 cm. If the function has zeros, or its graph
has x-intercepts, you can find___them

using the equation x = p _q .


| |a
a) Use this equation to find the zeros
of each quadratic function.
i) y = 2(x + 1)2 - 8
ii) y = -(x + 2)2 + 9
How could you verify that the zeros
are correct?
a) What is the mean height of the players? b) What are the zeros of the function
b) Determine the absolute value of the y = 4(x - 3)2 + 16? Explain whether
difference between each individuals or not you could use this method to
height and the mean. Determine the determine the zeros for all quadratic
sum of the values. functions written in vertex form.
___
c) Divide the sum by the number of players. 25. Explain, using examples, why x 2 = |x|.
d) Interpret the result in part c) in terms
of the height of players on this team.

Project Corner Space Tourism

Assume the following for the future of


space tourism.
The comfort and quality of a cruise ship
are available for travel in outer space.
The space vehicle in which tourists travel
is built within specified tolerances for
aerodynamics, weight, payload capacity, and
life-support systems, to name a few criteria.
Each space vehicle leaves Earth within a
given launch window.
The distance of Earth from other celestial destinations changes at
different times of the year.
The quantity of fuel on board the space vehicle determines its range of travel.
How might absolute value be involved in these design and preparation issues?

7.1 Absolute Value MHR 367


7.2
Absolute Value
Functions
Focus on . . .
creating a table of values for y = |f(x)|, given a
table of values for y = f(x)
sketching the graph of y = |f(x)| and determining
its intercept(s), domain, and range
generalizing a rule for writing absolute value
functions in piecewise notation

Stroboscopic photography involves using a fl flashing


hi strobe
t b lilight
ht and
da
camera with an open shutter. You must take stroboscopic photographs in
darkness so that every time the strobe flashes, you take a still image of a
moving object at that instant. Shown here is a stroboscopic photograph
following the path of a bouncing ball. To measure the total vertical
distance the ball travels as it bounces over a certain time interval, use
the absolute value of the function that models the height over time. What
type of function would you use to model the height of this bouncing ball
over time?

Investigate Absolute Value Functions

Materials In this activity, you will explore the similarities and differences between
grid paper linear, quadratic, and absolute value functions.
Part A: Compare Linear Functions With Corresponding Absolute Value
Functions
Consider the functions f(x) = x and g(x) = |x|.
1. Copy the table of values. Use the values of f (x) to
determine the values of g(x) and complete the table. What happens to
the value of the
x f(x) g (x)
functions f(x) and
-3 -3 g(x) when the
-2 -2 values of x are
negative?
-1 -1
0 0
1 1
2 2
3 3

2. Use the coordinate pairs to sketch graphs of the


functions on the same grid.

368 MHR Chapter 7


Reflect and Respond
3. Which characteristics of the two graphs are similar and which
are different?
4. From the graph, explain why the absolute value relation is
a function.
5. a) Describe the shape of the graph of g(x).
b) If you could sketch the graph of g(x) using two linear functions,
what would they be? Are there any restrictions on the domain
and range of each function? If so, what are they?

Part B: Compare Quadratic Functions With Corresponding Absolute


Value Functions
Consider the functions f(x) = x2 - 3 and h(x) = |x2 - 3|.
6. Copy the table of values. Use the values of f(x) to
determine the values of h(x) and complete the table.
x f(x) h (x)
-3 6
When are the
-2 1
values of f(x) and
-1 -2 h(x) the same and
0 -3 when are they
different?
1 -2
2 1
3 6

7. Use the coordinate pairs to sketch the graphs of f (x)


and h(x) on the same grid.

Reflect and Respond


8. Which characteristics of the two graphs are similar and which
are different?
9. a) For what values of x are the graphs of f(x) and h(x) the same?
different?
b) If you could sketch the graph of h(x) using two quadratic
functions, what would they be? Are there any restrictions on
the domain and range of each function? If so, what are they?
10. Describe how the graph of a linear or quadratic function is
related to its corresponding absolute value graph.

7.2 Absolute Value Functions MHR 369


Link the Ideas

absolute value The vertex, (0, 0), divides the graph of this absolute value function
function y = |x| into two distinct pieces.
a function that involves y
the absolute value of a y = |x|
variable 4

-4 -2 0 2 4 x
-2

-4
y=x

For all values of x less than zero, the y-value is -x. For all values of
x greater than or equal to zero, the y-value is x. Since the function is
defined by two different rules for each interval in the domain, you can
piecewise function define y = |x| as the piecewise function
a function composed of
two or more separate
functions or pieces,
y= { x,-x,if ifx x<0 0
each with its own
specific domain, that
The graph shows how y = |x| is related to the graph of y = x. Since |x|
combine to define the cannot be negative, the part of the graph of y = x that is below the x-axis
overall function is reflected in the x-axis to become the line y = -x in the interval x < 0.
the absolute value The part of the graph of y = x that is on or above the x-axis is zero or
function y = |x| can
positive and remains unchanged as the line y = x in the interval x 0.
be defined as the
piecewise function
x, if x 0
{
y = -x, if x < 0
Example 1
Graph an Absolute Value Function of the Form y = |ax + b|
Consider the absolute value function y = |2x - 3|.
a) Determine the y-intercept and the x-intercept.
b) Sketch the graph.
c) State the domain and range.
d) Express as a piecewise function.

Solution
a) To determine the y-intercept, let x = 0 and solve for y.
y = |2x - 3|
y = |2(0) - 3|
y = |-3|
y=3
The y-intercept occurs at (0, 3).

370 MHR Chapter 7


To determine the x-intercept, set y = 0 and solve for x.
|2x - 3| = 0
2x - 3 = 0 Since |0| = 0, |2x - 3| = 0 when 2x - 3 = 0.
2x = 3
x=_ 3
2
The x-intercept occurs at _ 3, 0 .
( )
2
b) Method 1: Sketch Using a Table of Values
Create a table of values, using the x-intercept and values to the
right and left of it.
Sketch the graph using the points in the table.
x y = |2x - 3| y

-1 5 6

0 3 4
(0, 3)
_3 0 y = |2x - 3|
2 2

3 3 2 ( )
3, 0
_

-2 0 2 4 6 x
4 5

Method 2: Sketch Using the Graph of y = 2x - 3


Use the graph of y = 2x - 3 to graph y = |2x - 3|.
Sketch the graph of y = 2x - 3, which is a line with a slope
of 2 and a y-intercept of -3.

The x-intercept of the original function is the x-intercept of the


corresponding absolute value function. The point representing
the x-intercept is an invariant point. invariant point
a point that remains
Reflect in the x-axis the part of the graph of y = 2x - 3 that is unchanged when a
below the x-axis. transformation is
applied to it
y
6
y = |2x - 3|
4
(0, 3) What other points
2 on the graph are
( _32 , 0) invariant points?

-4 -2 0 2 4 6 x
-2
(0, -3)
-4
y = 2x - 3
-6

7.2 Absolute Value Functions MHR 371


c) Since there is no x-value that cannot be substituted into the
function y = |2x - 3|, the domain is all real numbers, or {x | x R}.
For all values of x, |2x - 3| 0. The range is {y | y 0, y R}.

d) The V-shaped graph of the absolute value function y = | 2x - 3| is


composed of two separate linear functions, each with its own domain.
When x _ 3 , the graph of y = |2x - 3| is the graph of y = 2x - 3,
2
which is a line with a slope of 2 and a y-intercept of -3.
When x < _ 3 , the graph of y = |2x - 3| is the graph of
2
y = 2x - 3 reflected in the x-axis. The equation of the
reflected graph is y = -(2x - 3) or y = -2x + 3, which is a
line with a slope of -2 and a y-intercept of 3.
You can combine these two linear functions with their domains to
define the absolute value function y = |2x - 3|. Express the absolute
value function y = |2x - 3| as the piecewise function

2x - 3, if x _
3
y=
{ 2
-(2x - 3), if x < _
3
2

Your Turn
Consider the absolute value function y = |3x + 1|.
a) Determine the y-intercept and the x-intercept.
b) Sketch the graph.
c) State the domain and range.
d) Express as a piecewise function.

Example 2
Graph an Absolute Value Function of the Form f (x) = |ax2 + bx + c|
Consider the absolute value function f (x) = |-x2 + 2x + 8|.
a) Determine the y-intercept and the x-intercepts.
b) Sketch the graph.
c) State the domain and range.
d) Express as a piecewise function.

Solution
a) Determine the y-intercept by evaluating the function at x = 0.
f(x) = |-x2 + 2x + 8|
f(0) = |-(0)2 + 2(0) + 8|
f(0) = |8|
f(0) = 8
The y-intercept occurs at (0, 8)

372 MHR Chapter 7


The x-intercepts are the real zeros of the function, since they
correspond to the x-intercepts of the graph.
f(x) = |-x2 + 2x + 8|
0 = -x2 + 2x + 8
0 = -(x2 - 2x - 8)
0 = -(x + 2)(x - 4)
x + 2 = 0 or x - 4 = 0
x = -2 x=4
The x-intercepts occur at (-2, 0) and (4, 0).

b) Use the graph of y = f (x) to graph y = |f(x)|.

Complete the square to convert the quadratic function


y = -x2 + 2x + 8 to vertex form, y = a(x - p)2 + q.
y = -x2 + 2x + 8
y = -(x2 - 2x) + 8
y = -(x2 - 2x + 1 - 1) + 8
y = -[(x2 - 2x + 1) - 1] + 8
y = -[(x - 1)2 - 1] + 8
y = -(x - 1)2 - 1(-1) + 8
y = -(x - 1)2 + 9
Since p = 1 and q = 9, the vertex is located at (1, 9). Since a < 0, the
parabola opens downward. Sketch the graph.
y
10
(1, 9)
What other methods could you
8 use to find the vertex of the
(0, 8)
quadratic function?
6

4
y = |-x2 + 2x + 8|
2
(-2, 0) (4, 0)
-8 -6 -4 -2 0 2 4 6 x
-2

-4
y = -x2 + 2x + 8
-6

-8

-10

Reflect in the x-axis the part of the graph of y = -x2 + 2x + 8 that lies
below the x-axis.

c) The domain is all real numbers, or {x | x R}, and the range is all
non-negative values of y, or {y | y 0, y R}.

7.2 Absolute Value Functions MHR 373


d) The graph of y = |-x2 + 2x + 8| consists of two separate quadratic
functions. You can use the x-intercepts to identity each functions
specific domain.
When -2 x 4, the graph of y = |-x2 + 2x + 8| is the graph of
y = -x2 + 2x + 8, which is a parabola opening downward with a
vertex at (1, 9), a y-intercept of 8, and x-intercepts at -2 and 4.
When x < -2 or x > 4, the graph of y = |-x2 + 2x + 8| is the graph
of y = -x2 + 2x + 8 reflected in the x-axis. The equation of the
reflected graph is y = -(-x2 + 2x + 8) or y = x2 - 2x - 8, which is
a parabola opening upward with a vertex at (1, -9), a y-intercept of
-8, and x-intercepts at -2 and 4.

y
y = -x2 + 2x + 8,
10
(1, 9) -2 x 4
8
(0, 8)
6
y = x2 - 2x - 8, y = x2 - 2x - 8,
4
x < -2 x>4
2
(-2, 0) (4, 0)
-
-8 -6 -4 -2 0 2 4 6 8 10 x
-2

-4

-6

-8
(0, -8)
(1, -9)
-10

Express the absolute value function y = |-x2 + 2x + 8|


as the piecewise function
-x2 + 2x + 8, if -2 x 4
y= {
-(-x2 + 2x + 8), if x < -2 or x > 4

Your Turn
Consider the absolute value function f(x) = |x2 - x - 2|.
a) Determine the y-intercept and the x-intercepts.
b) Sketch the graph.
c) State the domain and range.
d) Express as a piecewise function.

374 MHR Chapter 7


Key Ideas

You can analyse absolute value functions in several ways:


 graphically, by sketching and identifying the characteristics of the
graph, including the x-intercepts and the y-intercept, the minimum
values, the domain, and the range
 algebraically, by rewriting the function as a piecewise function
 In general, you can express the absolute value function y = |f(x)|
as the piecewise function

y= { f(x), if f (x) 0
-f(x), if f (x) < 0
The domain of an absolute value function y = |f(x)| is the same as the
domain of the function y = f(x).
The range of an absolute value function y = |f(x)| depends on the range
of the function y = f(x). For the absolute value of a linear or quadratic
function, the range will generally, but not always, be {y | y 0, y R}.

Check Your Understanding

Practise 2. The point (-5, -8) is on the graph of


1. Given the table of values for y = f(x), y = f (x). Identify the corresponding
create a table of values for y = |f(x)|. point on the graph of y = |f (x)|.
a) x y = f (x) 3. The graph of y = f(x) has an x-intercept
-2 -3
of 3 and a y-intercept of -4. What are the
x-intercept and the y-intercept of the graph
-1 -1
of y = |f(x)|?
0 1
4. The graph of y = f (x) has x-intercepts of
1 3
-2 and 7, and a y-intercept of - _3 . State
2 5 2
the x-intercepts and the y-intercept of the
b) x y = f (x) graph of y = |f (x)|.
-2 0
-1 -2
0 -2
1 0
2 4

7.2 Absolute Value Functions MHR 375


5. Copy the graph of y = f(x). On the same set 7. Copy the graph of y = f (x). On the same set
of axes, sketch the graph of y = |f(x)|. of axes, sketch the graph of y = |f(x)|.
a) y a) y
y = f(x)
4 4
y = f(x)

2 2

-2 0 2 4 x -2 0 2 4 x
-2 -2

b) y b) y
y = f(x)
4 4
y = f(x)
2 2

-2 0 2 4 x -2 0 2 4 x
-2 -2

c) y c) y
4 2
y = f(x)
2
-6 -4 -2 0 x
-2
-2 0 2 4 x
y = f(x)
-2 -4

-4
8. Sketch the graph of each function. State
the intercepts and the domain and range.
6. Sketch the graph of each absolute value
function. State the intercepts and the a) y = |x2 - 4|
domain and range. b) y = |x2 + 5x + 6|
a) y = |2x - 6| c) f(x) = |-2x2 - 3x + 2|
b) y = |x + 5| d) y = | _14 x 2
-9|
c) f(x) = |-3x - 6|
e) g(x) = |(x - 3)2 + 1|
d) g(x) = |-x - 3|
f) h(x) = |-3(x + 2)2 - 4|
e) y = _ x - 2
1
|
2 |
f) h(x) = _ x + 3
1
3 | |

376 MHR Chapter 7


9. Write the piecewise function that 11. Express each function as a piecewise
represents each graph. function.
a) y a) y = |x - 4|
4 b) y = |3x + 5|
2 c) y = |-x2 + 1|
y = |2x - 2|
d) y = |x2 - x - 6|
-2 0 2 4 6 x

Apply
b) y 12. Consider the function g(x) = |6 - 2x|.
y = |3x + 6|
6
a) Create a table of values for the function
4 using values of -1, 0, 2, 3, and 5 for x.
b) Sketch the graph.
2
c) Determine the domain and range
-4 -2 0 2 4 x for g(x).
d) Write the function in piecewise
c) y notation.
y = _1 x - 1
| |
2 2 13. Consider the function g(x) = |x2 - 2x - 8|.
a) What are the y-intercept and x-intercepts
-2 0 2 4 6 x
of the graph of the function?

10. What piecewise function could you use b) Graph the function.
to represent each graph of an absolute c) What are the domain and range of g(x)?
value function? d) Express the function as a piecewise
a) y function.
4 14. Consider the function g(x) = |3x2 - 4x - 4|.

2 a) What are the intercepts of the graph?


y = |2x2 - 2|
b) Graph the function.
-2 -1 0 1 2 3 x
c) What are the domain and range of g(x)?

b) y d) What is the piecewise notation form of


y = |(x - 1.5)2 - 0.25| the function?
15. Raza and Michael are discussing the
1
functions p(x) = 2x2 - 9x + 10 and
q(x) = |2x2 - 9x + 10|. Raza says that
the two functions have identical graphs.
0 1 2 x Michael says that the absolute value
changes the graph so that q(x) has a
c) y different range and a different graph from
p(x). Who is correct? Explain your answer.
6
y = |3(x - 2)2 - 3|
4

-1 0 1 2 3 4 x

7.2 Absolute Value Functions MHR 377


16. Air hockey is a table game where two 17. The velocity, v, in metres per second, of
players try to score points by hitting a a go-cart at a given time, t, in seconds, is
puck into the other players goal. The modelled by the function v(t) = -2t + 4.
diameter of the puck is 8.26 cm. Suppose The distance travelled, in metres, can
a Cartesian plane is superimposed over the be determined by calculating the area
playing surface of an air hockey table so between the graph of v(t) = |-2t + 4| and
that opposite corners have the coordinates the x-axis. What is the distance travelled
(0, 114) and (236, 0), as shown. The path in the first 5 s?
of the puck hit by a player is given by 18. a) Graph f (x) = |3x - 2| and
y = |0.475x - 55.1|. g(x) = |-3x + 2|. What do you notice
about the two graphs? Explain why.
b) Graph f (x) = |4x + 3|. Write a different
absolute value function of the form
g(x) = |ax + b| that has the same graph.
19. Graph f (x) = |x 2 - 6x + 5|. Write a
different absolute value function of the
form g(x) = |ax 2 + bx + c| that has the
same graph as f(x) = |x 2 - 6x + 5|.
20. An absolute value function has the form
f(x) = |ax + b|, where a 0, b 0, and
a, b R. If the function f (x) has a domain
y
(0, 114)
of {x | x R}, a range of {y | y 0, y R},
an x-intercept occurring at _ 3 , 0 , and a
centre
line
( )2
y-intercept occurring at (0, 6), what are the
114 cm goal 33 cm
values of a and b?
puck (236, 0) 21. An absolute value function has the
(0, 0) 236 cm x form f(x) = |x2 + bx + c|, where b 0,
c 0, and b, c R. If the function f (x)
has a domain of {x | x R}, a range of
a) Graph the function.
{y | y 0, y R}, x-intercepts occurring
b) At what point does the puck ricochet
at (-6, 0) and (2, 0), and a y-intercept
off the side of the table?
occurring at (0, 12), determine the values
c) If the other player does not touch the of b and c.
puck, verify whether or not the puck
22. Explain why the graphs of y = |x2| and
goes into the goal.
y = x2 are identical.

378 MHR Chapter 7


Extend Step 2 Let the location of the grain storage
23. Is the following statement true for all facility be at point x (x kilometres
x, y R? Justify your answer. east of Allenby). Then, the absolute
|x| + |y| = |x + y| value of the distance of the facility
from Allenby is |x| and from Birkend
24. Draw the graph of |x| + |y| = 5.
is |x - 10|. Why do you need to use
25. Use the piecewise definition of y = |x| to absolute value?
prove that for all x, y R, |x|(|y|) = |xy|.
Continue this process to write absolute
26. Compare the graphs of f(x) = |3x - 6| and value expressions for the distance of
g(x) = |3x| - 6. Discuss the similarities the storage facility from each of the
and differences. seven towns. Then, combine them
to create a function for the total of
Create Connections the absolute value distances from the
27. Explain how to use a piecewise function to different towns to point x.
graph an absolute value function.
Step 3 Graph the combined function using a
28. Consider the quadratic function graphing calculator. Set an appropriate
y = ax2 + bx + c, where a, b, and c are real window to view the graph. What are
numbers and a 0. Describe the nature of the window settings?
the discriminant, b2 - 4ac, for the graphs
Step 4 a) What does the graph indicate about
of y = ax2 + bx + c and y = |ax2 + bx + c|
placing the point x at different
to be identical.
locations along the highway?
29. MINI LAB In Section 7.1, you solved the
b) What are the coordinates of the
following problem:
minimum point on the graph?
Suppose a straight stretch of highway
c) Interpret this point with respect
running west to east begins at the town
to the location of the grain storage
of Allenby (0 km). The diagram shows
facility.
the distances from Allenby east along the
highway to various towns. A new grain 30. Each set of transformations is applied to
storage facility is to be built along the the graph of f(x) = x2 in the order listed.
highway 24 km from Allenby. Find the Write the function of each transformed
total distance of the grain storage facility graph.
from all of the seven towns on the highway a) a horizontal translation of 3 units to the
for this proposed location. right, a vertical translation of 7 units
0 10 17 30 42 55 72 up, and then take its absolute value
Allenby Crawley Denford Essex Fortier Grey b) a change in the width by a factor of _4 ,
Birkend Ridge 5
a horizontal translation of 3 units to the
Step 1 Rather than building the facility at a
left, and then take its absolute value
point 24 km east of Allenby, as was
originally planned, there may be c) a reflection in the x-axis, a vertical
a more suitable location along the translation of 6 units down, and then
highway that would minimize the take its absolute value
total distance of the grain storage d) a change in the width by a factor of 5, a
facility from all of the towns. Do you horizontal translation of 3 units to the
think that point exists? If so, predict left, a vertical translation of 3 units up,
its location. and then take its absolute value

7.2 Absolute Value Functions MHR 379


7.3
Absolute Value Equations
Focus on . . .
solving an absolute value equation graphically, with or without technology
algebraically solving an equation with a single absolute value and verifying the solution
explaining why the absolute value equation |f(x)| = b for b < 0 has no solution

Is the speed of light the maximum


velocity possible? According to Albert
Einsteins theory of relativity, an
object travelling near the speed of
light, approximately 300 000 km/s,
will move more slowly and shorten
in length from the point of view of an
observer on Earth. On the television
show Star Trek, the speed of light
was called Warp 1 and the spaceship
USS Enterprise was able to travel at
much greater speeds. Is this possible
or just a fantasy?

Did Yo u Know ?

The town of Vulcan, Alberta, has been using the Star Trek connection since the debut
of the television series and now receives more than 12 000 visitors per year. There is a
replica of the USS Enterprise in Vulcan, and the tourism centre is designed as a landing
craft. Every year, in June, Vulcan hosts Galaxyfest-Spock Days.

380 MHR Chapter 7


Investigate Absolute Value Equations

1. Consider the absolute value equation |x| = 10.


2. Use the number line to geometrically solve the equation.
How many solutions are there?

-15 -10 -5 0 5 10 15

3. How many solutions are there for the equation |x| = 15? for |x| = 5?
for |x| = b, b 0? What are the solutions?
4. Make a conjecture about the number of solutions for an absolute
value equation.
5. Solve the absolute value equation |x| = 0.

Reflect and Respond


6. Is it possible to have an absolute value equation that has no
solutions? Under what conditions would this happen?
7. Discuss how to use the following definition of absolute value
to solve absolute value equations.

|x| = { x-xif ifx x<0 0


8. a) From the definition of absolute value in step 7, give a general
rule for solving |A| = b, b 0, for A, where A is an algebraic
expression.
b) State a general rule for solving the equation |A| = b, b < 0,
for A.

Link the Ideas

Use the definition of absolute value when solving absolute value absolute value
equations algebraically. equation
an equation that
There are two cases to consider. includes the absolute
Case 1: The expression inside the absolute value symbol is positive value of an expression
involving a variable
or zero.
Case 2: The expression inside the absolute value symbol is negative.

7.3 Absolute Value Equations MHR 381


Example 1
Solve an Absolute Value Equation
Solve |x - 3| = 7.

Solution
Method 1: Use Algebra
Using the definition of absolute value,

|x - 3| = { x-(x- 3,- 3),


if x 3
if x < 3
Case 1
The expression |x - 3| equals x - 3 when x - 3 0, or when x 3.
x-3=7
x = 10
The value 10 satisfies the condition x 3.
Case 2
The expression |x - 3| equals -(x - 3) when x - 3 < 0, or when x < 3.
-(x - 3) = 7
x - 3 = -7
x = -4
The value -4 satisfies the condition x < 3.
Verify the solutions algebraically by substitution.
For x = 10: For x = -4:
Left Side Right Side Left Side Right Side
|x - 3| 7 |x - 3| 7
= |10 - 3| = |-4 - 3|
= |7| = |-7|
=7 =7
Left Side = Right Side Left Side = Right Side
The solution is x = 10 or x = -4.

Method 2: Use a Graph


Graph the functions f(x) = |x - 3| and g(x) = 7 on the same coordinate
grid to see where they intersect.
y Why were these two
10 functions chosen for f(x)
and g(x)?
8
(-4, 7) g(x) = 7 (10, 7)
6

4
f(x) = |x - 3|
2

-6 -4 -2 0 2 4 6 8 10 12 x

382 MHR Chapter 7


The graphs intersect at (-4, 7) and (10, 7). This means that x = -4 and
x = 10 are solutions to the equation |x - 3| = 7.
You can verify the solutions using technology. Input the function
f(x) = |x - 3| and display the table of values to confirm the solutions
you found graphically.
From the table of values, the solution is x = -4 or x = 10.

Your Turn
Solve |6 - x| = 2 graphically and algebraically.

Example 2
Solve an Absolute Value Problem
A computerized process controls the amount of batter used to produce
cookies in a factory. If the computer program sets the ideal mass before
baking at 55 g but allows a tolerance of 2.5 g, solve an absolute value
equation for the maximum and minimum mass, m, of batter for cookies
at this factory.

Solution
Model the situation by the equation |m - 55| = 2.5.
Method 1: Use a Number Line
The absolute value equation |m - 55| = 2.5 means that the distance
between m and 55 is 2.5 units. To find m on a number line, start at 55
and move 2.5 units in either direction.
2.5 units 2.5 units

52 53 54 55 56 57 58 59
The distance from 55 to 52.5 is 2.5 units. The distance from 55 to 57.5 is 2.5 units.

The maximum mass is 57.5 g and the minimum mass is 52.5 g.

7.3 Absolute Value Equations MHR 383


Method 2: Use an Algebraic Method
Using the definition of absolute value,
m - 55, if m 55
|m - 55| = {-(m - 55), if m < 55
Case 1
m - 55 = 2.5
m = 57.5
Case 2
-(m - 55) = 2.5
m - 55 = -2.5
m = 52.5
The maximum mass is 57.5 g and the minimum mass is 52.5 g.

Your Turn
A computerized process controls the amount of fish that is packaged in
a specific size of can. The computer program sets the ideal mass at 170 g
but allows a tolerance of 6 g. Solve an absolute value equation for the
maximum and minimum mass, m, of fish in this size of can.

Example 3
Absolute Value Equation With an Extraneous Solution
Solve |2x - 5| = 5 - 3x.

Solution
Using the definition of absolute value, How do you determine the
_
5 restrictions on the domain in

|2x - 5| =
{2x - 5, if x
2
-(2x - 5), if x < _
5
2
this example?

So, |2x - 5| = 5 - 3x means 2x - 5 = 5 - 3x when x _ 5


2
or -(2x - 5) = 5 - 3x when x < _ 5.
2
Case 1
2x - 5 = 5 - 3x
5x = 10
x=2
The value 2 does not satisfy the condition x _5 , so it is an
2
extraneous solution.

384 MHR Chapter 7


Case 2
-(2x - 5) = 5 - 3x
-2x + 5 = 5 - 3x
x=0

The value 0 does satisfy the condition x < _


5.
2
Verify the solutions.
For x = 2: For x = 0:
Left Side Right Side Left Side Right Side
|2x - 5| 5 - 3x |2x - 5| 5 - 3x
= |2(2) - 5| = 5 - 3(2) = |2(0) - 5| = 5 - 3(0)
= |4 - 5| =5-6 = |0 - 5| =5-0
= |-1| = -1 = |-5| =5
=1 =5
Left Side Right Side Left Side = Right Side
The solution is x = 0.
Some absolute value equations may
have extraneous roots. Verify potential
solutions by substituting them into the
original equation.

Your Turn
Solve |x + 5| = 4x - 1.

Example 4
Absolute Value Equation With No Solution
Solve |3x - 4| + 12 = 9.

Solution
|3x - 4| + 12 = 9 Isolate the absolute value expression.
|3x - 4| = -3 This statement is never true.

Since the absolute value of a number is always greater than or equal to


zero, by inspection this equation has no solution. D i d You K n ow?

The solution set for this type of equation is the empty set. The empty set is a
set with no elements
Your Turn and is symbolized by
{} or .
Solve |4x - 5| + 9 = 2.

7.3 Absolute Value Equations MHR 385


Example 5
Solve an Absolute Value Equation Involving a Quadratic Expression
Solve |x2 - 2x| = 1.

Solution
Using the definition of absolute value, How can you use the x-intercepts of
2 the related parabola and the direction
x - 2x, if x 0 or x 2
|x2 - 2x| = { -(x 2
- 2x), if 0 < x < 2
in which it opens to determine the
domain for each case?

Case 1
x2 - 2x = 1
2
x - 2x - 1 = 0 ________
x = ____ Why is the quadratic formula used to solve for x?
-b b2 - 4ac
2a ________________
x = ______
-(-2) (-2)2 - 4(1)(-1)
__
2(1)
x= __
2 8
2
__
x= __
2 2 2
2 __
x = 1 2
__ __
Determine whether x = 1 + 2 or x = 1 - 2 satisfies the original
equation |x2 - 2x| = 1.
__
For x = 1 + 2 :
Left Side Right Side
|x2 - 2x| 1
__ __
= |(1 + 2 )2 - 2(1 + 2 )|
__ __
= |1 + 2 2 + 2 - 2 - 2 2 |
= |1|
=1
Left Side = Right Side
__
For x = 1 - 2 :
Left Side Right Side
|x2 - 2x| 1
__ __
= |(1 - 2 ) - 2(1 - 2 )|
2
__ __
= |1 - 2 2 + 2 - 2 + 2 2 |
= |1|
=1
Left Side = Right Side

386 MHR Chapter 7


Case 2
-(x2 - 2x) = 1
x2 - 2x = -1
2
x - 2x + 1 = 0
(x - 1)2 = 0
x-1 = 0
x = 1
Determine whether x = 1 satisfies the original equation |x2 - 2x| = 1.
Left Side Right Side
2
|x - 2x| 1
= |12 - 2(1)|
= |-1|
=1
Left Side = Right Side
__ __
The solutions are x = 1, x = 1 + 2 , and x = 1 - 2 .

You can also verify the solution graphically as x = 1, x 2.4,


and x -0.41.

Your Turn
Solve |x2 - 3x| = 2.

Example 6
Solve an Absolute Value Equation Involving Linear and
Quadratic Expressions
Solve |x - 10| = x2 - 10x.

Solution
Using the definition of absolute value,

|x - 10| = { x-(x- 10, if x 10


- 10), if x < 10

7.3 Absolute Value Equations MHR 387


Case 1
x - 10 = x2 - 10x
0 = x2 - 11x + 10
0 = (x - 10)(x - 1)
x - 10 = 0 or x - 1 = 0
x = 10 x=1
Only x = 10 satisfies the condition x 10, so x = 1 is an extraneous root.
Case 2
-(x - 10) = x2 - 10x
-x + 10 = x2 - 10x
0= x2 - 9x - 10
0= (x - 10)(x + 1)
x - 10 = 0 or x + 1 = 0
x = 10 x = -1
Only x = -1 satisfies the condition x < 10 for How could you verify
this case. But x = 10 satisfies the condition in these solutions?

Case 1, so the solutions are x = 10 and x = -1.

Your Turn
Solve |x - 5| = x2 - 8x + 15.

Key Ideas

You can solve absolute value equations by graphing the left side and
the right side of the equation on the same set of axes and determining
the points of intersection.
To solve an absolute value equation algebraically:
 Consider the two separate cases, corresponding to the two parts of the
definition of absolute value:

|x| = { x,-x,if ifx x<0 0


 Roots that satisfy the specified condition in each case are solutions to
the equation.
 Identify and reject extraneous roots.
Verify roots through substitution into the original equation.
Any absolute value equation of the form |f(x)| = a, where a < 0, has no
solution since by definition |f(x)| 0.

388 MHR Chapter 7


Check Your Understanding

Practise Apply
1. Use the number line to geometrically 7. Bolts are manufactured
solve each equation. at a certain factory to
have a diameter of
-10 -5 0 5 10 18 mm and are rejected
a) |x| = 7 b) |x| + 8 = 12 if they differ from this by
c) |x| + 4 = 4 d) |x| = -6 more than 0.5 mm.

2. Solve each absolute value equation a) Write an absolute


by graphing. value equation in
the form |d - a| = b
a) |x - 4| = 10 b) |x + 3| = 2
to describe the acceptance limits
c) 6 = |x + 8| d) |x + 9| = -3 for the diameter, d, in millimetres,
3. Determine an absolute value equation in of these bolts, where a and b are
the form |ax + b| = c given its solutions on real numbers.
the number line.
b) Solve the resulting absolute value
a) equation to find the maximum and
-10 -5 0 5 10
minimum diameters of the bolts.
b)
-10 -5 0 5 10 8. One experiment measured the speed
c) of light as 299 792 456.2 m/s with a
-10 -5 0 5 10
measurement uncertainty of 1.1 m/s.
4. Solve each absolute value equation
algebraically. Verify your solutions. a) Write an absolute value equation in
the form |c - a| = b to describe the
a) |x + 7| = 12
measured speed of light, c, metres
b) |3x - 4| + 5 = 7 per second, where a and b are real
c) 2|x + 6| + 12 = -4 numbers.
d) -6|2x - 14| = -42 b) Solve the absolute value equation
5. Solve each equation. to find the maximum and minimum
a) |2a + 7| = a - 4
values for the speed of light for this
experiment.
b) |7 + 3x| = 11 - x
9. In communities in Nunavut, aviation fuel
c) |1 - 2m| = m + 2
is stored in huge tanks at the airport. Fuel
d) |3x + 3| = 2x - 5 is re-supplied by ship yearly. The fuel
e) 3|2a + 7| = 3a + 12 tank in Kugaaruk holds 50 000 L. The fuel
6. Solve each equation and verify your re-supply brings a volume, V, in litres, of
solutions graphically. fuel plus or minus 2000 L.
a) |x| = x2 + x - 3 a) Write an absolute value equation in the
2 form |V - a| = b to describe the limits
b) |x - 2x + 2| = 3x - 4
for the volume of fuel delivered, where
c) |x2 - 9| = x2 - 9
a and b are real numbers.
d) |x2 - 1| = x
b) Solve your absolute value equation
e) |x2 - 2x - 16| = 8 to find the maximum and minimum
volumes of fuel.

7.3 Absolute Value Equations MHR 389


10. Consider the statement x = 7 4.8. 13. Determine whether n 0 or n 0
a) Describe the values of x. makes each equation true.
b) Translate the statement into an equation a) n + |-n| = 2n b) n + |-n| = 0
involving absolute value. 14. Solve each equation for x, where
11. When measurements are made in science, a, b, c R.
there is always a degree of error possible. a) |ax| - b = c b) |x - b| = c
Absolute error is the uncertainty of a
15. Erin and Andrea each solve
measurement. For example, if the mass of an
|x - 4| + 8 = 12. Who is correct?
object is known to be 125 g, but the absolute
Explain your reasoning.
error is said to be 4 g, then the measurement
could be as high as 129 g and as low as 121 g. Erins solution:
|x - 4| + 8 = 12
a) If the mass of a substance is measured
|x - 4| = 4
once as 64 g and once as 69 g, and the
x + 4 = 4 or -x + 4 = 4
absolute error is 2.5 g, what is the
x=0 x=0
actual mass of the substance?
Andreas solution:
b) If the volume of a liquid is measured
|x - 4| + 8 = 12
to be 258 mL with an absolute error of
|x - 4| = 4
7 mL, what are the least and greatest
x - 4 = 4 or -x + 4 = 4
possible measures of the volume?
x=8 x=0
12. The moon travels in a elliptical orbit
around Earth. The distance between Earth 16. Mission Creek in the
and the moon changes as the moon travels Okanagan Valley of
in this orbit. The point where the moon's British Columbia is the
orbit is closest to Earth is called perigee, site of the spawning of
and the point when it is farthest from Earth Kokanee salmon every
is called apogee. You can use the equation September. Kokanee
|d - 381 550| = 25 150 to find these salmon are sensitive to
distances, d, in kilometres. water temperature. If
moon the water is too cold,
egg hatching is delayed,
and if the water is too
Earth warm, the eggs die.
perigee apogee
(closest (farthest Biologists have found
to Earth) from Earth) that the spawning rate of the salmon is
greatest when the water is at an average
temperature of 11.5 C with an absolute
a) Solve the equation to find the perigee value difference of 2.5 C. Write and solve
and apogee of the moons orbit of Earth. an absolute value equation that determines
b) Interpret the given values 381 550 and the limits of the ideal temperature range for
25 150 with respect to the distance the Kokanee salmon to spawn.
between Earth and the moon.
D i d You K n ow ?
D id Yo u Know ?
In recent years, the September temperature of
When a full moon is Mission Creek has been rising. Scientists are
at perigee, it can appear as considering reducing the temperature of the water
much as 14% larger to us by planting more vegetation along the creek banks.
than a full moon at apogee. This would create shade, cooling the water.

390 MHR Chapter 7


17. Low-dose aspirin contains 81 mg of the 20. Write an absolute value equation with the
active ingredient acetylsalicylic acid (ASA) indicated solutions or type of solution.
per tablet. It is used to regulate and reduce a) -2 and 8
heart attack risk associated with high blood
b) no solution
pressure by thinning the blood.
a) Given a tolerance of 20% for generic c) one integral solution
brands, solve an absolute value equation d) two integral solutions
for the maximum and minimum amount 21. Does the absolute value equation
of ASA per tablet. |ax + b| = 0, where a, b R, always have
b) Which limit might the drug company a solution? Explain.
tend to lean toward? Why?
Create Connections
Extend 22. For each graph, an absolute value function
18. For the launch of the Ares I-X rocket from and a linear function intersect to produce
the Kennedy Space Center in Florida solutions to an equation composed of the
in 2009, scientists at NASA indicated two functions. Determine the equation that
they had a launch window of 08:00 to is being solved in each graph.
12:00 eastern time. If a launch at any a) y
time in this window is acceptable, write
an absolute value equation to express 6

the earliest and latest acceptable times 4


for launch.
2

-2 0 2 4 6 x

b) y
6

-4 -2 0 2 4 x

23. Explain, without solving, why the equation


19. Determine whether each statement is |3x + 1| = -2 has no solutions, while the
sometimes true, always true, or never equation |3x + 1| - 4 = -2 has solutions.
true, where a is a natural number. 24. Why do some absolute value equations
Explain your reasoning. produce extraneous roots when solved
a) The value of |x + 1| is greater than zero. algebraically? How are these roots created
b) The solution to |x + a| = 0 is greater in the algebraic process if they are not
than zero. actual solutions of the equation?

c) The value of |x + a| + a is greater


than zero.

7.3 Absolute Value Equations MHR 391


7.4
Reciprocal Functions
Focus on . . .
graphing the reciprocal of a given function
analysing the graph of the reciprocal of a given function
comparing the graph of a function to the graph of the reciprocal of
that function

identifying the values of x for which the graph of y =


_1
has
f(x)
vertical asymptotes

Isaac Newton (16431727) is one of the most important


mathematicians and physicists in history. Besides being the
co-inventor of calculus, Newton is famous for deriving the D i d You K n ow ?
law of universal gravitation. He deduced that the forces that
keep the planets in their orbits must be related reciprocally Isaac Newton made most of his important
discoveries in the 1660s. During this time
as the squares of their distances from the centres about
he was forced to work at home because
which they revolve.
the bubonic plague resulted in the closure
F1 F2 of all public buildings, including Cambridge
m
m1 m2 m1 m2 University, where Newton studied.
r
(
F1 = F2 = G _______
r2
)
We b Link
As a result of the reciprocal relationship, as the distance, To learn
earn more about
ab Isaac Newton and
r, between two planets increases, the gravitational force, his contributions to mathematics, go to
F, decreases. Similarly, as the distance decreases, the www.mhrprecalc11.ca and follow the links.
gravitational force between the planets will increase.

Investigate Exchange Rates

Materials Perhaps you have travelled to Mexico or to Hawaii and have


graphing calculator exchanged Canadian dollars for pesos or U.S. dollars. Perhaps
you have travelled overseas and exchanged British pounds for the
Japanese yen or Swiss franc. If so, you have experienced exchange
rates in action. Do you know how they work?
An exchange rate is the rate at which one currency is converted
into another currency. Exchange rates are typically quoted as a
ratio with either one of the currencies being set equal to one, such
as 1 Australian dollar = 0.9796 Canadian dollars.
1. If the Canadian dollar is worth US$0.80, it costs C$1.25 to buy
US$1. Change the values 0.80 and 1.25 to fractions in lowest
terms. Can you see how these fractions are related to each
other? Discuss with your classmates how you could use this
relationship to determine exchange rates.

392 MHR Chapter 7


2. In step 1, the Canadian-to-U.S. dollar exchange rate is 0.80. D i d You K n ow?
What is the U.S.-to-Canada dollar exchange rate? How many
For centuries, the
Canadian dollars could you buy with US$1? currencies of the
3. a) Copy and complete the table to C$1 in Purchase Price world were backed by
determine the purchase price of US$1 US$ of US$1 gold. That is, a piece
for various Canadian-to-U.S. dollar 0.65 1.54 of paper currency
issued by any
exchange rates. 0.70
national government
b) Describe your method of determining 0.75 represented a real
the purchase price of US$1. Would 0.80 amount of gold held
your method work for all currency in a vault by that
0.85
exchanges? government.
0.90
c) Plot the ordered pairs from the table of
0.95
values. Draw a smooth curve through
1.00
the points. Extrapolate. Does this curve
have an x-intercept? a y-intercept? 1.05

Explain. 1.10

4. Examine the currency exchange table shown. The Japanese yen () D i d You K n ow?
is shown as 0.0108. What does this number represent in terms of
A customer buys
exchange rates? currency from a bank
at a higher price

CURRENCIES and sells the same


currency to a bank
Currency In C$ Currency In C$ Currency In C$ at a lower price. The
Australia dollar 0.9796 Euro 1.5748 Peru sol 0.3629 difference between
Bahamas dollar 1.0525 Hong Kong dollar 0.1346 Philippine peso 0.0216 the price at which a
Bahrain dinar 2.7944 India rupee 0.0219 Poland zloty 0.3749 bank sells a currency
Barbados dollar 0.5287 Jamaica dollar 0.0113 Russia rouble 0.0346 and the price at which
Singapore dollar 0.7571
Brazil real 0.6134 Japan yen 0.0108 it buys the same
South Africa rand 0.1417
Chile peso 0.0020 Kenya shilling 0.0143 Switzerland franc 1.0418
currency is called the
Chinese yuan 0.1534 S. Korea won 0.0009 Ukraine hryvna 0.1238 spread. The spread is
Denmark krone 0.2107 Mexico peso 0.0786 U.A.E. dirham 0.2842 the cost of completing
Dominican peso 0.0286 New Zealand dollar 0.7801 U.K. pound 1.7266 the exchange.
Egypt pound 0.1924 Pakistan rupee 0.0120 U.S. dollar 1.0374

5. a) How many yen can you purchase with C$1? With C$200?
b) How much does it cost to purchase 5000?
6. Choose one other currency from the table or find current currency
exchange rates on the Internet.
a) How much of that currency can be purchased with C$1?
b) How much does it cost to purchase 100 units of the foreign currency?

Reflect and Respond


7. Analyse the relationship of currency exchange between countries.
For example, when you have the Canadian-to-U.S. dollar exchange
rate, how do you determine the U.S.-to-Canadian dollar exchange
rate? What is the relationship between the two calculations?
8. Does the relationship in step 7 always work?

7.4 Reciprocal Functions MHR 393


Link the Ideas

Recall that the product of a number and its reciprocal is always equal
to 1. For example, _ is the reciprocal of _4 and _
3 4 is the reciprocal of
4 3 3
_3 because _3 _4 = 1.
( )
4 4 3
So, for any non-zero real number a, the reciprocal of a is _ 1
a and the
reciprocal of _
1 _1
a is a. For a function f (x), its reciprocal is f(x) , provided that
f (x) 0.

Example 1
Compare the Graphs of a Function and Its Reciprocal

reciprocal function Sketch the graphs of y = f(x) and its reciprocal function y = _1 , where
f(x)
a function y =
_
1
f(x) = x. Examine how the functions are related.
f (x)
defined by
y = _ = _ if f(a) = b, Solution
1 1
f (a) b
f(a) 0, b 0 Use a table of values to graph the functions y = x and y = _
1
x.
x y=x
_1
y= x

-10 -10 -_1 Notice that the function values for


10 _1
y = x can be found by taking the
-5 -5 -_1
reciprocal of the function values for
5
y = x.
-2 -2 _
-1
2
-1 -1 -1 What is unique about the reciprocals
of -1 and 1? Why?
-_1 -_1 -2
2 2
-_1 -1_ -5
5 5
- _
1 - _
1 -10
10 10
0 0 undefined Why is the reciprocal of 0 undefined?
_1 _
1
10
10 10
_1 _1 5
5 5
_1 _1 2
2 2
1 1 1

2 2
_1
2
What happens to the value of the
5 5
_1 reciprocal as the absolute value of a
5
number increases in value?
10 10
_
1
10

394 MHR Chapter 7


y Why does the curve
approach the y-axis but
10
y=x never touch it?

1
y = Why does the curve
x
approach the x-axis but
-10 -8 -6 -4 -2 0 2 4 6 8 10 x
never touch it?

-5

-10

The function y = x is a function of degree one, so its graph is a line. asymptote


The function y = _ 1 is a rational function.
x
a line whose distance
from a given curve
Its graph has two distinct pieces, or branches. These branches are approaches zero
located on either side of the vertical asymptote, defined by the
non-permissible value of the domain of the rational function, and vertical asymptote
the horizontal asymptote, defined by the fact that the value 0 is for reciprocal
not in the range of the function. functions, occur at the
non-permissible values
of the function
Characteristic y=x
_1
y= x the line x = a is a
vertical asymptote if
Domain {x | x R} {x | x 0, x R} the curve approaches
Range {y | y R} {y | y 0, y R} the line more and more
closely as x approaches
If x > 0 and |x| is very large, If x > 0 and |x| is very large, then a, and the values of the
then y > 0 and is very large. y > 0 and is close to 0. function increase or
End behaviour If x < 0 and |x| is very large, If x < 0 and |x| is very large, then decrease without bound
then y < 0 and |y| is very y < 0 and y is close to 0. as x approaches a
large.
undefined, horizontal
Behaviour at x = 0 y=0
vertical asymptote at x = 0 asymptote
Invariant points (-1, -1) and (1, 1) describes the
behaviour of a graph
when |x| is very large
the line y = b is a
horizontal asymptote
if the values of the
function approach b
when |x| is very large

7.4 Reciprocal Functions MHR 395


Your Turn
Create a table of values and sketch the graphs of y = f (x) and its
reciprocal y = _ 1 , where f (x) = -x. Examine how the functions
f(x)
are related.

Example 2
Graph the Reciprocal of a Linear Function
Consider f(x) = 2x + 5.
a) Determine its reciprocal function y = _
1 .
f(x)
b) Determine the equation of the vertical asymptote of the reciprocal
function.
c) Graph the function y = f(x) and its reciprocal function y = _
1 .
f(x)
Describe a strategy that could be used to sketch the graph of a
reciprocal function.

Solution
a) The reciprocal function is y = __
1 .
2x + 5
b) A vertical asymptote occurs at any non-permissible values of the
corresponding rational expression __
1 .
2x + 5
To determine non-permissible values, set the denominator equal to 0
and solve.
2x + 5 = 0 How are the zeros of the function f(x) = 2x + 5
2x = -5 related to the vertical asymptotes of its reciprocal
__ 1
x = -_5 function y = ?
2x + 5
2
The non-permissible value is x = - _5.
2
In the domain of the rational expression __
1 , x -_
5.
2x + 5 2
The reciprocal function is undefined at this value, and its graph
has a vertical asymptote with equation x = - _5.
2

396 MHR Chapter 7


c) Method 1: Use Pencil and Paper
To sketch the graph of the function f (x) = 2x + 5, use the y-intercept
of 5 and slope of 2.
To sketch the graph of the reciprocal of a function, consider the
following characteristics:
Reciprocal Function
Function
f(x) =
__ 1
Characteristic f(x) = 2x + 5 2x + 5
x-intercept and The value of the The value of the
asymptotes function is zero at reciprocal function is
x = -_. undefined at x = - _ .
5 5
2 2
A vertical asymptote
exists.

Invariant points Solve 2x + 5 = 1. Solve


__
1
= 1.
The value of the 2x + 5
function is +1 at The value of the
(-2, 1). reciprocal function
is +1 at (-2, 1).

Solve 2x + 5 = -1. Solve


__
1
= -1.
The value of the 2x + 5
function is -1 at The value of the
(-3, -1). reciprocal function
is -1 at (-3, -1).

The graphs of y = 2x + 5 and y = __


1 are shown.
2x + 5
y

vertical asymptote 6
y = 2x + 5
at x = - 5
2 4

2
(-3, -1) (-2, 1)

-5 -4 -3 -2 -1 0 1 2 x
-2

-4

-6
1
y = ______ -8
2x + 5

7.4 Reciprocal Functions MHR 397


Method 2: Use a Graphing Calculator
Graph the functions using a graphing calculator.
Enter the functions as y = 2x + 5 and y = __ 1 or as y = f(x)
2x + 5
and y = _ 1 , where f (x) has been defined as f (x) = 2x + 5.
f(x)
Ensure that both branches of the reciprocal function are visible.

How can you determine if the


window settings you chose are
the most appropriate?

What are the asymptotes? How


do you know?

Use the calculators value and zero features to verify the invariant
points and the y-intercept.

Use the table feature on the calculator


to see the nature of the ordered pairs that exist when a function
and its reciprocal are graphed
to compare the two functions in terms of values remaining
positive or negative or values of y increasing or decreasing
to see what happens to the reciprocal function as the absolute
values of x get very large or very small

Your Turn
Consider f(x) = 3x - 9.
a) Determine its reciprocal function y = _
1 .
f(x)
b) Determine the equation of the vertical asymptote of the
reciprocal function.
c) Graph the function y = f(x) and its reciprocal function y = _
1 ,
f(x)
with and without technology. Discuss the behaviour of y = _ 1
f(x)
as it nears its asymptotes.

398 MHR Chapter 7


Example 3
Graph the Reciprocal of a Quadratic Function
Consider f(x) = x2 - 4.
a) What is the reciprocal function of f (x)?
b) State the non-permissible values of x and the equation(s) of the
vertical asymptote(s) of the reciprocal function.
c) What are the x-intercepts and the y-intercept of the reciprocal function?
d) Graph the function y = f(x) and its reciprocal function y = _ .
1
f(x)
Solution

a) The reciprocal function is y = __


1 .
x2 - 4
b) Non-permissible values of x occur when the denominator of the
corresponding rational expression is equal to 0.
x2 - 4 = 0
(x - 2)(x + 2) = 0
x - 2 = 0 or x + 2 = 0
x=2 x = -2
The non-permissible values of the corresponding rational
expression are x = 2 and x = -2.

The reciprocal function is undefined at these values, so its graph


has vertical asymptotes with equations x = 2 and x = -2.

c) To find the x-intercepts of the function y = __


1 , let y = 0.
x2 - 4
0 = __
1
x2 - 4
There is no value of x that makes this equation true. Therefore,
there are no x-intercepts.
To find the y-intercept, substitute 0 for x.

y= __
1
02 - 4
y = -_1
4
The y-intercept is - _
1.
4
d) Method 1: Use Pencil and Paper
For f(x) = x2 - 4, the coordinates of the vertex are (0, -4).
The x-intercepts occur at (-2, 0) and (2, 0).
Use this information to plot the graph of f(x).

7.4 Reciprocal Functions MHR 399


To sketch the graph of the reciprocal function,
Draw the asymptotes.
Plot the invariant points where f (x) = 1. The exact locations of
the invariant points can be found by solving x2 - 4 = 1.
__ __
Solving x2 - 4 = 1 results in the points ( 5 ,__1) and (- 5 , 1).
__
Solving x2 - 4 = -1 results in the points ( 3 , -1) and (- 3 , -1).
The y-coordinates of the points on the graph of the reciprocal
function are the reciprocals of the y-coordinates of the
corresponding points on the graph of f (x).
y

3
f(x) = x - 4
2
2
(- 5 , 1) ( 5 , 1)
1

-5 -4 -3 -2 -1 0 1 2 3 4 5 x
-1
(- 3, -1) ( 3, -1)
-2

-3

1
-4 y = ______
x2 - 4
-6

-7
x = -2 x=2

Method 2: Use a Graphing Calculator


Enter the functions y = x2 - 4 and y = __
1 .
x2 - 4
Adjust the window settings so that the vertex and
intercepts of y = x2 - 4 are visible, if necessary.

400 MHR Chapter 7


Your Turn
Consider f(x) = x2 + x - 6.
a) What is the reciprocal function of f (x)?
b) State the non-permissible values of x and the equation(s) of the
vertical asymptote(s) of the reciprocal function.
c) What are the x-intercepts and the y-intercept of the reciprocal function?
d) Sketch the graphs of y = f(x) and its reciprocal function y = _ .
1
f(x)

Example 4
Graph y = f(x) Given the Graph of y =
_
1
f(x)
The graph of a reciprocal function of y

the form y = __ 1 , where a and b 4


ax + b
are non-zero constants, is shown.
a) Sketch the graph of the original
2
( ) 1
3, _
3
function, y = f(x). -4 -2 0 2 4 6 x
b) Determine the original function, -2
y = f(x).
-4 1
y = ___
f(x)

Solution

a) Since y = _
1 = __
1 , the y y = f(x)
f(x) ax + b
4
original function is of the form (3, 3)
f(x) = ax + b, which is a linear
function. The reciprocal graph has
2
(2, 0)
( ) 1
3, _
3
a vertical asymptote at x = 2, so the -6 -2 0 2 4 6 x
graph of y = f(x) has an x-intercept -2
at (2, 0). Since 3, _
( ) 1 is a point on
1
3 -4
y = ___
the graph of y = _ 1 , the point (3, 3) f(x)
f(x)
must be on the graph of y = f(x).
Draw a line passing through (2, 0)
and (3, 3).

b) Method 1: Use the Slope and the y-Intercept


Write the function in the form y = mx + b. Use the coordinates of the
two known points, (2, 0) and (3, 3), to determine that the slope, m, is
3. Substitute the coordinates of one of the points into y = 3x + b and
solve for b.
b = -6
The original function is f(x) = 3x - 6.

7.4 Reciprocal Functions MHR 401


Method 2: Use the x-Intercept
With an x-intercept of 2, the function f(x) is based on the factor x - 2,
but it could be a multiple of that factor.
f(x) = a(x - 2)

Use the point (3, 3) to find the value of a.


3 = a(3 - 2)
3=a
The original function is f(x) = 3(x - 2), or f(x) = 3x - 6.

Your Turn y

4
The graph of a reciprocal function of
the form y = _1 = __ 1 , where a 2 1
y = ___
f(x) ax + b f(x)
and b are non-zero constants, is shown.
-6 -4 -2 0 2 4 x
a) Sketch the graph of the original
function, y = f(x).
(-2, - 1
_
4 )-2

-4
b) Determine the original function,
y = f(x).

Key Ideas

If f(x) = x, then _1 =_1 _1


x , where f(x) denotes a reciprocal function.
f(x)
You can obtain the graph of y = _1 from the graph of y = f(x) by using
f(x)
the following guidelines:
 The non-permissible values of the reciprocal function are related to the
position of the vertical asymptotes. These are also the non-permissible
values of the corresponding rational expression, where the reciprocal
function is undefined.
 Invariant points occur when the function f(x) has a value of 1 or -1. To
determine the x-coordinates of the invariant points, solve the equations
f(x) = 1.
 The y-coordinates of the points on the graph of the reciprocal function
are the reciprocals of the y-coordinates of the corresponding points on the
graph of y = f(x).
 As the value of x approaches a non-permissible value, the absolute value of
the reciprocal function gets very large.
 As the absolute value of x gets very large, the absolute value of the
reciprocal function approaches zero.

402 MHR Chapter 7


The domain of the reciprocal function is the same as the domain of the
original function, excluding the non-permissible values.
y

6
asymptote
4
y=x+2
invariant
2 1
points y = _____
x+2
-8 -6 -4 -2 0 2 4 x
-2

-4

-6

Check Your Understanding

Practise 2. For each function,


1. Given the function y = f(x), write the i) state the zeros
corresponding reciprocal function. ii) write the reciprocal function
a) y = -x + 2 iii) state the non-permissible values of the
b) y = 3x - 5 corresponding rational expression
c) y = x2 - 9 iv) explain how the zeros of the
original function are related to
d) y = x2 - 7x + 10
the non-permissible values of the
reciprocal function
v) state the equation(s) of the vertical
asymptote(s)
a) f(x) = x + 5 b) g(x) = 2x + 1
2
c) h(x) = x - 16 d) t(x) = x2 + x - 12

7.4 Reciprocal Functions MHR 403


3. State the equation(s) of the vertical b) y
asymptote(s) for each function. 4
y = f(x)
a) f(x) = __
1
5x - 10 2

b) f(x) = __
1
3x + 7 -4 -2 0 2 4 x

c) f(x) = ___
1 -2
(x - 2)(x + 4)
-4
d) f(x) = ___
1
x2 - 9x + 20
4. The calculator screen gives a function table c) y
for f(x) = __ 1 . Explain why there is an
8
y = f(x)
x-3
undefined statement. 6

-4 -2 0 2 4 6x
-2

7. Sketch the graphs of y = f (x) and y = _


1
5. What are the x-intercept(s) and the f(x)
y-intercept of each function? on the same set of axes. Label the
a) f(x) = __
1 asymptotes, the invariant points, and
x+5 the intercepts.
b) f(x) = __
1
3x - 4 a) f(x) = x - 16

c) f(x) = __
1 b) f(x) = 2x + 4
x2 - 9
c) f(x) = 2x - 6
d) f(x) = ___
1
x2 + 7x + 12 d) f(x) = x - 1
6. Copy each graph of y = f(x), and sketch the 8. Sketch the graphs of y = f (x) and
graph of the reciprocal function y = _
1 . y=_ 1 on the same set of axes.
f(x) f(x)
Describe your method. Label the asymptotes, the invariant
a) y points, and the intercepts.
y = f(x)
4 a) f(x) = x2 - 16

2
b) f(x) = x2 - 2x - 8
c) f(x) = x2 - x - 2
-4 -2 0 2 4 x d) f(x) = x2 + 2
-2

-4

404 MHR Chapter 7


9. Match the graph of the function with the A y
graph of its reciprocal. 4 1
y = ___
a) y f(x)
4 2
y = f(x)
2
-4 -2 0 2 4 x
-2
-2 0 2 4 x
-2 -4

-4
B y

b) y 6
y = f(x)
8 4
1
6 y = ___
2 f(x)

4
-4 -2 0 2 4 x
2 -2

-2 0 2 4 6x
C y
1
y = ___
c) y 4 f(x)
4
y = f(x) 2
2
-2 0 2 4 6 x
-2 0 2 4 x -2
-2

D y
1
d) y y = ___
4 f(x)
4
y = f(x) 2
2
-2 0 2 4 6 x
-2 0 2 4 x -2
-2
-4

7.4 Reciprocal Functions MHR 405


Apply 12. The greatest amount of time, t, in minutes,
10. Each of the following is the graph that a scuba diver can take to rise toward
of a reciprocal function, y = _
1 . the water surface without stopping for
f(x) decompression is defined by the function

t = __
i) Sketch the graph of the original 525
, where d is the depth, in
function, y = f(x). d - 10
ii) Explain the strategies you used. metres, of the diver.
iii) What is the original function, y = f(x)? a) Graph the function using graphing
technology.
a) y
b) Determine a suitable domain which
2
(4, 1) represents this application.
-2 0 2 4 6 8 x c) Determine the maximum time without
-2 stopping for a scuba diver who is 40 m
deep.
d) Graph a second
b)
function, t = 40. Find
ind
2 (
-1, - 1
_
4 ) the intersection point
int
of the two graphs.
-6 -4 -2 0 2 4 x Interpret this pointt
-2 in terms of the scubaba
diver rising to the
surface. Check thiss
11. You can model the swinging motion of a result algebraically
y
pendulum using many mathematical rules. with the original
For example, the frequency, f, or number function.
of vibrations per second of one swing, in
e) Does this graph
hertz (Hz), equals the reciprocal of the
have a horizontal
period, T, in seconds, of the swing. The
asymptote? What
formula is f = _1.
does this mean
T
a) Sketch the graph of the function f = _ .
1 with respect to the
T scuba diver?
b) What is the reciprocal function?
c) Determine the frequency of a pendulum
with a period of 2.5 s.
d) What is the period of a pendulum with
a frequency of 1.6 Hz?

D id Yo u Know ?

Much of the mathematics D i d You K n ow ?


of pendulum motion was
If scuba divers rise to the water surface too quickly,
described by Galileo, based
they may experience decompression sickness or
on his curiosity about a
the bends, which is caused by breathing nitrogen or
swinging lamp in the
other gases under pressure. The nitrogen bubbles
Cathedral of Pisa, Italy. His
are released into the bloodstream and obstruct blood
work led to much more
ow, causing joint pain.
accurate measurement of
time on clocks.

406 MHR Chapter 7


13. The pitch, p, in hertz (Hz), of a musical 15. a) Describe how to find the vertex of the
note is the reciprocal of the period, P, in parabola defined by f(x) = x2 - 6x - 7.
seconds, of the sound wave for that note b) Explain how knowing the vertex in
created by the air vibrations. part a) would help you to graph the
a) Write a function for pitch, p, in terms of function g(x) = ___ 1 .
period, P. x2 - 6x - 7
c) Sketch the graph of g(x) = ___
1 .
b) Sketch the graph of the function. x2 - 6x - 7
c) What is the pitch, to the nearest 0.1 Hz, 16. The amount of time, t, to complete a large
for a musical note with period 0.048 s? job is proportional to the reciprocal of the
number of workers, n, on the job. This can
be expressed as t = k _ 1
( ) _k
n or t = n , where
k is a constant. For example, the Spiral
Tunnels built by the Canadian Pacific
Railroad in Kicking Horse Pass, British
Columbia, were a major engineering feat
when they opened in 1909. Building two
spiral tracks each about 1 km long required
1000 workers to work about 720 days.
Suppose that each worker performed a
similar type of work.

14. The intensity, I, in watts per square metre


(W/m2), of a sound equals 0.004 multiplied
by the reciprocal of the square of the
distance, d, in metres, from the source of
the sound.
a) Substitute the given values of t and n
a) Write a function for I in terms of d to
into the formula to find the constant k.
represent this relationship.
b) Use technology to graph the function
b) Graph this function for a domain of
d > 0. t=_
k
n.
c) What is the intensity of a car horn for c) How much time would have been
a person standing 5 m from the car? required to complete the Spiral Tunnels
if only 400 workers were on the job?
d) Determine the number of workers
needed if the job was to be completed
in 500 days.

D i d You K n ow ?

Kicking Horse Pass is in Yoho National Park. Yoho is a


Cree word meaning great awe or astonishment. This
may be a reference to the soaring peaks, the rock
walls, and the spectacular Takakkaw Falls nearby.

7.4 Reciprocal Functions MHR 407


Extend 20. The diagram shows how an object forms
17. Use the summary of information to an inverted image on the opposite side
produce the graphs of both y = f(x) of a convex lens, as in many cameras.
and y = _ 1 , given that f(x) is a Scientists discovered the relationship
f(x) _1 + _1 = _1
linear function. u v f
where u is the distance from the object to
Interval of x x<3 x>3
the lens, v is the distance from the lens to
Sign of f (x) + -
the image, and f is the focal length of the
Direction of f (x) decreasing decreasing lens being used.
Sign of
_1
+ -
f(x) object image

Direction of
_
1 increasing increasing
f(x)

18. Determine whether each statement is true


or false, and explain your reasoning.
a) The graph of y = _
1 always has a
f(x) u v
vertical asymptote.
b) A function in the form of y = _
1 a) Determine the distance, v, between the
f(x) lens and the image if the distance, u, to
always has at least one value for the object is 300 mm and the lens has a
which it is not defined. focal length, f, of 50 mm.

c) The domain of y = _
1 is always b) Determine the focal length of a zoom
f(x) lens if an object 10 000 mm away
the same as the domain of y = f(x). produces an inverted image 210 mm
behind the lens.
Create Connections 21. MINI LAB Use technology to explore the
19. Rita and Jerry are discussing how behaviour of a graph near the vertical
to determine the asymptotes of the asymptote and the end behaviour of
reciprocal of a given function. Rita the graph.
concludes that you can determine the Consider the function
roots of the corresponding equation, and
f(x) = __ 1 ,x_ 1.
those values will lead to the equations of 4x - 2 2
the asymptotes. Jerry assumes that when Step 1 Sketch the graph of the function
the function is written in rational form, f(x) = __ 1 ,x_ 1 , drawing in
you can determine the non-permissible 4x - 2 2
the vertical asymptote.
values. The non-permissible values will
lead to the equations of the asymptotes.
a) Which student has made a correct
assumption? Explain your choice.
b) Is this true for both a linear and a

quadratic function?

408 MHR Chapter 7


Step 2 a) Copy and complete the tables to b) Describe what happens to the
show the behaviour of the function graph of the reciprocal function
-
as x _ 1 and as x _
( ) 1 +,
( ) as |x| becomes very large.
2 2
meaning when x approaches _ 1 from 22. Copy and complete the flowchart to
2 describe the relationship between
the left (-) and from the right (+). a function and its corresponding
- reciprocal function.
As x _
1 :
( ) As x _
1 +:
( )
2 2 Functions
x f(x) x f(x) 1
y = f (x) y = ___
0 -0.5 1 0.5 f (x)

0.4 0.6 The absolute value of


0.45 0.55 the function gets
very large.
0.47 0.53
0.49 0.51
0.495 0.505 Reciprocal values are
positive.
0.499 0.501

b) Describe the behaviour of


the function as the value of x
Function values are
approaches the asymptote. Will negative.
this always happen?
Step 3 a) To explore the end behaviour of
the function, the absolute value of The zeros of the
x is made larger and larger. Copy function are the
x-intercepts of the graph.
and complete the tables for values
of x that are farther and farther
from zero. The value of the
reciprocal function
As x becomes smaller:
is 1.
x f(x)
-10 -_1
42 The absolute value of
-100 the function approaches
zero.
-1000
-10 000
The value of the
-100 000
function is -1.

As x becomes larger:
x f(x)
10
_
1
38
100
1 000
10 000
100 000

7.4 Reciprocal Functions MHR 409


Chapter 7 Review
7.1 Absolute Value, pages 358367 5. Over the course of five weekdays,
1. Evaluate. one mining stock on the Toronto
Stock Exchange (TSX) closed at $4.28
a) |-5| | _43 |
b) 2 c) |-6.7|
on Monday, closed higher at $5.17
2. Rearrange these numbers in order from on Tuesday, finished Wednesday at
least to greatest. $4.79, and shot up to close at $7.15
|-3.5|, -2.7, - _
__ 9 , |-1.6|, 1 _
1 on Thursday, only to finish the week
-4, 9 ,
2| | | |2 at $6.40.
3. Evaluate each expression. a) What is the net change in the
a) |-7 - 2| closing value of this stock for
b) |-3 + 11 - 6| the week?

c) 5|-3.75| b) Determine the total change in the


closing value of the stock.
d) |52 - 7| + |-10 + 23|
4. A school group travels to Mt. Robson
Provincial Park in British Columbia 7.2 Absolute Value Functions, pages 368379
to hike the Berg Lake Trail. From the 6. Consider the functions f(x) = 5x + 2 and
Robson River bridge, kilometre 0.0, they g(x) = |5x + 2|.
hike to Kinney Lake, kilometre 4.2, where
a) Create a table of values for each
they stop for lunch. They then trek across
function, using values of -2, -1, 0, 1,
the suspension bridge to the campground,
and 2 for x.
kilometre 10.5. The next day they hike
to the shore of Berg Lake and camp, b) Plot the points and sketch the graphs
kilometre 19.6. On day three, they hike of the functions on the same coordinate
to the Alberta/British Columbia border, grid.
kilometre 21.9, and turn around and return c) Determine the domain and range for
to the campground near Emperor Falls, both f(x) and g(x).
kilometre 15.0. On the final day, they walk d) List the similarities and the differences
back out to the trailhead, kilometre 0.0. between the two functions and their
What total distance did the school corresponding graphs.
group hike?
7. Consider the functions f(x) = 8 - x2 and
g(x) = |8 - x2|.
a) Create a table of values for each
function, using values of -2, -1, 0, 1,
and 2 for x.
b) Plot the points and sketch the graphs
of the functions on the same coordinate
grid.
c) Determine the domain and range for
both f(x) and g(x).
d) List the similarities and the differences
between the two functions and their
corresponding graphs.

410 MHR Chapter 7


8. Write the piecewise function that 12. Solve each equation algebraically.
represents each graph. a) |q + 9| = 2
a) y b) |7x - 3| = x + 1
4
c) |x2 - 6x| = x
2 y = |2x - 4| d) 3x - 1 = |4x2 - x - 4|
13. In coastal communities, the depth, d, in
-2 0 2 4 6 x
metres, of water in the harbour varies
during the day according to the tides. The
b) y
maximum depth of the water occurs at
2 high tide and the minimum occurs at low
1
tide. Two low tides and two high tides will
generally occur over a 24-h period. On one
particular day in Prince Rupert, British
-2 -1 0 1 2 x
y = |x2 - 1| Columbia, the depth of the first high tide
and the first low tide can be determined
9. a) Explain why the functions
using the equation |d - 4.075| = 1.665.
f(x) = 3x2 + 7x + 2 and
g(x) = |3x2 + 7x + 2| have
different graphs.
b) Explain why the functions
f(x) = 3x2 + 4x + 2 and
g(x) = |3x2 + 4x + 2| have
identical graphs.
10. An absolute value function has the form
f(x) = |ax + b|, where a 0, b 0, and
a, b R. If the function f(x) has a domain
of {x | x R}, a range of {y | y 0, y R},
an x-intercept occurring at - _ 2 , 0 , and a
( )
3
y-intercept occurring at (0, 10), what are
the values of a and b?

7.3 Absolute Value Equations, pages 380391 a) Find the depth of the water, in metres,
at the first high tide and the first low
11. Solve each absolute value equation
tide in Prince Rupert on this day.
graphically. Express answers to the
nearest tenth, when necessary. b) Suppose the low tide and high tide
depths for Prince Rupert on the next
a) |2x - 2| = 9
day are 2.94 m, 5.71 m, 2.28 m, and
b) |7 + 3x| = x - 1 4.58 m. Determine the total change in
c) |x2 - 6| = 3 water depth that day.
d) |m2 - 4m| = 5

Chapter 7 Review MHR 411


14. The mass, m, in kilograms, of a bushel of 16. Sketch the graphs of y = f (x) and y = _
1
f(x)
wheat depends on its moisture content.
on the same set of axes. Label the
Dry wheat has moisture content as low
asymptotes, the invariant points, and
as 5% and wet wheat has moisture
the intercepts.
content as high as 50%. The equation
|m - 35.932| = 11.152 can be used to find a) f(x) = 4x - 9 b) f(x) = 2x + 5
the extreme masses for both a dry and 17. For each function,
a wet bushel of wheat. What are these i) determine the corresponding reciprocal
function, y = _
two masses? 1
f(x)
ii) state the non-permissible values of
x and the equation(s) of the vertical
asymptote(s) of the reciprocal function
iii) determine the x-intercepts and the
y-intercept of the reciprocal function
iv) sketch the graphs of y = f(x) and
y=_ 1 on the same set of axes
f(x)
a) f(x) = x2 - 25
b) f(x) = x2 - 6x + 5
7.4 Reciprocal Functions, pages 392409 18. The force, F, in newtons (N), required to
15. Copy each graph of y = f(x) and sketch lift an object with a lever is proportional to
the graph of the corresponding reciprocal the reciprocal of the distance, d, in metres,

function, y = _ 1 . Label the asymptotes, of the force from the fulcrum of a lever.
f(x) The fulcrum is the point on which a lever
the invariant points, and the intercepts. pivots. Suppose this relationship can be
modelled by the function F = _ 600
a) y .
d
-4 -2 0 2 4 x
-2
y = f(x)
-4
Crowbar
-6
Fulcrum

b) y
a) Determine the force required to lift an
y = f(x)
8 object if the force is applied 2.5 m from
the fulcrum.
6
b) Determine the distance from the
4 fulcrum of a 450-N force applied to lift
2 an object.
c) How does the force needed to lift an
-6 -4 -2 0 2 x object change if the distance from the
fulcrum is doubled? tripled?

412 MHR Chapter 7


Chapter 7 Practice Test
Multiple Choice 5. One of the vertical asymptotes of the graph
of the reciprocal function y = __
1
For #1 to #5, choose the best answer. x2 - 16
has equation
1. The value of the expression
A x=0
|-9 - 3| - |5 - 23| + |-7 + 1 - 4| is
B x=4
A 13
C x=8
B 19
D x = 16
C 21
D 25 Short Answer
2. The range of the function f(x) = |x - 3| is 6. Consider the function f(x) = |2x - 7|.
A {y | y > 3, y R} a) Sketch the graph of the function.
B {y | y 3, y R} b) Determine the intercepts.
C {y | y 0, y R} c) State the domain and range.
D {y | y > 0, y R} d) What is the piecewise notation form of
3. The absolute value equation |1 - 2x| = 9 the function?
has solution(s) 7. Solve the equation |3x2 - x| = 4x - 2
A x = -4
algebraically.
8. Solve the equation |2w - 3| = w + 1
B x=5
graphically.
C x = -5 and x = 4
D x = -4 and x = 5 Extended Response
4. The graph represents the reciprocal of 9. Determine the error(s) in the following
which quadratic function? solution. Explain how to correct the
y solution.
1 Solve |x - 4| = x2 + 4x.
4 y = ___
f(x)
Case 1
2
x+4= x2 + 4x
0= x2 + 3x - 4
-6 -4 -2 0 2 4 x
0= (x + 4)(x - 1)
-2
x+4= 0 or x - 1 = 0
-4 x= -4 or x=1
Case 2
-x - 4 = x2 + 4x
2
A f(x) = x + x - 2 0 = x2 + 5x + 4
B f(x) = x2 - 3x + 2 0 = (x + 4)(x + 1)
C f(x) = x2 - x - 2
x+4 = 0 or x + 1 = 0
x = -4 or x = -1
D f(x) = x2 + 3x + 2
The solutions are x = -4, x = -1,
and x = 1.

Chapter 7 Practice Test MHR 413


10. Consider the function f(x) = 6 - 5x. 12. Astronauts in space feel lighter because
a) Determine its reciprocal function. weight decreases as a person moves
away from the gravitational pull of Earth.
b) State the equations of any vertical
Weight, Wh, in newtons (N), at a particular
asymptotes of the reciprocal function. height, h, in kilometres, above Earth is
c) Graph the function f(x) and its related to the reciprocal of that height by
reciprocal function. Describe a strategy We
the formula Wh = ___ , where We is
that could be used to sketch the graph _ 2

of any reciprocal function. (


h +1
6400 )
the persons weight, in newtons (N), at sea
11. A biologist studying Canada geese
level on Earth.
migration analysed the vee flight formation
of a particular flock using a coordinate
system, in metres. The centre of each bird
was assigned a coordinate point. The lead
bird has the coordinates (0, 0), and the
coordinates of two birds at the ends of
each leg are (6.2, 15.5) and (-6.2, 15.5).
Bottom View of Flying Geese
y
(-6.2, 15.5) (6.2, 15.5)
16

12

-6 -4 -2 0 (0, 0) 2 4 6 x
-2

a) Write an absolute value function Canadian astronauts Julie Payette and Bob Thirsk
whose graph contains each leg of the
a) Sketch the graph of the function for
vee formation.
an astronaut whose weight is 750 N at
b) What is the angle between the legs of sea level.
the vee formation, to the nearest tenth b) Determine this astronauts weight at a
of a degree? height of
c) The absolute value function y = |2.8x| i) 8 km ii) 2000 km
describes the flight pattern of a different c) Determine the range of heights for
flock of geese. What is the angle which this astronaut will have a weight
between the legs of this vee formation, of less than 30 N.
to the nearest tenth of a degree?
D i d You K n ow ?

When people go into space, their mass remains


constant but their weight decreases because of
the reduced gravity.

414 MHR Chapter 7


Unit 3 Project Wrap-Up
Space: Past, Present, Future
Complete at least one of the following options.

Option 1 Option 2 Option 3


Research a radical equation Research rational expressions A company specializing in
or a formula related to space related to space anomalies. space tourism to various
exploration or the historical regions of the galaxy is
Search the Internet for a
contributions of an astronomer. sponsoring a logo design
rational expression that is
contest. The winner gets a free
Search the Internet for related to space-time, black
ticket to the destination of his
an equation or a formula holes, solar activity, or
or her choice.
involving radicals that another space-related topic.
is related to motion or Research the topic to The companys current logo
distance in space or for an determine why it involves a is made up of the following
astronomer whose work led rational expression. absolute value functions and
to discoveries in these areas. reciprocal functions.
Write a one-page report on  y = -|x| + 6, -6 x 6
Research the formula to your topic choice, including  y = |2x|, -2 x 2
determine why it involves the following:
a radical, or research the  a brief description of the
 y =
__ 1 , -1.95 x 1.95
x2 - 4
mathematics behind the space anomaly you chose _1 , -1 x -0.5
 y = -
astronomers discovery. and its significance x2
and 0.5 x 1
Prepare a poster for your  identification of the

topic choice. Your poster rational expression you y


should include the following: are using 6
 background information  an explanation of the
4
on the astronomer mathematics involved
or the origin of the and how it helps to model 2
radical equation you are the anomaly
presenting  sources of all research
-6 -4 -2 0 2 4 6x
 an explanation of the used in your report -2
mathematics involved and
how the formula relates to -4
distance or motion in space
 sources of all materials you Design a new logo for this
used in your research company.
The logo must include both
reciprocal functions and
absolute value functions.
Draw your logo. List the
functions you use, as well
as the domains necessary for
the logo.

Unit 3 Project Wrap-Up MHR 415


Cumulative Review, Chapters 57
Chapter 5 Radical Expressions Chapter 6 Rational Expressions
and Equations and Equations
___
1. Express 3xy 3 2x as an entire radical. 9. Simplify each expression. Identify any
________
2. Express 48a3b2c5 as a simplified mixed non-permissible values.

a) __
radical. 12a3b
3. Order the set of numbers from least to
48a2b4
b) ___
greatest. 4-x
__ ___ __ ___ __ 3
__ x2 - 8x + 16
3 6 , 36 , 2 3 , 18 , 2 9 , 8
c) ___ __
(x - 3)(x + 5) x+2
4. Simplify each expression. Identify any x2 - 1 x-3
restrictions on the values for the variables.
d) __ __
___ ___ 5x - 10 3x
a) 4 2a + 5 2a 6x 15x - 30
_____ ___
( __
x + 2 __ x - 9 __x+3
2

x - 3 )( x - 4 ) ( x - 2 )
b) 10 20x2 - 3x 45 e) 2
5. Simplify. Identify any restrictions on the
values of the variable in part c). 10. Determine the sum or difference. Express
__ __
3 3
a) 2 4 (-4 6 ) answers in lowest terms. Identify any
__ ___ __ non-permissible values.
b) 6 ( 12 - 3 )
a) __ + __
__ __ __ __ 10 a-1
c) (6 a + 3 )(2 a - 4 ) a+2 a-7
b) __ - __
6. Rationalize each denominator. 3x + 2 x-5
___
_
12 x+4 x2 - 4
a) __
c) __ - ___
4 2x 3
__
2 __ x2 - 25 x2 - 4x - 5
b)
2+ 3 11. Sandra simplified the expression
__ ___
__
7
+ 28 ___
(x + 2)(x + 5)
to x + 2. She stated
c) __ ___ x+5
7 - 14
______ that they were equivalent expressions.
7. Solve the radical equation x + 6 = x. Do you agree or disagree with Sandras
Verify your answers. statement? Provide a reason for
8. On a childrens roller coaster ride, the your answer.
speed in a loop depends on the height of 12. When two triangles are similar, you can
the hill the car has just come down and the use the proportion of corresponding sides
radius of the loop. The velocity, v, in feet to determine an unknown dimension.
per second, of a car at the top of a loop of Solve the rational equation to determine
radius, r, in feet, is given by the formula the value of x.
_______
v = h - 2r , where h is the height of the __
x+4
=_x
previous hill, in feet. 4 3
4
a) Find the height of the hill when the
velocity at the top of the loop is 20 ft/s 3
x
and the radius of the loop is 15 ft.
b) Would you expect the velocity of the
car to increase or decrease as the radius
of the loop increases? Explain your x
reasoning.

416 MHR Chapter 7


13. If a point is selected at random 17. Solve algebraically. Verify your solutions.
from a figure and is equally likely a) |2x - 1| = 9 b) |2x 2 - 5| = 13
to be any point inside the figure,
18. The area, A, of a triangle on a coordinate
then the probability that a point
grid with vertices at (0, 0), (a, b), and
is in the shaded region is given by
(c, d) can be calculated using the formula
area of shaded region
P = ____ A=_ 1 |ad - bc|.
area of entire figure 2
What is the probability that the a) Why do you think absolute value must
point is in the shaded region? be used in the formula for area?
b) Determine the area of a triangle with
8x vertices at (0, 0), (-5, 2), and (-3, 4).
4x 19. Sketch the graph of y = f(x) given the
graph of y = _ 1 . What is the original
f(x)
function, y = f(x)?
y
1
y = ___
4 f(x)
Chapter 7 Absolute Value and
Reciprocal Functions 2
(5, 1)
14. Order the values from least to greatest.
-2 0 2 4 6 8 x
|-5|, |4 - 6|, |2(-4) - 5|, |8.4|
-2
15. Write the piecewise function that
represents each graph.
a) y 20. Copy the graph of y = f(x), and sketch the

4 graph of the reciprocal function y = _ 1 .


f(x)
Discuss your method.
2
y = |3x - 6|
y
-2 0 2 4 6 x 4
y = f(x)
2
b) y
6 1
y = _ (x - 2)2 - 3 -6 -4 -2 0 2 4 x
3
4 -2

2 21. Sketch the graph of y = _


1 given
f(x)
-2 0 2 4 6 x
f(x) = (x + 2)2. Label the asymptotes, the
invariant points, and the intercepts.

16. For each absolute value function, 22. Consider the function f(x) = 3x - 1.

i) sketch the graph a) What characteristics of the graph of y = f(x)


are different from those of y = |f (x)|?
ii) determine the intercepts
b) Describe how the graph of y = f(x) is
iii) determine the domain and range
different from the graph of y = _ 1 .
a) y = |3x - 7| b) y = |x2 - 3x - 4| f(x)

Cumulative Review, Chapters 57 MHR 417


Unit 3 Test
Multiple Choice 6. Arrange the expressions |4 - 11|, _1 |-5|,
5
For #1 to #8, choose the best answer. |1-_ 1 , and |2| - |4| in order from least
|
4
1. What is the entire radical form of to greatest.
_____
A |4 - 11|, _ |-5|, 1 - _ , |2| - |4|
1 1
3
2( -27 )?
3
_____ 5 4 | |
A -54
B |2| - |4|, 1 - _ , _ |-5|, |4 - 11|
1 1
B
3
______
-108 |4 5 |
______
C |2| - |4|, _ |-5|, 1 - _ , |4 - 11|
3
1 1
C -216
3
______ 5 4 | |
D -432
D 1 - _ , _ |-5|, |4 - 11|, |2| - |4|
1 1
2. What is the simplified form of
_____
| 4 5 |
__
4 72x 5
__ , x > 0? 7. Which of the following statements is false?
x 8 ____ __ __ ____
A n m = mn
A __
2x3
12 __ ___ __
2
___ B ____ = _
18 1
B 4x 3x 36 2
____ __ ____
C __ _ __
3
6 2x
7 14n
__ C ___ =
2 8n 4n
__ ________
D 12x x
______ D m2 + n2 = m + n
2
3. Determine the root(s) of x + 2 = x + 3 .
8. The graph of y = _
1 has vertical
A x = - _ and x = 3
1 f(x)
4 asymptotes at x = -2 and x = 5 and a
B x = -_
1 horizontal asymptote at y = 0. Which
4 of the following statements is possible?
C x = _ and x = -3
1 A f(x) = (x + 2)(x + 5)
4
B f(x) = x2 - 3x - 10
D x= _
1
4 C The domain of f(x) is
4. Simplify the rational expression __
9x4 - 27x6
{x | x -2, x -5, x R}.
3x3
D The range of y = _ is {y | y R}.
for all permissible values of x. 1
f(x)
A 3x(1 - 3x)
B 3x(1 - 9x5) Numerical Response
3
C 3x - 9x Copy and complete the statements in #9
D 9x3 - 9x4 to #13.
_______
5. Which expression could be used to 9. The radical 3x - 9 results in real
determine the length of the line segment numbers when x .
between the points (4, -3) and (-6, -3)?
10. When the denominator
__
of the
A -6 - 4 _
5
expression __ is rationalized,
B 4-6 3 2
the expression becomes .
C |4 - 6|
D |-6 - 4|

418 MHR Chapter 7


11. The expression__
3x - 7
- __
x-k , 18. Consider the function y = |2x - 5|.
x + 11 x + 11
x -11, simplifies to __
2x + 21 a) Sketch the graph of the function.
x + 11 b) Determine the intercepts.
when the value of k is .
c) State the domain and range.
12. The lesser solution to the absolute value
equation |1 - 4x| = 9 is x = . d) What is the piecewise notation form of
the function?
13. The graph of the reciprocal function
__
1 19. Solve |x2 - 3x| = 2. Verify your solutions
f(x) = has vertical asymptotes
x2 - 4 graphically.
with equations x =  and x = . 20. Consider f(x) = x2 + 2x - 8. Sketch
the graph of y = f(x) and the graph of
Written Response
y=_ 1 on the same set of axes. Label
14. Order the numbers from least to greatest.
f(x)
__ __ __ the asymptotes, the invariant points, and
3 7 , 4 5 , 6 2 , 5 the intercepts.
_______ _______
15. Consider the equation 3x + 4 = 2x - 5 . 21. In the sport of curling, players measure
a) Describe a possible first step to solve the weight of their shots by timing the
the radical equation. stone between two marked lines on the
b) Determine the restrictions on the values ice, usually the hog lines, which are 72 ft
for the variable x. apart. The weight, or average speed, s, of
the curling stone is proportional to the
c) Algebraically determine all roots of
reciprocal of the time, t, it takes to travel
the equation.
between hog lines.
d) Verify the solutions by substitution.
16. Simplify the expression
___
4x 2
+ 4x - 8
___
2x2 + 3x - 2
.
2
x - 5x + 4 4x2 + 8x - 5
List all non-permissible values
for the variable.
17. The diagram shows two similar triangles.
x

x+3 x

7
Canadian women curlers at 2010 Vancouver Olympics

a) If d = 72, rewrite the formula d = st as


a) Write a proportion that relates the sides a function in terms of s.
of the similar triangles. b) What is the weight of a stone that takes
b) Determine the non-permissible values 14.5 s to travel between hog lines?
for the rational equation. c) How much time is required for a stone
c) Algebraically determine the value of x to travel between hog lines if its weight
that makes the triangles similar. is 6.3 ft/s?

Unit 3 Test MHR 419


Unit 4

Systems of
Equations and
Inequalities
Most decisions are much easier
when plenty of information is
available. In some situations,
linear and quadratic equations
provide the facts that are needed.
Linear and quadratic equations
and inequalities are used by
aerospace engineers to set
launch schedules, by biologists
to analyse and predict animal
behaviour, by economists to
provide advice to businesses,
and by athletes to improve their
performance. In this unit, you
will learn methods for solving
systems of linear and quadratic
equations and inequalities. You
will apply these skills to model
and solve problems in real-world
situations.

Looking Ahead
In this unit, you will model and
solve problems involving
systems of linear-quadratic or
quadratic-quadratic equations
linear and quadratic inequalities

420 MHR Unit 4 Systems of Equations and Inequalities


Unit 4 Project Nanotechnology

Nanotechnology is the science of the very small. Scientists manipulate matter on the
scale of a nanometre (one billionth of one metre, or 1 10-9 m) to make products
that are lighter, stronger, cleaner, less expensive, and more precise. With applications
in electronics, energy, health, the environment, and many aspects of modern life,
nanotechnology will change how everything is designed. In Canada, the National
Institute for Nanotechnology (NINT) in Edmonton, Alberta, integrates related research
in physics, chemistry, engineering, biology, informatics, pharmacy, and medicine.

In this project, you will choose an object that you feel could be enhanced by
nanotechnology. The object will have linear and parabolic design lines.

In Chapter 8, you will design the enhanced version of your object and determine
equations that control the shape of your design.

In Chapter 9, you will complete a cost analysis on part of the construction of your
object. You will compare the benefits of construction with and without nanotechnology.

At the end of your project, you will


display your design along with the supporting equations and cost calculations as
part of a nanotechnology exhibition
participate in a gallery walk with the other members of your class

In the Project Corner boxes, you will find information about various uses of
nanotechnology. Use this information to help you understand this evolving science
and to spark ideas for your design object.

Unit 4 Systems of Equations and Inequalities MHR 421


CHAPTER

8 Systems of
Equations
What causes that strange feeling in your
stomach when you ride a roller coaster?
Where do elite athletes get their technical
information? How do aerospace engineers
determine when and where a rocket will
land or what its escape velocity from a
planets surface is? If you start your own
business, when can you expect it to make
a profit?

The solution to all these questions


involves the types of equations that you
will work with in this chapter. Systems
of equations have applications in science,
business, sports, and many other areas,
and they are often used as part of a
decision-making process.

Did Yo u Know ?

An object can take several hyperbolic


path
different orbital paths. To
leave a planets surface, a parabolic
rocket must reach escape path
velocity. The escape velocity
is the velocity required to
elliptical
establish a parabolic orbit. path

Key Terms
system of linear-quadratic equations
system of quadratic-quadratic equations

422 MHR Chapter 8


Career Link
The career of a university researcher may
include publishing papers, presenting at
conferences, and teaching and supervising
students doing research in fields that they
find interesting. University researchers
often also have the opportunity to travel.

Dr. Ian Foulds, from Salmon Arm, British


Columbia, works as a university researcher
in Saudi Arabia. His research in the field Dr. Ian Foulds holds
of nanotechnology includes developing microrobot that
weighs less than
surface micromachining processes. 300 nanograms
Dr. Foulds graduated in electrical on his finger.
engineering, completing his doctorate
at Simon Fraser University in Burnaby,
British Columbia.

We b Link
To learn
earn more about
a fields involving research, go to
www.mhrprecalc11.ca and follow the links.

Chapter 8 MHR 423


8.1
Solving Systems of
Equations Graphically
Focus on . . .
modelling a situation using a system of linear-quadratic or quadratic-quadratic
equations
determining the solution of a system of linear-quadratic or quadratic-quadratic
equations graphically
interpreting points of intersection and the number of solutions of a system of
linear-quadratic or quadratic-quadratic equations
solving a problem that involves a system of linear-quadratic or quadratic-
quadratic equations

Companies that produce items to sell on the open market


aim to make a maximum profit. When a company has no, or
very few, competitors, it controls the marketplace by deciding
the price of the item and the quantity sold. The graph in the
Investigate below illustrates the relationship between the various
aspects that a company must consider when determining the price and
quantity. Notice that the curves intersect at a number of points. What do
you know about points of intersection on a graph?

Investigate Solving Systems of Equations Graphically

Work with a partner to discuss


your findings.
Part A: Solutions to a System y
36
Did Yo u Know ?
The graph shows data that a 34
Economists often 32
manufacturing company has marginal
30 cost
work with graphs collected about the business 28
like the one shown. 26
factors for one of its products.
The marginal cost 24
curve shows the 1. The companys profits are 22
Price ($)

change in total cost maximized when the marginal 20


18 average
as the quantity revenue is equal to the total cost
produced changes, 16
marginal cost. Locate this 14
and the marginal
point on the graph. What is 12
revenue curve shows 10
the change in the the quantity produced and the
8
price of the item when profits demand
corresponding total 6
revenue received. are maximized? 4
2 marginal
revenue
0 1 2 3 4 5 6 7 8 9 10 11 1213 x
Quantity (100s)

424 MHR Chapter 8


2. When the average total cost is at a minimum, it should equal
the marginal cost. Is this true for the graph shown? Explain how
you know.
3. A vertical line drawn to represent a production quantity of 600 items
intersects all four curves on the graph. Locate the point where this
vertical line intersects the demand curve. If the company produces
more than 600 items, will the demand for their product increase or
decrease? Explain.

Part B: Number of Possible Solutions


4. a) The manufacturing companys graph shows three examples of
systems involving a parabola and a line. Identify two business
factors that define one of these systems.
b) Consider other possible systems involving one line and one
parabola. Make a series of sketches to illustrate the different
ways that a line and a parabola can intersect. In other words,
explore the possible numbers of solutions to a system of system of
linear-quadratic equations graphically. linear-quadratic
equations
5. a) The manufacturing companys graph shows an example of a
a linear equation and
system involving two parabolas. Identify the business factors a quadratic equation
that define this system. involving the same
variables
b) Consider other possible systems involving two parabolas. Make
a graph of the system
a series of sketches to illustrate the different ways that two involves a line and a
parabolas can intersect. In other words, explore the possible parabola
numbers of solutions to a system of quadratic-quadratic
equations. system of
quadratic-quadratic
equations
Reflect and Respond two quadratic
equations involving the
6. Explain how you could determine the solution(s) to a system of
same variables
linear-quadratic or quadratic-quadratic equations graphically.
the graph involves two
7. Consider the coordinates of the point of intersection of the marginal parabolas
revenue curve and the marginal cost curve, (600, 6). How are the
coordinates related to the equations for marginal revenue and
marginal cost?

8.1 Solving Systems of Equations Graphically MHR 425


Link the Ideas

Any ordered pair (x, y) that satisfies both equations in a system of


linear-quadratic or quadratic-quadratic equations is a solution of
the system.
For example, the point (2, 4) is a solution of the system
y=x+2
y = x2
The coordinates x = 2 and y = 4 satisfy both equations.
A system of linear-quadratic or quadratic-quadratic equations may
have no real solution, one real solution, or two real solutions. A
quadratic-quadratic system of equations may also have an infinite
number of real solutions.

y y y

0 x 0 x 0 x

No point of One point of Two points of


intersection intersection intersection
No solution One solution Two solutions

y y y

Can two parabolas that


both open downward have
no points of intersection?
one point? two points? 0 x 0 x 0 x
Explain how.

What would the graph of


a system of quadratic- No point of One point of Two points of
quadratic equations with an intersection intersection intersection
infinite number of solutions No solution One solution Two solutions
look like?

426 MHR Chapter 8


Example 1
Relate a System of Equations to a Context
Blythe Hartley, of Edmonton, Alberta, is one of Canadas
best springboard divers. She is doing training dives from
a 3-m springboard. Her coach uses video analysis to plot
her height above the water.
a) Which system could represent the scenario? Explain
your choice and why the other graphs do not model thishis
situation.
b) Interpret the point(s) of intersection in the system
you chose.
System A System B System C System D
h h h h
Height

Height

Height

Height
0 Time t 0 Time t 0 Time t 0 e
Time t

Solution
a) System D, a linear-quadratic system, represents the scenario. The board
height is fixed and the divers parabolic path makes sense relative to
this height. She starts on the board, jumps to her maximum height, and
then her height decreases as she heads for the water.
The springboard is fixed at a height of 3 m above the water. Its
height must be modelled by a constant linear function, so eliminate
System A. The path of the dive is parabolic, with the height of the
diver modelled by a quadratic function, so eliminate System B.
Blythe starts her dive from the 3-m board, so eliminate System C.
b) The points of intersection in System D represent the two times
when Blythes height above the water is the same as the height
of the diving board.

Your Turn
Two divers start their dives at the same time. One diver jumps
from a 1-m springboard and the other jumps from a 3-m
springboard. Their heights above the water are plotted over time.
a) Which system could model this scenario? Explain your choice.
Tell why the other graphs could not model this situation.
b) Explain why there is no point of intersection in the graph
you chose.
System A System B System C System D
h h h h
Height

Height

Height

Height

0 Time t 0 Time t 0 Time t 0 Time t

8.1 Solving Systems of Equations Graphically MHR 427


Example 2
Solve a System of Linear-Quadratic Equations Graphically
a) Solve the following system of equations graphically:
4x - y + 3 = 0
2x2 + 8x - y + 3 = 0
b) Verify your solution.

Solution
a) Graph the corresponding functions. Adjust the dimensions of the
graph so that the points of intersection are visible. Then, use the
intersection feature.
If you are using paper and pencil, it may
be more convenient to write the linear
equation in slope-intercept form and the
quadratic equation in vertex form.

From the graph, the points of intersection


are (0, 3) and (-2, -5).

b) Verify the solutions by substituting into the


original equations.
Verify the solution (0, 3):
Substitute x = 0, y = 3 into the original equations.
Left Side Right Side
4x - y + 3 0
= 4(0) - (3) + 3
=0
Left Side = Right Side

Left Side Right Side


2x2 + 8x - y + 3 0
= 2(0)2 + 8(0) - (3) + 3
=0
Left Side = Right Side

428 MHR Chapter 8


Verify the solution (-2, -5):
Substitute x = -2, y = -5 into the original equations.

Left Side Right Side


4x -y + 3 0
= 4(-2) - (-5) + 3
= -8 + 5 + 3
=0
Left Side = Right Side

Left Side Right Side


2
2x + 8x - y + 3 0
= 2(-2)2 + 8(-2) - (-5) + 3
= 8 - 16 + 5 + 3
=0
Left Side = Right Side

Both solutions are correct.

The solutions to the system are (-2, -5) and (0, 3).

Your Turn
Solve the system graphically and verify your solution.
x-y+1=0
x2 - 6x + y + 3 = 0

Example 3
Solve a System of Quadratic-Quadratic Equations Graphically
a) Solve:
2x2 - 16x - y = -35 How many solutions do you think are
2x2 - 8x - y = -11 possible in this situation?

b) Verify your solution.

Solution
a) Graph the corresponding functions for both equations on the
same coordinate grid.

How do you know


that the graphs do not
intersect again at a
From the graph, the point of intersection is (3, 5). greater value of y?

8.1 Solving Systems of Equations Graphically MHR 429


b) Method 1: Use Technology

Method 2: Use Paper and Pencil


Left Side Right Side Left Side Right Side
2 2
2x - 16x - y -35 2x - 8x - y -11
= 2(3)2 - 16(3) - 5 = 2(3)2 - 8(3) - 5
= 18 - 48 - 5 = 18 - 24 - 5
= -35 = -11
Did Yo u Know ?
Left Side = Right Side Left Side = Right Side
Since the ordered pair (3, 5) satisfies both equations, it is the solution
You can use tangent
lines to draw to the system.
parabolas. Draw
a horizontal line Your Turn
segment AB. At the
Solve the system graphically and verify your solution.
midpoint of AB, draw a
height CD. Draw lines
2x2 + 16x + y = -26 How many solutions do you think are
x2 + 8x - y = -19 possible in this situation?
CA and CB (these are
the rst tangent lines
to the parabola). Mark
the same number
of equally spaced
points on CA and CB.
Example 4
Connect the point Apply a System of Linear-Quadratic Equations
A on CA (next to C)
to the point B on Engineers use vertical curves to improve the comfort and safety of roadways.
CB (next to B). Then Vertical curves are parabolic in shape and are used for transitions from one
connect A (next to straight grade to another. Each grade line is tangent to the curve.
A) to B (next to B),
and so on. Follow this What does it
pattern for successive mean for each
grade line to be
pairs of points until
tangent to the
all points on CB have
curve?
been connected to the
corresponding points
There are several vertical curves on the Trans-Canada Highway through
on CA. This technique
is the basis of most
the Rocky Mountains. To construct a vertical curve, surveyors lay out a
string art designs. grid system and mark the location for the beginning of the curve and the
C end of the curve.
A
A
Suppose surveyors model the first grade line for a section of road with
B the linear equation y = -0.06x + 2.6, the second grade line with the
B
A B linear equation y = 0.09x + 2.35, and the parabolic curve with the
D
quadratic equation y = 0.0045x2 + 2.8.

430 MHR Chapter 8


a) Write the two systems of equations that would be used to determine
the coordinates of the points of tangency.
b) Using graphing technology, show the surveyors layout of the vertical curve.
c) Determine the coordinates of the points of tangency graphically, to the
nearest hundredth.
d) Interpret each point of tangency.

Solution
a) The points of tangency are where the lines touch the parabola.
The two systems of equations to use are
y = -0.06x + 2.6 and y = 0.09x + 2.35
y = 0.0045x2 + 2.8 y = 0.0045x2 + 2.8

b) Graph all three equations.


You may need to adjust the
window to see the points
of tangency.

c) Use the intersection feature to


determine the coordinates of the
two points of tangency.

Verify using the calculator.

To the nearest hundredth,


the points of tangency are
(-6.67, 3.00) and (10.00, 3.25).

Could this solution be


found using pencil and
paper? Explain.

d) This means that the vertical curve starts at the location (-6.67, 3.00)
on the surveyors grid system and ends at the location (10.00, 3.25).

Your Turn
Another section of road requires the curve shown in the diagram.
The grade lines are modelled by the equations y = 0.08x + 6.2 and
y = -0.075x + 6.103 125. The curve is modelled by the equation
y = -0.002x2 + 5.4.

a) Write the two systems of equations to use to determine the


coordinates of the beginning and the end of the vertical curve
on a surveyors grid.
b) Using graphing technology, show the surveyors layout of the
vertical curve.
c) Determine the coordinates of each end of this vertical curve,
to the nearest hundredth.

8.1 Solving Systems of Equations Graphically MHR 431


Example 5
Model a Situation Using a System of Equations
Suppose that in one stunt, two Cirque du Soleil
performers are launched toward each other from
two slightly offset seesaws. The first performer
is launched, and 1 s later the second performer
is launched in the opposite direction. They
both perform a flip and give each other a high
five in the air. Each performer is in the air
for 2 s. The height above the seesaw versus
time for each performer during the stunt is
approximated by a parabola as shown. Their
paths are shown on a coordinate grid.

h
first second

Height Above
6

Seesaw (m)
performer performer
Did Yo u Know ?
4
5.0 m
Cirque du Soleil is
a Qubec-based 2
entertainment 2s
company that O 1 2 3 t
started in 1984 with Time (s)
20 street performers. a) Determine the system of equations that models the performers height
The company now
during the stunt.
has over 4000
b) Solve the system graphically using technology.
employees, including
1000 performers, and c) Interpret your solution with respect to this situation.
performs worldwide.
Their dramatic shows Solution
combine circus
arts with street a) For the first performer For the second performer
entertainment. (teal parabola), the vertex (blue parabola), the vertex
of the parabola is at (1, 5). of the parabola is at (2, 5).
Use the vertex form for a parabola: Use the vertex form for a
h = a(t - p)2 + q parabola: h = a(t - p)2 + q

Substitute the coordinates of the Then, the equation with the


vertex: vertex values substituted is
h = a(t - 1)2 + 5 h = a(t - 2)2 + 5

The point (0, 0) is on the parabola. The point (1, 0) is on the


Substitute and solve for a: parabola. Substitute and solve
0 = a(0 - 1)2 + 5 for a:
-5 = a 0 = a(1 - 2)2 + 5
-5 = a
The equation for the height of the
first performer versus time The equation for the height of
is h = -5(t - 1)2 + 5. the second performer versus
time is h = -5(t - 2)2 + 5.

432 MHR Chapter 8


The system of equations that models the performers heights is
h = -5(t - 1)2 + 5
h = -5(t - 2)2 + 5

b) Use a graphing calculator to graph the system. Use the intersection


feature to find the point of intersection.
How can you verify this solution?

The system has one solution: (1.5, 3.75).

c) The solution means that the performers are at the same height, 3.75 m
above the seesaw, at the same time, 1.5 s after the first performer is
launched into the air. This is 0.5 s after the second performer starts
the stunt. This is where they give each other a high five.

Your Turn
At another performance, the heights above the seesaw versus time
for the performers during the stunt are approximated by the parabola
shown. Assume again that the second performer starts 1 s after the
first performer. Their paths are shown on a coordinate grid.

h
first second
6
Height Above

performer performer
Seesaw (m)

4.5 m 4

2
1.5 s
0 0.5 1 1.5 2 2.5 t
Time (s)

a) Determine the system of equations that models the performers


height during the stunt.
b) Solve the system graphically using technology.
c) Interpret your solution with respect to this situation.

8.1 Solving Systems of Equations Graphically MHR 433


Key Ideas

Any ordered pair (x, y) that satisfies both equations in a linear-quadratic


system or in a quadratic-quadratic system is a solution to the system.
The solution to a system can be found graphically by graphing both equations
on the same coordinate grid and finding the point(s) of intersection.
y
y = x2 8

6
y = 2x - 1
4

2
(1, 1)

-6 -4 -2 O 2 4 6 x
-2

Since there is only one point of intersection, the linear-quadratic system


shown has one solution, (1, 1).
y
8
y=x +22
(2, 6)
6

4
(-1, 3)
2
y = -x2 + 2x + 6

-6 -4 -2 O 2 4 6 x
-2

Since there are two points of intersection, the quadratic-quadratic


system shown has two solutions, approximately (-1, 3) and (2, 6).
Systems of linear-quadratic equations may have no real solution, one real
solution, or two real solutions.
Systems of quadratic-quadratic equations may have no real solution, one
real solution, two real solutions, or an infinite number of real solutions.

434 MHR Chapter 8


Check Your Understanding

Practise 3. What type of system of equations is


Where necessary, round answers to the represented in each graph? Give the
nearest hundredth. solution(s) to the system.
1. The Canadian Arenacross a) x+y+3=0y
Championship for motocross 2
was held in Penticton,
British Columbia, in -6 -4 -2 O 2 x
March 2010. In the -2
competition, riders
launch their bikes off -4

jumps and perform stunts. -6


The height above ground x2 + 6x + y + 7 = 0

level of one rider going


off two different jumps b) y
y = x2 - 4x + 7
at the same speed is 6
plotted. Time is measured
4
from the moment the
rider leaves the jump. 2
The launch height and the y=1_ x2 - 2x + 3
2
launch angle of each jump O 2 4 6 8x
are different.
a) Which system models the situation? c) y
Explain your choice. Explain why y = 2x2 - 4x - 2
2
the other graphs do not model
this situation. O 2 4 6 8x

System A System B -2

h h y=-4
-4
Height

Height

4. Solve each system by graphing.


0 Time t 0 Time t Verify your solutions.
a) y = x + 7
System C System D
y = (x + 2)2 + 3
h h
b) f(x) = -x + 5
Height

Height

g(x) = _
1 (x - 4)2 + 1
2
c) x2 + 16x + y = -59
0 Time t 0 Time t
x - 2y = 60
b) Interpret the point(s) of intersection for d) x2 + y - 3 = 0
the graph you selected. x2 - y + 1 = 0
2. Verify that (0, -5) and (3, -2) are solutions e) y = x2 - 10x + 32
to the following system of equations. y = 2x2 - 32x + 137
y = -x2 + 4x - 5
y=x-5

8.1 Solving Systems of Equations Graphically MHR 435


5. Solve each system by graphing. 9. Every summer, the Folk on the Rocks Music
Verify your solutions. Festival is held at Long Lake in Yellowknife,
a) h = d 2 - 16d + 60 Northwest Territories.
h = 12d - 55
b) p = 3q2 - 12q + 17
p = -0.25q2 + 0.5q + 1.75
c) 2v2 + 20v + t = -40
5v + 2t + 26 = 0
d) n2 + 2n - 2m - 7 = 0
3n2 + 12n - m + 6 = 0
e) 0 = t2 + 40t - h + 400
t2 = h + 30t - 225

Apply Dene singer/


6. Sketch the graph of a system of two songwriter,
quadratic equations with only one Leela Gilday
from Yellowknife.
real solution. Describe the necessary
conditions for this situation to occur. Jonas has been selling shirts in the Art on
7. For each situation, sketch a graph to the Rocks area at the festival for the past
represent a system of quadratic-quadratic 25 years. His total costs (production of the
equations with two real solutions, so that shirts plus 15% of all sales to the festival)
the two parabolas have and the revenue he receives from sales (he
a) the same axis of symmetry has a variable pricing scheme) are shown
b) the same axis of symmetry and the on the graph below.
same y-intercept y

c) different axes of symmetry but the 16 000


Revenue
same y-intercept
Value ($)

12 000
d) the same x-intercepts
Cost
8. Given the graph of a quadratic function as 8 000

shown, determine the equation of a line 4 000


such that the quadratic function and the
line form a system that has 0 2 4 6 8 10 12 x
a) no real solution Quantity (100s)

b) one real solution a) What are the solutions to this system?


c) two real solutions Give answers to the nearest hundred.
y b) Interpret the solution and its
importance to Jonas.
2
c) You can determine the profit using the
-4 -2 O 2 4 x equation Profit = Revenue - Cost. Use
y = x2 - 2 the graph to estimate the quantity that
-2
gives the greatest profit. Explain why
this is the quantity that gives him the
most profit.

436 MHR Chapter 8


10. Vertical curves are used in the construction 12. Jubilee Fountain in Lost Lagoon is a
of roller coasters. One downward-sloping popular landmark in Vancouvers Stanley
grade line, modelled by the equation Park. The streams of water shooting out
y = -0.04x + 3.9, is followed by an of the fountain follow parabolic paths.
upward-sloping grade line modelled by the Suppose the tallest stream in the middle
equation y = 0.03x + 2.675. The vertical is modelled by the equation
curve between the two lines is modelled h = -0.3125d 2 + 5d, one of the smaller
by the equation y = 0.001x2 - 0.04x + 3.9. streams is modelled by the equation
Determine the coordinates of the beginning h = -0.85d 2 + 5.11d, and a second
and the end of the curve. smaller stream is modelled by the
equation h = -0.47d 2 + 3.2d, where h is
the height, in metres, of the water stream
and d is the distance, in metres, from
the central water spout.

11. A car manufacturer does performance tests


on its cars. During one test, a car starts from
rest and accelerates at a constant rate for
20 s. Another car starts from rest 3 s later
and accelerates at a faster constant rate. The
equation that models the distance the first a) Solve the system h = -0.3125d 2 + 5d
car travels is d = 1.16t2, and the equation and h = -0.85d 2 + 5.11d graphically.
that models the distance the second car Interpret the solution.
travels is d = 1.74(t - 3)2, where t is the b) Solve the system of equations involving
time, in seconds, after the first car starts the the two smaller streams of water
test, and d is the distance, in metres. graphically. Interpret the solution.
a) Write a system of equations that could
be used to compare the distance D i d You K n ow ?
travelled by both cars. Jubilee Fountain was built in 1936 to commemorate
b) In the context, what is a suitable the city of Vancouvers golden jubilee (50th birthday).

domain for the graph? Sketch the graph


of the system of equations. 13. The sum of two integers is 21. Fifteen
less than double the square of the smaller
c) Graphically determine the approximate
integer gives the larger integer.
solution to the system.
a) Model this information with a system
d) Describe the meaning of the solution in
of equations.
the context.
b) Solve the system graphically. Interpret
the solution.
c) Verify your solution.

8.1 Solving Systems of Equations Graphically MHR 437


14. A Cartesian plane is superimposed over a b) Determine a quadratic equation to
photograph of a snowboarder completing a model the frogs height compared to
540 Front Indy off a jump. The blue line is the horizontal distance it travelled
the path of the jump and can be modelled and a quadratic equation to model the
by the equation y = -x + 4. The red grasshoppers height compared to the
parabola is the path of the snowboarder horizontal distance it travelled.
during the jump and can be modelled by c) Solve the system of two equations.
the equation y = - _1 x2 + 3. The green
d) Interpret your solution in the context
4
line is the mountainside where the of this problem.
snowboarder lands and can be modelled
by the equation y = _ x+_
3 5. Extend
4 4 16. The Greek mathematician, Menaechmus
(about 380 B.C.E. to 320 B.C.E.) was one of
the first to write about parabolas. His goal
was to solve the problem of doubling the
cube. He used the intersection of curves
y
to find x and y so that _ _x _
a
x = y = 2a , where
a is the side of a given cube and x is the
side of a cube that has twice the volume.
Doubling a cube whose side length is 1 cm
y
is equivalent to solving _ 1 =_
x
x =_
y .
2
a) Use a system of equations to graphically
a) Determine the solutions to the y
solve _1 =_
x
x =_
y .
linear-quadratic systems: the blue 2
line and the parabola, and the b) What is the approximate side length
green line and the parabola. of a cube whose volume is twice the
b) Explain the meaning of the volume of a cube with a side length
solutions in this context. of 1 cm?
15. A frog jumps to catch a grasshopper. c) Verify your answer.
The frog reaches a maximum height of d) Explain how you could use the volume
25 cm and travels a horizontal distance formula to find the side length of a cube
of 100 cm. A grasshopper, located 30 cm whose volume is twice the volume of a
in front of the frog, starts to jump at the cube with a side length of 1 cm. Why
same time as the frog. The grasshopper was Menaechmus unable to use this
reaches a maximum height of 36 cm and method to solve the problem?
travels a horizontal distance of 48 cm. The
frog and the grasshopper both jump in the D i d You K n ow ?
same direction. Duplicating the cube is a classic problem of Greek
a) Consider the frogs starting position to mathematics: Given the length of an edge of a
be at the origin of a coordinate grid. cube, construct a second cube that has double
the volume of the rst. The problem was to nd a
Draw a diagram to model the given
ruler-and-compasses construction for the cube root
information. of 2. Legend has it that the oracle at Delos requested
that this construction be performed to appease the
gods and stop a plague. This problem is sometimes
referred to as the Delian problem.

438 MHR Chapter 8


17. The solution to a system of two 20. Without graphing, use your knowledge
equations is (-1, 2) and (2, 5). of linear and quadratic equations to
a) Write a linear-quadratic system of determine whether each system has no
equations with these two points as solution, one solution, two solutions, or
its solutions. an infinite number of solutions. Explain
how you know.
b) Write a quadratic-quadratic system
of equations with these two points a) y = x2
as its only solutions. y=x+1
c) Write a quadratic-quadratic system b) y = 2x2 + 3
of equations with these two points y = -2x - 5
as two of infinitely many solutions. c) y = (x - 4)2 + 1
18. Determine the possible number of y=_ 1 (x - 4)2 + 2
solutions to a system involving two 3
quadratic functions and one linear d) y = 2(x + 8)2 - 9
function. Support your work with a y = -2(x + 8)2 - 9
series of sketches. Compare your work e) y = 2(x - 3)2 + 1
with that of a classmate. y = -2(x - 3)2 -1
f) y = (x + 5)2 - 1
Create Connections y = x2 + 10x + 24
19. Explain the similarities and differences
between linear systems and the systems
you studied in this section.

Project Corner Nanotechnology

Nanotechnology has applications in a wide variety of areas.


Electronics: Nanoelectronics will produce new devices
that are small, require very little electricity, and produce
little (if any) heat.
Energy: There will be advances in solar power, hydrogen
fuel cells, thermoelectricity, and insulating materials.
Health Care: New drug-delivery techniques will be
developed that will allow medicine to be targeted directly
at a disease instead of the entire body.
The Environment: Renewable energy, more efficient use
of resources, new filtration systems, water purification
processes, and materials that detect and clean up
environmental contaminants are some of the potential
eco-friendly uses.
Everyday Life: Almost all areas of your life may be
improved by nanotechnology: from the construction of
your house, to the car you drive, to the clothes you wear.
Which applications of nanotechnology have you used?

8.1 Solving Systems of Equations Graphically MHR 439


8.2
Solving Systems of Equations
Algebraically
Focus on . . .
modelling a situation using a system of linear-quadratic or
quadratic-quadratic equations
relating a system of linear-quadratic or quadratic-quadratic
equations to a problem
determining the solution of a system of linear-quadratic or
quadratic-quadratic equations algebraically
interpreting points of intersection of a system of linear-
quadratic or quadratic-quadratic equations
solving a problem that involves a system of linear-quadratic
or quadratic-quadratic equations

Many ancient civilizations, such as Egyptian, Babylonian,


Greek, Hindu, Chinese, Arabic, and European, helped
develop the algebra we use today. Initially problems were
Ren Descartes
stated and solved verbally or geometrically without the use of symbols.
The French mathematician Franois Vite (15401603) popularized using
algebraic symbols, but Ren Descartes (15961650) thoroughly thought-out
symbolism for algebra led directly to the notation we use today. Do you
recognize the similarities and differences between his notation and ours?

Investigate Solving Systems of Equations Algebraically

1. Solve the following system of linear-quadratic equations


graphically using graphing technology.
y=x+6
y = x2
2. a) How could you use the algebraic method of elimination or
substitution to solve this system of equations?
b) What quadratic equation would you need to solve?
3. How are the roots of the quadratic equation in step 2b) related to
the solution to the system of linear-quadratic equations?
4. Graph the related function for the quadratic equation from step 2b)
in the same viewing window as the system of equations. Imagine a
vertical line drawn through a solution to the system of equations in
step 1. Where would this line intersect the equation from step 2b)?
Explain this result.
5. What can you conclude about the relationship between the roots
of the equation from step 2b) and the solution to the initial system
of equations?
440 MHR Chapter 8
6. Consider the following system of quadratic-quadratic equations.
Repeat steps 1 to 5 for this system.
y = 2x2 + 3x - 3
y = x2 + x

Reflect and Respond


7. Why are the x-coordinates in the solutions to the system of equations the
same as the roots for the single equation you created using substitution
or elimination? You may want to use sketches to help you explain.
8. Explain how you could solve a system of linear-quadratic or
quadratic-quadratic equations without using any of the graphing
steps in this investigation.

Link the Ideas

Recall from the previous section that systems of equations can have,
Why is it important to be able
depending on the type of system, 0, 1, 2, or infinite real solutions. to solve systems algebraically
You can apply the algebraic methods of substitution and elimination as well as graphically?
that you used to solve systems of linear equations to solve systems of
linear-quadratic and quadratic-quadratic equations.

Example 1
Solve a System of Linear-Quadratic Equations Algebraically
a) Solve the following system of equations.
5x - y = 10
x2 + x - 2y = 0
b) Verify your solution.

Solution
a) Method 1: Use Substitution
Since the quadratic term is in the variable x, solve the linear equation
for y.
Solve the linear equation for y. Why is it easier to solve
5x - y = 10 the first equation for y?

y = 5x - 10
Substitute 5x - 10 for y in the quadratic equation and simplify.
x2 + x - 2y = 0
2
x + x - 2(5x - 10) = 0
x2 - 9x + 20 = 0
Solve the quadratic equation by factoring.
(x - 4)(x - 5) = 0
x = 4 or x = 5

8.2 Solving Systems of Equations Algebraically MHR 441


Substitute these values into the original linear equation to determine
the corresponding values of y.
When x = 4: When x = 5: Why substitute into the linear
5x - y = 10 5x - y = 10 equation rather than the quadratic?

5(4) - y = 10 5(5) - y = 10
y = 10 y = 15
The two solutions are (4, 10) and (5, 15).
Method 2: Use Elimination
Align the terms with the same degree.
Since the quadratic term is in the variable x, eliminate the y-term.
5x - y = 10 q
x2 + x - 2y = 0 w
Multiply q by -2 so that there is an opposite term to -2y in q.
-2(5x - y) = -2(10)
-10x + 2y = -20 e
Add e and q to eliminate the y-terms.
-10x + 2y = -20
x2 + x - 2y = 0
x2 - 9x = -20
Then, solve the equation x2 - 9x + 20 = 0 by What do the two solutions
factoring, as in the substitution method above, tell you about the appearance
of the graphs of the two
to obtain the two solutions (4, 10) and (5, 15). equations?
b) To verify the solutions, substitute each ordered pair into the
original equations. How could you verify the solutions
using technology?
Verify the solution (4, 10):
Left Side Right Side Left Side Right Side
5x - y 10 x2 + x - 2y 0
2
= 5(4) - 10 = 4 + 4 - 2(10)
= 20 - 10 = 16 + 4 - 20
= 10 =0
Left Side = Right Side Left Side = Right Side
Verify the solution (5, 15):
Left Side Right Side Left Side Right Side
5x - y 10 x2 + x - 2y 0
= 5(5) - 15 = 52 + 5 - 2(15)
= 25 - 15 = 25 + 5 - 30
= 10 =0
Left Side = Right Side Left Side = Right Side
Both solutions are correct.
The two solutions are (4, 10) and (5, 15).

Your Turn
Solve the following system of equations algebraically.
3x + y = -9
4x2 -x + y = -9

442 MHR Chapter 8


Example 2
Model a Situation With a System of Equations
Glen loves to challenge himself
with puzzles. He comes
across a Web site that offers
online interactive puzzles,
but the puzzle-makers present
the following problem for
entry to their site.

So you like puzzles? Well, prove your worthiness by solving this


conundrum.

Determine two integers such that the sum of the smaller number
and twice the larger number is 46. Also, when the square of the
smaller number is decreased by three times the larger, the result
is 93. In the box below, enter the smaller number followed by the
larger number and you will gain access to our site.

a) Write a system of equations that relates to the problem.


b) Solve the system algebraically. What is the code that gives
access to the site?

Solution
a) Let S represent the smaller number.
Let L represent the larger number.
Use these variables to write an equation to represent the first
statement: the sum of the smaller number and twice the larger
number is 46.
S + 2L = 46
Next, write an equation to represent the second statement: when the
square of the smaller number is decreased by three times the larger,
the result is 93.
S2 - 3L = 93
Solving the system of equations gives the numbers that meet both sets
of conditions.

8.2 Solving Systems of Equations Algebraically MHR 443


b) Use the elimination method. Why was the elimination method chosen? Could
S + 2L = 46 q you use the substitution method instead?

S2 - 3L = 93 w
Multiply q by 3 and w by 2.
3(S + 2L) = 3(46)
3S + 6L = 138 e
2(S2 - 3L) = 2(93)
2S2 - 6L = 186 r
Add e and r to eliminate L.
3S + 6L = 138
2S2 - 6L = 186
2S2 + 3S = 324 Why can you not eliminate the variable S?

Solve 2S 2 + 3S - 324 = 0.
Factor.
(2S + 27)(S - 12) = 0
S = -13.5 or S = 12
Since the numbers are supposed to be integers, S = 12.
Substitute S = 12 into the linear equation to determine the value of L.
S + 2L = 46 Why was q chosen to substitute into?
12 + 2L = 46
2L = 34
L = 17
The solution is (12, 17).
Verify the solution by substituting (12, 17) into the original equations:
Left Side Right Side Left Side Right Side
S + 2L 46 S2 - 3L 93
= 12 + 2(17) = 122 - 3(17)
= 12 + 34 = 144 - 51
= 46 = 93
Left Side = Right Side Left Side = Right Side
The solution is correct.

The two numbers for the code are 12 and 17. The access key is 1217.

Your Turn
Determine two integers that have the following relationships:
Fourteen more than twice the first integer gives the second
integer. The second integer increased by one is the square of
the first integer.
a) Write a system of equations that relates to the problem.
b) Solve the system algebraically.

444 MHR Chapter 8


Example 3
Solve a Problem Involving a Linear-Quadratic System
A Canadian cargo plane drops a crate of
emergency supplies to aid-workers on the
ground. The crate drops freely at first before a
parachute opens to bring the crate gently to the
ground. The crates height, h, in metres, above
the ground t seconds after leaving the aircraft is
given by the following two equations.
h = -4.9t2 + 700 represents the height of the
crate during free fall.
h = -5t + 650 represents the height of the crate
with the parachute open.
a) How long after the crate leaves the aircraft
does the parachute open? Express your
answer to the nearest hundredth of a second.
b) What height above the ground is the crate
when the parachute opens? Express your
answer to the nearest metre.
c) Verify your solution.

Solution
a) The moment when the parachute opens corresponds to the point of
intersection of the two heights. The coordinates can be determined by
solving a system of equations.
The linear equation is written in terms of the variable h, so use the
method of substitution.
Substitute -5t + 650 for h in the quadratic equation.
h = -4.9t2 + 700
-5t + 650 = -4.9t2 + 700
2
4.9t - 5t - 50 = 0
Solve using the quadratic formula.
________
t= ____
-b b2 - 4ac
2a __________________
t= ______
-(-5) (-5)2 - 4(4.9)(-50)
_____ 2(4.9)
t= ___
5 1005
9.8_____ _____
t= ___
5 + 1005
or t = ___
5 - 1005
Why is t = -2.724... rejected as
9.8 9.8
a solution to this problem?
t = 3.745... or t = -2.724...
The parachute opens about 3.75 s after the crate leaves
the plane.

8.2 Solving Systems of Equations Algebraically MHR 445


b) To find the crates height above the ground, substitute the value
t = 3.745 into the linear equation.
h = -5t + 650
h = -5(3.745) + 650
h = 631.274
The crate is about 631 m above the ground when the parachute opens.

c) Method 1: Use Paper and Pencil


To verify the solution, substitute the answer for t into the first
equation of the system.
h = -4.9t2 + 700
h = -4.9(3.745)2 + 700
h = 631.274
The solution is correct.

Method 2: Use Technology

The solution is correct.

The crate is about 631 m above the ground when the parachute opens.

Your Turn
Suppose the crates height above the ground is given by the following
two equations.
h = -4.9t2 + 900
h = -4t + 500
a) How long after the crate leaves the aircraft does the parachute open?
Express your answer to the nearest hundredth of a second.
b) What height above the ground is the crate when the parachute opens?
Express your answer to the nearest metre.
c) Verify your solution.

446 MHR Chapter 8


Example 4
Solve a System of Quadratic-Quadratic Equations Algebraically
a) Solve the following system of equations.
3x2 - x - y - 2 = 0
6x2 + 4x - y = 4
b) Verify your solution.

Solution
a) Both equations contain a single y-term, so use elimination.
3x2 - x - y = 2 q Why can x not be eliminated?
6x2 + 4x - y = 4 w Could this system be solved by substitution? Explain.

Subtract q from w to eliminate y.


6x2 + 4x - y = 4
3x2 - x - y = 2
3x2 + 5x = 2

Solve the quadratic equation.


3x2 + 5x = 2
3x2 + 5x - 2 = 0
2
3x + 6x - x - 2 = 0
3x(x + 2) - 1(x + 2) = 0 Factor by grouping.
(x + 2)(3x - 1) = 0
x = -2 or x = _1
3
Substitute these values into the equation 3x2 - x - y = 2 to determine
the corresponding values of y.

When x = -2: When x = _ 1:


3
3x2 - x - y = 2 3x2 - x - y =2
3 _
1 2-_
2
3(-2) - (-2) - y = 2 1 -y
12 + 2 - y = 2 ( )
3 3
=2
y = 12 _1 - _1 - y =2
3 3
y = -2

The system has two solutions: (-2, 12) and _


1 , -2 .
( ) What do the two solutions tell you about the
3 appearance of the graphs of the two equations?

8.2 Solving Systems of Equations Algebraically MHR 447


b) To verify the solutions, substitute each ordered pair into the
original equations.

Verify the solution (-2, 12):


Left Side Right Side
3x2 - x - y - 2 0
2
= 3(-2) - (-2) - 12 - 2
= 12 + 2 - 12 - 2
=0
Left Side = Right Side

Left Side Right Side


6x2 + 4x - y 4
= 6(-2)2 + 4(-2) - 12
= 24 - 8 - 12
=4
Left Side = Right Side

Verify the solution _1 , -2 :


( )
3
Left Side Right Side
3x2 - x - y - 2 0
= 3 _ - _ - (-2) - 2
2
1 1
( ) ( )
3 3
_
1
= - +2-2_
1
3 3
=0
Left Side = Right Side

Left Side Right Side


6x2 + 4x - y 4
=6 _
1
( )
2
+4 _
1
( ) - (-2)
3 3
=_2 +_ 4 +2
3 3
=4
Left Side = Right Side
Both solutions are correct.

The system has two solutions: (-2, 12) and _


1 , -2 .
( )
3

Your Turn
a) Solve the system algebraically. Explain why you chose the method
that you did.
6x2 - x - y = -1
4x2 - 4x - y = -6
b) Verify your solution.

448 MHR Chapter 8


Example 5
Solve a Problem Involving a Quadratic-Quadratic System D i d You K n ow?

During a basketball game, In 1891 at a small


Ben completes an impressive college in Springeld
alley-oop. From one side of the Massachusetts, a
Canadian physical
hoop, his teammate Luke lobs a
education instructor
perfect pass toward the basket. named James
Directly across from Luke, Ben Naismith, invented the
jumps up, catches the ball and game of basketball
tips it into the basket. The path as a way to keep his
of the ball thrown by Luke can be students active during
modelled by the equation winter months. The
rst game was played
d 2 - 2d + 3h = 9, where d is the
with a soccer ball and
horizontal distance of the ball
two peach baskets,
from the centre of the hoop, in with numerous
metres, and h is the height of the stoppages in play to
ball above the floor, in metres. manually retrieve the
The path of Bens jump can be ball from the basket.
modelled by the equation
5d 2 - 10d + h = 0, where d is his
horizontal distance from the centre
of the hoop, in metres, and h is the
height of his hands above the floor,
in metres.
a) Solve the system of equations
algebraically. Give your solution to
the nearest hundredth.
b) Interpret your result. What
assumptions are you making?
3m
Solution
a) The system to solve is
d 2 - 2d + 3h = 9
5d 2 - 10d + h = 0

Solve the second equation for h since the leading coefficient of this
term is 1.
h = -5d 2 + 10d

Substitute -5d 2 + 10d for h in the first equation.


d 2 - 2d + 3h = 9
d - 2d + 3(-5d 2 + 10d) = 9
2

d 2 - 2d - 15d 2 + 30d = 9
14d 2 - 28d + 9 = 0

Solve using the quadratic formula.

8.2 Solving Systems of Equations Algebraically MHR 449


________
d= ____
-b b2 - 4ac
2a ________________
d= ______
-(-28) (-28)2 - 4(14)(9)
____ 2(14)
d= ___
28 280
28 ___ ___
d= __
14 + 70
or d = __
14 - 70
14 14
d= 1.597 d = 0.402
Substitute these values of d into the equation h = -5d 2 + 10d to find
the corresponding values of h.
___
For d = __
14 + 70
:
14
h = -5d 2 + 10d___ ___
2
h = -5 __ + 10 __
( ) ( )
14 + 70 14 + 70
14 14
h = 3.214
___
For d = __
14 - 70
:
14
h = -5d 2 + 10d___ ___
2
h = -5 __ + 10 __
( ) ( )
14 - 70 14 - 70
14 14
h = 3.214
To the nearest hundredth, the solutions to the How can you verify
system are (0.40, 3.21) and (1.60, 3.21). the solutions?

b) The parabolic path of the ball and Bens parabolic path will Why is the
intersect at two locations: at a distance of 0.40 m from the solution of
1.60 m not
basket and at a distance of 1.60 m from the basket, in both appropriate in
cases at a height of 3.21 m. Ben will complete the alley-oop this context?
if he catches the ball at the distance of 0.40 m from the hoop.
The ball is at the same height, 3.21 m, on its upward path
toward the net but it is still 1.60 m away.
This will happen if you assume Ben times his jump appropriately,
is physically able to make the shot, and the shot is not blocked by
another player.

Your Turn
Terri makes a good hit and the baseball travels on a path modelled by
h = -0.1x2 + 2x. Ruth is in the outfield directly in line with the path of
the ball. She runs toward the ball and jumps to try to catch it. Her jump
is modelled by the equation h = -x2 + 39x - 378. In both equations, x is
the horizontal distance in metres from home plate and h is the height of
the ball above the ground in metres.
a) Solve the system algebraically. Round your answer to the nearest
hundredth.
b) Explain the meaning of the point of intersection. What assumptions
are you making?

450 MHR Chapter 8


Key Ideas

Solve systems of linear-quadratic or quadratic-quadratic equations


algebraically by using either a substitution method or an elimination method.
To solve a system of equations in two variables using substitution,
 isolate one variable in one equation
 substitute the expression into the other equation and solve for the
remaining variable
 substitute the value(s) into one of the original equations to determine
the corresponding value(s) of the other variable
 verify your answer by substituting into both original equations
To solve a system of equations in two variables using elimination,
 if necessary, rearrange the equations so that the like terms align
 if necessary, multiply one or both equations by a constant to create
equivalent equations with a pair of variable terms with opposite
coefficients
 add or subtract to eliminate one variable and solve for the remaining
variable
 substitute the value(s) into one of the original equations to determine
the corresponding value(s) of the other variable
 verify your answer(s) by substituting into both original equations

Check Your Understanding

Practise 3. Solve each system of equations by


Where necessary, round your answers to the substitution, and verify your solution(s).
nearest hundredth. a) x2 - y + 2 = 0
1. Verify that (5, 7) is a solution to the 4x = 14 - y
following system of equations. b) 2x2 - 4x + y = 3
k + p = 12 4x - 2y = -7
4k2 - 2p = 86 c) 7d 2 + 5d - t - 8 = 0
2. Verify that _ , _ is a solution to the
1 3
(
3 4 ) 10d - 2t = -40
following system of equations. d) 3x2 + 4x - y - 8 = 0
y + 3 = 2x2 + 4x
18w2 - 16z2 = -7
e) y + 2x = x2 - 6
144w2 + 48z2 = 43
x + y - 3 = 2x2

8.2 Solving Systems of Equations Algebraically MHR 451


4. Solve each system of equations by 7. Marie-Soleil solved two systems of
elimination, and verify your solution(s). equations using elimination. Instead of
2
a) 6x - 3x = 2y - 5 creating opposite terms and adding, she
2x2 + x = y - 4 used a subtraction method. Her work
for the elimination step in two different
b) x2 + y = 8x + 19
systems of equations is shown below.
x2 - y = 7x - 11
First System
c) 2p2 = 4p - 2m + 6
5x + 2y = 12
5m + 8 = 10p + 5p2
x2 - 2x + 2y = 7
d) 9w2 + 8k = -14 -x2 + 7x = 5
w2 + k = -2
Second System
e) 4h2 - 8t = 6 12m2 - 4m - 8n = -3
6h2 - 9 = 12t 9m2 - m - 8n = 2
5. Solve each system algebraically. Explain 3m2 - 3m = -5
why you chose the method you used. a) Study Marie-Soleils method. Do you
a) y - 1 = - _ x
7 think this method works? Explain.
8
3x2 + y = 8x - 1 b) Redo the first step in each system by
multiplying one of the equations by
b) 8x2 + 5y = 100
-1 and adding. Did you get the same
6x2 - x - 3y = 5
results as Marie-Soleil?
c) x2 - _ x + _ y + _ = 0
48 1 1
9 3 3 c) Do you prefer to add or subtract to
-_5 2 _
x - x+_ 1y - _
3 1 =0 eliminate a variable? Explain why.
4 2 4 2
8. Determine the values of m and n if (2, 8)
is a solution to the following system of
Apply
equations.
6. Alex and Kaela are considering
the two equations n - m2 = 7 and mx2 - y = 16
2m2 - 2n = -1. Without making any mx2 + 2y = n
calculations, they both claim that the 9. The perimeter of the right triangle
system involving these two equations is 60 m. The area of the triangle is
has no solution. 10y square metres.
Alexs reasoning:
If I double every term in the first y + 14
equation and then use the elimination 2x
method, both of the variables will
disappear, so the system does not have 5x - 1
a solution.
a) Write a simplified expression for the
Kaelas reasoning:
triangles perimeter in terms of x and y.
If I solve the first equation for n and
substitute into the second equation, I b) Write a simplified expression for the
will end up with an equation without triangles area in terms of x and y.
any variables, so the system does not c) Write a system of equations and explain
have a solution. how it relates to this problem.
a) Is each persons reasoning correct? d) Solve the system for x and y. What are
b) Verify the conclusion graphically. the dimensions of the triangle?
e) Verify your solution.

452 MHR Chapter 8


10. Two integers have a difference of -30. 13. The 2015-m-tall Mount Asgard in
When the larger integer is increased by Auyuittuq (ow you eet took) National
3 and added to the square of the smaller Park, Baffin Island, Nunavut, was used
integer, the result is 189. in the opening scene for the James
a) Model the given information with a Bond movie The Spy Who Loved Me.
system of equations. A stuntman skis off the edge of the
mountain, free-falls for several seconds,
b) Determine the value of the integers by
and then opens a parachute. The height,
solving the system.
h, in metres, of the stuntman above
c) Verify your solution. the ground t seconds after leaving
11. The number of the edge of the mountain is given by
centimetres in the two functions.
circumference of a r
circle is three times
the number of square
centimetres in the
area of the circle.
a) Write the system of linear-quadratic
equations, in two variables, that models
the circle with the given property.
b) What are the radius, circumference, and
area of the circle with this property?
12. A 250-g ball is thrown into the air with
an initial velocity of 22.36 m/s. The h(t) = -4.9t2 + 2015 represents the
kinetic energy, Ek, of the ball is given height of the stuntman before he opens
by the equation Ek = _ 5 (d - 20)2 and
the parachute.
32
its potential energy, Ep, is given by the h(t) = -10.5t + 980 represents the
equation Ep = - _ 5 (d - 20)2 + 62.5, height of the stuntman after he opens
32 the parachute.
where energy is measured in joules (J)
a) For how many seconds does the
and d is the horizontal distance
stuntman free-fall before he opens
travelled by the ball, in metres.
his parachute?
a) At what distances does the ball have
b) What height above the ground was
the same amount of kinetic energy as
the stuntman when he opened the
potential energy?
parachute?
b) How many joules of each type of energy
c) Verify your solutions.
does the ball have at these distances?
c) Verify your solution by graphing. D i d You K n ow ?
d) When an object is thrown into the Mount Asgard, named after the kingdom of the gods
air, the total mechanical energy of the in Norse mythology, is known as Sivanitirutinguak
object is the sum of its kinetic energy (see va kneek tea goo ting goo ak) to Inuit. This
and its potential energy. On Earth, one name, in Inuktitut, means shape of a bell.
of the properties of an object in motion
is that the total mechanical energy is a
constant. Does the graph of this system
show this property? Explain how you
could confirm this observation.

8.2 Solving Systems of Equations Algebraically MHR 453


14. A table of values is shown for two different a) The height of the summit of a volcano
quadratic functions. is 2500 m. If a lava fragment blasts
First Quadratic Second Quadratic out of the middle of the summit
at an angle of 45 travelling at
x y x y 60 m/s, confirm that the function
-1 2 -5 4 h(x) = -0.003x2 + x + 2500
0 0 -4 1 approximately models the fragments
1 2 -3 0 height relative to the horizontal
2 8 -2 1 distance travelled. Confirm that a
fragment blasted out at an angle
a) Use paper and pencil to plot each set of of 60 travelling at 60 m/s can be
ordered pairs on the same grid. Sketch approximately modelled by the function
the quadratic functions. h(x) = -0.005x2 + 1.732x + 2500.
b) Estimate the solution to the system b) Solve the system
involving the two quadratic functions. h(x) = -0.003x2 + x + 2500
c) Determine a quadratic equation for each h(x) = -0.005x2 + 1.732x + 2500
function and model a quadratic-quadratic c) Interpret your solution and the
system with these equations. conditions required for it to be true.
d) Solve the system of equations
algebraically. How does your solution D i d You K n ow ?
compare to your estimate in part b)? Iceland is one of the most active volcanic areas
15. When a volcano erupts, it sends lava in the world. On April 14, 2010, when Icelands
fragments flying through the air. From the Eyjafjallajokull (ay yah fyah lah yoh kuul) volcano
had a major eruption, ash was sent high into Earths
point where a fragment is blasted into the
atmosphere and drifted south and east toward
air, its height, h, in metres, relative to the
Europe. This large ash cloud wreaked havoc on air
horizontal distance travelled, x, in metres, trafc. In fear that the airplanes engines would
can be approximated using the function be clogged by the ash, thousands of ights were
h(x) = - __ 4.9 cancelled for many days.
x2 + (tan )x + h0,
(v0 cos )2
where v0 is the initial velocity of the 16. In western Canada, helicopter bombing
fragment, in metres per second; is the is used for avalanche control. In high-risk
angle, in degrees, relative to the horizontal areas, explosives are dropped onto the
at which the fragment starts its path; mountainside to safely start an avalanche.
and h0 is the initial height, in metres, of
The function h(x) = - _ 5 x2 + 200
the fragment. 1600
represents the height, h, in metres, of the
explosive once it has been thrown from
the helicopter, where x is the horizontal
distance, in metres, from the base of the
mountain. The mountainside is modelled
by the function h(x) = 1.19x.
a) How can the following system of
equations be used for this scenario?
h = -_ 5 x2 + 200
1600
h = 1.19x
b) At what height up the mountain does
the explosive charge land?

454 MHR Chapter 8


17. The monthly economic situation of 19. A normal line is a line that is
a manufacturing firm is given by the perpendicular to a tangent line of
following equations. a curve at the point of tangency.
R = 5000x - 10x2 y
RM = 5000 - 20x
tangent
C = 300x + _ 1 x2 line
12
CM = 300 + _ 1 x2
0 x
4 normal
where x represents the quantity sold, line
R represents the firms total revenue,
RM represents marginal revenue, C
represents total cost, and CM represents The line y = 4x - 2 is tangent to the
the marginal cost. All costs are curve y = 2x2 - 4x + 6 at a point A.
in dollars.
a) What are the coordinates of point A?
a) Maximum profit occurs when marginal
b) What is the equation of the normal
revenue is equal to marginal cost.
line to the curve y = 2x2 - 4x + 6
How many items should be sold to
at the point A?
maximize profit?
c) The normal line intersects the curve
b) Profit is total revenue minus total
again at point B, creating chord AB.
cost. What is the firms maximum
Determine the length of this chord.
monthly profit?
20. Solve the following system of equations
using an algebraic method.
Extend
18. Kate is an industrial design engineer. She y = __
2x - 1
x
is creating the program for cutting fabric __x +y-2=0
for a shade sail. The shape of a shade sail x+2
is defined by three intersecting parabolas. 21. Determine the equations for the
The equations of the parabolas are linear-quadratic system with the following
2
y = x + 8x + 16 properties. The vertex of the parabola is at
y = x2 - 8x + 16 (-1, -4.5). The line intersects the parabola
y = -_x2 + 2 at two points. One point of intersection is
8 on the y-axis at (0, -4) and the other point
where x and y are measurements in metres. of intersection is on the x-axis.
a) Use an algebraic method to determine
the coordinates of the three vertices of Create Connections
the sail. 22. Consider graphing methods and
b) Estimate the area of material required to algebraic methods for solving a
make the sail. system of equations. What are the
advantages and the disadvantages
of each method? Create your own
examples to model your answer.
23. A parabola has its vertex at (-3, -1)
and passes through the point (-2, 1).
A second parabola has its vertex at (-1, 5)
and has y-intercept 4. What are the
approximate coordinates of the point(s)
at which these parabolas intersect?

8.2 Solving Systems of Equations Algebraically MHR 455


24. Use algebraic reasoning to show that Step 2 Algebraically determine the values of
the graphs of y = - _
1 x - 2 and b for which the system has two real
2 solutions, one real solution, and no
y = x2 - 4x + 2 do not intersect.
real solution.
25. MINI LAB In this activity, you will explore Step 3 Consider the system of linear-quadratic
the effects that varying the parameters equations y = x2 and y = mx - 1,
b and m in a linear equation have on a where m  R. Graph the system of
system of linear-quadratic equations. equations for different values of m.
Step 1 Consider the system of linear-quadratic Experiment with changing the value of
equations y = x2 and y = x + b, where m. For what value of m do the parabola
b  R. Graph the system of equations and the line intersect in exactly one
for different values of b. Experiment point? Based on your results, predict
with changing the value of b so that for the values of m for which the system
some of your values of b the parabola has two real solutions, one real
and the line intersect in two points, solution, and no real solution.
and not for others. For what value Step 4 Algebraically determine the values of
of b do the parabola and the line m for which the system has two real
intersect in exactly one point? Based solutions, one real solution and no
on your results, predict the values real solution.
of b for which the system has two
Step 5 Consider the system of linear-
real solutions, one real solution, and
quadratic equations y = x2 and
no real solution.
y = mx + b, where m, b  R.
Determine the conditions on m and
b for which the system has two real
solutions, one real solution, and
no real solution.

Project Corner Carbon Nanotubes and Engineering

Carbon nanotubes are cylindrical molecules made of carbon. They have


many amazing properties and, as a result, can be used in a number of
different applications.
Carbon nanotubes are up to 100 times stronger than
steel and only _
1 its mass.
16
Researchers mix nanotubes with plastics as reinforcers.
Nanotechnology is already being applied to sports
equipment such as bicycles, golf clubs, and tennis
rackets. Future uses will include things like aircraft,
bridges, and cars. What are some other things that could
be enhanced by this stronger and lighter product?

456 MHR Chapter 8


Chapter 8 Review
8.1 Solving Systems of Equations Graphically, 5. Solve each system of equations by
pages 424439 graphing.
Where necessary, round your answers to the a) p = _1 (x + 2) 2
+2
3
nearest hundredth.
_
p = 1 (x - 1)
2
+3
1. Consider the tables of values for 3
y = -1.5x - 2 and y = -2(x - 4)2 + 3. b) y = -6x2 - 4x + 7
y = x2 + 2x - 6
x y x y
0.5 -2.75 0.5 -21.5 c) t = -3d 2 - 2d + 3.25

1 -3.5 1 -15 t=_ 1d - 5


8
1.5 -4.25 1.5 -9.5 6. An engineer constructs side-by-side
2 -5 2 -5 parabolic arches to support a bridge
2.5 -5.75 2.5 -1.5 over a road and a river. The arch over
3 -6.5 3 1 the road has a maximum height of 6
m and a width of 16 m. The river arch
a) Use the tables to determine a solution to has a maximum height of 8 m, but
the system of equations its width is reduced by 4 m because
y = -1.5x - 2 it intersects the arch over the road.
y = -2(x - 4)2 + 3 Without this intersection, the river arch
would have a width of 24 m. A support
b) Verify this solution by graphing.
footing is used at the intersection point
c) What is the other solution to the of the arches. The engineer sketched
system? the arches on a coordinate system. She
2. State the number of possible solutions to placed the origin at the left most point
each system. Include sketches to support of the road.
your answers.
y
a) a system involving a parabola and a
12
horizontal line
Bridge
b) a system involving two parabolas that 10

both open upward 8


c) a system involving a parabola and a line
6
with a positive slope
3. Solve each system of equations by 4
graphing.
2
a) y = _ x + 4
2
3
y = -3(x + 6)2 0 5 10 15 20 25 30 35 x

b) y = x 2 - 4x + 1
y = -_1 (x - 2)2 + 3 a) Determine the equation that models
2 each arch.
4. Adam graphed the system of quadratic
b) Solve the system of equations.
equations y = x 2 + 1 and y = x 2 + 3 on
c) What information does the solution
a graphing calculator. He speculates that
to the system give the engineer?
the two graphs will intersect at some large
value of y. Is Adam correct? Explain.

Chapter 8 Review MHR 457


7. Caitlin is at the base of a hill with a 10. Solve each system algebraically, giving
constant slope. She kicks a ball as hard as exact answers. Explain why you chose
she can up the hill. the method you used.
a) Explain how the following system a) p = 3k + 1
models this situation. p = 6k2 + 10k - 4
h = -0.09d 2 + 1.8d b) 4x2 + 3y = 1
h=_ 1d 3x2 + 2y = 4
2
c) _ + _ - _ = 3
w2 w z
b) Solve the system. 2 4 2
c) Interpret the point(s) of intersection _
w2 - _3w
+_ z +_1 =0
in the context. 3 4 6 3
d) 2y - 1 = x2 - x
x2 + 2x + y - 3 = 0
8.2 Solving Systems of Equations 11. The approximate height, h, in metres,
Algebraically, pages 440456 travelled by golf balls hit with two
8. y different clubs over a horizontal distance
6
of d metres is given by the following
functions:
4
seven-iron: h(d) = -0.002d 2 + 0.3d
2 nine-iron: h(d) = -0.004d 2 + 0.5d
a) At what distances is the ball at the
O 2 4 6 8 x same height when either of the
-2 clubs is used?
y = x2 - 6x + 5 b) What is this height?
-4
y = 2x - 7 12. Manitoba has
-6
many
biopharmaceutical
a) Estimate the solutions to the system of companies. Suppose
equations shown in the graph. scientists at one of
these companies grow
b) Solve the system algebraically.
two different cell cultures
9. Without solving the system 4m2 - 3n = -2 in an identical nutrient-rich medium. The
and m2 + _ 7 m + 5n = 7, determine which rate of increase, S, in square millimetres
2
per hour, of the surface area of each culture
solution is correct: _
1 , 1 or _
( ) ( 1 , -1 .
) after t hours is modelled by the following
2 2
quadratic functions:
First culture: S(t) = -0.007t2 + 0.05t
Second culture: S(t) = -0.0085t2 + 0.06t
a) What information would the scientists
gain by solving the system of related
equations?
b) Solve the system algebraically.
c) Interpret your solution.

458 MHR Chapter 8


Chapter 8 Practice Test
Multiple Choice 4. What is the solution to the following
system of equations?
For #1 to #5, choose the best answer.
y = (x + 2)2 - 2
y=_
1. The graph for a system of equations is 1 (x + 2)2
shown. In which quadrant(s) is there a 2
solution to the system? A no solution
A I only B x=2
B II only C x = -4 and x = 2
C I and II only D x = -4 and x = 0
D II and III only 5. Connor used the substitution method to
y solve the system
5m - 2n = 25
3m2 - m + n = 10
Below is Connors solution for m. In which
0 x
line did he make an error?
Connors solution:
Solve the second equation for n:
_1 (x - 6)
2
n = 10 - 3m2 + m line 1
2. The system y = + 2 and
2 Substitute into the first equation:
y = 2x + k has no solution. How 5m - 2(10 - 3m2 + m) = 25 line 2
many solutions does the system 2
5m - 20 + 6m - 2m = 25
y = -_1 (x - 6)2 + 2 and y = 2x + k have? 6m2 + 3m - 45 = 0 line 3
2
2m2 + m - 15 = 0
A none
(2m + 5)(m - 3) = 0 line 4
B one m = 2.5 or m = -3
C two A line 1 B line 2
D infinitely many C line 3 D line 4
3. Tables of values are shown for two
different quadratic functions. What Short Answer
conclusion can you make about the
related system of equations? Where necessary, round your answers to
the nearest hundredth.
x y x y
6. A student determines that one solution to
1 6 1 -6
a system of quadratic-quadratic equations
2 -3 2 -3
is (2, 1). What is the value of n if the
3 -6 3 -2 equations are
4 -3 4 -3 4x2 - my = 10
5 6 5 -6 mx2 + ny = 20
A It does not have a solution. 7. Solve algebraically.

B It has at least two real solutions. a) 5x 2 + 3y = -3 - x


2x 2 - x = -4 - 2y
C It has an infinite number of solutions.
b) y = 7x - 11
D It is quadratic-quadratic with a
5x 2 - 3x - y = 6
common vertex.

Chapter 8 Practice Test MHR 459


8. For a dance routine, the choreographer 10. a) Determine a system of quadratic
has arranged for two dancers to perform equations for the functions shown.
jet jumps in canon. Sophie leaps first, y
and one count later Noah starts his
4
jump. Sophies jump can by modelled
by the equation h = -4.9t2 + 5.1t 2
and Noahs by the equation
h = -4.9(t - 0.5)2 + 5.3(t - 0.5). -4 -2 O 2 4 x
In both equations, t is the time in
seconds and h is the height in metres. b) Solve the system algebraically.
a) Solve the system graphically. What
are the coordinates of the point(s) Extended Response
of intersection? 11. Computer animators design game characters
b) Interpret to have many different abilities. The
the solution double-jump mechanic allows the character
in the context to do a second jump while in mid-air and
of this scenario. change its first trajectory to a new one.

D id Yo u Know ?

Canon is a choreographic form


where the dancers perform the
same movement beginning at
different times.
During a double jump, the first part of
the jump is modelled by the equation
h = -12.8d 2 + 6.4d, and the second
9. The perimeter of the rectangle is
part is modelled by the equation
represented by 8y metres and the
h = -_ 248
(d - 0.7)2 + 2. In both
area is represented by 15
(6y + 3) square metres. equations, d is the horizontal distance
and h is the height, in centimetres.
a) Solve the system of quadratic-quadratic
x+6
equations by graphing.
b) Interpret your solution.
x+8
12. The parabola y = -x2 + 4x + 26.5
a) Write two equations in terms of intersects the x-axis at points A and B.
x and y : one for the perimeter and The line y = 1.5x + 5.25 intersects the
one for the area of the rectangle. parabola at points A and C. Determine
b) Determine the perimeter and the approximate area of ABC.
the area. y

A B
0 x

460 MHR Chapter 8


Unit 4 Project
Nanotechnology
This part of your project will require you to be creative and to
use your math skills. Combining your knowledge of parabolas
and quadratic systems with the nanotechnology information you
have gathered in this chapter, you will design a futuristic version
of a every-day object. The object should have some linear and
parabolic design lines.

Chapter 8 Task
Choose an object that you feel could be improved using
nanotechnology. Look at the information presented in this
chapters Project Corners to give you ideas.
Explain how the object you have chosen will be enhanced
by using nanotechnology.
Create a new design for your chosen object. Your design
must include intersections of parabolic and linear design
curves.
Your design will inevitably go through a few changes
as you develop it. Keep a well-documented record of
the evolution of your design.
Select a part of your design that involves an intersection
of parabolas or an intersection of parabolas and lines.
Determine model equations for each function involved
in this part of your design.
Using these equations, determine any points of
intersection.
What is the relevance of the points of intersection
to the design of the object? How is it helpful to have
model equations and to know the coordinates of the
points of intersection?

Unit 4 Project MHR 461


CHAPTER

9 Linear and
Quadratic
Inequalities
The solution to a problem may be not a single
value, but a range of values. A chemical
engineer may need a reaction to occur within
a certain time frame in order to reduce
undesired pollutants. An architect may design
a building to deflect less than a given distance
in a strong wind. A doctor may choose a dose
of medication so that a safe but effective level
remains in the body after a specified time.

These situations illustrate the importance


of inequalities. While there may be many
acceptable values in each of the scenarios
above, in each case there is a lower acceptable
limit, an upper acceptable limit, or both. Even
though many solutions exist, we still need
accurate mathematical models and methods
to obtain the solutions.

We b Link
A small
mall number of mathematicians have earned the
distinction of having an inequality named for them.
To learn more about these special inequalities, go to
www.mhrprecalc11.ca and follow the links.

Key Terms
solution region test point
boundary

462 MHR Chapter 9


Career Link
Chemical engineers solve problems involving
chemical processes. They create and design
systems to improve processes or to make them
more helpful to people, the environment, or
both. Chemical engineers are often employed
by industry, government, and environmental
agencies. They may also work independently
as consultants. Engineers in this field are in
great demand and can find work worldwide.

We b Link
To learn
earn more about
a chemical engineering, go to
www.mhrprecalc11.ca and follow the links.

Chapter 9 MHR 463


9.1
Linear Inequalities
in Two Variables
Focus on . . .
explaining when a solid or a dashed line
should be used in the solution to an
inequality
explaining how to use test points to find
the solution to an inequality
sketching, with or without technology,
the graph of a linear inequality
solving a problem that involves a linear
inequality

How can you choose the correct amounts of two


items when both items are desirable? Suppose you want to take
music lessons, but you also want to work out at a local gym. Your
budget limits the amount you can spend. Solving a linear inequality
can show you the alternatives that will help you meet both your
musical and fitness goals and stay within your budget. Linear
inequalities can model this situation and many others that require
you to choose from combinations of two or more quantities.

Investigate Linear Inequalities

Materials Suppose that you have received a gift card for a music-downloading
grid paper service. The card has a value of $15. You have explored the Web site
straight edge and discovered that individual songs cost $1 each and a complete album
costs $5. Both prices include all taxes. Work with a partner to investigate
this situation.
1. List all possible combinations of songs and albums that you can
purchase if you spend all $15 of your gift card.
2. Let x represent the number of individual songs purchased and
y represent the number of albums purchased. Write a linear
equation in two variables to model the situation described in
step 1.
3. Plot the points from step 1 that represent the coordinates of a
combination of songs and albums that you can purchase for $15.
On the same coordinate grid, graph the linear equation from step 2.

464 MHR Chapter 9


4. List all possible combinations of songs and albums that you Is it convenient to find all
possible combinations this
can purchase for less than or equal to the total amount of your
way?
gift card.
5. Write a linear inequality in two variables to model the situation How is the value of the
described in step 4. gift card reflected in your
inequality?
6. Verify the combinations you found in step 4 by substituting
the values in the inequality you wrote in step 5.
7. Compare your work with that of another pair of students
to see if you agree on the possible combinations and the We b Link
inequality that models the situation. Linear
ear programming
programm
8. On the coordinate grid from step 3, plot each point that is a mathematical
method of finding
represents the coordinates of a combination of songs and the best solution to
albums that you can purchase for less than or equal to $15. a problem requiring
a combination of two
Reflect and Respond different items. Linear
programming is part
9. How does the graph show that it is possible to spend the entire of the mathematical
field of operations
value of the gift card? research. To learn
10. Consider the inequality you wrote in step 5. Is it represented on more about a career
as an operations
your graph? Explain. researcher, go to
11. How would your graph change if the variables How are the real www.mhrprecalc11.ca
numbers different from and follow the links.
x and y represented quantities that could be real
the whole numbers?
numbers, rather than whole numbers?

Link the Ideas

A linear inequality in two variables may be in one of the following


four forms:
Ax + By < C
Ax + By C
Ax + By > C
Ax + By C
where A, B, and C are real numbers.
An inequality in the two variables x and y describes a region in
the Cartesian plane. The ordered pair (x, y) is a solution to a linear
inequality if the inequality is true when the values of x and y are
substituted into the inequality. The set of points that satisfy a linear
inequality can be called the solution set, or solution region. solution region
all the points in the
Cartesian plane that
satisfy an inequality
also known as the
solution set

9.1 Linear Inequalities in Two Variables MHR 465


boundary The line related to the linear equality Ax + By = C, or boundary,
a line or curve that divides the Cartesian plane into two solution regions.
separates the Cartesian For one solution region, Ax + By > C is true.
plane into two regions For the other solution region, Ax + By < C is true.
may or may not be part
of the solution region
y
drawn as a solid line solution region
and included in the Ax + By > C
solution region if the
inequality involves
or
drawn as a dashed 0 x
line and not included in boundary
the solution region if Ax + By = C
the inequality involves solution region
< or > Ax + By < C

In your previous study of linear equations in two variables, the solution


was all the ordered pairs located on the graph of the line. The solution to a
linear inequality in two variables is a solution region that may or may not
include the line, depending on the inequality.

Example 1
Graph a Linear Inequality of the Form Ax + By C
a) Graph 2x + 3y 6.
b) Determine if the point (-2, 4) is part of the solution.

Solution
a) First, determine the boundary of the graph, and then determine which
region contains the solution.
There are several approaches to graphing the boundary.

Method 1: Solve for y


Solve the inequality for y in terms of x.
2x + 3y 6
3y -2x + 6
y -_ 2x + 2
3
Since the inequality symbol is , points on the boundary are included
in the solution. Use the slope of - _2 and the y-intercept of 2 to graph
3
the related line y = - _
2 x + 2 as a solid line.
3

466 MHR Chapter 9


Method 2: Use the Intercepts
Since the inequality symbol is , points on the boundary are included
in the solution.

Use the intercepts to graph the related line 2x + 3y = 6 as a solid line.


For x = 0: For y = 0:
2(0) + 3y = 6 2x + 3(0) = 6
3y = 6 2x = 6
y=2 x=3
Locate the points (0, 2) and (3, 0) and draw a line passing through them.

After graphing the boundary, select a test point from Why must the test point
each region to determine which contains the solution. test point not
a point not on the
be on the line?
boundary of the graph
For (0, 0): For (2, 4): of an inequality that
Left Side Right Side Left Side Right Side is representative of all
the points in a region
2x + 3y 6 2x + 3y 6
a point that is used to
= 2(0) + 3(0) = 2(2) + 3(4)
determine whether
=0 = 16 the points in a region
Left Side Right Side Left Side  Right Side satisfy the inequality

The point (0, 0) satisfies the inequality, so shade that region as


the solution region.

y
6
test points
(2, 4)
4
2x + 3y 6
2
solution region (0, 0)
-4
- 4 - -22 0 2 4 x

b) Determine if the point (-2, 4) is in the solution region.

Left Side Right Side


2x + 3y 6
= 2(-2) + 3(4)
= -4 + 12
=8
Left Side  Right Side
The point (-2, 4) is not part of the solution to the inequality
2x + 3y 6. From the graph of 2x + 3y 6, the point (-2, 4)
is not in the solution region.

Your Turn
a) Graph 4x + 2y 10.
b) Determine if the point (1, 3) is part of the solution.

9.1 Linear Inequalities in Two Variables MHR 467


Example 2
Graph a Linear Inequality of the Form Ax + By > C
Graph 10x - 5y > 0.

Solution
Solve the inequality for y in terms of x. Is there another way to
solve the inequality?
10x - 5y > 0
-5y > -10x
y < 2x Why is the inequality symbol reversed?

Graph the related line y = 2x as a broken, or dashed, line.


Use a test point from one region. Try (-2, 3).

Left Side Right Side


10x - 5y 0 Why is the point (0, 0) not
used as a test point this time?
= 10(-2) - 5(3)
= -20 - 15
= -35
Left Side Right Side
The point (-2, 3) does not satisfy the inequality. Shade the other
region as the solution region.

y
4

2 Why is the boundary


10x - 5y > 0
graphed with a dashed line?
-4 -2 0 2 4 x
-2
-2

Did Yo u Know ? Verify the solution region by using a test point in the shaded region.
Try (2, -3).
An open solution
region does not Left Side Right Side
include any of the 10x - 5y 0
points on the line = 10(2) - 5(-3)
that bounds it. A
= 20 + 15
closed solution region
includes the points on
= 35
the line that bounds it. Left Side > Right Side

The graph of the solution region is correct.

Your Turn
Graph 5x - 20y < 0.

468 MHR Chapter 9


Example 3
Write an Inequality Given Its Graph
Write an inequality to represent the graph.

y
4

4
-4
- 2 0
-2
- 2 4 x
-2

Solution
Write the equation of the boundary in slope-intercept form, y = mx + b.
The y-intercept is 1. So, b = 1.
Use the points (0, 1) and (1, 3) to determine that the slope, m, is 2.
y = 2x + 1
The boundary is a dashed line, so it is not part of the solution region.
Use a test point from the solution region to determine whether the
inequality symbol is > or <.
Try (-2, 4).

Left Side Right Side


y 2x + 1
=4 = 2(-2) + 1
= -3
Left Side > Right Side

An inequality that represents the graph is y > 2x + 1.

Your Turn
Write an inequality to represent the graph.

y
2

-4 -2 0 2 4 x
-2

-4

9.1 Linear Inequalities in Two Variables MHR 469


Example 4
Write and Solve an Inequality
Suppose that you are constructing a tabletop using aluminum and glass.
The most that you can spend on materials is $50. Laminated safety
glass costs $60/m2, and aluminum costs $1.75/ft. You can choose the
dimensions of the table and the amount of each material used. Find all
possible combinations of materials sufficient to make the tabletop.

Solution
Let x represent the area of glass used and y represent the length of
aluminum used. Then, the inequality representing this situation is
60x + 1.75y 50
Solve the inequality for y in terms of x.
60x + 1.75y 50
1.75y -60x + 50
y __
-60x + _ 50
1.75 1.75

Use graphing technology to graph the related line y = - _ 60 x + _ 50


1.75 1.75
as a solid line. Shade the region where a test point results in a true
statement as the solution region.

470 MHR Chapter 9


Examine the solution region.
You cannot have a negative amount of safety glass or aluminum.
Therefore, the domain and range contain only non-negative values.

The graph shows all possible combinations of glass and aluminum that
can be used for the tabletop. One possible solution is (0.2, 10). This
represents 0.2 m2 of the laminated safety glass and 10 ft of aluminum.

Your Turn
Use technology to find all possible combinations of tile and stone that
can be used to make a mosaic. Tile costs $2.50/ft2, stone costs $6/kg, and
the budget for the mosaic is $150.

Key Ideas

A linear inequality in two variables describes a region of the


Cartesian plane.
All the points in one solution region satisfy the inequality and make
up the solution region.
The boundary of the solution region is the graph of the related linear
equation.
 When the inequality symbol is or , the points on the boundary
are included in the solution region and the line is a solid line.
 When the inequality symbol is < or >, the points on the boundary
are not included in the solution region and the line is a dashed line.
Use a test point to determine which region is the solution region for
the inequality.

9.1 Linear Inequalities in Two Variables MHR 471


Check Your Understanding

Practise 5. Graph each inequality using technology.


1. Which of the ordered pairs are solutions to a) 6x - 5y 18
the given inequality?
b) x + 4y < 30
a) y < x + 3,
c) -5x + 12y - 28 > 0
{(7, 10), (-7, 10), (6, 7), (12, 9)}
d) x 6y + 11
b) -x + y -5,
{(2, 3), (-6, -12), (4, -1), (8, -2)} e) 3.6x - 5.3y + 30 4
c) 3x - 2y > 12, 6. Determine the solution to -5y x.
{(6, 3), (12, -4), (-6, -3), (5, 1)} 7. Use graphing technology to determine the
d) 2x + y 6, solution to 7x - 2y > 0.
{(0, 0), (3, 1), (-4, -2), (6, -4)} 8. Graph each inequality. Explain your choice
2. Which of the ordered pairs are not of graphing methods.
solutions to the given inequality?
a) 6x + 3y 21
a) y > -x + 1,
b) 10x < 2.5y
{(1, 0), (-2, 1), (4, 7), (10, 8)}
c) 2.5x < 10y
b) x + y 6,
{(2, 4), (-5, 8), (4, 1), (8, 2)} d) 4.89x + 12.79y 145
c) 4x - 3y < 10, e) 0.8x - 0.4y > 0
{(1, 3), (5, 1), (-2, -3), (5, 6)} 9. Determine the inequality that corresponds
d) 5x + 2y 9, to each graph.
{(0, 0), (3, -1), (-4, 2), (1, -2)} a) y
3. Consider each inequality. 4
Express y in terms of x, if necessary.
2
Identify the slope and the y-intercept.
Indicate whether the boundary should be x
4
-4
- 2 0
-2
- 2 4
a solid line or a dashed line.
-2
-2
a) y x + 3
-4
-4
b) y > 3x + 5
c) 4x + y > 7
b) y
d) 2x - y 10
4
e) 4x + 5y 20
f) x - 2y < 10 2

4. Graph each inequality without using


4
-4
- 2 0
-2
- 2 4 x
technology.
-2
-2
a) y -2x + 5
b) 3y - x > 8 -4
-4

c) 4x + 2y - 12 0
d) 4x - 10y < 40
e) x y - 6

472 MHR Chapter 9


c) y 12. The Alberta Foundation for the Arts
2 provides grants to support artists. The
Aboriginal Arts Project Grant is one of
4
-4
- 2 0
-2
- 2 4 x its programs. Suppose that Camille has
-2
-2 received a grant and is to spend at most
$3000 of the grant on marketing and
-4
-4 training combined. It costs $30/h to work
with an elder in a mentorship program and
d)
$50/h for marketing assistance.
y
a) Write an inequality to represent the
6
number of hours working with an elder
4 and receiving marketing assistance
that Camille can afford. Include any
2
restrictions on the variables.
2 0
-2
- 2 4 6 x b) Graph the inequality.

Apply
10. Express the solution to x + 0y > 0
graphically and in words.
11. Amaruq has a part-time job that pays her
$12/h. She also sews baby moccasins and
sells them for a profit of $12 each. Amaruq
wants to earn at least $250/week.

Mother Eagle by Jason Carter, artist chosen to


represent Alberta at the Vancouver 2010 Olympics.
a) Write an inequality that represents the Jason is a member of the Little Red River Cree Nation.
number of hours that Amaruq can work We b Link
and the number of baby moccasins she
To learn
earn more about
a the Alberta Foundation for
can sell to earn at least $250. Include the Arts, go to www.mhrprecalc11.ca and follow
any restrictions on the variables. the links.
b) Graph the inequality.
13. Mariya has purchased a new smart phone
c) List three different ordered pairs in
the solution. and is trying to decide on a service plan.
Without a plan, each minute of use costs
d) Give at least one reason that Amaruq
$0.30 and each megabyte of data costs
would want to earn income from her part-
$0.05. A plan that allows unlimited talk
time job as well as her sewing business,
and data costs $100/month. Under which
instead of focusing on one method only.
circumstances is the plan a better choice
for Mariya?

9.1 Linear Inequalities in Two Variables MHR 473


14. Suppose a designer is modifying the Extend
tabletop from Example 4. The designer 16. Drawing a straight line is not the only way
wants to replace the aluminum used in to divide a plane into two regions.
the table with a nanomaterial made from
a) Determine one other relation that when
nanotubes. The budget for the project
graphed divides the Cartesian plane
remains $50, the cost of glass is still
into two regions.
$60/m2, and the nanomaterial costs
$45/kg. Determine all possible combinations b) For your graph, write inequalities that
of material available to the designer. describe each region of the Cartesian
plane in terms of your relation. Justify
your answer.
c) Does your relation satisfy the definition
of a solution region? Explain.
17. Masha is a video game designer. She
treats the computer screen like a grid.
Each pixel on the screen is represented
by a coordinate pair, with the pixel in the
Multi-walled carbon nanotube bottom left corner of the screen as (0, 0).
15. Speed skaters spend many hours training For one scene in a game she is working on,
on and off the ice to improve their strength she needs to have a background like the
and conditioning. Suppose a team has a one shown.
monthly training budget of $7000. Ice rental (512, 768)
costs $125/h, and gym rental for strength
training costs $55/h. Determine the solution
region, or all possible combinations of (0, 384) (1024, 384)
training time that the
team can afford.

(0, 0) (512, 0)

The shaded region on the screen is made


up of four inequalities. What are the four
inequalities?

18. MINI LAB Work in small groups.


In April 2008, Manitoba Hydro agreed to
provide Wisconsin Public Service with up
to 500 MW (megawatts) of hydroelectric
power over 15 years, starting in 2018.
Hydroelectric projects generate the
Olympic gold medalist
Christine Nesbitt majority of power in Manitoba; however,
D id Yo u Know ? wind power is a method of electricity
generation that may become more
Canadian long-track and short-track speed skaters
common. Suppose that hydroelectric
won 10 medals at the 2010 Olympic Winter Games
power costs $60/MWh (megawatt hour) to
in Vancouver, part of an Olympic record for the most
gold medals won by a country in the history of the produce, wind power costs $90/MWh, and
Winter Games. the total budget for all power generation is
$35 000/h.

474 MHR Chapter 9


Step 1 Write the inequality that represents Create Connections
the cost of power generation. Let x 19. Copy and complete the following mind map.
represent the number of megawatt hours
of hydroelectric power produced. Let Linear Inequalities
y represent the number of megawatt
hours of wind power produced. Give an example
for each type of
Step 2 Graph and solve the inequality for linear inequality.
the cost of power generation given
the restrictions imposed by the
State the
hydroelectric agreement. Determine inequality sign.
the coordinates of the vertices of the
solution region. Interpret the intercepts
in the context of this situation. Is the boundary
solid or broken?
Step 3 Suppose that Manitoba Hydro can
sell the hydroelectric power for
Which region
$95/MWh and the wind power for do you shade?
$105/MWh. The equation
R = 95x + 105y gives the revenue,
20. The graph shows the solution to a linear
R, in dollars, from the sale of
inequality.
power. Use a spreadsheet to find the
revenue for a number of different
points in the solution region. Is it
possible to find the revenue for all
possible combinations of power
generation? Can you guarantee
that the point giving the maximum
possible revenue is shown on your
spreadsheet?
a) Write a scenario that has this region
as its solution. Justify your answer.
b) Exchange your scenario with a partner.
Verify that the given solution fits each
scenario.
21. The inequality 2x - 3y + 24 > 0, the
positive y-axis, and the negative x-axis
define a region in quadrant II.
Step 4 It can be shown that the maximum
revenue is always obtained from a) Determine the area of this region.
one of the vertices of the solution b) How does the area of this region depend
region. What combination of wind on the y-intercept of the boundary of
and hydroelectric power leads to the the inequality 2x - 3y + 24 > 0?
highest revenue? c) How does the area of this region depend
Step 5 With your group, discuss reasons that on the slope of the boundary of the
a combination other than the one that inequality 2x - 3y + 24 > 0?
produces the maximum revenue might d) How would your answers to parts b)
be chosen. and c) change for regions with the same
shape located in the other quadrants?

9.1 Linear Inequalities in Two Variables MHR 475


9.2
Quadratic Inequalities
in One Variable
Focus on . . .
developing strategies to solve quadratic inequalities in one
variable
modelling and solving problems using quadratic inequalities
interpreting quadratic inequalities to determine solutions
to problems

An engineer designing a roller coaster must know


the minimum speed required for the cars to stay
on the track. To determine this value, the engineer
can solve a quadratic inequality. While infinitely
many answers are possible, it is important that the
engineer be sure that the speed of the car is in the
solution region.
A bicycle manufacturer must know the maximum
distance the rear suspension will travel when
going over rough terrain. For many bicycles,
the movement of the rear wheel is described
by a quadratic equation, so this problem
requires the solution to a quadratic inequality. Solving quadratic
inequalities is important to ensure that the manufacturer can reduce
warranty claims.

Investigate Quadratic Inequalities

Materials 1. Consider the quadratic inequalities x2 - 3x - 4 > 0 and


grid paper x2 - 3x - 4 < 0.
coloured pens, pencils, a) Use the graph of the corresponding function f (x) = x2 - 3x - 4
or markers to identify the zeros of the function.
f(x) The x-axis is divided
into three sections
by the parabola.
2
What are the three
sections?
-2 0 2 4 6 x
-2

-4

-6
f(x) = x2 - 3x - 4

476 MHR Chapter 9


b) Identify the x-values for which the inequality x2 - 3x - 4 > 0
is true.
c) Identify the x-values for which the inequality x2 - 3x - 4 < 0
is true.
2. Consider the quadratic inequality x2 - x - 6 < 0.
a) Graph the corresponding quadratic function f (x) = x2 - x - 6.
b) How many zeros does the function have?
c) Colour the portion of the x-axis for which the inequality
x2 - x - 6 < 0 is true.
d) Write one or more inequalities to represent the values of x
for which the function is negative. Show these values on a
number line.
3. Consider the quadratic inequality x2 - 4x + 4 > 0. D i d You K n ow?
a) Graph the corresponding quadratic function f (x) = x2 - 4x + 4. Babylonian
b) How many zeros does the function have? mathematicians were
among the rst to
c) Colour the portion of the x-axis for which the inequality solve quadratics.
x2 - 4x + 4 > 0 is true. However, they had
no notation for
d) Write one or more inequalities to represent the values of x
variables, equations,
for which the function is positive. Show these values on a
or inequalities, and
number line. did not understand
negative numbers.
Reflect and Respond It was more than
1500 years before
4. a) Explain how you arrived at the inequalities in steps 2d) and 3d). notation was
b) What would you look for in the graph of the related function developed.
when solving a quadratic inequality of the form ax2 + bx + c > 0
or ax2 + bx + c < 0?

Link the Ideas

You can write quadratic inequalities in one variable in one of the


following four forms:
ax2 + bx + c < 0
ax2 + bx + c 0
ax2 + bx + c > 0
ax2 + bx + c 0
where a, b, and c are real numbers and a 0.
You can solve quadratic inequalities graphically or algebraically. The
solution set to a quadratic inequality in one variable can have no values,
one value, or an infinite number of values.

9.2 Quadratic Inequalities in One Variable MHR 477


Example 1
Solve a Quadratic Inequality of the Form ax2 + bx + c 0, a > 0
Solve x2 - 2x - 3 0.

Solution
Method 1: Graph the Corresponding Function
Graph the corresponding function f(x) = x2 - 2x - 3.
To determine the solution to x2 - 2x - 3 0, look for the values
of x for which the graph of f (x) lies on or below the x-axis.

f(x)
2

What strategies can you use to


-4 -2 0 2 4 6 x sketch the graph of a quadratic
-2 function in standard form?

-4
f(x) = x2 - 2x - 3
-6

The parabola lies on the x-axis at x = -1 and x = 3. The graph lies


below the x-axis between these values of x. Therefore, the solution
set is all real values of x between -1 and 3, inclusive, or
{x | -1 x 3, x R}.
Method 2: Roots and Test Points
Solve the related equation x2 - 2x - 3 = 0 to find the roots. Then,
use a number line and test points to determine the intervals that
satisfy the inequality.
x2 - 2x - 3 = 0
(x + 1)(x - 3) = 0
x + 1 = 0 or x - 3 = 0
x = -1 x=3
Plot -1 and 3 on a number line. Use closed circles since these values
are solutions to the inequality.
x < -1 -1 < x < 3 x>3

-4 -3 -2 -1 0 1 2 3 4 5 6

Does it matter which The x-axis is divided into three intervals by the roots of the equation.
values you choose as Choose one test point from each interval, say -2, 0, and 5. Then,
test points?
substitute each value into the quadratic inequality to determine
Are there any values that whether the result satisfies the inequality.
you should not choose?

478 MHR Chapter 9


Use a table to organize the results.

Interval x < -1 -1 < x < 3 x>3


Test Point -2 0 5
Substitution (-2) - 2(-2) - 3
2
0 - 2(0) - 3
2
5 - 2(5) - 3
2

=4+4-3 =0+0-3 = 25 - 10 - 3
=5 = -3 = 12
Is x2 - 2x - 3 0? no yes no

The values of x between -1 and 3 also satisfy the inequality.


The value of x2 - 2x - 3 is negative in the interval -1 < x < 3.
The solution set is {x | -1 x 3, x R}.

-4 -3 -2 -1 0 1 2 3 4 5 6

Method 3: Case Analysis


Factor the quadratic expression to rewrite the inequality
as (x + 1)(x - 3) 0.
The product of two factors is negative when the factors have different
signs. There are two ways for this to happen.
Case 1: The first factor is negative and the second factor is positive.
x + 1 0 and x - 3 0
Solve these inequalities to obtain x -1 and x 3.

-1

3
Any x-values that satisfy both conditions are part of Why are there no
the solution set. There are no values that make both values that make both
inequalities true?
of these inequalities true.
Case 2: The first factor is positive and the second factor is negative.
x + 1 0 and x - 3 0
Solve these inequalities to obtain x -1 and x 3.

The dashed lines indicate


-1 that -1 x 3 is
common to both.
3

These inequalities are both true for all values How would the steps in
between -1 and 3, inclusive. this method change if the
original inequality were
The solution set is {x | -1 x 3, x R}. x2 - 2x - 3 0?

Your Turn
Solve x2 - 10x + 16 0 using two different methods.

9.2 Quadratic Inequalities in One Variable MHR 479


Example 2
Solve a Quadratic Inequality of the Form ax2 + bx + c < 0, a < 0
Solve -x2 + x + 12 < 0.

Solution
Method 1: Roots and Test Points
Solve the related equation -x2 + x + 12 = 0 to find the roots.
-x2 + x + 12 =0
-1(x2 - x - 12) =0
-1(x + 3)(x - 4) =0
x + 3 = 0 or x-4=0
x = -3 x=4
Plot -3 and 4 on a number line.
Use open circles, since these values are not solutions to the inequality.
x < -3 -3 < x < 4 x>4

-4 -3 -2 -1 0 1 2 3 4 5 6

Choose a test point from each of the three intervals, say -5, 0, and 5, to
determine whether the result satisfies the quadratic inequality.
Use a table to organize the results.
Interval x < -3 -3 < x < 4 x>4
Test Point -5 0 5
Substitution -(-5)2 + (-5) + 12 -02 + 0 + 12 -52 + 5 + 12
= -25 - 5 + 12 = 0 + 0 + 12 = -25 + 5 + 12
= -18 = 12 = -8
Is -x2 + x + 12 < 0? yes no yes

The values of x less than -3 or greater than 4 satisfy the inequality.


The solution set is {x | x < -3 or x > 4, x R}.

-4 -3 -2 -1 0 1 2 3 4 5 6

480 MHR Chapter 9


Method 2: Sign Analysis
Factor the quadratic expression to rewrite the inequality
as -1(x + 3)(x - 4) < 0.
Determine when each of the factors, -1(x + 3) and x + 4, is positive, Since -1 is a constant
zero, or negative. factor, combine it with
(x + 3) to form one factor.
Substituting -4 in -1(x + 3) results in a positive value (+).
-1(-4 + 3) = -1(-1)
=1
Substituting -3 in -1(x + 3) results in a value of zero (0).
-1(-3 + 3) = -1(0)
=0
Substituting 1 in -1(x + 3) results in a negative value (-).
-1(1 + 3) = -1(4)
=1
Sketch number lines to show the results.
+ 0 - -
-1(x + 3)
-3

- - 0 +
x-4
4

- 0 + 0 -
-1(x + 3)(x - 4)
-3 4

From the number line representing the product, the values of x less
than -3 or greater than 4 satisfy the inequality -1(x + 3)(x - 4) < 0.
The solution set is {x | x < -3 or x > 4, x R}.

Your Turn
Solve -x2 + 3x + 10 < 0 using two different methods.

9.2 Quadratic Inequalities in One Variable MHR 481


Example 3
Solve a Quadratic Inequality in One Variable
Solve 2x2 - 7x > 12.

Solution
Why is it important to
rewrite the inequality First, rewrite the inequality as 2x2 - 7x - 12 > 0.
with 0 on one side of the
inequality?
Solve the related equation 2x2 - 7x - 12 = 0 to find the roots.
Use the quadratic formula with a = 2, b = -7, and c = -12.
Why use the quadratic
________
formula in this case?
x= ___
-b b2 - 4ac
2a
_________________

x= ______
-(-7) (-7)2 - 4(2)(-12)
____ 2(2)
x= __
7 145
4 ____ ____
x= __
7 + 145
or x = __
7 - 145
4 4
x 4.8 x -1.3
Use a number line and test points.
x < -1.3 -1.3 < x < 4.8 x > 4.8

-4 -3 -2 -1 0 1 2 3 4 5 6

Choose a test point from each of the three intervals, say -3, 0, and 6, to
determine whether the results satisfy the original quadratic inequality.
Use a table to organize the results.
____ ____ ____ ____

Interval x<
__
7 - 145 __
7 - 145
<x<
__
7 + 145
x>
__
7 + 145
4 4 4 4
Test Point -3 0 6
Substitution 2(-3) - 7(-3)
2
2(0) - 7(0)
2
2(6) - 7(6)
2

= 18 + 21 =0+0 = 72 - 42
= 39 =0 = 30
Is 2x2 - 7x > 12? yes no yes

Therefore, the exact solution set____


is
____
{x | x < __ or x > __ , x R . }
7 - 145
7 + 145

4 4

7 - 145
__________ 7 + 145
__________
-1.3 4.8
4 4 Can you solve this
inequality using sign
-4 -3 -2 -1 0 1 2 3 4 5 6 analysis and case analysis?

Your Turn
Solve x2 - 4x > 10.

482 MHR Chapter 9


Example 4
Apply Quadratic Inequalities
If a baseball is thrown at an initial speed of 15 m/s Why is the quadratic
from a height of 2 m above the ground, the inequality expression greater
than zero?
-4.9t2 + 15t + 2 > 0 models the time, t, in seconds,
that the baseball is in flight. During what time
interval is the baseball in flight?

Solution
The baseball will be in flight from the time it is thrown until it lands on
the ground.
Graph the corresponding quadratic function and determine the
coordinates of the x-intercepts and the y-intercept.

Why is it useful to know the


y-intercept of the graph in
this case?

The graph of the function lies on or above the x-axis for values of x
between approximately -0.13 and 3.2, inclusive. However, you cannot
have a negative time that the baseball will be in the air.
The solution set to the problem is {t | 0 < t < 3.2, t R}. In other words,
the baseball is in flight between 0 s and approximately 3.2 s after it
is thrown.

Your Turn We b Link


Suppose a baseball is thrown from a height of 1.5 m. The inequality To learn
earn about
-4.9t2 + 17t + 1.5 > 0 models the time, t, in seconds, that the baseball is baseball in
Canada, go to
in flight. During what time interval is the baseball in flight?
www.mhrprecalc11.ca
and follow the links.

9.2 Quadratic Inequalities in One Variable MHR 483


Key Ideas

The solution to a quadratic inequality in one variable is a set of values.


To solve a quadratic inequality, you can use one of the following strategies:
 Graph the corresponding function, and identify the values of x for which
the function lies on, above, or below the x-axis, depending on the inequality
symbol.
 Determine the roots of the related equation, and then use a number line and
test points to determine the intervals that satisfy the inequality.
 Determine when each of the factors of the quadratic expression is positive,
zero, or negative, and then use the results to determine the sign of the product.
 Consider all cases for the required product of the factors of the quadratic
expression to find any x-values that satisfy both factor conditions in each case.
For inequalities with the symbol or , include the x-intercepts in the
solution set.

Check Your Understanding

Practise 2. Consider the graph of the quadratic


1. Consider the graph of the quadratic function g(x) = -x2 + 4x - 4.
function f(x) = x2 - 4x + 3. g(x)

f(x) 2
g(x) = -x2 + 4x - 4
8
-2 0 2 4 6 x
6 -2

4 -4

2 -6

-2 0 2 4 6 x
-2
What is the solution to
f(x) = x2 - 4x + 3
a) -x2 + 4x - 4 0?
b) -x2 + 4x - 4 0?
What is the solution to
c) -x2 + 4x - 4 > 0?
a) x2 - 4x + 3 0?
d) -x2 + 4x - 4 < 0?
b) x2 - 4x + 3 0?
3. Is the value of x a solution to the given
c) x2 - 4x + 3 > 0?
inequality?
d) x2 - 4x + 3 < 0?
a) x = 4 for x2 - 3x - 10 > 0
b) x = 1 for x2 + 3x - 4 0
c) x = -2 for x2 + 4x + 3 < 0
d) x = -3 for -x2 - 5x - 4 0

484 MHR Chapter 9


4. Use roots and test points to determine the Apply
solution to each inequality. 10. Each year, Dauphin, Manitoba, hosts the
a) x(x + 6) 40 largest ice-fishing contest in Manitoba.
Before going on any ice, it is important
b) -x2 - 14x - 24 < 0
to know that the ice is thick enough to
c) 6x2 > 11x + 35 support the intended load. The solution
d) 8x + 5 -2x2 to the inequality 9h2 750 gives the
thickness, h, in centimetres, of ice that
5. Use sign analysis to determine the solution
will support a vehicle of mass 750 kg.
to each inequality.
a) x2 + 3x 18
b) x2 + 3 -4x
c) 4x2 - 27x + 18 < 0
d) -6x x2 - 16
6. Use case analysis to determine the solution
to each inequality.
a) x2 - 2x - 15 < 0
b) x2 + 13x > -12
c) -x2 + 2x + 5 0
d) 2x2 8 - 15x
7. Use graphing to determine the solution to a) Solve the inequality to determine the
each inequality. minimum thickness of ice that will
a) x2 + 14x + 48 0 safely support the vehicle.
b) Write a new inequality, in the form
b) x2 3x + 28
9h2 mass, that you can use to find
c) -7x2 + x - 6 0 the ice thickness that will support a
d) 4x(x - 1) > 63 mass of 1500 kg.
8. Solve each of the following inequalities. c) Solve the inequality you wrote in
Explain your strategy and why you part b).
chose it. d) Why is the thickness of ice required to
2
a) x - 10x + 16 < 0 support 1500 kg not twice the thickness
needed to support 750 kg? Explain.
b) 12x2 - 11x - 15 0
c) x2 - 2x - 12 0 D i d You K n ow ?

d) x2 - 6x + 9 > 0 Conservation efforts at Dauphin Lake, including


habitat enhancement, stocking, and education, have
9. Solve each inequality. resulted in sustainable sh stocks and better shing
a) x2 - 3x + 6 10x for anglers.

b) 2x2 + 12x - 11 > x2 + 2x + 13


c) x2 - 5x < 3x2 - 18x + 20
d) -3(x2 + 4) 3x2 - 5x - 68

9.2 Quadratic Inequalities in One Variable MHR 485


11. Many farmers in Southern Alberta irrigate c) Write and solve a similar inequality to
their crops. A centre-pivot irrigation determine when carbon fibre prices will
system spreads water in a circular pattern drop below $5/kg.
over a crop.

D i d You K n ow ?

Carbon bre is prized for its high strength-to-mass


ratio. Prices for carbon bre were very high when the
technology was new, but dropped as manufacturing
methods improved.

13. One leg of a right triangle is 2 cm longer


than the other leg. How long should the
shorter leg be to ensure that the area of the
triangle is greater than or equal to 4 cm2?

a) Suppose that Murray has acquired


Extend
14. Use your knowledge of the graphs of
rights to irrigate up to 63 ha (hectares)
of his land. Write an inequality to quadratic functions and the discriminant
model the maximum circular area, in to investigate the solutions to the quadratic
square metres, that he can irrigate. inequality ax2 + bx + c 0.

b) What are the possible radii of circles a) Describe all cases where all real
that Murray can irrigate? Express your numbers satisfy the inequality.
answer as an exact value. b) Describe all cases where exactly one
c) Express your answer in part b) to the real number satisfies the inequality.
nearest hundredth of a metre. c) Describe all cases where infinitely many
D id Yo u Know ?
real numbers satisfy the inequality and
infinitely many real numbers do not
The hectare is a unit of area dened as 10 000 m2. satisfy the inequality.
It is primarily used as a measurement of land area.
15. For each of the following, give an
12. Suppose that an engineer determines that
inequality that has the given solution.
2
she can use the formula -t + 14 P to a) -2 x 7
estimate when the price of carbon fibre b) x < 1 or x > 10
will be P dollars per kilogram or less in
t years from the present. c) _5 x 6
3
a) When will carbon fibre be available at d) x < -_3 or x > - _
1
$10/kg or less? 4 __
5 __
e) x -3 - 7 or x -3 +
7
b) Explain why some of the values of t that
satisfy the inequality do not solve the f) x R
problem. g) no solution

486 MHR Chapter 9


16. Solve |x2 - 4| 2. 19. Compare and contrast the methods of
17. The graph shows the solution to the graphing, roots and test points, sign
2
inequality -x + 12x + 16 -x + 28. analysis, and case analysis. Explain which
of the methods you prefer to use and why.
20. Devan needs to solve x2 + 5x + 4 -2.
His solutions are shown.
Devans solution:
Begin by rewriting the inequality: x2 + 5x + 6 0
Factor the left side: (x + 2)(x + 3) 0. Then,
consider two cases:

a) Why is 1 x 12 the solution to the Case 1:


inequality? (x + 2) 0 and (x + 3) 0
Then, x -2 and x -3, so the solution is x -3.
b) Rearrange the inequality so that it has
the form q(x) 0 for a quadratic q(x). Case 2:
c) Solve the inequality you determined in
(x + 2) 0 and (x + 3) 0
part b). Then, x -2 and x -3, so the solution is x -2.

d) How are the solutions to parts a) and c) From the two cases, the solution to the inequality
related? Explain. is x -3 or x -2.
a) Decide whether his solution is correct.
Create Connections Justify your answer.
18. In Example 3, the first step in the b) Use a different method to confirm the
solution was to rearrange the inequality correct answer to the inequality.
2x2 - 7x > 12 into 2x2 - 7x - 12 > 0.
Which solution methods require this first
step and which do not? Show the work
that supports your conclusions.

Project Corner Financial Considerations

Currently, the methods of nanotechnology


in several fields are very expensive.
However, as is often the case, it is
expected that as technology improves,
the costs will decrease. Nanotechnology
seems to have the potential to decrease
costs in the future. It also promises greater
flexibility and greater precision in the
manufacturing of goods.
What changes in manufacturing might
help lower the cost of nanotechnology?

9.2 Quadratic Inequalities in One Variable MHR 487


9.3
Quadratic Inequalities
in Two Variables
Focus on . . .
explaining how to use test points to find the
solution to an inequality
explaining when a solid or a dashed
line should be used in the solution to
an inequality
sketching, with or without technology, the
graph of a quadratic inequality
solving a problem that involves a
quadratic inequality

An arch is a common way to


span a doorway or window. A
parabolic arch is the strongest
possible arch because the arch
is self-supporting. This is because the shape of the arch causes the force
of gravity to hold the arch together instead of pulling the arch apart.
There are many things to consider when designing an arch. One
important decision is the height of the space below the arch. To ensure
that the arch is functional, the designer can set up and solve a quadratic
inequality in two variables. Quadratic inequalities are applied in physics,
engineering, architecture, and many other fields.

Investigate Quadratic Inequalities in Two Variables

Materials 1. Sketch the graph of the function y = x2.


grid paper 2. a) Label four points on the graph and copy and complete
coloured pens, pencils, the table for these points. One has been done for you.
or markers
x y Satisfies the Equation y = x2?
3 9 9 = 32 Yes

b) What can you conclude about the points that lie on


the parabola?

488 MHR Chapter 9


3. The parabola that you graphed in step 1 divides the Cartesian
plane into two regions, one above and one below the parabola.
a) In which of these regions do you think the solution set for
y < x2 lies?
b) Plot four points in this region of the plane and create a table
similar to the one in step 2, using the heading Satisfies the
Inequality y < x2? for the last column.
4. Were you correct in your thinking of which region the solution set
for y < x2 lies in? How do you know?
5. Shade the region containing the solution set for the inequality y < x2.
6. a) In which region does the solution set for y > x2 lie?
b) Plot four points in this region of the plane and create a table
similar to the one in step 2, using the heading Satisfies the
Inequality y > x2? for the last column.
7. Did the table verify the region you chose for the set of points that
satisfy y > x2?
8. Shade the region containing the solution set for the inequality y > x2.

Reflect and Respond


9. Why is a shaded region used to represent the solution sets in steps 5
and 8?
10. Make a conjecture about how you can identify the solution region of
the graph of a quadratic inequality.
11. Under what conditions would the graph of the function be part of the
solution region for a quadratic inequality?

Link the Ideas

You can express a quadratic inequality in two variables in one of the


following four forms:
y < ax2 + bx + c
y ax2 + bx + c
y > ax2 + bx + c
y ax2 + bx + c
where a, b, and c are real numbers and a 0.
A quadratic inequality in two variables represents a region of the
Cartesian plane with a parabola as the boundary. The graph of a quadratic
inequality is the set of points (x, y) that are solutions to the inequality.

9.3 Quadratic Inequalities in Two Variables MHR 489


Consider the graph of y < x2 - 2x - 3.

y
2

2 0
-2
- 2 4 6 x
2
-2
-

-4
-4
y = x2 - 2x - 3
6
-6
-

The boundary is the related parabola y = x2 - 2x - 3. Since the


inequality symbol is <, points on the boundary line are not included in
the solution region, so the curve is drawn as a dashed line.
To determine which region is the solution region, choose a test point
from either above or below the parabola. If the coordinates of the test
point satisfy the inequality, then shade the region containing the test
point. If the coordinates do not satisfy the inequality, then shade the
region that does not contain the test point.
Try (0, 0), which is above the parabola.
Left Side Right Side
y x2 - 2x - 3
=0 = 02 - 2(0) - 3
= -3
Left Side Right Side
The point (0, 0) does not satisfy the inequality. Thus, shade the region
below the parabola.

Example 1
Graph a Quadratic Inequality in Two Variables With a < 0
a) Graph y < -2(x - 3)2 + 1.
b) Determine if the point (2, -4) is a solution to the inequality.

Solution
How can you use the a) Graph the related parabola y = -2(x - 3)2 + 1. Since the inequality
values of a, p, and q to symbol is <, draw the parabola as a dashed line, indicating that it is
graph the parabola?
not part of the solution.
Use test points to decide which of the two regions contains the
solutions to the inequality.

490 MHR Chapter 9


Choose (0, 0) and (3, -3).
Left Side Right Side Left Side Right Side
y -2(x - 3)2 + 1 y -2(x - 3)2 + 1
=0 = -2(0 - 3)2 + 1 = -3 = -2(3 - 3)2 + 1
= -18 + 1 =0+1
= -17 =1
Left Side Right Side Left Side < Right Side
The point (3, -3) satisfies the inequality, so shade the region below
the parabola.
y
y < -2(x - 3)2 + 1
2

-2 0 2 4 6 x
-2
(3, -3)
-4

-6

-8

b) From the graph of y < -2(x - 3)2 + 1, the point (2, -4) is in
the solution region. It is part of the solution to the inequality
y < -2(x - 3)2 + 1. Verify this by substituting in the inequality.

Left Side Right Side


y -2(x - 3)2 + 1
= -4 = -2(2 - 3)2 + 1
= -2 + 1
= -1
Left Side < Right Side

Your Turn
a) Graph y > (x - 4)2 - 2.
b) Determine if the point (2, 1) is a solution to the inequality.

9.3 Quadratic Inequalities in Two Variables MHR 491


Example 2
Graph a Quadratic Inequality in Two Variables With a > 0
Graph y x2 - 4x - 5.

Solution
Graph the related parabola y = x2 - 4x - 5. Since the inequality symbol
is , points on the parabola are included in the solution. Draw the
parabola using a solid line.
Use a test point from one region to decide whether that region contains
the solutions to the inequality.
Choose (0, 0).
Left Side Right Side
y x2 - 4x - 5
=0 = 02 - 4(0) - 5
=0-0-5
= -5
Left Side Right Side
The point (0, 0) satisfies the inequality, so shade the region above
the parabola.
y
y x2 - 4x - 5
2

-2 0 2 4 6 x
2
-2

4
-4

-6

-8

Your Turn
Graph y -x2 + 2x + 4.

492 MHR Chapter 9


Example 3
Determine the Quadratic Inequality That Defines a Solution Region
You can use a parabolic reflector to focus sound, light, or
radio waves to a single point. A parabolic microphone has
a parabolic reflector attached that directs incoming sounds
to the microphone. Ren, a journalist, is using a parabolic
microphone as he covers the Francophone Summer Festival
of Vancouver. Describe the region that Ren can cover with
his microphone if the reflector has a width of 50 cm and a
maximum depth of 15 cm.

Solution
Method 1: Describe Graphically
Draw a diagram and label it with the given information.
Let the origin represent the vertex
of the parabolic reflector.
Let x and y represent the horizontal and vertical distances, in
centimetres, from the low point in the centre of the parabolic
reflector.
50 cm
D i d You K n ow ?
(-25, 15) y (25, 15)
A parabolic reector can be used to
15 cm collect and concentrate energy entering
the reector. A parabolic reector causes
x incoming rays in the form of light, sound,
(0, 0)
or radio waves, that are parallel to the axis
of the dish, to be reected to a central
point called the focus. Similarly, energy
radiating from the focus to the dish can
From the graph, the region covered lies between -25 cm to
be transmitted outward in a beam that is
+25 cm because of the width of the microphone.
parallel to the axis of the dish.
Method 2: Describe Algebraically y
You can write a quadratic function to represent a parabola if
you know the coordinates of the vertex and one other point.
F P3
Since the vertex is (0, 0), the function is of the form y = ax2. P2
V P1 x
Substitute the coordinates of the top of one edge of the
parabolic reflector, (25, 15), and solve to find a = _3 .
125
y=_ 3 x2
125

9.3 Quadratic Inequalities in Two Variables MHR 493


The microphone picks up sound from the space above the graph of
the quadratic function. So, shade the region above the parabola.

y
2
20 3
y ___ x2 Why is the reflector
125 represented by a solid
10
10 curve rather than a
broken curve?
-20 -10 0 10 20 x
-10

However, the maximum scope is from -25 to +25 because of the


width of the microphone. So, the domain of the region covered by the
microphone is restricted to {x | -25 x 25, x R}.
Use a test point from the solution region to verify the inequality symbol.
Choose the point (5, 5).
Left Side Right Side
y _3 x2
125
=_
=5 3 (5)2
125
=_3
5
Left Side Right Side

The region covered by the microphone can be described by the quadratic


inequality y _3 x2, where -25 x 25.
125

Your Turn
A satellite dish is 60 cm
in diameter and 20 cm
deep. The dish has a
parabolic cross-section.
Locate the vertex of the
parabolic cross-section
at the origin, and sketch
the parabola that
represents the dish.
Determine an inequality
that shows the region
from which the dish
can receive a signal.

494 MHR Chapter 9


Example 4
Interpret the Graph of an Inequality in a Real-World Application
Samia and Jerrod want to learn the exhilarating sport
of alpine rock climbing. They have enrolled in one
of the summer camps at the Cascade Mountains in
southern British Columbia. In the brochure, they come
across an interesting fact about the manila rope that is
used for rappelling down a cliff. It states that the rope
can safely support a mass, M, in pounds, modelled by
the inequality M 1450d 2, where d is the diameter of
the rope, in inches. Graph the inequality to examine
how the mass that the rope supports is related to the
diameter of the rope.

Solution
Graph the related parabola M = 1450d 2.
Since the inequality symbol is , use a solid line for
the parabola.
Shade the region below the parabola since the
inequality is less than.

Verify the solution region using the test point (2, 500). D i d You K n ow?

Left Side Right Side Manila rope is a type


M 1450d 2 of rope made from
= 500 = 1450(2)2 manila hemp. Manila
= 5800 rope is used by rock
climbers because it
Left Side Right Side
is very durable and
Examine the solution. exible.

You cannot have a negative value for the diameter of the rope or the
mass. Therefore, the domain is {d | d 0, d R} and the range is
{M | M 0, M R}.
One solution is (1.5, 1000). This means that a rope with a diameter
of 1.5 in. will support a weight of 1000 lb.

9.3 Quadratic Inequalities in Two Variables MHR 495


Your Turn
Sports climbers use a rope that is longer and supports less mass than
manila rope. The rope can safely support a mass, M, in pounds, modelled
by the inequality M 1240(d - 2)2, where d is the diameter of the rope,
in inches. Graph the inequality to examine how the mass that the rope
supports is related to the diameter of the rope.

Key Ideas

A quadratic inequality in two variables represents a region of the Cartesian


plane containing the set of points that are solutions to the inequality.
The graph of the related quadratic function is the boundary that divides the
plane into two regions.
 When the inequality symbol is or , include the points on the boundary
in the solution region and draw the boundary as a solid line.
 When the inequality symbol is < or >, do not include the points on the
boundary in the solution region and draw the boundary as a dashed line.
Use a test point to determine the region that contains the solutions to the
inequality.

Check Your Understanding

Practise 2. Which of the ordered pairs are not


1. Which of the ordered pairs are solutions to solutions to the inequality?
the inequality? a) y 2(x - 1)2 + 1,
a) y < x2 + 3, {(0, 1), (1, 0), (3, 6), (-2, 15)}
{(2, 6), (4, 20), (-1, 3), (-3, 12)} b) y > -(x + 2)2 - 3,
b) y -x2 + 3x - 4, {(-3, 1), (-2, -3), (0, -8), (1, 2)}
{(2, -2), (4, -1), (0, -6), (-2, -15)}
c) y _1 (x - 4)2
+ 5,
2 2
c) y > 2x + 3x + 6,
{(0, 4), (3, 1), (4, 5), (2, 9)}
{(-3, 5), (0, -6), (2, 10), (5, 40)}
_2
d) y - _ x2 - x + 5,
1 d) y < - (x + 3)2 - 2,
3
2 {(-2, 2), (-1, -5), (-3, -2), (0, -10)}
{(-4, 2), (-1, 5), (1, 3.5), (3, 2.5)}

496 MHR Chapter 9


3. Write an inequality to describe each graph, 4. Graph each quadratic inequality using
given the function defining the boundary transformations to sketch the boundary
parabola. parabola.
a) y = -x2 - 4x + 5 y a) y 2(x + 3)2 + 4
8 _1
b) y > - (x - 4)2 - 1
2
6 c) y < 3(x + 1)2 + 5

4 d) y _1 (x - 7)
2
-2
4
2 5. Graph each quadratic inequality using
points and symmetry to sketch the
-6 4
-4
- 2 0
-2
- 2 x boundary parabola.
-2
-2 a) y < -2(x - 1)2 - 5
b) y > (x + 6)2 + 1
b) y c) y _2 (x - 8) 2
3
y_
8 1 (x + 7)
2
d) -4
2
6
6. Graph each quadratic inequality.
4 a) y x2 + x - 6
2 1 b) y > x2 - 5x + 4
y = _ x2 - x + 3
2
c) y x2 - 6x - 16
2 0
-2
- 2 4 6 x
d) y < x2 + 8x + 16
7. Graph each inequality using graphing
c) y
technology.
6
1 a) y < 3x2 + 13x + 10
y = - _ x2 - x + 3
4 4 b) y -x2 + 4x + 7
2 c) y x2 + 6
d) y > -2x2 + 5x - 8
-6
- -4 -2 0 2 x
8. Write an inequality to describe each graph.
-2
a) y
6
d) y
4
2
2
-6 -4 2 0
-2 2 x
2
-2
- -4 -2 0 2 4 x

-4
-4
b) y
-6
-6 2
y = 4x2 + 5x - 6
-8
-4 -2 0 2 4 6x
-2

-4

9.3 Quadratic Inequalities in Two Variables MHR 497


Apply 11. The University Bridge in Saskatoon is
9. When a dam is built across a river, it supported by several parabolic arches.
is often constructed in the shape of a The diagram shows how a Cartesian plane
parabola. A parabola is used so that the can be applied to one arch of the bridge.
force that the river exerts on the dam helps The function y = -0.03x2 + 0.84x - 0.08
hold the dam together. Suppose a dam is to approximates the curve of the arch, where
be built as shown in the diagram. x represents the horizontal distance from
the bottom left edge and y represents the
y
height above where the arch meets the
8
Dam vertical pier, both in metres.
(50, 4)
4
(100, 0)
(0, 0)

0 20 40 60 80 100 120 x

y
a) What is the quadratic function that
models the parabolic arch of the dam?
b) Write the inequality that approximates
the region below the parabolic arch of
the dam.
y = -0.03x2 + 0.84x - 0.08
D id Yo u Know ?
0 x
The Mica Dam, which spans the Columbia River near
Revelstoke, British Columbia, is a parabolic dam that
provides hydroelectric power to Canada and parts of
the United States.

10. In order to get the longest possible jump,


ski jumpers need to have as much lift area, a) Write the inequality that approximates
L, in square metres, as possible while in the possible water levels below the
the air. One of the many variables that parabolic arch of the bridge.
influences the amount of lift area is the b) Suppose that the normal water level of
hip angle, a, in degrees, of the skier. The the river is at most 0.2 m high, relative
relationship between the two is given by to the base of the arch. Write and solve
L -0.000 125a2 + 0.040a - 2.442. an inequality to represent the normal
a) Graph the quadratic inequality. river level below the arch.
b) What is the range c) What is the width of the river under
of hip angles that the arch in the situation described in
will generate lift part b)?
area of at least
0.50 m2?

Canadian ski jumper


Stefan Read

498 MHR Chapter 9


12. In order to conduct microgravity 13. A highway goes under a bridge formed by
research, the Canadian Space Agency a parabolic arch, as shown. The highest
uses a Falcon 20 jet that flies a parabolic point of the arch is 5 m high. The road is
path. As the jet nears the vertex of 10 m wide, and the minimum height of the
the parabola, the passengers in the jet bridge over the road is 4 m.
experience nearly zero gravity that lasts
y
for a short period of time. The function
h = -2.944t2 + 191.360t + 6950.400
(0, 5)
models the flight of a jet on a parabolic
path for time, t, in seconds, since
weightlessness has been achieved and
0 x
height, h, in metres.
highway

a) Determine the quadratic function that


models the parabolic arch of the bridge.
b) What is the inequality that represents
the space under the bridge in
quadrants I and II?

Extend
14. Tavia has been adding advertisements
to her Web site. Initially her revenue
increased with each additional ad she
included on her site. However, as she kept
increasing the number of ads, her revenue
began to drop. She kept track of her data
as shown.
Number of Ads 0 10 15

Revenue ($) 0 100 75

a) Determine the quadratic inequality


that models Tavias revenue.
Canadian Space Agency astronauts David Saint-Jacques b) How many ads can Tavia include on
and Jeremy Hansen experience microgravity during her Web site to earn revenue of at
a parabolic flight as part of basic training. least $50?
a) The passengers begin to experience
D i d You K n ow ?
weightlessness when the jet climbs
above 9600 m. Write an inequality to The law of diminishing returns is a principle in
represent this information. economics. The law states the surprising result
that when you continually increase the quantity
b) Determine the time period for which of one input, you will eventually see a decrease in
the jet is above 9600 m. the output.
c) For how long does the microgravity
exist on the flight?

9.3 Quadratic Inequalities in Two Variables MHR 499


15. Oil is often recovered from a formation 17. An environmentalist has been studying the
bounded by layers of rock that form a methane produced by an inactive landfill.
parabolic shape. Suppose a geologist has To approximate the methane produced,
discovered such an oil-bearing formation. p, as a percent of peak output compared
The quadratic functions that model the to time, t, in years, after the year 2000, he
rock layers are y = -0.0001x2 - 600 and uses the inequality p 0.24t2 - 8.1t + 74.
y = -0.0002x2 - 700, where x represents
the horizontal distance from the centre
of the formation and y represents the
depth below ground level, both in metres.
Write the inequality that describes the
oil-bearing formation.
y

-500 0 500 x

rock layer
-500
y = -0.0001x2 - 600

oil-bearing
formation y = -0.0002x2 - 700 a) For what time period is methane
production below 10% of the peak
production?
b) Graph the inequality used by the
Create Connections
environmentalist. Explain why only
16. To raise money, the student council
a portion of the graph is a reasonable
sells candy-grams each year. From past
model for the methane output of the
experience, they expect to sell 400
landfill. Which part of the graph would
candy-grams at a price of $4 each. They
the environmentalist use?
have also learned from experience that
each $0.50 increase in the price causes a c) Modify your answer to part a) to reflect
drop in sales of 20 candy-grams. your answer in part b).
a) Write an equality that models this d) Explain how the environmentalist
situation. Define your variables. can use the concept of domain to
make modelling the situation with the
b) Suppose the student council needs
quadratic inequality more reasonable.
revenue of at least $1800. Solve an
inequality to find all the possible prices 18. Look back at your work in Unit 2, where
that will achieve the fundraising goal. you learned about quadratic functions.
Working with a partner, identify the
c) Show how your solution would change
concepts and skills you learned in that
if the student council needed to raise
unit that have helped you to understand
$1600 or more.
the concepts in this unit. Decide which
concept from Unit 2 was most important to
your understanding in Unit 4. Find another
team that chose a different concept as the
most important. Set up a debate, with
each team defending its choice of most
important concept.

500 MHR Chapter 9


Chapter 9 Review
9.1 Linear Inequalities in Two Variables, 3. Graph each inequality using technology.
pages 464475 a) 4x + 5y > 22
1. Graph each inequality without using b) 10x - 4y + 52 0
technology.
c) -3.2x + 1.1y < 8
a) y 3x - 5
d) 12.4x + 4.4y > 16.5
b) y > -_
3x + 2
_3 x 9y
4 e)
4
c) 3x - y 6
4. Janelle has a budget of $120 for
d) 4x + 2y 8
entertainment each month. She usually
e) 10x - 4y + 3 < 11 spends the money on a combination of
2. Determine the inequality that corresponds movies and meals. Movie admission,
to each of the following graphs. with popcorn, is $15, while a meal
a) y costs $10.
4 a) Write an inequality to represent
the number of movies and meals
2
that Janelle can afford with her
entertainment budget.
6
-6
- 4
-4
- 2 0
-2
- 2 x
-2 b) Graph the solution.
c) Interpret your solution. Explain how
the solution to the inequality relates
b) y
to Janelles situation.
4
5. Jodi is paid by commission as a
2
salesperson. She earns 5% commission
for each laptop computer she sells and
4
-4
- 2 0
-2
- 2 4 x
8% commission for each DVD player she
-2 sells. Suppose that the average price of a
laptop is $600 and the average price of a
c) y DVD player is $200.
4 a) What is the average amount Jodi earns
for selling each item?
2
b) Jodi wants to earn a minimum
4
-4
- 2 0
-2
- 2 4 x commission this month of $1000.
-2
-2
Write an inequality to represent
this situation.
c) Graph the inequality. Interpret
d) y
your results in the context of
4
Jodis earnings.
2

4
-4
- 2 0
-2
- 2 4 x
-2
-2

Chapter 9 Review MHR 501


9.2 Quadratic Inequalities in One Variable, 10. David has learned that the light
pages 476487 from the headlights reaches about
100 m ahead of the car he is driving.
6. Choose a strategy to solve each inequality.
If v represents Davids speed,
Explain your strategy and why you
in kilometres per hour, then the
chose it.
inequality 0.007v 2 + 0.22v 100
a) x2 - 2x - 63 > 0 gives the speeds at which David can
b) 2x2 - 7x - 30 0 stop his vehicle in 100 m or less.
c) x2 + 8x - 48 < 0
d) x2 - 6x + 4 0
7. Solve each inequality.
a) x(6x + 5) 4
b) 4x2 < 10x - 1
c) x2 4(x + 8)
d) 5x2 4 - 12x
8. A decorative fountain shoots water in
a parabolic path over a pathway. To
determine the location of the pathway, a) What is the maximum speed at which
the designer must solve the inequality David can travel and safely stop his
-_3 x2 + 3x 2, where x is the horizontal vehicle in the 100-m distance?
4 b) Modify the inequality so that it gives
distance from the water source,
the speeds at which a vehicle can stop
in metres.
in 50 m or less.
c) Solve the inequality you wrote in
part b). Explain why your answer is not
half the value of your answer for part a).

9.3 Quadratic Inequalities in Two Variables,


pages 488500
11. Write an inequality to describe each
graph, given the function defining the
boundary parabola.
a) y

a) Solve the inequality. 6


-6
- -4 -2 0 2x

b) Interpret the solution to the inequality -2


-2

for the fountain designer. 1 4


-4
-
y = _ (x + 3)2 - 4
9. A rectangular storage shed is to be built 2
so that its length is twice its width. If the
b) y
maximum area of the floor of the shed is
18 m2, what are the possible dimensions 2
of the shed?
2 0 2 4 6 x
y = 2(x - 3)2

502 MHR Chapter 9


12. Graph each quadratic inequality. 15. An engineer is designing a roller coaster
a) y < x2 + 2x - 15 for an amusement park. The speed
at which the roller coaster can safely
b) y -x2 + 4
complete a vertical loop is approximated
c) y > 6x2 + x - 12 by v 2 10r, where v is the speed, in
d) y (x - 1)2 - 6 metres per second, of the roller coaster and
r is the radius, in metres, of the loop.
13. Write an inequality to describe each graph.
a) y
8

4
-4
- 2 0
-2
- 2 4x

b) y
2

6
-6 4
-4
- -2 0
- x a) Graph the inequality to examine how
-2
the radius of the loop is related to the
speed of the roller coaster.
-4
b) A vertical loop of the roller coaster has
-6
- a radius of 16 m. What are the possible
safe speeds for this vertical loop?
16. The function y = _ x2 - 4x + 90
1
14. You can model the maximum 20
Saskatchewan wheat production for the models the cable that supports a
years 1975 to 1995 with the function suspension bridge, where x is the
y = 0.003t2 - 0.052t + 1.986, where t horizontal distance, in metres, from
is the time, in years, after 1975 and y is the base of the first support and y
the yield, in tonnes per hectare. is the height, in metres, of the cable
above the bridge deck.
a) Write and graph an inequality to model
the potential wheat production during y
this period.
b) Write and solve an inequality to
represent the years in which production
is at most 2 t/ha. 0 x

D id Yo u K n ow ?

Saskatchewan has 44% of Canadas total cultivated


a) Write an inequality to determine the
farmland. Over 10% of the worlds total exported
points for which the height of the cable
wheat comes from this province.
is at least 20 m.
b) Solve the inequality. What does the
solution represent?

Chapter 9 Review MHR 503


Chapter 9 Practice Test
Multiple Choice 4. For the quadratic function q(x) shown in
the graph, which of the following is true?
For #1 to #5, choose the best answer.
y
1. An inequality that is equivalent to
3x - 6y < 12 is
A y < _x - 2
1
2
B y > _x - 2
1
q(x)
2
C y < 2x - 2
D y > 2x - 2 0 x

2. What linear inequality does the graph


show? A There are no solutions to q(x) > 0.
y B All real numbers are solutions to
6 q(x) 0.

4
C All real numbers are solutions to
q(x) 0.
2
D All positive real numbers are solutions
to q(x) < 0.
-6 -4 -2 0 2 4 x
-2
5. What quadratic inequality does
the graph show?

A y> _3 x + 4 y
4 y = -(x + 2)2 + 1
2
B _
y 3x + 4
4
2 0 2x
C _
y < 4x + 4
-6 -4 -2
-
3 2
-2
-

D _
y 4x + 4 -4
-4
3
3. What is the solution set for the quadratic 6
-6
-
2
inequality 6x - 7x - 20 < 0?

A {x | x - _34 or x _52 , x R} A y < -(x + 2)2 + 1

{x | - _34 x _25 , x R}
B y -(x + 2)2 + 1
B
C y -(x + 2)2 + 1
C {x | - _34 < x < _25 , x R} D y > -(x + 2)2 + 1

D {x | x < - _34 or x > _52 , x R}

504 MHR Chapter 9


Short Answer Extended Response
6. Graph 8x 2(y - 5). 11. Malik sells his artwork for different prices
7. Solve 12x2 < 7x + 10. depending on the type of work. Pen and
ink sketches sell for $50, and watercolours
8. Graph y > (x - 5)2 + 4.
sell for $80.
9. Stage lights often have parabolic reflectors a) Malik needs an income of at least
to make it possible to focus the beam of $1200 per month. Write an inequality
light, as indicated by the diagram. to model this situation.
y b) Graph the inequality. List three different
ordered pairs in the solution.
c) Suppose Malik now needs at least
$2400 per month. Write an inequality
to represent this new situation. Predict
0 x how the answer to this inequality will
be related to your answer in part b).
Suppose the reflector in a stage light is d) Solve the new inequality from part c) to
represented by the function y = 0.02x2. check your prediction.
What inequality can you use to model the 12. Let f(x) represent a quadratic function.
region illuminated by the light? a) State a quadratic function for
10. While on vacation, Ben has $300 to spend which the solution set to f (x) 0
on recreation. Scuba diving costs $25/h is {x | -3 x 5, x R}. Justify
and sea kayaking costs $20/h. What are all your answer.
the possible ways that Ben can budget his b) Describe all quadratics for which
recreation money? solutions to f(x) 0 are of the form
m x n for some real numbers m
and n.
c) For your answer in part b), explain
whether it is more convenient to
express quadratic functions in the
form f (x) = ax2 + bx + c or
f(x) = a(x - p)2 + q, and why.
13. The normal systolic blood pressure,
p, in millimetres of mercury (mmHg),
for a woman a years old is given by
p = 0.01a2 + 0.05a + 107.
a) Write an inequality that expresses the
ages for which you expect systolic blood
pressure to be less than 120 mmHg.
b) Solve the inequality you wrote in
part a).
c) Are all of the solutions to your
inequality realistic answers for this
problem? Explain why or why not.

Chapter 9 Practice Test MHR 505


Unit 4 Project
Nanotechnology
The Chapter 9 Task focusses on a cost analysis of part of the construction
of your object. You will compare the benefits of construction with and
without nanotechnology.

Chapter 9 Task
The graph models your projected costs of production now and in the
future. The linear graph represents the cost of traditional production
methods, while the parabola represents the cost of nanotechnology.
y
12
y = -0.1(x - 7)2 + 10
Cost (millions of dollars)

10
y = 0.25x + 3
8
A
6
B
C
4

0 2 4 6 8 10 12 14 16 18 20 x
Time (years)

Explain why it is reasonable to represent the costs of nanotechnology


by a parabola that opens downward.
Explain the meaning and significance of the point labelled B on the
graph.
What are the boundaries of region A? Write the inequalities that
determine region A. Explain what the points in region A represent.
What are the boundaries of region C? Write the inequalities that
determine region C. Explain what the points in region C represent.
How are regions A and C important to you as a designer and
manufacturer?
If the costs of nanotechnology decrease from their peak more quickly than
anticipated, how will that change the graph and your production plans?
The graph representing nanotechnologys cost has an x-intercept. Is this
reasonable? Justify your answer.
Is cost the only factor you would address when considering using
nanotechnology to produce your product? Explain your answer.

506 MHR Chapter 9


Unit 4 Project Wrap-Up
Nanotechnology
Choose a format in which to
display your finished project that
best complements your design.
For example, you may create one
or more of the following:
a hand-drawn illustration
a CAD drawing
an animation
photographs showing your
design from different angles
a 3-D model of your design
a video documenting your process and final design
a different representation of your design

Your project should include a visual representation of the evolution of


your design. Submit the equations used when designing your project
as well as the necessary points of intersection and the answers to the
Chapter 9 Task to your teacher.
You will display your final project in a gallery walk in your classroom.
In a gallery walk, each project is posted in the classroom so that you and
your classmates can circulate and view all the projects produced, similar
to the way that you may visit an art gallery.

Unit 4 Project Wrap-up MHR 507


Cumulative Review, Chapters 89
Chapter 8 Systems of Equations 5. Copy and complete the flowchart for solving
systems of linear-quadratic equations.
1. Examine each system of equations and
match it with a possible sketch of the Solving Linear-Quadratic Systems
system. You do not need to solve the
systems to match them. Substitution Method Elimination Method
2 2
A y=x +1 B y=x +1
y = -x2 + 1 y=x
C y = x2 + 1 D y = x2 + 1
2
y = -x + 4 y=x+4
a) y b) y

Solve New
Quadratic Equation
0 x 0 x

No
Solution
c) y d) y
6. Copy and complete the flowchart for
solving systems of quadratic-quadratic
equations.
0 x 0 x
Solving Quadratic-Quadratic Systems

Substitution Method Elimination Method


2. Solve the system of linear-quadratic
equations graphically. Express your
answers to the nearest tenth.
3x + y = 4
y = x2 - 3x - 1
Solve New
3. Consider the system of linear-quadratic Quadratic Equation
equations
y = -x2 + 4x + 1
3x - y - 1 = 0 7. The price, P, in dollars, per share, of a
a) Solve the system algebraically. high-tech stock has fluctuated over a
b) Explain, in graphical terms, what the 10-year period according to the equation
ordered pairs from part a) represent. P = 14 + 12t - t 2, where t is time, in years.
The price of a second high-tech stock has
4. Given the quadratic function y = x2 + 4
shown a steady increase during the same
and the linear function y = x + b,
time period according to the relationship
determine all the possible values of b that
P = 2t + 30. Algebraically determine for
would result in a system of equations with
what values the two stock prices will be
a) two solutions
the same.
b) exactly one solution
c) no solution

508 MHR Chapter 9


8. Explain how you could determine if 12. Write an inequality to describe each
the given system of quadratic-quadratic graph, given the function defining the
equations has zero, one, two, or an infinite boundary parabola.
number of solutions without solving or a) y
using technology.
6
y = (x - 4)2 + 2
y = -(x + 3)2 - 1 4
y = x2 + 1
9. Solve the system of quadratic-quadratic 2
equations graphically. Express your
answers to the nearest tenth. -4 -2 0 2 4 x
y = -2x2 + 6x - 1
y = -4x2 + 4x + 2 b) y
y = -(x + 3)2 + 2
10. Algebraically determine the solution(s) 2
to each system of quadratic-quadratic
equations. 8
-8
- 6
-6
- -4 -2 O 2x
2
-2
a) y = 2x2 + 9x - 5
2
y = 2x - 4x + 8 4
-4
b) y = 12x2 + 17x - 5
-6
y = -x2 + 30x - 5

Chapter 9 Linear and Quadratic Inequalities 13. Explain how each test point can be used to
11. Match each inequality with its graph. determine the solution region that satisfies
A 2x + y < 3 B 2x - y 3 the inequality y > x - 2.

C 2x - y 3 D 2x + y > 3 a) (0, 0)

a) b) b) (2, -5)
y y
6 6
c) (-1, 1)
14. What linear inequality is shown in
4 4
the graph?
2 2 y
6
-2 O 2 4x 2
-2
- O 2 x
4

2
c) y d) y
2 2
4
-4
- 2
-2
- O 2 4 x
2
-2
- O 2 x -2 O 2 4x
-2
-2 -2 15. Sketch the graph of y x2 - 3x - 4. Use
a test point to verify the solution region.
-4
-4 4
-4
16. Use sign analysis to determine the
-6 -6
-6 solution of the quadratic inequality
2x2 + 9x - 33 2.
17. Suppose a rectangular area of land is to be
enclosed by 1000 m of fence. If the area is
to be greater than 60 000 m2, what is the
range of possible widths of the rectangle?

Cumulative Review, Chapters 89 MHR 509


Unit 4 Test
Multiple Choice 3. The ordered pairs (1, 3) and (-3, -5)
are the solutions to which system of
For #1 to #9, choose the best answer. linear-quadratic equations?
1. Which of the following ordered pairs is a A y = 3x + 5
solution to the system of linear-quadratic y = x 2 - 2x - 1
equations? B y = 2x + 1
y = x 2 + 4x - 2
C y=x+2
y = x2 + 2
D y = 4x - 1
y = x 2 - 3x + 5
4. How many solutions are possible for the
following system of quadratic-quadratic
equations?
A (2.5, -12.3) B (6, 0) y - 5 = 2(x + 1)2
C (7, 8) D (0, -13) y - 5 = -2(x + 1)2
2. Kelowna, British Columbia, is one of A zero
the many places in western Canada with B one
bicycle motocross (BMX) race tracks
C two
for teens.
D an infinite number
5. Which point cannot be used as a test
point to determine the solution region
for 4x - y 5?
A (-1, 1) B (2, 5)
C (3, 1) D (2, 3)
6. Which linear inequality does the
graph show?
y
8

Which graph models the height versus 6

time of two of the racers travelling over 4


one of the jumps?
2
A h B h
Height
Height

O 2 4 6 8 x

0 Time t 0 Time t
A y -x + 7

C h D h B y -x + 7
C y > -x + 7
Height

Height

D y < -x + 7

0 Time t 0 t
Time

510 MHR Chapter 9


7. Which graph represents the quadratic 8. Determine the solution(s), to the nearest
2
inequality y 3x + 10x - 8? tenth, for the system of quadratic-quadratic
A y equations.
y = -_ 2 x2 + 2x + 3
-6 4
-4 2
-2
- O 2 x 3
4
-4
-
y = x2 - 4x + 5
A (3.2, 2.5)
8
-8
-
B (3.2, 2.5) and (0.4, 3.7)
1
12
-12 C (0.4, 2.5) and (2.5, 3.7)
-16
- D (0.4, 3.2)
9. What is the solution set for the quadratic
B y
inequality -3x2 + x + 11 < 1?
A x | x < - _ or x > 2, x R
5
-6 4
-4 2
-2
- O 2 x
{ 3 }
B x | x < - _ or x 2, x R
5
4
-4
-
{ 3 }
x | -_
-8
-8 5 < x < 2, x R
1
12
-12
C { 3 }
D x | - _ x 2, x R
5
-16
-
{ 3 }
C
Numerical Response
y

Copy and complete the statements in #10


6
-6
- 4
-4
- -2 O 2 x
to #12.
-4
10. One of the solutions for the system of
-8
linear-quadratic equations y = x2 - 4x - 2
2
-12 and y = x - 2 is represented by the
ordered pair (a, 3), where the value of a
1
16
-16
is .
11. The solution of the system of
D y quadratic-quadratic equations represented
by y = x2 - 4x + 6 and y = -x2 + 6x - 6
6
-6
- 4
-4
- -2 O 2 x
with the greater coordinates is of the form
-4 (a, a), where the value of a is .
-8 12. On a forward somersault dive, Lauries
height, h, in metres, above the water
2
-12
t seconds after she leaves the diving
1
16
-16 board is approximately modelled by
h(t) = -5t2 + 5t + 4. The length of time
that Laurie is above 4 m is .

Unit 4 Test MHR 511


Written Response 15. Algebraically determine the solutions
to the system of quadratic-quadratic
13. Professional golfers, such as Canadian
equations. Verify your solutions.
Mike Weir, make putting look easy to
spectators. New technology used on a 4x2 + 8x + 9 - y = 5
television sports channel analyses the 3x2 - x + 1 = y + x + 6
greens conditions and predicts the path 16. Dolores solved the inequality
of the golf ball that the golfer should putt 3x2 - 5x - 10 > 2 using roots and test
to put the ball in the hole. Suppose the points. Her solution is shown.
straight line from the ball to the hole is 3x2 - 5x - 10 > 2
represented by the equation y = 2x and the 3x2 - 5x - 8 > 0
predicted path of the ball is modelled by 3x2 - 5x - 8 = 0
the equation y = _ 1 x2 + _3 x. (3x - 8)(x + 1) = 0
4 2
3x - 8 = 0 or x + 1 = 0
3x = 8 x = -1
x= _
8
3
Choose test points -2, 0, and 3 from the
intervals x < -1, -1 < x < _8 , and x > _
8,
3 3
respectively.
The values of x less than -1 satisfy the
inequality 3x2 - 5x - 10 > 2.
a) Upon verification, Dolores realized
she made an error. Explain the error
and provide a correct solution.
b) Use a different strategy to determine
the solution to 3x2 - 5x - 10 > 2.
17. A scoop in field hockey occurs when
a player lifts the ball off the ground
with a shovel-like movement of the
stick, which is placed slightly under the
ball. Suppose a player passes the ball
a) Algebraically determine the solution to with a scoop modelled by the function
the system of linear-quadratic equations. h(t) = -4.9t2 + 10.4t, where h is the height
of the ball, in metres, and t represents
b) Interpret the points of intersection in
time, in seconds. For what length of time,
this context.
to the nearest hundredth of a second, is the
14. Two quadratic functions, ball above 3 m?
f(x) = x2 - 6x + 5 and g(x), intersect at the
points (2, -3) and (7, 12). The graph of g(x)
is congruent to the graph of f(x) but opens
downward. Determine the equation of g(x)
in the form g(x) = a(x - p)2 + q.

512 MHR Chapter 9


Answers
Chapter 1 Sequences and Series 18.
Multiples of 28 7 15
1.1 Arithmetic Sequences, pages 16 to 21
Between 1 and 1000 500 and 600 50 and 500
1. a) arithmetic sequence: t1 = 16, d = 16; next First Term, t1 28 504 60
three terms: 96, 112, 128
Common
b) not arithmetic 28 7 15
Difference, d
c) arithmetic sequence: t1 = -4, d = -3; next
nth Term, tn 980 595 495
three terms: -19, -22, -25
d) arithmetic sequence: t1 = 3, d = -3; next General Term tn = 28n tn = 7n + 497 tn = 15n + 45
three terms: -12, -15, -18 Number of
35 14 30
2. a) 5, 8, 11, 14 b) -1, -5, -9, -13 Terms
c) 4, _21 , _
22 , _
23 d) 1.25, 1.00, 0.75, 0.50 19. a) 14.7, 29.4, 44.1, 58.8; tn = 14.7n, where n
5 5 5
3. a) t1 = 11 b) t7 = 29 c) t14 = 50 represents every increment of 30 ft in depth.
4. a) 7, 11, 15, 19, 23; t1 = 7, d = 4 b) 490 psi at 1000 ft and 980 psi at 2000 ft

b) 6, _ , 3, _ ; t1 = 6, d = - _
9 3 3 c) y Water Pressure
2 2 2 as Depth Changes
120
c) 2, 4, 6, 8, 10; t1 = 2, d = 2
5. a) 30 b) 82 c) 26 d) 17

Water Pressure (psi)


100
6. a) t2 = 15, t3 = 24 b) t2 = 19, t3 = 30
c) t2 = 37, t3 = 32 80
7. a) 5, 8, 11, 14, 17 b) tn = 3n + 2
c) t50 = 152, t200 = 602 60
d) The general term is a linear equation of the
40
form y = mx + b, where tn = y and n = x.
Therefore, tn = 3n + 2 has a slope of 3. 20
e) The constant value of 2 in the general term
is the y-intercept of 2.
0 1 2 3 4 5 6 x
8. A and C; both sequences have a natural-number 30-ft Depth Changes
value for n. d) 14.7 psi
9. 5 e) 14.7
10. tn = -3yn + 8y; t15 = -37y f) The y-intercept represents the first term of
11. x = -16; first three terms: -78, -116, -154 the sequence and the slope represents the
12. z = 2y - x common difference.
13. a) tn = 6n + 4 b) 58
20. Other lengths are 6 cm, 12 cm, and 18 cm. Add
c) 12
the four terms to find the perimeter. Replace t2
14. a) 0, 8, 16, 24
with t1 + d, t3 with t1 + 2d, and t4 with t1 + 3d.
b) 32 players
Solve for d.
c) tn = 8n - 8
21. a) 4, 8, 12, 16, 20 b) tn = 4n
d) 12:16
c) 320 min
e) Example: weather, all foursomes starting on
22. -29 beekeepers
time, etc. 23. 5.8 million carats. This value represents the
15. 21 square inches increase of diamond carats mined each year.
16. a) tn = 2n - 1 b) 51st day
24. 1696.5 m
c) Susan continues the program until she
25. a) 13:54, 13:59, 14:04, 14:09, 14:14; t1 = 13:54,
accomplishes her goal. d = 0:05
17. a) Carbon Atoms 1 2 3 4 b) tn = 0:05n + 13:49
Hydrogen Atoms 4 6 8 10 c) Assume that the arithmetic sequence of
times continues.
b) tn = 2n + 2 or H = 2C + 2
d) 15:49
c) 100 carbon atoms

Answers MHR 513


26. a) d > 0 b) d < 0 7. a) 124 500 b) 82 665
c) d = 0 d) t1 8. 156 times
c) _ (1 + 3n)
e) tn 9. a) 2 b) 40
n
2
27. Definition: An ordered list of terms in which 10. 8425
the difference between consecutive terms 11. 3 + 10 + 17 + 24
12. a) Sn = _ [2t1 + (n - 1)d]
is constant. n
Common Difference: The difference between 2
successive terms, d = tn - tn - 1 Sn = _
n [2(5) + (n - 1)10]
Example: 12, 19, 26, 2
Formula: tn = 7n + 5
_
n
Sn = [10 + 10n - 10]
2
28. Step 1 The graph of an arithmetic sequence is
Sn = __
n(10n)
always a straight line. The common difference 2
is described by the slope of the graph. Since Sn = _
10n 2

the common difference is always constant, the 2


graph will be a straight line. Sn = 5n2
Step 2 _
100 [2(5) + (100 - 1)10]
a) Changing the value of the first term changes b) S100 =
2
the y-intercept of the graph. The y-intercept S100 =_
100 [10 + 990]
increases as the value of the first term 2
increases. The y-intercept decreases as the S100 =_
100 (1000)
2
value of the first term decreases.
S100 = 50 000
b) Yes, the graph keeps it shape. The slope
stays the same. d(100) = 5(100)2
d(100) = 5(10 000)
Step 3
a) Changing the value of the common
d(100) = 50 000
13. 171
difference changes the slope of the graph.
14. a) the number of handshakes between six
b) As the common difference increases, the
people if they each shake hands once
slope increases. As the common difference
b) 1 + 2 + 3 + 4 + 5 + 6 + 7 + 8 + 9
decreases, the slope decreases.
c) 435
Step 4 The common difference is the slope. d) Example: The number of games played in a
Step 5 The slope of the graph represents the home and away series league for n teams.
common difference of the general term of 15. a) t1 = 6.2, d = 1.2
the sequence. The slope is the coefficient of the b) t20 = 29
variable n in the general term of the sequence. c) S20 = 352
16. 173 cm
1.2 Arithmetic Series, pages 27 to 31
17. a) True. Example: 2 + 4 + 6 + 8 = 20,
1. a) 493 b) 735 4 + 8 + 12 + 16 = 40, 40 = 2 20
c) -1081 d)
_
301 __
= 100.3 b) False. Example: 2 + 4 + 6 + 8 = 20,
3 2 + 4 + 6 + 8 + 10 + 12 + 14 + 16 = 72,
2. a) t1 = 1, d = 2, S8 = 64 72 2 20
b) t1 = 40, d = -5, S11 = 165 c) True. Example: Given the sequence 2, 4,
c) t1 = _1 , d = 1, S = 24.5 6, 8, multiplying each term by 5 gives 10,
2 7

d) t1 = -3.5, d = 2.25, S6 = 12.75 20, 30, 40. Both sequences are arithmetic
3. a) 344 b) 663 sequences.
c) 195 d) 396 18. a) 7 + 11 + 15 b) 250 c) 250
d) Sn = _ [2t1 + (n - 1)d]
n
e) 133
2
b) _ 38.46
500
Sn = _
4. a) 2 n [2(7) + (n - 1)4]
13 2
c) 4 d) 41
_
n
Sn = [14 + 4n - 4]
5. a) 16 b) 10 2
6. a) t10 = 50, S10 = 275 _
n
Sn = [4n + 10]
b) t10 = -17, S10 = -35 2
c) t10 = -46, S10 = -280 Sn = n(2n + 5)
d) t10 = 7, S10 = 47.5 Sn = 2n2 + 5n

514 MHR Answers


19. a) 240 + 250 + 260 + + 300 9. a) t1 = 3; r = 0.75
b) Sn = 235n + 5n2 b) tn = 3(0.75)n - 1
c) 1890 c) approximately 53.39 cm
d) Nathan will continue to remove an extra d) 7
10 bushels per hour. 10. a) 95%
20. (-27) + (-22) + (-17) b) 100, 95, 90.25, 85.7375
21. Jeanette and Pierre have used two different c) 0.95
forms of the same formula. Jeanette has d) about 59.87%
replaced tn with t1 + (n - 1)d. e) After 27 washings, 25% of the original
22. a) 100 colour would remain in the jeans. Example:
b) Sgreen = 1 + 2 + 3 + + 10 The geometric sequence continues for
Sblue = 0 + 1 + 2 + 3 + + 9 each washing.
Stotal = Sgreen + Sblue 11. 1.77
Stotal = _10 (1 + 10) + _
10 (0 + 9) 12. a) 1, 2, 4, 8, 16 b) tn = 1(2)n - 1
29
2 2 c) 2 or 536 870 912
Stotal = 5(11) + 5(9) 13. a) 1.031 b) 216.3 cm
Stotal = 55 + 45 c) 56 jumps
Stotal = 100 14. a) 1, 2, 4, 8, 16, 32 b) tn = 1(2)n - 1
23. a) 55 25
c) 2 or 33 554 432
b) The nth triangular number is represented d) All cells continue to double and all cells
by Sn. live.
Sn = _ n [2t + (n - 1)d] 15. 2.9%
2 1
16. 8 weeks
_
n
Sn = [2(1) + (n - 1)(1)]
2 17. 65.2 m
Sn = _ n [2 + (n - 1)] 18. 0.920
2 19. a) 76.0 mL b) 26 h
Sn = _ n (1 + n)
20. a) Time, d (days) Charge Level, C (%)
2
0 100
1.3 Geometric Sequences, pages 39 to 45
1 98
1. a) geometric; r = 2; tn = 2n - 1 2 96.04
b) not geometric
3 94.12
c) geometric; r = -3; tn = 3(-3)n - 1
n-1
d) not geometric b) tn = 100(0.98)
e) geometric; r = 1.5; tn = 10(1.5)n - 1 c) The formula in part b) includes the first
f) geometric; r = 5; tn = -1(5)n - 1 term at d = 0 in the sequence. The formula
2. C = 100(0.98)n does not consider the first
Geometric Common 6th 10th
Sequence Ratio Term Term term of the sequence.
a) d) 81.7%
6, 18, 54, 3 1458 118 098
21. a) 24.14 mm b) 1107.77 mm
b) 1.28, 0.64, 0.32, 0.5 0.04 0.0025 22. Example: If a, b, c are terms of an arithmetic
c)
_1 , _3 , _9 , 3
_
243 __
19 683 sequence, then b - a = c - b. If 6a, 6b, 6c are
terms of a geometric series, then _ 6b = _
5 5 5 5 5 6c and
3. a) 2, 6, 18, 54 b) -3, 12, -48, 192 6a 6b
c) 4, -12, 36, -108 d) 2, 1, _1 , _1 6b - a = 6c - b. Therefore, b - a = c - b. So, when
2 4 6a, 6b, 6c form a geometric sequence, then a, b, c
4. 18.9, 44.1, 102.9 form an arithmetic sequence.
( _14 ) _5 ; 9, 15, 25
n-1
5. a) tn = 3(2)n - 1 b) tn = 192 - 23.
3
c) tn =_
5 (3) n-1
d) tn = 4(2) n-1 24. a) 23.96 cm b) 19.02 cm
9
c) 2.13 cm d) 2.01 cm
6. a) 4 b) 7 c) 5
e) 2.01, 1.90, 1.79; arithmetic; d = -0.11 cm
d) 6 e) 9 f) 8
25. Malas solution is correct. Since the aquarium
7. 37
loses 8% of the water every day, it maintains
( _43 )
n-1
8. 16, 12, 9; tn = 16 92% of the water every day.

Answers MHR 515


26.
1 50
12. b) Length of Number Perimeter
500 3
1 1 Stage Each Line of Line of
1 10
100 10 Number Segment Segments Snowflake
1

20
2 6 18 54 1 1 3 3
1 1

16

4
1 4 9
2
_1 12 4
5 3 3
8
4
25
2
1 1 1 3
_1 48
_
16

4
16 4 1
4

16

64 9 3
125
32 4
_1
192
_
64
4 27 9
625
100
4
64
5
_1
768
_
256
81 27
2 2
27. a) 0.86 cm b) 1.72 cm
= (_
n-1
1
c) 3.43 cm2 d) 109.88 cm2 c) length, tn
3
; )
number of line segments, tn = 3(4)n - 1;
1.4 Geometric Series, pages 53 to 57
_1 perimeter, tn = 3 _
4 n-1
( )
1. a) geometric; r = 6 b) geometric; r = - 3
2
d) _
1024 12.64
c) not geometric d) geometric; r = 1.1 81
t1 = 6, r = 1.5, S10 = __
174 075 , S 679.98 13. 98 739
2. a)
256 10 14. 91 mm
b) t1 = 18, r = -0.5, S12 = __
12 285 , S12 12.00 15. a) 226.9 mg b) 227.3 mg
1024 16. 8
c) t1 = 2.1, r = 2, S9 = __
10 731 , S = 1073.10
17.
__
58 025
10 9
48
d) t1 = 0.3, r = 0.01, S12 = _
10 , S 0.30 18. a = 5, b = 10, c = 20 or a = 20, b = 10, c = 5
33 12
19. 15
b) _
3280
3. a) 12 276
81 20.
_
341

__ 4
c) - __
209 715 d)
36 855
21.
256 256
Sequences
4. a) 40.50 b) 0.96
c) 109 225 d) 39 063
5. a) 3 b) 295.7 Arithmetic Geometric

6. 7
7. a) 81 b) 81 + 27 + 9 + 3 + 1 General Term General Term
= -_
Example Example
8. t2
81 ; S = 7.8 Formula Formula
16 6 tn = t1 + (n - 1)d 1, 3, 5, 7, t n = t1 r n - 1 3, 9, 27, 81,
9. a) If the person in charge is included, the
series is 1 + 4 + 16 + 64 + . If the
Series
person in charge is not included, the
series is 4 + 16 + 64 + .
b) If the person in charge is included, the sum Arithmetic Geometric
is 349 525. If the person in charge is not
included, the sum is 1 398 100.
General Sum General Sum
10. 46.4 m Formula
Example
Formula
Example

n 1+3+5+ rtn - t1 3 + 9 + 27 +
Sn = (t1 + tn )
2 7+ Sn = ,r 1 81 +
r-1
or or
n t1(r n - 1)
Sn = [2 t1 + (n - 1)d ] Sn =, r 1
2 r-1

20 m 22. Examples:
a) All butterflies produce the same number of
eggs and all eggs hatch.
b) No. Tom determined the total number of
butterflies from the first to fifth generations.
He should have found the fifth term, which
11. 794.3 km would determine the total number of
butterflies in the fifth generation only.

516 MHR Answers


c) This is a reasonable estimate, but it does
t
_4 _4
include all butterflies up to the fifth b) S = _ 1
= __5 _
= 5 = 4 and
generation, which is 6.42 107 more 1-r 1-_ 4 _1
5 5
butterflies than those produced in the
fifth generation. t
_1 _1
S = _ 1
= __5 = 5 =_
_ 1
1-_ _4 4
d) Determine t5 = 1(400)4 or 2.56 1010. 1-r 1
5 5
1.5 Infinite Geometric Series, pages 63 to 65 21. Geometric series converge only when
-1 < r < 1.
1. a) divergent b) convergent
22. a) Sn = - _ n2 + _ n
3 11
c) convergent d) divergent 8 8
e) divergent _1 - 1
n

( )
2. a) _
32 b) no sum b) Sn = __
4
-_
5 3
c) no sum d) 2 4
e) 2.5
Sn = - _
4 _
1 n
+_4
( )
3. a) 0.87 + 0.0087 + 0.000 087 + ; 3 4 3
S = _
87 or _
29
c) S = __
1
1-_
99 33 1
b) 0.437 + 0.000 437 + ; S =
437 _ 4
999 S = _
4
4. Yes. The sum of the infinite series representing 3
0.999 is equal to 1. 23. Step 3
n 1 2 3 4
5. a) 15 b) _4 or 0.8
5 Fraction _1 _1 _
1 _
1
c) 14 of Paper 4 16 64 256

Step 4 _
1 +_1 +_1 +_1 , Example: S = _
6. t1 = 27; 27 + 18 + 12 + 1
r=_ 2 ; -8 - _ 16 - _ 32 - _ 64 - 4 16 64 256 3

7.
5 5 25 125
8. a) 400 000 barrels of oil Chapter 1 Review, pages 66 to 68
b) Determining the lifetime production
1. a) arithmetic, d = 4 b) arithmetic, d = -5
assumes the oil well continues to produce
c) not arithmetic d) not arithmetic
at the same rate for many months. This is an
2. a) C b) D
unreasonable assumption because 94% is a
c) E d) B
high rate to maintain.
e) A
9. x=_ 1; 1 + _ 3 +_ 9 +_ 27 +
3. a) term, n = 14 b) not a term
4 4 16 64
10. r=_ 1 c) term, n = 54 d) not a term
2 4. a) A
11. a) -1 < x < 1 b) -3 < x < 3 b)
c) - _ < x < _
1 1
2 2
y Compare Two Sequences
12. 6 cm 120
13. 250 cm
14. No sum, since r = 1.1 > 1. Therefore, the series 100
Term Value

is divergent.
80
15. 48 m
16. a) approximately 170.86 cm 60
b) 300 cm
17. a) Rita 40
Sequence 1
b) r = - _ ; therefore, r < -1, and the series
4
Sequence 2
3 20
is divergent.
18. 125 m
0 5 10 15 x
19. 72 cm Term Number
a) Example: _ + _ + _ + + _
4 4 2 4 3 4 n
20. ( ) ( )
5 5 ( ) 5 5
In the graph, sequence 1 has a larger positive
slope than sequence 2. The value of term 17 is
and _ 1 + _ 1 + _ 1 ++ _
2 3 n
1
5 ( ) ( )
5 ( )
5 5
greater in sequence 1 than in sequence 2.

Answers MHR 517


5. t10 = 41 22.
6. 306 cm
7. a) S10 = 195 b) S12 = 285
c) S10 = -75 d) S20 = 3100
8. S40 = 3420
9. a) 29 b) 225
c) 25 days
10. a) 61 b) 495 a) 1, _1 , _
1,_
1 . Yes. The areas form a
4 16 64
11. 1170
12. a) not geometric geometric sequence. The common ratio is _ 1.
4
b) geometric, r = -2, t1 = 1, tn = (-2)n - 1 b) 1_ 21 or 1.328 125 square units
geometric, r = _
1 , t = 1, t = _ 1 n-1 64
c)
2 1 n 2 ( ) c) _4 square units
d) not geometric 3
13. a) 7346 bacteria 23. a) A series is geometric if there is a common
b) tn = 5000(1.08)n ratio r such that r 1.
14. 2 cm or approximately 6.28 cm An infinite geometric series converges
15. if -1 < r < 1.
Arithmetic Geometric An infinite geometric series diverges
Sequence Sequence
if r < -1 or r > 1.
b) Example:
Definition Definition 4 + 2 + 1 + 0.5 + ; S = 8
A sequence in which A sequence in which 21 - 10.5 + 5.25 - 2.625 + ; S = 14
the difference between the ratio between
consecutive terms consecutive terms
is constant is constant Chapter 1 Practice Test, pages 69 to 70
1. D
Formula Formula 2. B
tn = t1 + (n - 1)d tn = t1r n - 1 3. B
4. B
5. C
Example Example 6. 11.62 cm
3, 6, 9, 12, 4, 12, 36, 108, 7. Arithmetic sequences form straight-line graphs,
where the slope is the common difference
16. a) arithmetic b) geometric of the sequence. Geometric sequences form
c) geometric d) arithmetic curved graphs.
e) arithmetic f) geometric 8. A = 15, B = 9
17. a) S10 = __
174 075 , S 679.98 9. 0.7 km
256 10
10. a) 5, 36, 67, 98, 129, 160
b) S12 = __
36 855 , S 35.99
b) tn = 31n - 26
1024 12

c) S20 = __
20 000 , S 6666.67 c) 5, 10, 20, 40, 80, 160
3 20
d) tn = 5(2)n - 1
d) S9 = __
436 905 , S 106.67
11. a) 17, 34, 51, 68, 85
4096 9

18. a) 19.1 mm b) 1.37 m b) tn = 17n

19. a) S = 15 b) S = _3 c) 353 million years


4 d) Assume that the continents continue to
20. a) convergent, S = 16 separate at the same rate every year.
b) divergent 12. a) 30 s, 60 s, 90 s, 120 s, 150 s
c) convergent, S = -28 b) arithmetic
d) convergent, S = _3 c) 60 days
2
d) 915 min
21. a) r = -0.4
b) S1 = 7, S2 = 4.2, S3 = 5.32, S4 = 4.872,
S5 = 5.0512
c) 5
d) S = 5

518 MHR Answers


Chapter 2 Trigonometry 9. 159.6
10. a) dogwood (-3.5, 2), white pine (3.5, -2),
2.1 Angles in Standard Position, pages 83 to 87 river birch (-3.5, -2)
b) red maple 30, flowering dogwood 150,
1. a) No; the vertex is not at the origin. river birch 210, white pine 330
b) Yes; the vertex is at the origin and the initial c) 40 m
__
arm is on the x-axis. 11. 50 3 cm
c) No; the initial arm is not on the x-axis. 12. a) A(x, -y), A(-x, y), A (-x, -y)
d) Yes; the vertex is at the origin and the initial b) AOC = 360 - , AOC = 180 - ,
arm is on the x-axis. A OB = 180 +__
__
2. a) F b) C c) A 13. (5 3 - 5) m or 5( 3 - 1) m
d) D e) B f) E 14. 252
3. a) I b) IV c) III 15. Cu (copper), Ag (silver), Au (gold),
d) I e) III f) II Uuu (unununium)
4. a) y 16. a) 216 b) 8 days c) 18 days
17. a) 70 b) 220
70 y y
0 x
70 220

0 x 0 x
b) y

310 c) 170 d) 285

0 x y y

170 285

0 x
c) 0 x
y

225
18. a) Angle Height (cm)
0 x
0 12.0
15 23.6
d) y 30 34.5
45 43.8
165
60 51.0
0 x 75 55.5
90 57.0

b) A constant increase in the angle does


5. a) 10 b) 15 c) 72 d) 35 not produce a constant increase in the
6. a) 135, 225, 315 b) 120, 240, 300 height. There is no common difference
c) 150, 210, 330 d) 105, 255, 285 between heights for each pair of angles;
7. a) 288 b) 124 c) 198 d) 325 for example, 23.6 cm - 12 cm = 11.6 cm,
8. 34.5 cm - 23.6 cm = 10.9 cm.
sin cos tan
__ __ c) When extends beyond 90, the heights
30
_1 _
3 _
1__
or
_
3
decrease, with the height for 105 equal to
2 2 3 3
__ __ the height for 75 and so on.
45
_
1__
or
_
2 _
1__
or
_
2
1 19. 45 and 135
2 2 2 2
__ 20. a) 19.56 m
60
_
3 _1 3
__
b) i) 192 ii) 9.13 m
2 2
21. a) B b) D

Answers MHR 519


22. x 2 + y 2 = r 2 d) y
23. a) 2
(-1, 0)

20 40 60 80 -6 -4 -2 O 2 4 6 x
sin 0.3420 0.6428 0.8660 0.9848 -2
sin (180 - ) 0.3420 0.6428 0.8660 0.9848 __
sin (180 + ) -0.3420 -0.6428 -0.8660 -0.9848 2. a) sin 60 = _
3
, cos 60 = _
1 , tan 60 = 3
__
2 __ 2
sin 225 = - _ 1__ or - _
sin (360 - ) -0.3420 -0.6428 -0.8660 -0.9848 2
b) ,
2 2__
b) Each angle in standard position has the
cos 225 = - _ 1__ or - _ 2
same reference angle, but the sine ratio , tan 225 = 1
2 2 __
sin 150 = _ 1 , cos 150 = - _
differs in sign based on the quadrant 3
c) ,
location. The sine ratio is positive in 2 __ 2
quadrants I and II and negative in quadrants _1
tan 150 = - __ or - _3
3 3
III and IV.
d) sin 90 = 1, cos 90 = 0, tan 90 is
c) The ratios would be the same as those for
undefined
the reference angle for cos and tan in
quadrant I but may have different signs than 3. a) sin = _4 , cos = _ 3 , tan = _ 4
5 5 3
sin in each of the other quadrants. b) sin = - _ 5 , cos = - _ 12 , tan = _ 5
__
__
3025 3 13 13 12
24. a) ft
c) sin = - _15 , cos = _ 8 , tan = - _ 15
16
17 __ 17 8 __
b) As the angle increases to 45 the distance _
_ _ or _ ,
1 2 1 2
increases and then decreases after 45. d) sin = - __ or - , cos = __
2 2 2 2
c) The greatest distance occurs with an angle tan = -1
of 45. The product of cos and sin has a 4. a) II b) I c) III d) IV
maximum value when = 45. 5. a) sin = _
12 , cos = - , tan = - _
_ 5 12
13 13___ 5
2.2 Trigonometric Ratios of Any Angle, b) _ 3
sin = - ___ or - __
3 34
,
34 ___34
pages 96 to 99
cos = _ 5___ or __ , tan = - _
5 34 3
1. a) y 34 34 5
6 (2, 6) c) sin = ___ or __ , cos = ___ or _
_ 3 _1 _ 6 2__ ,
45 5 45 5

4 tan = _1
2
d) sin = - _ 5 , cos = - _ 12 , tan = _ 5
2
13 13 12
6. a) positive b) positive
-6 -4 -2 O 2 4 6 x c) negative d) negative
7. a) y

b) y
4 (-12, 5) (12, 5)

(-4, 2)
2

O x

-6 -4 -2 O 2 4 6 x

b) 23 or 157
__ __
c) y
8. a) sin = _
5
, tan = - _
5
3 2
2
b) cos = _
4 , tan = _3
5 4 ___
sin = - _
4___ or - __
-6 -4 -2 O 2 4 6 x 4 41
c) ,
41 ___41
-2
cos = _
5___ or __
(-5, -2) 5 41
41 41

520 MHR Answers


__ __
_ , tan = _
2 2 2
d) cos = - b) True; both sin 225 and cos 135 have a
3 __ 4
sin = - _1__ or - _2 reference angle of 45 and
sin 45 = cos 45 = _
e) , 1__ .
2
2__
cos = - _
1__ or - _
2 2
2 2 c) False; tan 135 is in quadrant II, where
9. a) 60 and 300 b) 135 and 225 tan < 0, and tan 225 is in quadrant III,
c) 150 and 330 d) 240 and 300 where tan > 0.
e) 60 and 240 f) 135 and 315 d) True; from the reference angles in a
10.
sin cos tan
30-60-90 triangle, __

0 0 1 0 sin 60 = cos 330 = _


3
.
2
90 1 0 undefined e) True; the terminal arms lie on the axes,
180 0 -1 0 passing through P(0, -1) and P(-1, 0),
respectively, so sin 270 = cos 180 = -1.
270 -1 0 undefined
19.
360 0 1 0
sin cos tan
11. a) x = -8, y = 6, r = 10, sin = _
3,
0 0 1 0
5 __ __
cos = - _
4 , tan = - _
3 _1 _ _ _
3 1__ 3
5 4 30 or
2 2 3 3
b) x = 5, y = -12, r = 13, sin = - _ ,
12 __ __
13 45
_
1__
or
_
2 _
1__
or
_
2
1
cos = _ 5 , tan = - _
12 2 2 2 2
__
13 5
60
_
3 _1 __
3
12. a) y 2 2

(-9, 4) 90 1 0 undefined
__

R 120
_
3
-_
1 - 3
__
2 2
0 x __ __

135
_
1__
or
_
2
-_
1__
or - _
2
-1
b) 24 c) 156 2 2 2 2
__ __
13. a) y
150
_1 -_
3
-_
1__
or - _
3
2 2 3 3
180 0 -1 0
0 R x __ __

210 -_
1 -_
3 _
1__
or
_
3
2 2 3 3
__ __
(7, -24)
-_ or - _ -_ or - _
1__ 2 1__ 2
225 1
2 2 2 2
b) 74 __
__ c) 286
-_ -_
3 __
1
14. a) sin = _
2__ or _
2 5 240
2 2
3
5 5__
sin = _
2__ or _
2 5 270 -1 0 undefined
b) __
5 5 __
-_
3 _1 __

c) sin = _
2__ or _
2 5 300
2 2
- 3
5 5 __ __
d) They all have the same sine ratio. This 315 -_
1__
or - _
2 _
1__
or
_
2
-1
2 2 2 2
happens because the points P, Q, and R are __ __
collinear. They are on the same terminal arm. 330 -_
1 _
3
-_
1__
or - _
3
2 2 3 3
15. a) 74 and 106
b) sin = _ , cos = _ , tan = _
24 7 24 360 0 1 0
25
__ 25 7
20. a) A = 45, B = 135, C = 225,
16. sin = _
2 6
5 D = 315
_1__ , _1__ , B - _1__ , _1__ ,
17. sin 0 = 0, cos 0 = 1, tan 0 = 0, sin 90 = 1,
cos 90 = 0, tan 90 is undefined
b) A (2 2 ) (
2 2 )
C -_ 1__ ,- _1__ , D _1__ ,- _ 1__
18. a) True. R for 151 is 29 and is in quadrant II.
The sine ratio is positive in quadrants I and II.
( 2 2 2) ( 2 )

Answers MHR 521


21. a)
Angle Sine Cosine Tangent
The measures satisfy the Pythagorean
Theorem, so ABC is a right triangle and
0 0 1 0
CAB = 90.
15 0.2588 0.9659 0.2679 Alternatively, CAB is inscribed in a
30 0.5 0.8660 0.5774 semicircle and must be a right angle.
45 0.7071 0.7071 1 Hence, CAB is a right triangle and the
Pythagorean Theorem must hold true.
60 0.8660 0.5 1.7321
26. Reference angles can determine the
75 0.9659 0.2588 3.7321 trigonometric ratio of any angle in quadrant
90 1 0 undefined I. Adjust the signs of the trigonometric ratios
105 0.9659 -0.2588 -3.7321 for quadrants II, III, and IV, considering that
the sine ratio is positive in quadrant II and
120 0.8660 -0.5 -1.7321
negative in quadrants III and IV, the cosine
135 0.7071 -0.7071 -1 ratio is positive in the quadrant IV but negative
150 0.5 -0.8660 -0.5774 in quadrants II and III, and the tangent ratio
165 0.2588 -0.9659 -0.2679 is positive in quadrant III but negative in
quadrants II and IV.
180 0 -1 0
27. Use the reference triangle to identify the
b) As increases from 0 to 180, sin measure of the reference angle, and then adjust
increases from a minimum of 0 to a for the fact that P is in quadrant III. Since
maximum of 1 at 90 and then decreases to tan R = _ 9 , you can find the reference angle to
0 again at 180. sin = sin (180 - ). 5
be 61. Since the angle is in quadrant III, the
Cos decreases from a maximum of 1 at 0
angle is 180 + 61 or 241.
and continues to decrease to a minimum
28. Sine is the ratio of the opposite side to the
value of -1 at 180. cos = -cos (180 - ).
hypotenuse. The hypotenuse is the same value,
Tan increases from 0 to being undefined
r, in all four quadrants. The opposite side, y, is
at 90 then back to 0 again at 180.
positive in quadrants I and II and negative in
c) For 0 90, cos = sin (90 - ).
quadrants III and IV. So, there will be exactly
For 90 180, cos = -sin ( - 90).
two sine ratios with the same positive values in
d) Sine ratios are positive in quadrants I and
quadrants I and II and two sine ratios with the
II, and both the cosine and tangent ratios
same negative values in quadrants III and IV.
are positive in quadrant I and negative in
29. = 240. Both the sine ratio and the cosine
quadrant II.
ratio are negative, so the terminal arm must
e) In quadrant III, the sine and cosine ratios are
be in quadrant III. The __value of the reference
negative and the tangent ratios are positive.
In quadrant IV, the cosine ratios are positive angle when sin R = _
3
is 60. The angle in
2
and the sine and tangent___
ratios are negative. quadrant III is 180 + 60 or 240.
22. _ 6
a) sin = ___ or __
6 37
, 30. Step 4
37 37
___ a) As point A moves around the circle, the sine
cos = _ 1___ or _
37
, tan = 6 ratio increases from 0 to 1 in quadrant I,
37 37
b) _1 decreases from 1 to 0 in quadrant II,
20 decreases from 0 to -1 in quadrant III,
23. As increases from 0 to 90, x decreases from and increases from -1 to 0 in quadrant
12 to 0, y increases from 0 to 12, sin increases IV. The cosine ratio decreases from 1 to
from 0 to 1, cos decreases from 1 to 0, and 0 in quadrant I, decreases from 0 to -1
tan increases
______
from 0 to undefined. in quadrant II, increases from -1 to 0 in
tan = __
1 - a2 quadrant III, and increases from 0 to 1 in
24.
a
quadrant IV. The tangent ratio increases
25. Since BOA__is 60, the coordinates of point
from 0 to infinity in quadrant I, is undefined
A are _
( 1, _
)
3
. The coordinates of point B for an angle of 90, increases from negative
2 2
are (1, 0) and of point C are (-1, 0). Using the infinity to 0 in the second quadrant,
increases from 0 to positive infinity in the
Pythagorean theorem d2 = (x2 - x1)2 + (y2 - y1)2,
__ third quadrant, is undefined for an angle of
dAB = 1, dBC = 2, and dAC = 3 .
270, and increases from negative infinity to
Then, AB2 = 1, AC2 = 3, and BC2 = 4.
0 in quadrant IV.
So, AB2 + AC2 = BC2.
522 MHR Answers
b) The sine and cosine ratios are the same d) BC = 6.0 cm
when A is at approximately (3.5355, 3.5355) C
and (-3.5355, -3.5355). This corresponds to
78 x
45 and 225.
c) The sine ratio is positive in quadrants I B
23
and II and negative in quadrants III and 15 cm
A
IV. The cosine ratio is positive in quadrant 6. a) two solutions b) one solution
I, negative in quadrants II and III, and c) one solution d) no solutions
positive in quadrant IV. The tangent ratio is 7. a) a > b sin A, a > h, b > h
positive in quadrant I, negative in quadrant b) a > b sin A, a > h, a < b
II, positive in quadrant III, and negative in c) a = b sin A, a = h
quadrant IV. d) a > b sin A, a > h, a b
d) When the sine ratio is divided by the cosine 8. a) A = 48, B = 101, b = 7.4 cm or
ratio, the result is the tangent ratio. This A = 132, B = 17, b = 2.2 cm
is true for all angles as A moves around b) P = 65, R = 72, r = 20.9 cm or
the circle. P = 115, R = 22, r = 8.2 cm
c) no solutions
2.3 The Sine Law, pages 108 to 113
9. a) a 120 cm b) a = 52.6 cm
1. a) 8.9 b) 50.0 c) 52.6 cm < a < 120 cm
c) 8 d) 44 d) a < 52.6 cm
2. a) 36.9 mm b) 50.4 m 10. a)
3. a) 53 b) 58
4. a) C = 86, A = 27, a = 6.0 m or
C = 94, A = 19, a = 4.2 m
b) C = 54, c = 40.7 m, a = 33.6 m
c) B = 119, c = 20.9 mm, a = 12.4 mm 49 64
Roy Maria
d) B = 71, c = 19.4 cm, a = 16.5 cm 500 m
5. a) AC = 30.0 cm b) 409.9 m
B 11. 364.7 m
24 cm
12. 41
73
13. 4.5 m
14. a) M
A 57
21

x
3
h
C 66 m
b) AB = 52.4 cm b) 4.1 m c) 72.2 m
B 15. a) 1.51 b) 0.0151 mm
16. least wingspan 9.1 m, greatest wingspan 9.3 m
38 17. a) Since a < b (360 < 500) and
a > b sin A (360 > 500 sin 35), there are
x 63 cm
two possible solutions for the triangle.
b) second
stop B
56 cairn
A C
C second
c) AB = 34.7 m 52.8 360 m
360 m 17.8 stop
B B
cairn x 127.2
50 500 m
x C 92.2 x

500 m 35 A
A 50 first
35
stop
27 m
C A first
stop

Answers MHR 523


c) Armands second stop could be either 25. B
191.9 m or 627.2 m from his first stop.
18. 911.6 m
19. a c
Statements Reasons

sin C = _h sin B = _h sin B ratio in ABD


b c sin C ratio in ACD A
C b
h = b sin C In ABC,
Solve each ratio for h.
sin A = _ a and sin B = _
h = c sin B b
c c
Equivalence property
b sin C = c sin B
or substitution Thus, c = __a and c = _ b .
sin A sin B
_
sin C
=_
sin B
Divide both sides by bc. Then, __ a =_ b .
c b sin A sin B
This is only true for a right triangle and does
20. C not show a proof for oblique triangles.
b a 26. a) 12.9 cm
__ __
b) (4 5 + 4) cm or 4( 5 + 1) cm
A B c) 4.9 cm
c
Given A = B, prove that side AC = BC, d) 3.1 cm
or a = b. e) The spiral is created by connecting the
Using the sine law, 36 angle vertices for the reducing golden
__a =_ b triangles.
sin A sin B 27. Concept maps will vary.
But A = B, so sin A = sin B. 28. Step 1
Then, __ a = __ b .
sin A sin A
So, a = b.
21. 14.1 km2
B
22. a) 32.1 cm < a < 50.0 cm
C
50.0 cm D
40
A B
b) a < 104.2 cm
C A C
125.7 cm Step 2
56 a) No.
A B
b) There are no triangles formed when BD is
c) a = 61.8 cm
less than the distance from B to the line AC.
C Step 3

73.7 cm
B

57
A B
23. 166.7 m
24. a) There is no known side opposite a known A D C
angle. a) Yes.
b) There is no known angle opposite a known b) One triangle can be formed when BD equals
side. the distance from B to the line AC.
c) There is no known side opposite a known
angle.
d) There is no known angle and only one
known side.

524 MHR Answers


Step 4 e)
B
18.4 m
9.6 m
B A 10.8 m C
A = 24
f) B

A D D C

a) Yes. 4.6 m
3.2 m
b) Two triangles can be formed when BD is greater
than the distance from B to the line AC.
Step 5 A 2.5 m C
a) Yes. C = 107
b) One triangle is formed when BD is greater 5. a) Use the cosine law because three sides are
than the length AB. given (SSS). There is no given angle and
Step 6 The conjectures will work so long as opposite side to be able to use the sine law.
A is an acute angle. The relationship changes b) Use the sine law because two angles and an
when A > 90. opposite side are given.
c) Use the cosine law to find the missing side
2.4 The Cosine Law, pages 119 to 125 length. Then, use the sine law to find the
1. a) 6.0 cm b) 21.0 mm c) 45.0 m indicated angle.
2. a) J = 34 b) L = 55 6. a) 22.6 cm
c) P = 137 d) C = 139
b) 7.2 m
3. a) Q = 62, R = 66, p = 25.0 km
7. 53.4 cm
b) S = 100, R = 33, T = 47
8. 2906 m
4. a) B 9. The angles between the buoys are 35, 88,
and 57.
24 cm 10. 4.2
11. 22.4 km
67 12. 54.4 km
A 34 cm C
13. 458.5 cm
BC = 33.1 cm 14. a)
137
b) B
15 cm 5 km
24 8 cm 8 km

A C 42 Julia and Isaac


AC = 8.4 m
c) B base camp
b) 9.1 km
9 cm c) 255
15. 9.7 m
48 16. Use the cosine law in each oblique triangle to
A 10 cm C find the measure of each obtuse angle. These
AB = 7.8 cm three angles meet at a point and should sum
d) B to 360. The three angles are 118, 143, and
99. Since 118 + 143 + 99 = 360, the side
15 cm
measures are accurate.
9 cm 17. The interior angles of the bike frame are 73,
62, and 45.
A C 18. 98.48 m
12 cm
19. 1546 km
B = 53

Answers MHR 525


20. 438.1 m Prove that c2 =____________
a2 + b2 - 2ab cos C:
2
21. The interior angles of the building are 65, 32, Left Side = ( (a + x)2 + y 2 )
and 83. = (a + x)2 + y 2
22. = a2 + 2ax + x 2 + y 2
_______ 2
Statement Reason Right Side = a2 + ( x 2 + y 2 )
- 2a( x 2 + y 2 ) - __
_______
Use the Pythagorean x
c 2 = (a - x)2 + h 2
Theorem in ABD. (
_______
x 2 + y 2 )
Expand the square of a = a2 + x 2 + y 2 + 2ax
c 2 = a 2 - 2ax + x2 + h 2
binomial. = a2 + 2ax + x 2 + y 2
Use the Pythagorean
Left Side = Right Side
b 2 = x2 + h 2 Therefore, the cosine law is true.
Theorem in ACD.
30. 115.5 m
c 2 = a 2 - 2ax + b 2 Substitute b2 for x2 + h2.
31. a) 228.05 cm2
cos C = _
x Use the cosine ratio in b) 228.05 cm2
b ACD. c) These methods give the same measure when
x = b cos C Multiply both sides by b. C = 90.
Substitute b cos C for x in d) Since cos 90 = 0, 2ab cos 90 = 0, so
c 2 = a 2 - 2ab cos C + b 2 a2 + b2 - 2ab cos 90 = a2 + b2. Therefore,
step 4.
c2 can be found using the cosine law or
c 2 = a 2 + b 2 - 2ab cos C Rearrange.
the Pythagorean Theorem when there is a
23. 36.2 km right triangle.
24. No. The three given lengths cannot be arranged 32.
Concept Summary for Solving a Triangle
to form a triangle ( 2 + b 2 < c 2). When using
the cosine law, the cosines of the angles are Begin by Using
either greater than 1 or less than -1, which Given the Method of
is impossible. Right triangle A
25. 21.2 cm Two angles and any side B
26. ABC = 65, ACD = 97 Three sides C
27. 596 km2
Three angles D
28. 2.1 m
29. y Two sides and the included angle C
B(-x, y) Two sides and the angle opposite
B
one of them

33. Step 2
c
b a) A = 29, B = 104, C = 47
b) The angles at each vertex of a square are 90.
R
A(a, 0) Therefore,
C(0, 0) a x 360 = ABC + 90 + GBF + 90
180 = ABC + GBF
GBF = 76, HCI = 133, DAE = 151
cos R = -cos = - __ x
_______ c) GF = 6.4 cm, ED = 13.6 cm, HI = 11.1 cm
x2 + y 2 Step 3
_______
x2 + y 2
b = ____________ a) For HCI, the altitude from C to HI is
c = (a + x)2 + y 2 2.1 cm. For AED, the altitude from A to
DE is 1.6 cm. For BGF, the altitude from
B to GF is 3.6 cm. For ABC, the altitude
from B to AC is 2.9 cm.
b) area of ABC is 11.7 cm2, area of BGF is
11.7 cm2, area of AED is 11.7 cm2, area of
HCI is 11.7 cm2

526 MHR Answers


__
Step 4 All four triangles have the same area. b) sin 120 = _
3
, cos 120 = - _
1,
2 __ 2
Since you use reference angles to determine the tan 120 = - 3
altitudes, the product of _1 bh will determine __
c) sin 330 = - _ , cos 330 = _ ,
1 3
2
the same area for all triangles. This works for 2 __ 2
tan 330 = - _1__ or - _ 3
any triangle.
3 __ 3
Chapter 2 Review, pages 126 to 128 d) sin 135 = _1__ or _
2
,
2 2 __
cos 135 = - _ 1__ or - _
1. a) E b) D c) B d) A 2
, tan 135 = -1
e) F f) C g) G 2 2
6. a) y
2. a) y
Q(-3, 6)
200
R 0 x
0 x

___ __
Quadrant III, R = 20 b) 45 or 3 5 __
b) c) sin = _
6___ or _
2 5
,
y 45 5 __
cos = - _
3___ or - _
5
130
, tan = -2
45 5
R d) 117
0 x 7. (2, 5), (-2, 5), (-2, -5)
8. a) sin 90 = 1, cos 90 = 0, tan 90 is
undefined
b) sin 180 = 0, cos 180 = -1, tan 180 = 0
Quadrant II, R = 50
c)
_4
9. a) cos = - , tan = _3
y 5 4
__ __
b) sin = - _ 8
or - _
2 2
,
3__ 3__
20
tan = - 8 or -2 2

0 x
c) sin = _
12 , cos = _ 5
13 13
10. a) 130 or 310 b) 200 or 340
c) 70 or 290
Quadrant I, R = 20
11. a) Yes; there is a known angle
d) y
(180 - 18 - 114 = 48) and a known
opposite side (3 cm), plus another
330
known angle.
0 R x b) Yes; there is a known angle (90) and
opposite side (32 cm), plus one other
known side.
c) No; there is no known angle or
Quadrant IV, R = 30 opposite side.
3. No. Reference angles are measured from the 12. a) C = 57, c = 36.9 mm
x-axis. The reference angle is 60. b) A = 78, B = 60
4. quadrant I: = 35, quadrant II: = 180 - 35 13. R
or 145, quadrant III: = 180 + 35 or 215,
quadrant IV: = 360 - 35__or 325
5. a) sin 225 = - _
1__ or - _2
,
q p
2 2__
cos 225 = - _ 1__ or - _
2
, tan 225 = 1 63.5 51.2
2 2
P 6.3 cm Q
R = 65.3, q = 5.4 cm, p = 6.2 cm

Answers MHR 527


14. 2.8 km c) C
15. a) Ship B, 50.0 km 8m
b) S 24
A 15 m B

A = 23, C = 133, AC = 8.4 m


h 23. a)
47 49
A x B
53.6 km/h
68 km
Use tan 49 = _ h and tan 47 = __ h .
x 68 - x
Solve x tan 49 = (68 - x) tan 47.
54
x = 32.8 km
48 km/h
Then, use cos 49 = _ 32.8 and cos 47 = _35.2
BS AS b) 185.6 km
to find BS and AS. 24. a) 6 cm
AS = 51.6 km, BS = 50.0 km
122
16. no solutions if a < b sin A, one solution if 4 cm
a = b sin A or if a b, and two solutions if
58
b > a > b sin A
17. a) b) 8.8 cm and 5.2 cm
720 km
70 360 km
20 Chapter 2 Practice Test, pages 129 to 130

b) 47 E of S 1. A
c) 939.2 km 2. A
18. a) The three sides do not meet to form a 3. C
triangle since 4 + 2 < 7. 4. B
b) A + C > 180 5. C
c) Sides a and c lie on top of side b, so no 6. -6
triangle is formed. 7. a) Oak Bay
d) A + B + C < 180
19. a) sine law; there is a known angle and
1.1 km
a known opposite side plus another
79
known angle 57
b) cosine law; there is a known Ross Bay 1.9 km
SAS (side-angle-side) b) 2.6 km
20. a) a = 29.1 cm
8. a) two
b) B = 57
b) B = 53, C = 97, c = 19.9 or
21. 170.5 yd
B = 127, C = 23, c = 7.8
22. a) C 9. R = 17
10.8 m 9.6 m
10. a) Q
A 18.4 m B

A = 24
10 cm
b) C P 56

12 cm
48
R
10 cm 9 cm b) R = 40, Q = 84, r = 7.8 cm or
R = 28, Q = 96, r = 5.7 cm
11. 5.2 cm
A B 12. a) 44 b) 56 c) 1.7 m
13. quadrant I: = R, quadrant II: = 180 - R,
AB = 7.8 cm
quadrant III: = 180 + R,
quadrant IV: = 360 - R

528 MHR Answers


14. a) second base 7. 201 m
8. a) r = 0.1, S = 1
70 ft b) Answers will vary.
__
9. 2 5
pitchers x
first
10. sin = _
8 , cos = _
15 , tan = _
8
mound base 17 17 15
50 ft 11. a) 40 b) 60
70 ft y y
120
home plate 40
b) a2 + b2 = c2 0 x 0 x
70 + 702 = c2
2

c = 99
c) 45 d) 60
Second base to pitchers mound is 99 - 50
y y
or 49 ft.
Distance from first base to pitchers mound 225 300
is x 2 = 502 + 702 - 2(50)(70) cos 45 or 0 x
0 x
49.5 ft.
15. Use the sine law when the given information
includes a known angle and a known opposite 12. a) 90
side, plus one other known side or angle. Use b) y
the cosine law when given oblique triangles (0, 2)
with known SSS or SAS. 2
16. patio triangle: 38, 25, 2.5 m; shrubs triangle:
1
55, 2.7 m, 3.0 m
17. 3.1 km
-2 -1 0 1 2 x
Cumulative Review, Chapters 12,
pages 133 to 135
c) sin = 1, cos = 0, tan is undefined
__
1. a) A b) D c) E d) C e) B
13. a) sin 405 = _
1__ or _
2

2. a) geometric, r = _2 ; _
16 , _
32 , _
64 2
__ 2
3 3 9 27
cos 330 = _
3
b) arithmetic, d = -3; 5, 2, -1 b)
2
c) arithmetic, d = 5; -1, 4, 9 c) tan 225 = 1
d) geometric, r = -2; 48, -96, 192 d) cos 180 = -1 __
3. a) tn = -3n + 21
e) tan 150 = = - _
1__ or - _
3

b) tn = _ n - _
3 1 3 3
2 2 f) sin 270 = -1
4. tn = 2(-2)n - 1 t20 = -220 or -1 048 576 14. The bear is 8.9 km from station A and 7.4 km
5. a) S12 = 174 b) S5 = 484 from station B.
6. a) y Phytoplankton Production 15. 9.4
50 16. a) woodpecker b) 40.8 m
45
Phytoplankton (t)

40
35
30
25
20 Chelsea 52 70
15 16 m
10 17. 134.4
5

0 1 2 3 4 5 6 x Unit 1 Test, pages 136 to 137


Number of 11-Day Cycles
1. B
b) tn = 10n
2. C
c) The general term is a linear equation with a
3. D
slope of 10.

Answers MHR 529


4. C b) The shapes of the y
5. D graphs are the same
6
6. $0.15 per cup with the parabola of
2
7. 45 y = (x - 2) being two 4
8. 300 units to the right.
9. 2775 vertex: (2, 0), axis 2
10. a) 5 b) -6 of symmetry: x = 2,
c) tn = 5n - 11 d) S10 = 165 domain: {x | x R}, 0 2 4 x
11. $14 880.35 range: y = (x - 2)2
-2
12. 4 km {y | y 0, y R},
( _21 )
n-1
13. a) 64, 32, 16, 8, b) tn = 64 x-intercept occurs
at (2, 0), y-intercept occurs at (0, 4)
c) 63 games
c) The shapes of the graphs are the same
14. a) y with the parabola of y = x 2 - 4 being
four units lower.
y
0 x 2

-4 -2 0 2 4 x
b) 60, 120, 180, 240, 300, 360 -2
c) tn = 60n y = x2 - 4
15. a) 58 b) 5.3 m -4
16. 38
vertex: (0, -4), axis of symmetry: x = 0,
Chapter 3 Quadratic Functions domain: {x | x R},
range: {y | y -4, y R},
3.1 Investigating Quadratic Functions in Vertex x-intercepts occur at (-2, 0) and (2, 0),
Form, pages 157 to 162 y-intercept occurs at (0, -4)
d) The shapes of the graphs are the same with
1. a) Since a > 0 in f (x) = 7x 2, the graph opens the parabola of y = (x + 3)2 being three units
upward, has a minimum value, and has a to the left.
range of {y | y 0, y R}.
y
b) Since a > 0 in f (x) = _1 x 2, the graph opens
y = (x + 3)2
6 10
upward, has a minimum value, and has a
range of {y | y 0, y R}. 8
c) Since a < 0 in f (x) = -4x 2, the graph opens
downward, has a maximum value, and has a 6
range of {y | y 0, y R}.
4
d) Since a < 0 in f (x) = -0.2x 2, the graph
opens downward, has a maximum value, 2
and has a range of {y | y 0, y R}.
2. a) The shapes of the graphs y
-6 -4 -2 0 2 x
are the same with the
6
parabola of y = x 2 + 1
being one unit higher. vertex: (-3, 0), axis of symmetry: x = -3,
4
vertex: (0, 1), axis of domain: {x | x R},
symmetry: x = 0, 2 range: {y | y 0, y R},
domain: {x | x R}, x-intercept occurs at (-3, 0),
y = x2 + 1
range: {y | y 1, y R}, y-intercept occurs at (0, 9)
-2 0 2 x
no x-intercepts, y-intercept
occurs at (0, 1)

530 MHR Answers


3. a) Given the graph of y = x 2, move the entire c) y
graph 5 units to the left and 11 units up. y = -3(x - 1)2 + 12
12
b) Given the graph of y = x 2, apply the change
in width, which is a multiplication of the 10
y-values by a factor of 3, making it narrower,
reflect it in the x-axis so it opens downward, 8
and move the entire new graph down
10 units. 6
c) Given the graph of y = x 2, apply the change
4
in width, which is a multiplication of the
y-values by a factor of 5, making it narrower. 2
Move the entire new graph 20 units to the
left and 21 units down.
-2 0 2 4 6 x
d) Given the graph of y = x 2, apply the change
in width, which is a multiplication of the -2

y-values by a factor of _ 1 , making it wider,


8
reflect it in the x-axis so it opens downward, vertex: (1, 12), axis of symmetry: x = 1,
and move the entire new graph 5.6 units to opens downward, maximum value of 12,
the right and 13.8 units up. domain: {x | x R},
4. a) range: {y | y 12, y R},
y y = -(x - 3)2 + 9
x-intercepts occur at (-1, 0) and (3, 0),
8 y-intercept occurs at (0, 9)
d) y
6
2
4

2 -2 0 2 4 6 x
-2
1
-2 0 2 4 6 x y = _ (x - 2)2 - 2
-4 2
-2
vertex: (2, -2), axis of symmetry: x = 2,
opens upward, minimum value of -2,
vertex: (3, 9), axis of symmetry: x = 3, domain: {x | x R},
opens downward, maximum value of 9, range: {y | y -2, y R},
domain: {x | x R}, range: {y | y 9, y R}, x-intercepts occur at (0, 0) and (4, 0),
x-intercepts occur at (0, 0) and (6, 0), y-intercept occurs at (0, 0)
5. a) y1 = x 2, y2 = 4x 2 + 2, y3 = _ x 2 - 2,
y-intercept occurs at (0, 0) 1
b) 2
y4 = _
y 1 x2 - 4
6 4
b) y1 = -x 2, y2 = -4x 2 + 2, y3 = - _ x 2 - 2,
1
2
4 y4 = - _1 x2 - 4
4
2 c) y1 = (x + 4)2, y2 = 4(x + 4)2 + 2,
y = 0.25(x + 4) + 1
2
y3 = _1 (x + 4)2 - 2, y = _ 1 (x + 4)2 - 4
2 4 4
d) y1 = x 2 - 2, y2 = 4x 2, y3 = _ x 2 - 4,
-8 -6 -4 -2 0 2 x 1
2
vertex: (-4, 1), axis of symmetry: x = -4, y4 = _1 x2 - 6
4
opens upward, minimum value of 1, 6. For the function f (x) = 5(x - 15)2 - 100, a = 5,
domain: {x | x R}, range: {y | y 1, y R}, p = 15, and q = -100.
no x-intercepts, y-intercept occurs at (0, 5) a) The vertex is located at (p, q), or (15, -100).
b) The equation of the axis of symmetry is
x = p, or x = 15.
c) Since a > 0, the graph opens upward.

Answers MHR 531


d) Since a > 0, the graph has a minimum value 14. a) The vertex is located at (36, 20 000), it opens
of q, or -100. downward, and it has a change in width by
e) The domain is {x | x R}. Since the function a multiplication of the y-values by a factor of
has a minimum value of -100, the range is 2.5 of the graph y = x 2. The equation of the
{y | y -100, y R}. axis of symmetry is x = 36, and the graph
f) Since the graph has a minimum value of has a maximum value of 20 000.
-100 and opens upward, there are two b) 36 times
x-intercepts. c) 20 000 people
7. a) vertex: (0, 14), axis of symmetry: x = 0, 15. Examples: If the vertex is at the origin, the
opens downward, maximum value of 14, quadratic function will be y = 0.03x 2. If the
domain: {x | x R}, edge of the rim is at the origin, the quadratic
range: {y | y 14, y R}, two x-intercepts function will be y = 0.03(x - 20)2 - 12.
b) vertex: (-18, -8), axis of symmetry: 16. a) Example: Placing the vertex at the origin,
x = -18, opens upward, minimum value the quadratic function is y = _ 1 x 2 or
294
of -8, domain: {x | x R}, y 0.0034x .2

range: {y | y -8, y R}, two x-intercepts b) Example: If the origin is at the top of
c) vertex: (7, 0), axis of symmetry: x = 7, opens the left tower, the quadratic function is
upward, minimum value of 0, domain: y=_ 1 (x - 84)2 - 24 or
{x | x R}, range: {y | y 0, y R}, one 294
y 0.0034(x - 84)2 - 24. If the origin is
x-intercept
at the top of the right tower, the quadratic
d) vertex: (-4, -36), axis of symmetry: x = -4,
opens downward, maximum value of -36, function is y = _ 1 (x + 84)2 - 24 or
294
domain: {x | x R}, y 0.0034(x + 84)2 - 24.
range: {y | y -36, y R}, no x-intercepts c) 8.17 m; this is the same no matter which
8. a) y = (x + 3)2 - 4 b) y = -2(x - 1)2 + 12 function is used.
_1
c) y = (x - 3) + 12
d) y = - _ (x + 3)2 + 4
1 17. y = -_ 9 (x - 11)2 + 9
2 4 121
a) y = - _ x 2 y = -_
9.
1 b) y = 3x 2 - 6 18.
1 (x - 60)2 + 90
4 40
c) y = -4(x - 2)2 + 5 d) y = _ (x + 3)2 - 10
1 19. Example: Adding q is done after squaring the
5 x-value, so the transformation applies directly
10. a) (4, 16) (-1, 16) (-1, 24)
to the parabola y = x2. The value of p is added
b) (4, 16) (4, 4) (4, -4)
or subtracted before squaring, so the shift is
c) (4, 16) (4, -16) (14, -16)
opposite to the sign in the bracket to get back to
d) (4, 16) (4, 48) (4, 40)
the original y-value for the graph of y = x2.
11. Starting with the graph of y = x2, apply the
a) y = - __ (x - 8000)2 + 10 000
20.
7
change in width, which is a multiplication of 160 000
the y-values by a factor of 5, reflect the graph in b) domain: {x | 0 x 16 000, x R},
the x-axis, and then move the entire graph up range: {y | 7200 y 10 000, y R}
20 units. 21. a) Since the vertex is located at (6, 30), p = 6
12. Example: Quadratic functions will always have and q = 30. Substituting these values into
one y-intercept. Since the graphs always open the vertex form of a quadratic function and
upward or downward and have a domain of using the coordinates of the given point, the
{x | x R}, the parabola will always cross the function is y = -1.5(x - 6)2 + 30.
y-axis. The graphs must always have a value at b) Knowing that the x-intercepts are -21 and
x = 0 and therefore have one y-intercept. -5, the equation of the axis of symmetry
a) y = _ x 2
13.
1 must be x = -13. Then, the vertex is located
30 at (-13, -24). Substituting the coordinates
b) The new function could be
of the vertex and one of the x-intercepts into
y=_ 1 (x - 30)2 - 30 or y = _ 1 (x + 30)2 - 30.
the vertex form, the quadratic function is
30 30
Both graphs have the same size and shape, y = 0.375(x + 13)2 - 24.
but the new function has been transformed
by a horizontal translation of 30 units to the
right or to the left and a vertical translation
of 30 units down to represent a point on the
edge as the origin.

532 MHR Answers


22. a) Examples: I chose x = 8 as the axis of d) This is a quadratic function. Once the
symmetry, I choose the position of the hoop expression is expanded, it is a polynomial of
to be (1, 10), and I allowed the basketball to degree two.
be released at various heights (6 ft, 7 ft, and 2. a) The coordinates of the vertex are (-2, 2).
8 ft) from a distance of 16 ft from the hoop. The equation of the axis of symmetry is
For each scenario, substitute the coordinates x = -2. The x-intercepts occur at (-3, 0)
of the release point into the function and (-1, 0), and the y-intercept occurs at
y = a(x - 8)2 + q to get an expression for q. (0, -6). The graph opens downward, so the
Then, substitute the expression for q and the graph has a maximum of 2 of when x = -2.
coordinates of the hoop into the function. The domain is {x | x R} and the range is
My three functions are {y | y 2, y R}.
y = -_ 4 (x - 8)2 + _346 , b) The coordinates of the vertex are (6, -4).
15 15 The equation of the axis of symmetry is
y = -_ 3 (x - 8)2 + _297 , and
15 15 x = 6. The x-intercepts occur at (2, 0) and
y = -_ 2 (x - 8)2 + _248 . (10, 0), and the y-intercept occurs at (0, 5).
15 15 The graph opens upward, so the graph has
b) Example: y = - _ 4 (x - 8)2 + _346 ensures a minimum of -4 when x = 6. The
15 15
that the ball passes easily through the hoop. domain is {x | x R} and the range is
c) domain: {x | 0 x 16, x R}, {y | y -4, y R}.
c) The coordinates of the vertex are (3, 0). The
range: y | 0 y _
{ 346 , y R
} equation of the axis of symmetry is x = 3.
15
23. (m + p, an + q) The x-intercept occurs at (3, 0), and the
24. Examples: y-intercept occurs at (0, 8). The graph opens
a) f (x) = -2(x - 1)2 + 3 upward, so the graph has a minimum of 0
b) Plot the vertex (1, 3). Determine a point on when x = 3. The domain is {x | x R} and
the curve, say the y-intercept, which occurs the range is {y | y 0, y R}.
at (0, 1). Determine that the corresponding 3. a) f (x) = -10x 2 + 50x
point of (0, 1) is (2, 1). Plot these two b) f (x) = 15x 2 - 62x + 40
additional points and complete the sketch of 4. a) f(x)
the parabola.
2
25. Example: You can determine the number of
x-intercepts if you know the location of the
vertex and the direction of opening. Visualize -4 -2 0 2 4 x
the general position and shape of the graph -2
based on the values of a and q. Consider
f (x) = 0.5(x + 1)2 - 3, g(x) = 2(x - 3)2, and -4
f(x) = x2 - 2x - 3
h(x) = -2(x + 3)2 - 4. For f (x), the parabola
opens upward and the vertex is below the vertex is (1, -4); axis of symmetry is x = 1;
x-axis, so the graph has two x-intercepts. opens upward; minimum value of -4 when
For g(x), the parabola opens upward and x = 1; domain is {x | x R},
the vertex is on the x-axis, so the graph has range is {y | y -4, y R};
one x-intercept. For h(x), the parabola opens x-intercepts occur at (-1, 0) and (3, 0),
downward and the vertex is below the x-axis, y-intercept occurs at (0, -3)
so the graph has no x-intercepts. b) f(x)
26. Answers may vary. f(x) = -x2 + 16
16
3.2 Investigating Quadratic Functions in Standard
12
Form, pages 174 to 179
8
1. a) This is a quadratic function, since it is a
polynomial of degree two. 4
b) This is not a quadratic function, since it is a
polynomial of degree one.
-4 -2 0 2 4 x
c) This is not a quadratic function. Once the
expression is expanded, it is a polynomial of
degree three.

Answers MHR 533


vertex is (0, 16); axis of symmetry is x = 0; b)
opens downward; maximum value of 16
when x = 0; domain is {x | x R}, range is
{y | y 16, y R}; x-intercepts occur at (-4,
0) and (4, 0), y-intercept occurs at (0, 16)
c) p(x)
vertex is (1.3, 6.1); axis of symmetry is
4 x = 1.3; opens downward; maximum value
of 6.1 when x = 1.3; domain is {x | x R},
2
range is {y | y 6.1, y R};
x-intercepts occur at (-0.5, 0) and (3, 0),
-6 -4 -2 0 2 x y-intercept occurs at (0, 3)
-2 c)

-4

-6

-8 vertex is (6.3, 156.3); axis of symmetry is


p(x) = x + 6x
2
x = 6.3; opens downward; maximum value
vertex is (-3, -9); axis of symmetry is of 156.3 when x = 6.3; domain is {x | x R},
x = -3; opens upward; minimum value range is {y | y 156.3, y R};
of -9 when x = -3; domain is x-intercepts occur at (0, 0) and (12.5, 0),
{x | x R}, range is {y | y -9, y R}; y-intercept occurs at (0, 0)
x-intercepts occur at (-6, 0) and (0, 0), d)
y-intercept occurs at (0, 0)
d) g(x)

-2 0 2 4 6 x
g(x) = -2x2 + 8x - 10
-2 vertex is (-3.2, 11.9); axis of symmetry is
x = -3.2; opens upward; minimum value of
-4
11.9 when x = -3.2; domain is {x | x R},
-6 range is {y | y 11.9, y R};
no x-intercepts,
-8 y-intercept occurs at (0, 24.3)
6. a) (-3, -7) b) (2, -7) c) (4, 5)
-10 7. a) 10 cm, h-intercept of the graph
b) 30 cm after 2 s, vertex of the parabola
vertex is (2, -2); axis of symmetry is x = 2; c) approximately 4.4 s, t-intercept of the graph
opens downward; maximum value of -2 d) domain: {t | 0 t 4.4, t R},
when x = 2; domain is {x | x R}, range range: {h | 0 h 30, h R}
is {y | y -2, y R}; no x-intercepts, e) Example: No, siksik cannot stay in the air
y-intercept occurs at (0, -10) for 4.4 s in real life.
5. a) 8. Examples:
a) Two; since the graph has a maximum
value, it opens downward and would
cross the x-axis at two different points.
One x-intercept is negative and the other
is positive.
vertex is (-1.2, -10.1); axis of symmetry is b) Two; since the vertex is at (3, 1) and the
x = -1.2; opens upward; minimum value of graph passes through the point (1, -3), it
-10.1 when x = -1.2; domain is {x | x R}, opens downward and crosses the x-axis
range is {y | y -10.1, y R}; at two different points. Both x-intercepts
x-intercepts occur at (-3, 0) and (0.7, 0), are positive.
y-intercept occurs at (0, -6)

534 MHR Answers


c) Zero; since the graph has a minimum of 1 and d) y (2, 5)
opens upward, it will not cross the x-axis.
4
d) Two; since the graph has an axis of
symmetry of x = -1 and passes through 2
(0, 1) (4, 1)
the x- and y-axes at (0, 0), the graph could
open upward or downward and has another x
-4 -2 0 2 4
x-intercept at (-2, 0). One x-intercept is zero
-2
and the other is negative. x=2
9. a) domain: {x | x R}, range: {y | y 68, y R}
b) domain: {x | 0 x 4.06, x R}, 11. a) {x | 0 x 80, x R}
range: {y | 0 y 68, y R} b)
c) Example: The domain and range of algebraic
functions may include all real values. For
given real-world situations, the domain and
range are determined by physical constraints
such as time must be greater than or equal to
zero and the height must be above ground, c) The maximum depth of the dish is 20 cm,
or greater than or equal to zero. which is the y-coordinate of the vertex
10. Examples: (40, -20). This is not the maximum
a) y value of the function. Since the parabola
x=1 opens upward, this the minimum value of
4
the function.
2 d) {d | -20 d 0, d R}
e) The depth is approximately 17.19 cm, 25 cm
(-1, 0) (3, 0)
from the edge of the dish.
-4 -2 0 2 4 x
12. a)
-2

-4
(1, -4)

b) y
x = -3
4 b) The h-intercept represents the height of
the log.
2
c) 0.1 s; 14.9 cm
(-5, 0) (-1, 0) d) 0.3 s
-6 -4 -2 0 2 x e) domain: {t | 0 t 0.3, t R},
-2 range: {h | 0 h 14.9, h R}
f) 14.5 cm
-4 13. Examples:
(-3, -4)
a) {v | 0 v 150, v R}
b)
c) y v f
0 0
8
25 1.25
6
(-1, 6) (3, 6) 50 5
4 75 11.25
100 20
2
(1, 2) 125 31.25

x 150 45
-4 -2 0 2 4
x=1

Answers MHR 535


f(v) d) The vertex indicates the maximum area of
the rectangle.
50
e) domain: {x | -2 x 10, x R}, range:
40 {A | 0 A 72, A R}; the domain
represents the values for x that will produce
30 dimensions of a rectangle. The range
f(v) = 0.002v2 represents the possible values of the area of
20
the rectangle.
f) The function has both a maximum value and a
10
minimum value for the area of the rectangle.
g) Example: No; the function will open
0 25 50 75 100 125 150 v downward and therefore will not have
a minimum value for a domain of
c) The graph is a smooth curve instead of a real numbers.
straight line. The table of values shows that 16. Example: No; the simplified version of the
the values of f are not increasing at a constant function is f(x) = 3x + 1. Since this is not a
rate for equal increments in the value of v. polynomial of degree two, it does not represent
d) The values of the drag force increase by a a quadratic function. The graph of the function
value other than 2. When the speed of the f(x) = 4x2 - 3x + 2x(3 - 2x) + 1 is a
vehicle doubles, the drag force quadruples. straight line.
e) The driver can use this information to 17. a) A = -2x 2 + 140x; this is a quadratic
improve gas consumption and fuel economy. function since it is a polynomial of
14. a) degree two.
b)

The coordinates of the vertex are


(81, 11 532). The equation of the axis c) (35, 2450); The vertex represents the
of symmetry is x = 81. There are no maximum area of 2450 m2 when the width
x-intercepts. The y-intercept occurs at is 35 m.
(0, 13 500). The graph opens upward, so the d) domain: {x | 0 x 70, x R},
graph has a minimum value of 11 532 when range: {A | 0 A 2450, A R}
x = 81. The domain is {n | n 0, n R}. The domain represents the possible values
The range is {C | C 11 532, C R}. of the width, and the range represents the
b) Example: The vertex represents the minimum possible values of the area.
cost of $11 532 to produce 81 000 units. e) The function has a maximum area (value)
Since the vertex is above the n-axis, there of 2450 m2 and a minimum value of 0 m2.
are no n-intercepts, which means the cost of Areas cannot have negative values.
production is always greater than zero. The f) Example: The quadratic function assumes
C-intercept represents the base production that Maria will use all of the fencing to
cost. The domain represents thousands of make the enclosure. It also assumes that any
units produced, and the range represents the width from 0 m to 70 m is possible.
cost to produce those units. 18. a) Diagram 4 Diagram 5 Diagram 6
15. a) A = -2x 2 + 16x + 40
b)

Diagram 4: 24 square units


Diagram 5: 35 square units
Diagram 6: 48 square units
c) The values between the x-intercepts will b) A = n2 + 2n
produce a rectangle. The rectangle will have a c) Quadratic; the function is a polynomial of
width that is 2 greater than the value of x and degree two.
a length that is 20 less 2 times the value of x.

536 MHR Answers


d) {n | n 1, n N}; The values of n are d) Example: Using the graph or table, notice
natural numbers. So, the function is discrete. that as the speed increases the stopping
Since the numbers of both diagrams and distances increase by a factor greater
small squares are countable, the function than the increase in speed. Therefore,
is discrete. it is important for drivers to maintain
e) A greater distances between vehicles as the
speed increases to allow for increasing
50
stopping distances.
40 21. a) f (x) = x 2 + 4x + 3, f (x) = 2x 2 + 8x + 6, and
A = n2 + 2n, n N f (x) = 3x 2 + 12x + 9
30 b) f(x) f(x) = 3x2 + 12x + 9

20 100
f(x) = 2x2 + 8x + 6

10 80

60
0 1 2 3 4 5 6 n
40
19. a) A = r 2
b) domain: {r | r 0, r R}, 20
range: {A | A 0, A R} f(x) = x2 + 4x + 3
c) 0 1 2 3 4 x

c) Example: The graphs have similar shapes,


curving upward at a rate that is a multiple
of the first graph. The values of y for each
value of x are multiples of each other.
d) The x-intercept and the y-intercept occur at d) Example: If k = 4, the graph would start
(0, 0). They represent the minimum values with a y-intercept 4 times as great as the
of the radius and the area. first graph and increase with values of y that
e) Example: There is no axis of symmetry are 4 times as great as the values of y of the
within the given domain and range. first function. If k = 0.5, the graph would
20. a) d(v) = _ + _
1.5v v2
3.6 130 start with a y-intercept _1 of the original
2
b) d(v) y-intercept and increase with values of y
v d 1.5v v2
d(v) = ____ + ____
0 0 400 3.6 130 that are _1 of the original values of y for each
2
25 15 value of x.
300
50 40 f(x)
200 f(x) = 4x2 + 16x + 12
75 75 140
100 119 100
120
125 172
150 236 0 50 100 150 200 v 100
175 308
80
200 391
60
c) No; when v doubles from 25 km/h to
50 km/h, the stopping distance increases 40
by a factor of _
40 = 2.67, and when the
f(x) = 0.5x2 + 2x + 1.5
15 20
velocity doubles from 50 km/h to 100 km/h,
the stopping distance increases by a factor
of _
119 = 2.98. Therefore, the stopping 0 1 2 3 4 x
40
distance increases by a factor greater
than two.

Answers MHR 537


e) Example: For negative values of k, the graph c) Example: The first two graphs have the
would be reflected in the x-axis, with a same y-intercept at (0, 35). The second two
smooth decreasing curve. Each value of y graphs pass through the origin (0, 0). The
would be a negative multiple of the original last two graphs share the same y-intercept
value of y for each value of x. at (0, 100). Each pair of graphs share
f(x) the same y-intercept and share the same
f(x) = -x2 - 4x - 3 constant term.
0 1 2 3 4 x d) Example: Every projectile on the moon had
-20 a higher trajectory and stayed in the air for a
longer period of time.
-40 25. Examples:
a) (2m, r); apply the definition of the axis of
-60
symmetry. The horizontal distance from the
f(x) = -2x2 - 8x - 6 y-intercept to the x-coordinate of the vertex
-80
is m - 0, or m. So, one other point on the
graph is (m + m, r), or (2m, r).
f) The graph is a line on the x-axis. b) (-2j, k); apply the definition of the axis of
g) Example: Each member of the family of symmetry. The horizontal distance from the
functions for f (x) = k(x 2 + 4x + 3) has given point to the axis of symmetry is 4j - j,
values of y that are multiples of the original or 3j. So, one other point on the graph is
function for each value of x. (j - 3j, k), or (-2j, k).
22. Example: The value of a in the function _
s+t
f (x) = ax 2 + bx + c indicates the steepness of c) ( 2 )
, d ; apply the definitions of the axis
the curved section of a function in that when of symmetry and the minimum value of a
a > 0, the curve will move up more steeply as a function. The x-coordinate of the vertex is
halfway between the x-intercepts, or _ .
increases and when -1 < a < 1, the curve will s+t
move up more slowly the closer a is to 0. The 2
The y-coordinate of the vertex is the least
sign of a is also similar in that if a > 0, then the
value of the range, or d.
graph curves up and when a < 0, the graph will
26. Example: The range and direction of opening
curve down from the vertex. The value of a in
are connected and help determine the location
the function f (x) = ax + b indicates the exact
of the vertex. If y q, then the graph will open
steepness or slope of the line determined by
upward. If y q, then the graph will open
the function, whereas the slope of the function
downward. The range also determines the
f (x) = ax 2 + bx + c changes as the value of x
maximum or minimum value of the function
changes and is not a direct relationship for the
and the y-coordinate of the vertex. The equation
entire graph.
of the axis of symmetry determines the
23. a) b = 3
x-coordinate of the vertex. If the vertex is above
b) b = -3 and c = 1
the x-axis and the graph opens upward, there
24. a)
will be no x-intercepts. However, if it opens
Earth Moon downward, there will be two x-intercepts. If the
h(t) = -4.9t 2 + 20t + 35 h(t) = -0.815t 2 + 20t + 35 vertex is on the x-axis, there will be only one
h(t) = -16t 2 + 800t h(t) = -2.69t 2 + 800t x-intercept.
27. Step 2 The y-intercept is determined by the
h(t) = -4.9t 2 + 100 h(t) = -0.815t 2 + 100
value of c. The values of a and b do not affect
b) its location.
Step 3 The axis of symmetry is affected by the
values of a and b. As the value of a increases,
the value of the axis of symmetry decreases. As
the value of b increases, the value of the axis of
symmetry increases.
Step 4 Increasing the value of a increases the
steepness of the graph.

538 MHR Answers


Step 5 Changing the values of a, b, and c c) maximum value of 47
affects the position of the vertex, the steepness d) minimum value of -1.92
of the graph, and whether the graph opens e) maximum value of 18.95
upward (a > 0) or downward (a < 0). a affects f) maximum value of 1.205
a) y = x + _ - _
the steepness and determines the direction of 3 2 121
opening. b and a affect the value of the axis
8. ( 4) 16
of symmetry, with b having a greater effect. b) y = - x +( _3 2
)+_ 9
c determines the value of the y-intercept. 16 256
c) y = 2 x - _ + _
5 2 263
3.3 Completing the Square, pages 192 to 197
( 24 ) 288
9. a) f (x) = -2(x - 3)2 + 8
1. a) x 2 + 6x + 9; (x + 3)2 b) Example: The vertex of the graph is (3, 8).
b) x 2 - 4x + 4; (x - 2)2 From the function f (x) = -2(x - 3)2 + 8,
c) x 2 + 14x + 49; (x + 7)2 p = 3 and q = 8. So, the vertex is (3, 8).
d) x 2 - 2x + 1; (x - 1)2 10. a) maximum value of 62; domain: {x | x R},
2. a) y = (x + 4)2 - 16; (-4, -16) range: {y | y 62, y R}
b) y = (x - 9)2 - 140; (9, -140) b) Example: By changing the function to vertex
c) y = (x - 5)2 + 6; (5, 6) form, it is possible to find the maximum
d) y = (x + 16)2 - 376; (-16, -376) value since the function opens down and
3. a) y = 2(x - 3)2 - 18; working backward, p = 62. This also helps to determine the
y = 2(x - 3)2 - 18 results in the original range of the function. The domain is all
function, y = 2x 2 - 12x. real numbers for non-restricted quadratic
b) y = 6(x + 2)2 - 7; working backward, functions.
y = 6(x + 2)2 - 7 results in the original 11. Example: By changing the function to vertex
function, y = 6x 2 + 24x + 17. form, the vertex is _ 13 , - _
( )3 or (3.25, -0.75).
c) y = 10(x - 8)2 - 560; working backward, 4 4
y = 10(x - 8)2 - 560 results in the original 12. a) There is an error in the second line of the
function, y = 10x 2 - 160x + 80. solution. You need to add and subtract the
d) y = 3(x + 7)2 - 243; working backward, square of half the coefficient of the x-term.
y = 3(x + 7)2 - 243 results in the original y = x 2 + 8x + 30
function, y = 3x 2 + 42x - 96. y = (x 2 + 8x + 16 - 16) + 30
4. a) f (x) = -4(x - 2)2 + 16; working backward, y = (x + 4)2 + 14
f (x) = -4(x - 2)2 + 16 results in the original b) There is an error in the second line of the
function, f (x) = -4x 2 + 16x. solution. You need to add and subtract the
b) f (x) = -20(x + 10)2 + 1757; working square of half the coefficient of the x-term.
backward, f (x) = -20(x + 10)2 + 1757 There is also an error in the last line. The
results in the original function, factor of 2 disappeared.
f (x) = -20x 2 - 400x - 243. f (x) = 2x 2 - 9x - 55
c) f (x) = -(x + 21)2 + 941; working backward, f (x) = 2[x 2 - 4.5x + 5.0625 - 5.0625] - 55
f (x) = -(x + 21)2 + 941 results in the f (x) = 2[(x 2 - 4.5x + 5.0625) - 5.0625] - 55
original function, f (x) = -x 2 - 42x + 500. f (x) = 2[(x - 2.25)2 - 5.0625] - 55
d) f (x) = -7(x - 13)2 + 1113; working backward, f (x) = 2(x - 2.25)2 - 10.125 - 55
f (x) = -7(x - 13)2 + 1113 results in the f (x) = 2(x - 2.25)2 - 65.125
original function, f (x) = -7x 2 + 182x - 70. c) There is an error in the third line of the
5. Verify each part by expanding the vertex solution. You need to add and subtract the
form of the function and comparing with the square of half the coefficient of the x-term.
standard form and by graphing both forms of y = 8x 2 + 16x - 13
the function. y = 8[x 2 + 2x] - 13
6. a) minimum value of -11 when x = -3 y = 8[x 2 + 2x + 1 - 1] - 13
b) minimum value of -11 when x = 2 y = 8[(x 2 + 2x + 1) - 1] - 13
c) maximum value of 25 when x = -5 y = 8[(x + 1)2 - 1] - 13
d) maximum value of 5 when x = 2 y = 8(x + 1)2 - 8 - 13
a) minimum value of - _
13 y = 8(x + 1)2 - 21
7.
4
b) minimum value of _1
2

Answers MHR 539


d) There are two errors in the second line of 21. a) Answers may vary.
the solution. You need to factor the leading b) A = -2w 2 + 90w, where A is the area and w
coefficient from the first two terms and is the width.
add and subtract the square of half the c) 1012.5 m2
coefficient of the x-term. There is also an d) Example: Verify the solution by graphing or
error in the last line. The -3 factor was not changing the function to vertex form, where
distributed correctly. the vertex is (22.5, 1012.5).
f (x) = -3x 2 - 6x e) Example: Assume that the measurements
f (x) = -3[x 2 + 2x + 1 - 1] can be any real number.
f (x) = -3[(x 2 + 2x + 1) - 1] 22. The dimensions of the large field are 75 m by
f (x) = -3[(x + 1)2 - 1] 150 m, and the dimensions of the small fields
f (x) = -3(x + 1)2 + 3 are 75 m by 50 m.
13. 12 000 items 23. a) The two numbers are 14.5 and 14.5, and the
14. 9m maximum product is 210.25.
15. a) 5.56 ft; 0.31 s after being shot b) The two numbers are 6.5 and -6.5, and the
b) Example: Verify by graphing and finding the minimum product is -42.25.
vertex or by changing the function to vertex 24. 8437.5 cm2
f (x) = - _3 x-_ 3 2+_ 47
form and using the values of p and q to find
the maximum value and when it occurs.
25.
4 ( 4 ) 64
26. a) y = ax 2 + bx + c
16. a) Austin got +12x when dividing 72x by -6
and should have gotten -12x. He also forgot y = a x2 + _
( b
)
ax + c
to square the quantity (x + 6). Otherwise his
y = a x2 + _ bx + _ b - _
2

work was correct and his answer should be ( a 2a ( ) ( ))


b2
4a2
+c

y=a x+_ b -_
y = -6(x - 6)2 + 196. Yuri got an answer 2

( )
2
ab + c
of -216 when he multiplied -6 by -36. He 2a 4a2
y=a x+_ b + __
2
should have gotten 216 to get the correct
answer of y = -6(x - 6)2 + 196.
( 2a ) 4a2c - ab2
4a2
y = a x + _ + ___
2
a(4ac - b2)
b) Example: To verify an answer, either
work backward to show the functions are
( b
2a ) 4a2
y=a x+_ b + __
2
equivalent or use technology to show the
graphs of the functions are identical.
( 2a ) 4ac - b2
4a
17. 18 cm (
b) - _b , __
4ac - b2
)
2a 4a
18. a) The maximum revenue is $151 250 when c) Example: This formula can be used to find
the ticket price is $55. the vertex of any quadratic function without
b) 2750 tickets using an algebraic method to change the
c) Example: Assume that the decrease in ticket function to vertex form.
prices determines the same increase in ticket 27. a) (3, 4)
sales as indicated by the survey. b) f (x) = 2(x - 3)2 + 4, so the vertex is (3, 4).
c) a = a, p = - _ , and q = __
19. a) R(n) = -50n2 + 1000n + 100 800, where b 4ac - b2
R is the revenue of the sales and n is the 2a 4a
number of $10 increases in price. 28. a) A = - __
4+ 2
( )w + 3w
b) The maximum revenue is $105 800 when 8
b) maximum area of __ , or approximately
18
the bikes are sold for $460.
4+
2.52 m2, when the width is __
c) Example: Assume that the predictions of a 12 , or
decrease in sales for every increase in price 4+
holds true. approximately 1.68 m
20. a) P(n) = -0.1n2 + n + 120, where P is the c) Verify by graphing and comparing the vertex
production of peas, in kilograms, and n is values, __ 12 , __
( 18 , or approximately
)
the increase in plant rows. 4+ 4+
b) The maximum production is 122.5 kg of peas (1.68, 2.52).
d) width: __ or approximately 1.68 m,
12
when the farmer plants 35 rows of peas. 4+
length: __
c) Example: Assume that the prediction 6 or approximately 0.84 m,
holds true. 4+
radius: __ 6 or approximately 0.84 m;
4+
Answers may vary.

540 MHR Answers


29. Examples: vertex: (4, 0), axis of symmetry: x = 4, opens
a) The function is written in both forms; downward, maximum value of 0,
standard form is f (x) = 4x 2 + 24 and domain: {x | x R}, range: {y | y 0, y R}
vertex form is f (x) = 4(x + 0)2 + 24. 2. a) f(x)
b) No, since it is already in completed
2
square form.
30. Martines first error was that she did not
correctly factor -4 from -4x 2 + 24x. Instead -6 -4 -2 0 2 x
of y = -4(x 2 + 6x) + 5, it should have been -2
y = -4(x 2 - 6x) + 5. Her second error occurred
when she completed the square. Instead of -4
y = -4(x 2 + 6x + 36 - 36) + 5, it should
-6
have been y = -4(x 2 - 6x + 9 - 9) + 5.
Her third error occurred when she factored
(x 2 + 6x + 36). This is not a perfect square f(x) = 2(x2 + 1)2 - 8
trinomial and is not factorable. Her last error vertex: (-1, -8), axis of symmetry: x = -1,
occurred when she expanded the expression minimum value of -8, domain: {x | x R},
-4[(x + 6)2 - 36] + 5. It should be range: {y | y -8, y R}, x-intercepts occur
-4(x - 3)2 + 36 + 5 not -4(x + 6)2 - 216 + 5. at (-3, 0) and (1, 0), y-intercept occurs at
The final answer is y = -4(x - 3)2 + 41. (0, -6)
31. a) R = -5x 2 + 50x + 1000 b) f(x)
b) By completing the square, you can f(x) = -0.5(x - 2)2 + 2
2
determine the maximum revenue and price
to charge to produce the maximum revenue, 1
as well as predict the number of T-shirts that
will sell. -1 0 1 2 3 4 5 x
c) Example: Assume that the market research
-1
holds true for all sales of T-shirts.

Chapter 3 Review, pages 198 to 200 vertex: (2, 2), axis of symmetry: x = 2,
2 maximum value of 2, domain: {x | x R},
1. a) Given the graph of f (x) = x , move it 6 units
range: {y | y 2, y R}, x-intercepts occur
to the left and 14 units down.
at (0, 0) and (4, 0), y-intercept occurs
vertex: (-6, -14), axis of symmetry: x = -6,
at (0, 0)
opens upward, minimum value of -14,
3. Examples:
domain: {x | x R},
a) Yes. The vertex is (5, 20), which is above the
range: {y | y -14, y R}
x-axis, and the parabola opens downward to
b) Given the graph of f (x) = x 2, change the
produce two x-intercepts.
width by multiplying the y-values by a
b) Yes. Since y 0, the graph touches the x-axis
factor of 2, reflect it in the x-axis, and move
at only one point and has one x-intercept.
the entire graph up 19 units.
c) Yes. The vertex of (0, 9) is above the x-axis
vertex: (0, 19), axis of symmetry: x = 0,
and the parabola opens upward, so the
opens downward, maximum value of 19,
graph does not cross or touch the x-axis and
domain: {x | x R}, range: {y | y 19, y R}
has no x-intercepts.
c) Given the graph of f (x) = x 2, change the
d) No. It is not possible to determine if the graph
width by multiplying the y-values by a
opens upward to produce two x-intercepts or
factor of _ 1 , move the entire graph 10 units
downward to produce no x-intercepts.
5
to the right and 100 units up. 4. a) y = -0.375x 2 b) y = 1.5(x - 8)2
vertex: (10, 100), axis of symmetry: x = 10, c) y = 3(x + 4)2 + 12
opens upward, minimum value of 100, d) y = -4(x - 4.5)2 + 25
a) y = _ (x + 3)2 - 6
domain: {x | x R}, range: {y | y 100, y R} 5.
1 b) y = -2(x - 1)2 + 5
d) Given the graph of f(x) = x2, change the width 4
6. Example: Two possible functions for the mirror
by multiplying the y-values by a factor of 6,
are y = 0.0069(x - 90)2 - 56 and y = 0.0069x 2.
reflect it in the x-axis, and move the entire
graph 4 units to the right.

Answers MHR 541


7. a) i) y = __22 x ii) y = __ x
2 22 2
+ 30 12. a) h(d)
18 769 18 769
iii) y = __ (x - 137) + 30
22 (25, 20)
2 20
18 769
b) Example: The function will change as 10
the seasons change with the heat or cold
(0, 0) (50, 0)
changing the length of the cable and
-10 0 10 20 30 40 50 d
therefore the function.
8. y = - _ (x - 7.5)2 + 30 or
8 -10
h(d) = -0.032d 2 + 1.6d
15
y -0.53(x - 7.5)2 + 30
b) The maximum height of the ball is 20 m.
9. a) vertex: (2, 4), axis of symmetry: x = 2,
The ball is 25 m downfield when it reaches
maximum value of 4, opens downward,
its maximum height.
domain: {x | x R},
c) The ball lands downfield 50 m.
range: {y | y 4, y R},
d) domain: {x | 0 x 50, x R},
x-intercepts occur at (-2, 0) and (6, 0),
range: {y | 0 y 20, y R}
y-intercept occurs at (0, 3)
13. a) y = (5x + 15)(31 - 2x) or
b) vertex: (-4, 2), axis of symmetry:
y = -10x 2 + 125x + 465
x = -4, maximum value of 2, opens
b)
upward, domain: {x | x R},
range: {y | y 2, y R},
no x-intercepts, y-intercept occurs at (0, 10)
10. a) Expanding y = 7(x + 3)2 - 41 gives
y = 7x 2 + 42x + 22, which is a polynomial
of degree two. c) The values between the x-intercepts will
b) Expanding y = (2x + 7)(10 - 3x) gives produce a rectangle.
y = -6x 2 - x + 70, which is a polynomial d) Yes; the maximum value is 855.625; the
of degree two. minimum value is 0.
11. a) f(x) e) The vertex represents the maximum area
f(x) = -2x2 + 3x + 5
6 and the value of x that produces the
maximum area.
4 f) domain: {x | 0 x 15.5, x R},
range: {y | 0 y 855.625, y R}
2
14. a) y = (x - 12)2 - 134
b) y = 5(x + 4)2 - 107
-1 0 1 2 3 x c) y = -2(x - 2)2 + 8
d) y = -30(x + 1)2 + 135

15. vertex: _ , - _ , axis of symmetry: x = _ ,


vertex: (0.75, 6.125), axis of symmetry: 5 13 5
x = 0.75, opens downward, maximum value (
4 4 ) 4
of 6.125, domain: {x | x R}, minimum value of - _ 13 , domain: {x | x R},
4
range: y | y - _
range: {y | y 6.125, y R}, 13 , y R
x-intercepts occur at (-1, 0) and (2.5, 0), { 4 }
y-intercept occurs at (0, 5) 16. a) In the second line, the second term should
b) Example: The vertex is the highest point have been +3.5x. In the third line, Amy
on the curve. The axis of symmetry divides found the square of half of 3.5 to be 12.25;
the graph in half and is defined by the it should have been 3.0625 and this term
x-coordinate of the vertex. Since a < 0, the should be added and then subtracted. The
graph opens downward. The maximum solution should be
value is the y-coordinate of the vertex. The y = -22x 2 - 77x + 132
domain is all real numbers. The range is less y = -22(x 2 + 3.5x) + 132
than or equal to the maximum value, since y = -22(x 2 + 3.5x + 3.0625 - 3.0625) + 132
the graph opens downward. The x-intercepts y = -22(x 2 + 3.5x + 3.0625) + 67.375 + 132
are where the graph crosses the x-axis, and y = -22(x + 1.75)2 + 199.375
the y-intercept is where the graph crosses b) Verify by expanding the vertex form to
the y-axis. standard form and by graphing both forms
to see if they produce the same graph.

542 MHR Answers


17. a) R = (40 - 2x)(10 000 + 500x) or ii) The axis of symmetry of the function in
R = -1000x2 + 400 000 where R is part a) iii) will be different as compared
the revenue and x is the number of to f (x) = x 2 because the entire graph is
price decreases. translated horizontally. Instead of an axis
b) The maximum revenue is $400 000 and the of symmetry of x = 0, the graph of the
price is $40 per coat. function in part a) iii) will have an axis
c) of symmetry of x = -11.
iii) The range of the functions in part a) ii)
and iv) will be different as compared
to f (x) = x 2 because the entire graph is
either translated vertically or reflected
in the x-axis. Instead of a range of
d) The y-intercept represents the sales before {y | y 0, y R}, the function in
changing the price. The x-intercepts indicate part a) ii) will have a range of
the number of price increases or decreases {y | y -20, y R} and the function
that will produce revenue. in part a) iv) will have a range of
e) domain: {x | -20 x 20, x R}, {y | y 0, y R}.
range: {y | 0 y 400 000, y R} 10. y
f) Example: Assume that a whole number of
price increases can be used. 8

4
Chapter 3 Practice Test, pages 201 to 203
1. D -4 -2 0 2 4 6 x
2. C
-4
3. A
4. D -8
5. D y = 2(x - 1)2 - 8
6. A
7. a) y = (x - 9)2 - 108 Vertex (1, -8)
b) y = 3(x + 6)2 - 95
Axis of Symmetry x=1
c) y = -10(x + 2)2 + 40
8. a) vertex: (-6, 4), axis of symmetry: x = -6, Direction of Opening upward
maximum value of 4, domain: {x | x R}, Domain {x | x R}
range: {y | y 4, y R}, x-intercepts occur Range {y | y -8, y R}
at (-8, 0) and (-4, 0)
x-Intercepts -1 and 3
b) y = -(x + 6)2 + 4
9. a) i) change in width by a multiplication of y-Intercept -6
the y-values by a factor of 5 11. a) In the second line, the 2 was not factored
ii) vertical translation of 20 units down out of the second term. In the third line, you
iii) horizontal translation of 11 units to need to add and subtract the square of half
the left the coefficient of the x-term. The first three
iv) change in width by a multiplication steps should be
of the y-values by a factor of _1 and a y = 2x 2 - 8x + 9
7 y = 2(x 2 - 4x) + 9
reflection in the x-axis y = 2(x 2 - 4x + 4 - 4) + 9
b) Examples:
b) The rest of the process is shown.
i) The vertex of the functions in part a) ii)
y = 2[(x 2 - 4x + 4) - 4] + 9
and iii) will be different as compared y = 2(x - 2)2 - 8 + 9
to f (x) = x 2 because the entire graph is y = 2(x - 2)2 + 1
translated. Instead of a vertex of (0, 0), c) The solution can be verified by expanding
the graph of the function in part a) ii) the vertex form to standard form or
will be located at (0, -20) and the vertex by graphing both functions to see that
of the graph of the function in part a) iii) they coincide.
will be located at (-11, 0).

Answers MHR 543


12. Examples: f) Yes; the maximum value is 36 when d is 3,
a) The vertex form of the function and the minimum value is 0 when d is 0 or 6.
C(v) = 0.004v 2 - 0.62v + 30 is g) Example: Assume that any real-number
C(v) = 0.004(v - 77.5)2 + 5.975. The distance can be used to build the fence.
most efficient speed would be 77.5 km/h 15. a) f (x) = -0.03x 2
and will produce a fuel consumption of b) f (x) = -0.03x 2 + 12
5.975 L/100 km. c) f (x) = -0.03(x + 20)2 + 12
b) By completing the square and d) f (x) = -0.03(x - 28)2 - 3
determining the vertex of the function, 16. a) R = (2.25 - 0.05x)(120 + 8x)
you can determine the most efficient fuel b) Expand and complete the square to get the
consumption and at what speed it occurs. vertex form of the function. A price of $1.50
13. a) The maximum height of the flare is gives the maximum revenue of $360.
191.406 25 m, 6.25 s after being shot. c) Example: Assume that any whole number of
b) Example: Complete the square to produce price decreases can occur.
the vertex form and use the value of q to
determine the maximum height and the Chapter 4 Quadratic Equations
value of p to determine when it occurs,
or use the fact that the x-coordinate of the 4.1 Graphical Solutions of Quadratic Equations,
vertex of a quadratic function in standard pages 215 to 217
form is x = - _ b and substitute this value
2a 1. a) 1 b) 2 c) 0 d) 2
into the function to find the corresponding 2. a) 0 b) -1 and -4
y-coordinate, or graph the function to find c) none d) -3 and 8
the vertex. 3. a) x = -3, x = 8 b) r = -3, r = 0
14. a) A(d) = -4d 2 + 24d c) no real solutions d) x = 3, x = -2
b) Since the function is a polynomial of e) z = 2 f) no real solutions
degree two, it satisfies the definition of a 4. a) n -3.2, n 3.2 b) x = -4, x = 1
quadratic function. c) w = 1, w = 3 d) d = -8, d = -2
c) e) v -4.7, v -1.3 f) m = 3, m = 7
A(d)
A(d) = -4d 2 + 24d 5. 60 yd
36 6. a) -x 2 + 9x - 20 = 0 or x 2 - 9x + 20 = 0
(3, 36) b) 4 and 5
30
7. a) x 2 + 2x - 168 = 0
24 b) x = 12 and x = 14 or x = -12 and x = -14
8. a) Example: Solving the equation leads to the
18 distance from the firefighter that the water
hits the ground. The negative solution is not
12 part of this situation.
b) 12.2 m
6
c) Example: Assume that aiming the hose
(0, 0) (6, 0) higher would not reach farther. Assume that
-2 0 2 4 6 d wind does not affect the path of the water.
9. a) Example: Solving the equation leads to the
Example: By completing the square, time that the fireworks hit the ground. The
determine the vertex, find the y-intercept negative solution is not part of the situation.
and its corresponding point, plot the three b) 6.1 s
points, and join them with a smooth curve. 10. a) -0.75d 2 + 0.9d + 1.5 = 0 b) 2.1 m
d) (3, 36); the maximum area of 36 m2 happens 11. a) -2d 2 + 3d + 10 = 0 b) 3.1 m
when the fence is extended to 3 m from 12. a) first arch: x = 0 and x = 84, second arch:
the building. x = 84 and x = 168, third arch: x = 168
e) domain: {d | 0 d 6, d R}, and x = 252
range: {A | 0 A 36, A R}; negative b) The zeros represent where the arches reach
distance and area do not have meaning in down to the bridge deck.
this situation. c) 252 m

544 MHR Answers


13. a) k = 9 b) k < 9 c) k > 9 12. a) 1 s and 5 s
14. a) 64 ft b) Assume that the mass of the fish does not
b) The relationship between the height, radius, affect the speed at which the osprey flies
and span of the arch stays the same. Input after catching the fish. This may not be a
the measures in metres and solve. reasonable assumption for a large fish.
15. about 2.4 s 13. a) 150t - 5t 2 = 0 b) 30 s
16. For the value of the function to change from 14. 8 and 10 or 0 and -2
negative to positive, it must cross the x-axis and 15. 15 cm
therefore there must be an x-intercept between 16. 3 s; this seems a very long time considering the
the two values of x. ball went up only 39 ft.
17. The other x-intercept would have to be 4. 17. a) 1 cm
18. The x-coordinate of the vertex is halfway b) 7 cm by 5 cm
between the two roots. So, it is at 2. You can 18. a) No; (x - 5) is not a factor of the expression
then substitute x = 2 into the equation to find x 2 - 5x - 36, since x = 5 does not satisfy
the minimum value of -16. the equation x 2 - 5x - 36 = 0.
b) Yes; (x + 3) is a factor of the expression
4.2 Factoring Quadratic Equations, x 2 - 2x - 15, since x = -3 satisfies the
pages 229 to 233 equation x 2 - 2x - 15 = 0.
c) No; (4x + 1) is not a factor of the expression
1. a) (x + 2)(x + 5) b) 5(z + 2)(z + 6)
c) 0.2(d - 4)(d - 7) 6x 2 + 11x + 4, since x = - _1 does not
4
2. a) (y - 1)(3y + 7) b) (4k - 5)(2k + 1) satisfy the equation 6x 2 + 11x + 4 = 0.
c) 0.2(2m - 3)(m + 3) d) Yes; (2x - 1) is a factor of the expression
3. a) (x + 5)(x - 4) b) (x - 6)2 4x 2 + 4x - 3, since x = _1 satisfies the
_1 (x + 2)(x + 6) 2
c) d) 2(x + 3)2 equation 4x 2 + 4x - 3 = 0.
4
a) - _ and 2
4. a) (2y + 3x)(2y - 3x) 19.
1 b) -4 and 3
b) (0.6p + 0.7q)(0.6p - 0.7q) 2
_1 s + _3 t _1 s - _3 t 20. 20 cm and 21 cm
c) ( 2 )(
5 2 )5 21. 8 m and 15 m
d) (0.4t + 4s)(0.4t - 4s) 22. a) x(x - 7) = 690 b) 30 cm by 23 cm
5. a) (x + 8)(x - 5) 23. 5m
b) (2x2 - 8x + 9)(3x2 - 12x + 11) 24. 5m
c) (-4)(8j) 25. P=_ 1 d(v + v )(v - v )
6. a) (10b)(10b - 7) 2 1 2 1 2

26. No; the factor 6x - 4 still has a common factor


b) 16(x2 - x + 1)(x2 + x + 1)
of 2.
c) (10y3 - x)(10y3 + x)
27. a) 6(z - 1)(2z + 5)
b) x = 2, x = - _
7. a) x = -3, x = -4 1
2 b) 4(2m2 - 8 - 3n)(2m2 - 8 + 3n)
c) _ (2y - 3x)2
c) x = -7, x = 8 d) x = 0, x = -5 1
x = -_ 1, x = _ 4 f) x = 4, x = _
7 36
d) 7 w - _ (5w + 1)
e) 5
8. a)
3
n = -2, n = 2
5 2
b) x = -4, x = -1
( )3
28. 4(3x + 5y) centimetres
_ d) y = _ , y = _
c) w = -9, x = - 1 5 3
3 4 2 29. The shop will make a profit after 4 years.
d = -_ f) x = _
e)
3 , d = -1 3 30. a) x 2 - 9 = 0 b) x 2 - 4x + 4 = 0
2 2 2
c) 3x - 14x + 8 = 0
b) - _ and 1
9. a) 0 and 5 8
d) 10x 2 - x - 3 = 0
9
d) - _ and _
21 21 31. Example: x 2 - x + 1 = 0
c) -5 and -3
5 5 32. a) Instead of evaluating 81 - 36, use the
e) -5 and 7 f)
_7 difference of squares pattern to rewrite
2
the expression as (9 - 6)(9 + 6) and then
10. a) -6 and 7 b) -10 and 3
simplify. You can use this method when
d) - _ and _
c) -7 and 3 1 3
3 2 a question asks you to subtract a square
f) -3 and _
e) -5 and 2 1 number from a square number.
2
11. a) (x + 10)(2x - 3) = 54 b) 3.5 cm

Answers MHR 545


______
b) Examples: 14. a) x = -1 k + 1
______
b) x = ___
1 k2 + 1
k
144 - 25 = (12 - 5)(12 + 5) ______
= (7)(17) c) x = ___
k k2 + 4
2
________
= 119
256 - 49 = (16 - 7)(16 + 7) 15. x= ____
-b b2 - 4ac
No. Some will result
2a
= (9)(23) in a negative in the radical, which means the
= 207 solution(s) are not real.
16. a) n = 43 b) n = 39
4.3 Solving Quadratic Equations by Completing the 17. a) 122 = 42 + x 2 - 2(4)(x) cos (60)
Square, pages 240 to 243 b) 13.5 m

1. a) c = _1 b) c = _
25 18. Example: In the first equation, you must
4 4 take the square root to isolate or solve for x.
c) c = 0.0625 d) c = 0.01 This creates__the situation. In the second
e) c=_ 225 f) c = _
81 equation, 9 is already present, which means
4 4
b) (x + 2)2 = _
17 the principle or positive square root only.
2. a) (x + 2)2 = 2
2
3 19. Example: Allison did all of her work on one
c) (x - 3) = -1
side of the equation; Riley worked on both
3. a) (x - 6)2 - 27 = 0 b) 5(x - 2)2 - 21 = 0
sides. Both end up at the same solution but by
c) (
-2 x - _
1 2
)- =0_7
different paths.
4 8
d) 2
0.5(x + 2.1) + 1.395 = 0 20. Example:
e) -1.2(x + 2.125)2 - 1.981 25 = 0 Completing the square requires operations
f) _1 (x + 3)2 - _ 21 = 0 with rational numbers, which could lead to
2 2 arithmetic errors.
4. a) x = 8 b) s = 2 ___ Graphing the corresponding function using
c) t = 6 d) y = 11 technology is very easy. Without technology,
5. a) x = 1, x = 5 b) x = -5, x = 1 the manual graph could take a longer amount
__
c) d=- ,d= _
3 _1 d) h = __
3 7 of time.
2 2
__ 4 Factoring should be the quickest of the methods.
e) s= __
-12 3
f) x = -4 3 2
__
All of the methods lead to the same answers.
2 ___ __ 21. a) Example: y = 2(x - 1)2 - 3, 0 = 2x 2 - 4x - 1
6. a) x = -5 21 b) x = 4 3
___ __ b) Example: y = 2(x + 2)2, 0 = 2x2 + 8x + 8
x = -1 _ 2 or __ -3 6
c)
__

3 3___
c) Example: y = 3(x - 2)2 + 1, 0 = 3x2 - 12x + 13

d) x=1 _
5
or __
2 10
4.4 The Quadratic Formula, pages 254 to 257
2 ___ 2 __
e) x = -3 13 f) x = 4 2 7 1. a) two distinct real roots
7. a) x = 8.5, x = -0.5 b) x = -0.8, x = 2.1 b) two distinct real roots
c) x = 12.8, x = -0.8 d) x = -7.7, x = 7.1 c) two distinct real roots
e) x = -2.6, x = 1.1 f) x = -7.8, x = -0.2 d) one distinct real root
8. a) e) no real roots
x
f) one distinct real root
x x 2. a) 2 b) 2 c) 1
4 ft
10 ft
d) 1 e) 0 f) 2
__
x
3. a) x = -3, x = - _
3 b) p = __
3 3 2
b) 4x 2 + 28x - 40 = 0 ___7 2 __
c) 12.4 ft by 6.4 ft c) q= __
-5 37
d) m = __
-2 3 2
6___ 2
9. a) -0.02d 2 + 0.4d + 1 = 0
j = __ f) g = - _
7 17 3
b) 22.2 m e)
4 4
10. 200.5 m 4. a) z = -4.28, z = -0.39
11. 6 in. by 9 in. b) c = -0.13, c = 1.88
12. 53.7 m c) u = 0.13, u = 3.07
13. a) x 2 - 7 = 0 b) x 2 - 2x - 2 = 0 d) b = -1.41, b = -0.09
c) 4x 2 - 20x + 14 = 0 or 2x 2 - 10x + 7 = 0 e) w = -0.15, w = 4.65
f) k = -0.27, k__= 3.10
x = __ , -0.18 and -1.82
-3 6
5. a)
3
546 MHR Answers
___
b) h = __
-1 73
, -0.80 and 0.63 Chapter 4 Review, pages 258 to 260
12 _____
c) m = ___ , -1.78 and 0.28
-0.3 0.17 1. a) x = -6, x = -2 b) x = -1, x = 5
0.4
__
c) x = -2, x = - _4 d) x = -3, x = 0
d) y = __
3 2
, 0.79 and 2.21 3
2 ___ e) x = -5, x = 5
e) x = __ , -0.47 and 0.61
1 57 2. D
14 __ 3. Example: The graph cannot cross over or touch
f) z = __
3 7
, 0.18 and 2.82 the x-axis.
2
6. Example: Some are easily solved so they do 4. a) Example:
not require the use of the quadratic formula.
x2 - 9 = 0 __
7. a) n = -1 3 ; complete the square
b) y = 3; factor
__
c) u = 2 2 ; square root
___
d) x = __ ; quadratic formula
1 19 b) 1000 key rings or 5000 key rings produce
3 no profit or loss because the value of P
e) no real roots; graphing
is 0 then.
8. 5 m by 20 m or 10 m by 10 m
5. a) -1 and 6 b) 6 m
9. 0.89 m___
b) _ (x + 1)(x - 4)
6. a) (x - 1)(4x - 9)
1
10. 1 23 , -3.80 and 5.80 2
11. 5m c) (3v + 10)(v + 2)
12. a) (30 - 2x)(12 - 2x) = 208 d) (3a2 - 12 + 35b)(3a2 - 12 - 35b)
b) 2 in. 7. a) x = -7, x = -3 b) m = -10, m = 2
c) p = -3, p = _ d) z = _ , z = 3
c) 8 in. by 26 in. by 2 in. 2 1
13. a) 68.8 km/h b) 95.2 km/h 5 2
8. a) g = 3, g = - _ b) y = _ , y = _
1 1 5
c) 131.2 km/h
2 2 4
c) k = _ d) x = - _ , x = 6
14. a) 4.2 ppm b) 3.4 years 3 3
15. $155, 130 jackets 5 2
16. 169.4 m 9. a) Example: 0 = x 2 - 5x + 6

b = 13, x = _ 3 b) Example: 0 = x 2 + 6x + 5
17.
2 c) Example: 0 = 2x 2 + 5x - 12
18. 2.2 cm __ __ 10. 6 s
19. a) (-3 + 3 5 ) m b) (-45 + 27 5 ) m2 11. a) V = 15(x)(x + 2) b) 2145 = 15x(x + 2)
20. 3.5 h c) 11 m by 13 m
21. Error in Line 1: The -b would make the first 12. x = -4 and x = 6. Example: Factoring is fairly
number -(-7) = 7. easy and exact.
b) k = _
Error in Line 2: -4(-3)(2) = +24 not -24. 9
___ 13. a) k = 4
The correct solution is x = __
-7 73
.
4
6 14. a) x = 7 b) x = 2, x = -8
__
d) x = __
22. a) x = -1 and x = 4 __ 3 5
c) x = 5 2 6
b) Example: The axis of symmetry is halfway ___ ___ 3
between the roots. __ = _ 15. a) x = 4 _ or __
-1 + 4 3 . Therefore, 29 8 58
2 2 2___ 2 ___
the equation of the axis of symmetry is
b) y = -2 _
19 or ___
-10 95
x=_ 3. 5 5
2 c) no real solutions
23. Example: If the quadratic is easily factored, 16. 68.5 s
17. a) 0 = - _ d 2 + 2d + 1 b) 4.4 m
then factoring is faster. If it is not easily 1
factored, then using the quadratic formula will 2
yield exact answers. Graphing with technology 18. a) two distinct real roots
is a quick way of finding out if there are b) one distinct real root
real solutions. c) no real roots
24. Answers may vary. d) two distinct real roots ___
19. a) x = - _ , x = 1 b) x = __
5 -7 29
3 __ 10
c) x = __
2 7
d) x = - _
9
3 5

Answers MHR 547


20. a) 0 = -2x 2 + 6x + 1 b) 3.2 m Cumulative Review, Chapters 34,
21. a) 3.7 - 0.05x b) 2480 + 40x pages 264 to 265
c) R = -2x 2 + 24x + 9176
d) 5 or 7 1. a) C b) A c) D d) B
22. 2. a) not quadratic b) quadratic
c) not quadratic d) quadratic
Algebraic Steps Explanations
3. a) Example: b) Example:
2
ax + bx = -c Subtract c from both sides.
_b
x2 + a x = -_
c
Divide both sides by a.
a
_b _
x2 + a x +
b2
=
_
b2 _c
-a Complete the square.
4a2 4a2

(x + _ __
2
b - 4ac2 Factor the perfect square
2a )
b
= c) Example:
4a 2
trinomial.
_________

x+
_
b
=
__
b - 4ac 2 Take the square root of
2a 4a2 both sides.
________

x=
____
-b b - 4ac
2
Solve for x.
2a

Chapter 4 Practice Test, pages 261 to 262 4. a) vertex: (-4, -3), domain: {x | x R},
range: {y | y -3, y R}, axis of
1. C symmetry: x = -4, x-intercepts occur at
2. B approximately (-5.7, 0) and (-2.3, 0),
3. D y-intercept occurs at (0, 13)
4. B b) vertex: (2, 1), domain: {x | x R}, range:
5. B {y | y 1, y R}, axis of symmetry: x = 2,
6. a) x = 3, x = 1 _3
b) x = - , x = 5 x-intercepts occur at (1, 0) and (3, 0),
2
c) x = -3, x = 1 y-intercept occurs at (0, -3)
___ c) vertex: (0, -6), domain: {x | x R},
7. x = __
-5 37
range: {y | y -6, y R}, axis of
6 ___
8. x = -2 11 symmetry: x = 0, no x-intercepts,
9. a) one distinct real root y-intercept occurs at (0, -6)
b) two distinct real roots d) vertex: (-8, 6), domain: {x | x R},
c) no real roots range: {y | y 6, y R}, axis of
d) two distinct real roots symmetry: x = -8, no x-intercepts,
10. a) y-intercept occurs at (0, 38)
3x + 1 5. a) y = (x - 5)2 - 7; the shapes of the
x graphs are the same with the parabola of
y = (x - 5)2 - 7 being translated 5 units to
3x - 1 the right and 7 units down.
b) x 2 + (3x - 1)2 = (3x + 1)2 b) y = -(x - 2)2 - 3; the shapes of the
c) 12 cm, 35 cm, and 37 cm graphs are the same with the parabola of
11. a) 3.8 s y = -(x - 2)2 - 3 being reflected in the
b) 35 m x-axis and translated 2 units to the right and
c) Example: Choose graphing with technology 3 units down.
so you can see the path and know which c) y = 3(x - 1)2 + 2; the shape of the graph
points correspond to the situation. of y = 3(x - 1)2 + 2 is narrower by a
12. 5 cm multiplication of the y-values by a factor
13. 22 cm by 28 cm of 3 and translated 1 unit to the right and
14. a) (9 + 2x)(6 + 2x) = 108 or 2 units up.
4x 2 + 30x - 54 = 0
b) x = 1.5
Example: Factoring is the most efficient
strategy.
c) 42 m

548 MHR Answers


d) y = _1 (x + 8)
2
+ 4; the shape of the Chapter 5 Radical Expressions
4
graph of y = _
1 (x + 8) 2
+ 4 is wider by a and Equations
4
multiplication of the y-values by a factor
5.1 Working With Radicals, pages 278 to 281
of _
1 and translated 8 units to the left and
4 1.
Mixed Radical Form Entire Radical Form
4 units up. __ ____
6. a) 22 m b) 2 m c) 4 s 4 7 112
__ ___
7. In order: roots, zeros, x-intercepts 5 2 50
__ ____
8. a) (3x + 4)(3x - 2) b) (4r - 9s)(4r + 9s)
-11 8 - 968
c) (x + 3)(2x + 9) d) (xy + 4)(xy - 9) __ ____
-10 2 - 200
e) 5(a + b)(13a + b) f) (11r + 20)(11r - 20)
___ __
9. 7, 8, 9 or -9, -8, -7 2. a) 2 __
14 b) 15 3
3 __
10. 15 seats per row, 19 rows c) 2 3 __ d) cd ____
c
3
11. 3.5 m 3. a) 6m2 2__,mR b) 2q 3q2 , q R
5
12. Example: Dallas did not divide the 2 out of c) -4st 5t , s, t R
the -12 in the first line or multiply the 36 by 4.
Mixed Radical Form Entire Radical Form
2 and thus add 72 to the right side instead of __ _____ _____
36 in line two. Doug made a sign error on the 3n 5 45n 2 , n 0 or - 45n 2 , n < 0
3
__ 3
______
-12 in the first line. He should have calculated -6 2 -432
____
_
_
200 as the value in the radical, not 80. When he
___ 1 ___3 3 7
80 divided by 4 to get 7a ,a0
simplified,
___
he took 2a 8a 2

___ ______
20 , which is not correct. 3 3
__ 4x 2x 128x 4
The correct answer is 3 _ 5__ or __
6 5 2 __ __ __ __
. 5. a) 15 5 ___ and 40 5 b) 32z 4 7 and 48z 2 7
2 __ 2 4 4
___
13. a) Example: square root, x = 2 c) -35 w 2 and 9w 2( w 2 )
3
__ 3
__
b) Example: factor, m = 2 and m = 13 d) 6 2 and 18 2

__ __
c) Example: factor, s = -5 and s = 7 6. a) 3 6 , 7 2 , 10 __
d) Example: use quadratic formula, x = - _
1
_
__ 7 , -2 __
16 b) -3 2 , -4, -2 3
and x = 3 3
___ 3
__ 23 __
14. a) two distinct real roots c) 21 , 2.8, 2 5 , 3 2

b) one distinct real root 7. Example: Technology could be used.


__ __
c) no real roots 8. a) 4 5 b) 10.4 2 - 7
15. a) 85 = x 2 + (x + 1)2 4
___
c) -4 11 + 14 d) - _2 __6 + 2 ___
10
b) Example: factoring, x = -7 and x = 6 __ 3__ __
9. a) 12 3 b) 6 2 + 6 7
c) The top is 7-in. by 7-in. and the bottom is
6-in. by 6-in. c) -28 5
__
+ 22.5 d)
_
13 3
__ ___
3 - 7 11
4 ___
d) Example: Negative lengths are not possible. __ __
10. a) 8a a , a 0 b) 9 2x - x , x 0
3
___
c) 2(r - 10) 5r , r R
Unit 2 Test, pages 266 to 267
d) _ ___
4w - 6 2w , w 0
1. A 5 __
2. D 11. 25.2__ 3 m/s

3. D 12. 12 _____
2 cm
3
4. B 13. 12 3025 million kilometres
___
5. B 14. 2 30 m/s

___
11 m/s ___
6. 76 15. 2 38 m
a) _____ __
b) 8 19
m
16. 1575 mm2, 15 7 mm2
7. $900 __
8. 0.18 17. 7 5__units
9. a) 53.5 cm b) 75.7 cm c) No 18. 14 2 m
10. a) 47.5 m b) 6.1 s 19. Brady is correct. The answer can be further
__
11. 12 cm by 12 cm simplified to 10y 2 y .
___
12. a) 3x 2 + 6x - 672 = 0 20. 4 58
b) x = -16 and x = 14 Example: Simplify each __ radical to see which is
c) 14 in., 15 in., and 16 in. not a like
________
radical to 12 6 .
__
d) Negative lengths are not possible. 21. 2 - 3 m

Answers MHR 549


__
22. 12
__
2 cm __ c) __
16 + 4 6t
,t_
8, t 0
__
23. 5 3 and 7 3
8____
- 3t ___3
It is an arithmetic sequence with a common d) ____
5 30y - 10 3y
,y0
__
difference of 2 3 . ___6 __ __
12. c2 + 7c 3c + c2 c + 7c2 3
___ _1
24. a) 2 75 and 108 2 Example: Write the radicals 13. a) When applying the distributive property,
in simplest form; then, add the two radicals Malcolm distributed the 4 to both the whole
with
___
the greatest coefficients.
___
number and the root. The 4 should only be
b) 2 75 and -3 12 Example: Write the distributed to the whole __
number. The correct
radicals in simplest form; then, subtract answer is 12 + 8 2 .
the radical with the least coefficient from b) Example: Verify using decimal
the radical with the greatest coefficient. approximations.
25. a) Example: If x = 3, b) Example:
__ __
If x = 3, __ 4 __ 23.3137
(-3)2 = (-3)(-3) 32 = 9 3 - 2 2__
__
(-3)2 = 9 9 = 3
__
12 + 8 2 23.3137
__
(-3)2 = 32 32 -3
14.
__
5 +1
2 ____ ___
a) T = __ b) __ s
5.2 Multiplying and Dividing Radical Expressions, 10L 9 30
15.
5__ 5
pages 289 to 293 16. 860 + 172 __5 m
___ 4
___
1. a) 14 15 b) -56 c) 4 15 17. -28 -__16 3 __ __ 3 __
d) 4x 38x
____ _____
e) 3y 3( 12y 2 )
3
f)
_
3t __
6
3
18.
3
a) 4 3 mm
3
b) 2 6 mm
3
c) 2 3 : 6
2 19. a) Lev forgot to switch the inequality sign
___ ___
2. a) 3 11 ___ - 4 77 __ ___ when he divided by -5. The correct answer
b) -14 10 - 6 3 + 26
__ __ __ is x < _ 3.
c) 2y + y d) 6z 2 - 5z 2
3 + 2z 3 5
__ __
3. a) 6 2 + 12 __ b) 1 - 9 6___ b) The square root of a negative number is not
___ 3
c) 15j + 33 5 , j 0 d) 3 - 16 4k a real number.
___ __ __
4. a) 8 14 - 24 7 + 2 2 - 6 c) Example: The expression cannot have a
b) -389 variable in the denominator
___ or under the
__
c) -27 __+ 3 5 ___ __ radical sign. __
2x __ 14
d)
3
36 4__- 48 ___
3
13 ( 2 __
) + 208 __ 3___
5
__
e) -4 3__+ 3 30 - 6 ___ + 4 2 - 6 5 + 2 20. Olivia evaluated 25 as 5 in the third step.
__
5. a) 15c 2 ___ - 90 c + 2 2c - 12, c 0 The
__
final steps should be as follows:
___ ___ __
b) 2 + 7 5x - 40x__2x - 140x 2 10 , x 0 ___
3 (2c - 5c)
= __
3 (-3c)
c) 258m___ - 144m 3____ ,m0 3 3__
3 __ 3
___
d)
3 3
20r__6r 2 + 30r 12r - 16r 3 - 24 6r 2 = -c 3
6. a) 2 2 b) -1 ___ 21. 735 cm3
c)
__
3 2 ____ d)
__
9m 35 22. 12 m2__
__
73 ___
(__
15 3 _ 9 2
)
7. a) __
87 11p
b) __
6v 2 98 23.
2
,
2
11 7____ __ __
___
__
- 3m 24.
____
25x 2
+ 30x x + 9x
or ____
x(25x + 30 x + 9)
8. a) 2 10 b)
m 625x 2 - 450x __
+ 81 (25x - 9)2
____
c) __
- 15u 3
d) 4 150t
_____ 25. a) -3 6 b) -6 c) 3
9u
__ ___ d) Examples: The answer to part b) is the
9. a) 2 3 - 1; 11 __
b) 7 + 11 ; 38 opposite value of the coefficient of the
__
c) 8 z__+ 3 7 ;___ 64z - 63 middle term. The answer to part c) is the
d) 19 h - 4 2h ; 329h __ __ value of the constant.
b) ___
__ -7 3 + 28 2 __ __
10. a) 10 + 5 3
29___ 26.
__ c
( a )( r )
n-1

___ ___ r
c) ___
35 + 2 14
d)
__
-8 - 39 ___ __
27. (15 14 + 42 7 + 245 2 + 7 2702 ) cm2
__ _____
__3 __ 5
11. a) ___ , r __
4r 2
6 - 36r 3 6 28. Example: You cannot multiply or divide radical
6r 2 2 expressions with different indices, or algebraic
__ - 81
b) _
9 2

, n>0
expressions with different variables.
2

550 MHR Answers


29. Examples: To rationalize the denominator you 3. a) x = _9 b) x = -2 c) x = -22
2
need to multiply the numerator and denominator 4. a) z = 25 b) y = 36
by a conjugate. To factor a difference of squares,
c) x = _
4 d) m = - _
49
each factor is the conjugate of the other. If you 3 6
factor 3a - 16 ___
as a difference
___
of squares, the 5. k = -8 is an extraneous root because if -8 is
factors are 3a - 4 and 3a + 4. The factors substituted for k, the result is a square root that
form a conjugate pair. equals a negative number, which cannot be true
30. a) 3 m ______ in the real-number system.
b) h(t) = -5(t - 1)2 + 8; t = __ + 1
8-h 6. a) n = 50 __ b) no solution c) x = -1
___
5 7. a) m = 2 7 __ b) x = -16, x = 4
c) ___
19 + 4 10
m c) q = 2 + 2 6 d) n = 4
4 8. a) x = 10 b) x = -32, x = 2
Example: The snowboarder starts the jump
d) j = - _
___
c) d = 4
2
at t = 0 and ends the jump at t = __
5 + 2 10
. 3
5 9. a) k = 4 b) m = 0 __
d) n = ___
The snowboarder will be halfway at 50 + 25 3
___ c) j = 16
t= __
5 + 2 10
. Substitute this value of t into
2
10 10. a) z = 6 b) y_____
=8 c) r = 5 d) x = 6
the original equation to find the height at 11. The equation x + 8 + 9 = 2 has an
the halfway point. extraneous
_____
root because simplifying it further
31. Yes, they are. Example: using the quadratic formula to x + 8 = -7 has no solution.
__________
3 12. Example: Jerry made a mistake when he
32. a) ___
6V(V - 1)2
squared both sides, because he squared each
V-1
b) A volume greater than one will result in a term on the right side rather than squaring
real ratio. (x - 3). The right side should have been
33. Step 1 (x - 3)2 = x 2 - 6x + 9, which gives x = 8 as the
__
y = x y = x2 correct solution. Jerry should have listed the
restriction following the first line: x -17.
x y x y
13. 11.1 m
0 0 0 0 14. a) B 6 b) about 13.8 km/h
1 1 1 1 15. 1200 kg
__
4 2 2 4 16. 2 + n =______
n; n = 4
17. a) v = 19.6h , h 0 b) 45.9 m
9 3 3 9
c) 34.3 m/s; A pump at 35 m/s will meet the
16 4 4 16 requirements.
Step 2 Example: The values of x and y have 18. 6372.2 km ___
a = ___
been interchanged. 3x - 4 3x + 4
19. x ___
Step 3 y
20. a) Example: 4a =______-8
y = x2
16 b) Example: 2 + x + 4 = x
21. 2.9 m
12 22. 104 km
23. a) The maximum profit is $10 000 and it
8
requires 100 employees.
y= x ___________
4 b) n = 100 10 000 - P
c) P 10 000
0 4 8 12 16 x
d) domain: n 0, n W
range: P 10 000, P W
Example: The restrictions on the radical 24. Example: Both types of equations may involve
function produce the right half of the parabola. rearranging. Solving a radical involves squaring
both sides; using the quadratic formula involves
5.3 Radical Equations, pages 300 to 303 taking a square root.
25. Example: Extraneous roots may occur because
1. a) 3z b) x - 4
c) 4(x + 7) d) 16(9 - 2y)
squaring both sides and solving the quadratic
2. Example: Isolate the radical and square both
equation may result in roots that do not satisfy
sides. x = 36 the original equation.

Answers MHR 551


__
26. a) 6.8% b) Pf = Pi(r + 1)3 d) ___
a 2
+ 2a b + b
, b 0 and b a2
__ a2 __
-b
c) 320, 342, 365, 390
15. 4 2 +__8 5
d) geometric sequence with r = 1.068 __
a) _ b) __
5 6 -2a2 2
27. Step 1 16.
_______
__ 18 __ 3
1 6 + 6 2.906 800 603
17.
__
24 + 6 2
units
____________
_______
__ 7
2 6 + 6 + 6 2.984 426 344
18. a) radical defined for x 0; solution: x = 49
_________________
____________
_______
3 6 + 6 + 6 + 6
__
2.997 403 267
b) radical defined for x 4; no solution
______________________
c) radical defined for x 0; solution: x = 18
_________________
____________
_______
__
4 6 + 6 + 6 + 6 + 6 2.999 567 18 d) radical defined for x 0; solution: x = 21
a) restriction: x _ ; solution: x = _
___________________________
______________________
_________________ 19.
12 9
____________
_______
__
5 6 + 6 + 6 + 6 + 6 + 6 2.999 927 862 7 2
________________________________
___________________________
b) restriction: y 3; solution: y = 3 and y = 4
c) restriction: n _ ; solution: n = 8
______________________
_________________
____________
_______ -25
6 6 + 6 + 6 + 6 + 6 + 6 + __6 2.999 987 977
7
_____________________________________
________________________________
___________________________
______________________
_________________
____________
_______ d) restriction: 0 m 24; solution: m = 12
7 __ 2.999 997 996
6 + 6 + 6 + 6 + 6 + 6 + 6 + 6 e) no restrictions; solution: x = -21
__________________________________________
_____________________________________
________________________________
___________________________
______________________
_________________
____________ 20. Example: Isolate the radical; then, square both
8 _______ 2.999 999 666
6 + 6 + 6 + 6 + 6 + 6 + 6 + 6 + __
6 sides. Expand and simplify. Solve the quadratic
_______________________________________________
__________________________________________
_____________________________________
________________________________
___________________________
equation. n = -3 is an extraneous root because
______________________
_________________
9 __ 2.999
____________ 999 944
6 + 6 + 6 + 6 + 6 + 6 + 6 + 6 + 6 +_______
6
when it is substituted into the original equation
a false statement is reached.
Step 2 Example: 3.0 ______ 21. 33.6 m
Step 3 x = 6 + x , x -6
x2 = 6 + x Chapter 5 Practice Test, pages 306 to 307
(x - 3)(x + 2) = 0
x = 3 or x = -2 1. B
Step 4 The value of x must be positive because 2. D
it is a square root. 3. C
4. D
Chapter 5 Review, pages 304 to 305 5. B
____ 5
_____ 6. C ___
1. a) 320 b) -96 __ ____ __
_____ 3
_______ 7. 3 11 , 5___
6 , 160 , 9 2
6
c) 63y d) -108z 4 __
2. a) 6 2
__ ___
b) 6 10 8.
____
-12n 10 - 288n 5
__ 3
_____ 287 __ __
2
c) 3m 3
___
d)
__
2xy ( 10x 2 )__ 9. The radical is defined for x - 5 and x 5 .
The solution is x = _
3
3. a) 13 ___ -4 7
b) ___ c) 3 7.
4. a) -33x 5x + 14 3x , x 0 3 ____
_ 3 ____ __
The solution is ___ . The extraneous
b) 11a + 12a a , a 0 102 + 6 214
10 10.
____ 25
___
5. 3 42 Example: Simplify each radical to see
__
8 7 . ___
if it__equals___ root is ___
102 - 6 214
.
__ 25
6. 3 7 , 8, 65__, 2 17 11. 15 2
__
v = 13 d
7. a) __ b) 48 km/h 12. 9 2 km
__ _____ 3
___
8. 8 6 km 13. a) 6 b) y - 3 c) 49
9. a) false b) true c) false 14. $6300
__ __ 4
__
10. a) 2 3 b) -30f 4 3 c) 6 9 15. She is______
correct. ___
__ 16. a) 1 + x 2 b) 2 30 units
11. a) -1 b) 83 - 20 6
a) R = _2
__
17.
P b) 400
c) a2 + 17a a + 42a, a 0 I ____ ___
a) x = _ b) _ cm
12. Yes; they are conjugate pairs and the solutions SA 22 __
to the quadratic equation.___
__ 3 __
18. 6 2
c) 2

13. a) _ b) __ c) __
2 -( 25 )2 -4a 2 19. a) 3713.15 = 3500(1 + i)2 b) 3%
2 __
25 ___
3
14. a) __
-8 - 2 3
b) __
2 35 + 7
13 ____ 13
c) ___
12 - 6 3m
, m 0 and m _4
4 - 3m 3

552 MHR Answers


Chapter 6 Rational Expressions and 13. Shali divided the term 2 in the numerator
and the denominator. You may only divide
Equations by factors. The correct solution is the second
step, _ .
g+2
6.1 Rational Expressions, pages 317 to 321
2
14. Example: __
2p
1. a) 18 b) 14x c) 7
d) 4x - 12 e) 8 f) y + 2
p2 + p - 2
15. a) ___ b) __ , n 4
2. a) Divide both by pq.
2n2 + 11n + 12 2n + 3
2n2 - 32 2(n - 4)
b) Multiply both by (x - 4).
b) _2
16. a)
x 2
c) Divide both by (m - 3).
4x
d) Multiply both by (y 2 + y). c) x 0
d) _
3. a) 0 b) 1 c) -5
d) none e) 1 f) none 4
4. The following values are non-permissible x
e) 79%
because they would make the denominator
zero, and division by zero is not defined.
a) 4 b) 0 c) -2, 4 2x
d) -3, 1 e) 0 f)
_4 , - _5 17. a) The non-permissible value, -2, does not
3 2
5. a) r 0 b) t 1 make sense in the context as the mass
c) x 2 d) g 0, 3 cannot be -2 kg.
_ __ b) p = 0 c) 900 kg
; w -_
2 3(2w + 3) 2, 0
6. a) ; c 0, 5 b)
3 2(3w + 2) 3 _
50 b) __ , p 4
100
18. a)
q ,q0 p-4
c) __ ; x _ , 7 d) - _ ; a -2, 3
x+7 1 1
b) __
2x - 1 2 2 350 + 9n
19. a) $620
7. a) x 2 is not a factor. n
b) Factor the denominator. Set each factor c) $20.67
equal to zero and solve. x -3, 1 20. a) No; she divided by the term, 5, not a factor.
b) Example: If m = 5 then _ _ .
5 1
c) Factor the numerator and denominator.
10 6
Determine the non-permissible values.
21. a) Multiply by ._5 b) Multiply by _ .
x-2
Divide like factors. _
x+1 5 x-2
22. a) __ b) __
x+3 4x - 8 3x - 6
8. a) _3r , r 0, p 0 b) - _ , x 2
3 12 9
c) ___
2p 5 2x 2 + x - 10
6x + 15
c) __ , b 6
b-4 __k+3
, k -_ 5, 3
_ b) ___
d) 25b 4a2bx + 4a2b
2(b - 6) 2(k - 3) 2 23. a)
5b 12a2b
e) -1, x 4
__
5(x + y)
__
2b - 2a
f) x-y ,xy c)
-14x
9. Sometimes true. The statement is not true 24. a) P
when x = 3.
10. There may have been another factor that x-3

divided out. For example: ___


y(y + 3)
Q R
(y - 6)(y + 3)
b) 2(x + 2) c) x 3
11. yes, provided the non-permissible value, x 5,
is discussed 25. a) ___
(2x - 1)(3x + 1)
= __ , x _
(2x - 1) 1
(3x + 1)(3x - 1) (3x - 1) 3
12. Examples: ___ , ___ ,
x 2 + 2x + 1 x 2
+ 4x + 4
b) In the last step: __ = __ , n 0, _
x 2 + 3x + 2 x 2 + 5x + 6 n+3 -n - 3 5
-n n
___
2x 2
+ 5x + 2 2
26. a) _ , x 3
x+6
3x 2 + 7x + 2
x+3
Write a rational expression in simplest b) (2x - 7)(2x - 5), x -3
form, and multiply both the numerator and
c) ___ , x -3, -1, 2
(x - 3)(x + 2)
the denominator by the same factor. For (x + 3)(x - 2)
example, the first expression was obtained as ___
(x + 5)(x + 3)
d) , x 1
follows: _ = ___ .
x+1 (x + 1)(x + 1) 3
x+2 (x + 2)(x + 1) 27. 6x 2 + _
19 x + 2, x _1, _
3
2 4 2

Answers MHR 553


28. a) Lt c) ___
4(y - 7)
, y -3, 1, _
3
(2y - 3)(y - 1) 2
b)
2. a) __
d - 10 , d -10 b) _
a - 1 , a 3, -1
4 a-3
c) _1 , z 4, _5
2 2
r
d) __
p+1
, p -3, 1, _
3, _
1
3 2 2
R 3. a) _t b) __
3
2 2x - 1
c) _
y - 3
d)
__
p-3
8 2p - 3
(R - r)(R + r) 4. a) s 0, t 0 b) r 7, 0
c) L = ___ , t > 0, R > r, and t, R,
(R + r)(R - r) c) n 1
t 5. x - 3, x -3
and r should be expressed in the same units. _ y
29. Examples: 6. , y 3, 0
y+3
a) ___
2
a) __ = __ = -1, p 3
3-p -1(p - 3)
(x + 2)(x - 5) 7.
p-3 p-3
b) ___
x 2 + 3x __
x 2 + 2x - 3
; the given expression has a b)
7k - 1 __ 1
3k 1 - 7k
non-permissible value of -1. Multiply the
numerator and denominator by a factor, = __
7k - 1 ___ 1
3k -1(7k - 1)
x + 3, that has a non-permissible value
=_ -1 or - _ 1 , k 0, _
1
of -3. 3k 3k 7
a) __ , w -2, - _
30. a) Example: if y = 7, 8.
w-2 3
3 2
_
y-3
and ___
2y 2
- 5y - 3
b) _ , v 0, -3, 5,
4 8y + 4 v2
v+3
=_ = ___
7-3 2(72) - 5(7) - 3
c) ___ , x -5, 2, - _
4 -1(3x - 1) 1
8(7) + 4
=_60 x+5 3
=1
d) _ , y 1, 2, - _ , _
60 -2 1 3
=1 y-2 2 4
9. -3 and -2 are the non-permissible values
b) ___ = ___ = __
2y 2 - 5y - 3 (2y + 1)(y - 3) y-3
8y + 4 4(2y + 1) 4 of the original denominators, and -1 is the
c) The algebraic approach, in part b), proves
non-permissible value when the reciprocal of
that the expressions are equivalent for all the divisor is created.
values of y, except the non-permissible 10.
__
n2 - 4
(n - 2); __ , n -1, 2
n+2
n+1 n+1
a) __ (60) = 12x - 36 metres
value. (x - 3)
11.
31. a) m = __
p-8 5
b) 900 __ = __ kilometres
p+1 600 3n + 3
b) Any value -1 < p < 8 will give a negative n+1 2
slope. Example: If p = 0, m = _-8 . per hour, n -1
c) ___ = __ metres, x _ , -1
1 x 2 + 2x + 1 x+1 3
c) If p = -1, then the expression is undefined, (2x - 3)(x + 1) 2x - 3 2
and the line is vertical. 12. They are reciprocals of each other. This is
32. Example: _ = __ = _ ,
12 (3)(4) 4 always true. The divisor and dividend are
15 (3)(5) 5 interchanged.
___ x2 - 4 = ___
(x + 2)(x - 2)
13. Example:
x 2 + 5x + 6 (x + 3)(x + 2)
1 yd _
3 ft __
( )(12 in. __
2.54 cm = 91.44 cm
)( )
= __ , x -3,-2
(x - 2)
1 yd 1 ft 1 in.
(x + 3)
14. a) Tessa took the reciprocal of the dividend,
6.2 Multiplying and Dividing Rational Expressions, not the divisor.
b) = ___ _
pages 327 to 330 (c + 6)(c - 6) 8c2
2c c+6
1. a) 9m, c 0, f 0, m 0 = 4c(c - 6)
b) __
a - 5 , a -5, 1, a b
= 4c2 - 24c, c 0,-6
5(a - 1)

554 MHR Answers


c) The correct answer is the reciprocal of 4. a) 24, 12; LCD = 12
Tessas answer. Taking reciprocals of either b) 50a3y3, 10a2y 2; LCD = 10a2y 2
factor produces reciprocal answers. c) (9 - x 2)(3 + x), 9 - x 2;
15. (x - 9) x
2 ___
2
- 2x - 3 = x + 3; x 3, x -1 LCD = 9 - x 2 or (3 - x)(3 + x)
5. a) _ , a 0 b) _ , x 0
x+1 11 x+9
_1 _
( )( x+2 x ___
2
- 7x - 8 ; __x+1 15a 6x
16.
2 x-8 )( x2 - 4) 2(x - 2)
, x 2, 8
__
2(10x - 3)
c) ,x0
a) K = _ , m 0, w 0, h 0
17.
Pw 5x
d) ____
2h (2z - 3x)(2z + 3x)
_
2r xyz , x 0, y 0, z 0
b) y = x , d 0, x 0, r 0
c) a = vw, w 0 e) ___
4st + t2 - 4
,t0
10t3
18. 2(n - 4), n -4, 1, 4
f) ____
6bxy 2 - 2ax + a2b2y
19. a) Yes; when the two binomial factors are , a 0, b 0, y 0
a2b2y
multiplied, you get the expression x 2 - 5.
a) ___ , x 2
__ -5x + 18
6.
b) __
x + 7 __ (x + 2)(x - 2)
b) ___ , x -3, 4
x - 3 3x - 11
__
c) x + 7 ; it is the same. (x - 4)(x + 3)
c) ___ , x 2
20. a) approximately 290 m 2x(x - 4)

b) __2 metres
(x + 3)2 (x - 2)(x + 2)
d) _
4g(x - 5) 3 , y -1, 0
Agree. Example: _ 2 _ 1 = __ =_
(2)(1) 2, y
21. ( )( ) 3 5 (3)(5) 15 ____ -3(5h + 9)
e) , h 3
and _
2_
1= _2 _ 5 =_10 (h + 3)(h + 3)(h - 3)
5 ( 3 )( 1 )
f) ____ , x -3, 0, 1, 2
3 3 (2x - 3)(x + 2)
__
(x + 2)
__ = ___
(x + 1) (x + 2)(x + 1) x(x - 2)(x - 1)(x + 3)
(x + 3) (x + 3)(x + 3)(x + 3)
a) ___ , x 5, _
2(x 2 - 3x + 5) 1
7.
___
x
= 2
2
+ 3x + 2
, x -3 (x - 5)(x + 5) 2
x + 6x + 9
b) ___ , x -3, 0, 2, 8
-x + 4
__
(x + 2)
__ = __ __
(x + 1) (x + 2) (x + 3) (x - 2)(x + 3)
c) ___ , n 2, 3, 4
(x + 3) (x + 3) (x + 3) (x + 1) n+8
= __
(x + 2)
, x -3,-1
(n - 4)(n - 2)
d) ___ , w -2, -3, -4
(x + 1) w+9
(w + 3)(w + 4)
22. a) __ b) __
p+2 p-4
4-p p+2 8. In the third line, multiplying by -7 should
_b give -7x + 14. Also, she has forgotten to list
23. a) tan B = _ b) _ = _
b c b the non-permissible values.
a _a a
= _____
c 6x + 12 + 4 - 7x + 14

c) They are the same; tan B = __ .


sin B (x - 2)(x + 2)
cos B = ___-x + 30
, x 2
(x - 2)(x + 2)
6.3 Adding and Subtracting Rational Expressions, 9. Yes. Factor -1 from the numerator to create
pages 336 to 340 -1(x - 5). Then, the expression simplifies
to _-1 .
1. a) _
7x b) _
10 , x 0 x+5
a) _ , x 0, 3
6 x 2x
10.
c) __
4t + 4
or __
4(t + 1)
d) m, m -1
x+3
b) __ , t -6, -2, 0, 3
5 5 3(t + 6)
e) a + 3, a 4 2(t - 3)
2.
__
3x - 7
+ __ = ___
6x + 7 3x - 7 + 6x + 7 c) __3m , m 0, - _ 3 , -3
9 9 9 m+3 2
=_9x
d) _ , x 4, 2
x
9 x-2
=x
3. a) ___ , x -1, 3
-4x + 13
(x - 3)(x + 1)
b) ____ , x -10, 2
3x(x + 6)
(x - 2)(x + 10)(x + 2)

Answers MHR 555


_
AD + C 18. a) Incorrect: _a - _b = __
2 2
a - b . Find the LCD
__ b a ab
= ( __ ) D
B AD + CB
11. a) first, do not just combine pieces.
D B
b) Incorrect: __ = __ . Factor c from
ca + cb a+b
= ( __ )( _
AD + CB 1
B )
D
c + cd 1+d
the numerator and from the denominator,
= __
AD + CB remembering that c(1) = c.
c) Incorrect: _ - _ = __ . Distribute
BD a 6-b a-6+b
=_AD + _CB 4 4 4
BD BD the subtraction to both terms in the
=_A+_ C numerator of the second rational expression
B D by first putting the numerator in brackets.
(_ d) Incorrect: __ = _ . Simplify the
[ ]
AB + C D
___
D ) +E F= _ 1-_
1
a
b
b)
F ( AB + C)D + EFD b
b-a

= AB + CD + EF denominator first, and then divide.


e) Incorrect: _ = _ . Multiplying
____________
1 -1
12.
___ 2
5x - 2x + 1
a-b b-a
4 both numerator and denominator by -1,
13. a) _
200 tells the expected number of weeks which is the same as multiplying the whole
m
to gain 200 kg; __
200 tells the number of expression by 1, changes every term to
m+4 its opposite.
weeks to gain 200 kg when the calf is on the 19. a) Agree. Each term in the numerator is
healthy growth program. divided by the denominator, and then can
b) _ - __
200 200 be simplified.
m m+4 b) Disagree. If Keander was given the rational
c) __ , m 0, -4; yes, the expressions
800
m(m + 4) expression __ 3x - 7 , there are multiple
x
are equivalent. original expressions that he could come up
a) _ minutes with, for example __ 2x - 1 + __
14.
200 x - 6 or
n x x
b) _
200
( _500 _ 1000 minutes
) x___
2
- x + 11 ___
x2
- 4x + 18
n + n + n x - x .

c) _ minutes; the time it would take to type


1700 R1R2R3
20. a) _ b) ____
12
n
13 R2R3 + R1R3 + R1R2
all three assignments
c) _
_
200 + __500 + __ 1000 - _ 1700 12
d)
n ( n-5 n - 10 n ) 13
d) the simplified form from part b), because
____
= 12 500n - 75 000
with it you do not need to find the LCD first
n(n - 5)(n - 10)
21. Example:
a) ___ , x -5, -2, 0, 3, 4
2
2x + 13
15.
(x - 4)(x + 5) Arithmetic: Algebra:
b) ___ , x -3, -2, 0, 1, _
-9 1 _2 _6 _x _ 3x
(x - 1)(x + 2) 2 If = , then If = , then
3 9 2 6
c) ___ , x -5, -2, 0, 3, 4 _2 = __ _x = __
3(1 - 4x) 2-6 x - 3x
(x + 5)(x - 4) 3 3-9 2 2-6
d) ___ , x 0, -2, -3, -6, - _
15 1 =
_
-4
=
_
-2x
(x + 6)(x + 3) 2 -6 -4
_
20 _ _
2 _
x
16. ( x
+ 16
x-2
hours ) =
3
=
2
17. Example: In a three-person relay, Barry ran
22. a) __
-2p + 9
,p3
the first 12 km at a constant rate. Jim ran the 2(p - 3)
second leg of 8 km at a rate 3 km/h faster, and b) _3 ; the slope is undefined when p = 3,
Al ran the last leg of 5 km at a rate 2 km/h 0
so this is a vertical line through A and B.
slower than Barry. The total time for the relay
c) The slope is negative.
would be _ 12 + _ 8 +_
( 5 hours. ) d) When p = 4, the slope is positive; from
x x+3 x-2
p = 5 to p = 10 the slope is always negative.

556 MHR Answers


23. 3 10. 30 students
24. Examples: _ + _ = __ = _ and
2 1 2+1 3 11. The integers are 5 and 6.
5 5 5 5 12. a) Less than 2 min. There is more water going
_2 + _1 = __
2(3) + 1(5)
=_11 in at once.
5 3 15 15
b)
_2 + _1 = _
2+1 _ 3
x x x = x and Time to Fill Fraction Filled Fraction Filled
_2 + _1 = __
2(y) + 1(x)
= __
2y + x Tub (min) in 1 min in x minutes
x y xy xy
Cold Tap 2
_1 _x
25. a) The students suggestion is correct. 2 2
Example: find the average of _ 1 and _3.
_1 _x
2 4 Hot Tap 3
3 3
_1 + _3 2 = __
( ) 2+3
( _
) () 1
2 4 4 2
Both Taps x
_1 1
=_5 x
8 _x + _x = 1
c) d) 1.2 min
Halfway between _ 1 and _3 , or _4 and _6 , is _
5. 2 3
2 4 8 8 8 13. 6 h
b) _ , a 0
13
14. a)
4a Distance Rate Time
26. Yes. Example: _ + _ = _ and _ + _ = _ = _
1 1 5 1 1 1 5 (km) (km/h) (h)
2 3 6 2 3 _6 6 __
18
5 Downstream 18 x+3
x+3
_1 + _1 = _x+y _
1 _
1 __ 1 _
x+y
__
x y xy and x + y = _ xy = xy Upstream 8 x-3
8
x-3
x+y
_
1 _
1
27. a) u + v = uv _
u+v
b) 5.93 cm b) _
18 = _
8 c) 7.8 km/h
x+3 x-3
c) f = _ uv d) x 3
u+v 15. 28.8 h
28. Step 3 Yes
16. 5.7 km/h
Step 4 a) A = 2, B = 1
17. about 50 km/h west of Swift Current, and
b) A = 3, B = 3
60 km/h east of Swift Current
Step 5 Always:
18. about 3.5 km/h
_ 3 +_ ____
-2 = 3(x - 1) + -2(x - 4)
19.
x-4 x-1 (x - 4)(x - 1) Reading Rate in Number of Number

= ___ x+5 Pages per Day Pages Read of Days


(x - 4)(x - 1) First
x 259
_
259
Half x
6.4 Rational Equations, pages 348 to 351
1. a) 4(x - 1) - 3(2x - 5) = 5 + 2x
Second
x + 12 259
__
259
Half x + 12
b) 2(2x + 3) + 1(x + 5) = 7
c) 4x - 5(x - 3) = 2(x + 3)(x - 3) about 20 pages per day for the first half of
2. a) f = -1 b) y = 6, y 0 the book
c) w = 12, w 3, 6 20. a) 2 L b) 4.5 L
3. a) t = 2 or t = 6, t 0 b) c = 2, c 3 21. a= _
1
3
c) d = -2 or d = 3, d -4, 1
_1 + _1
d) x = 3, x 1
a) __ = _ _
a b 1 2ab
4. No. The solution is not a permissible value. 22.
2 x, x = a + b
5. a) _ 2 , __
3-x -_ 3 - 3x , x > 0 b) 4 and 12, or -6 and 2
x
a) _ _1 - _1 = a
x2 x2
23.
1-_ 1 =a or
b) _
3-x _ 2 __6 - 2x x y x y
x2 x , x3 , x > 0 _
y-x
c) x = _
1 y - x = axy xy = a
2 y = axy + x y - x = axy
6. a) b = 3.44 or b = 16.56 y = x(ay + 1) y = axy + x
b) c = -3.54 or c = 2.54
__ __
y
=x y = x(ay + 1)
7. l = 15( 5 + 1), 48.5 cm ay + 1
8. The numbers are 5 and 20. __
y
=x
ay + 1
9. The numbers are 3 and 4.
In both, x 0, y 0, ay -1.
Answers MHR 557
b) __
2d - gt2
=v ,t0 4. a) -6; s 0 b) -1; x _3
c) - _ ; b 2
1
2t 0 5 4
__ a) __ b) _
c) n =
Ir , n 0, R - _
r , E Ir, I 0 5.
2x 2 - 6x 1
E - IR n 10x x+3
24. a) Rational expressions combine operations
c) __
3c - 6d d)
___
m 2
- 3m - 4
and variables in one or more terms. 9f m2 - 16
Rational equations involve rational 6. a) Factor the denominator(s), set each factor
expressions and an equal sign. equal to zero, and solve.
Example: _ 1+_
x
1 is a rational expression,
y Example: Since __ m - 4 = ___ m-4 ,
m2 - 9 (m + 3)(m - 3)
which can be simplified but not solved. the non-permissible values are 3.
_1 + _1 = 5 is a rational equation that can
b) i) x - 5, x - _
2 ii)
_ a
, a 3
x 2x 3 a+3
iii) - _ , x y iv) __ , x _
be solved. 3 9x - 2 2
b) Multiply each term by the LCD. Then, 4 2 9
divide common factors. 7. a) x + 1
_5 - _ 1 =_ 1 b) x 1, as this would make a width of 0, and
x x-1 x-1 x -1, as this would make a length of 0.
x(x - 1) _5 - x(x - 1) _ = x(x - 1) _
1 1 8. Example: The same processes are used
( )
x ( x-1 ) ( x-1) for rational expressions as for fractions.
Simplify the remaining factors by multiplying. Multiplying involves finding the product of
Solve the resulting linear equation. the numerators and then the product of the
(x - 1)(5) - x(1) = x(1) denominators. To divide, you multiply by the
5x - 5 - x = x reciprocal of the divisor. The differences are
3x = 5 that rational expressions involve variables and
x=_ 5 may have non-permissible values.
3
c) Example: Add the second term on the left to (_12 )(_35 ) = __
(1)(3) __
x+2
__ = ___
x+3 (x + 2)(x + 3)

both sides, to give _ 5=_ 2 . (2)(5) 2 5 (2)(5)


=_ ___
x x-1 3 x 2
+ 5x + 6
=
25. a) 5.5 pages per minute 10 10
b) and c) Answers may vary. _3 _1 = ( _3 )( _2 ) __
x+2
__ = __ __
x+1 x+2 2
26. a) 46 4 2 4 1 4 2 4 x+1
=_ = __ , x -1
x+2
b) _ is 90%, so ___ = 45. For this
45 10(40) + 5(x) 3
50 15 2 2(x + 1)
equation to be true, you would need 55 on _5q _ 2
m , m 0, t 0
each of the remaining quizzes, which is 9. a) , r 0, p 0 b)
2r 4t3
not possible. c) _3 , a -b
27. a) The third line should be 2
d) ___
2x + 2 - 3x 2 + 3 = 5x 2 - 5x 2(x - 2)(x + 5)
, x -2, 0
____ 0 = 8x 2 - 7x - 5 (x 2 + 25)
b) __
7 209 e) 1, d -3, -2, -1

f) ___ , y 1, 5, 9
16 -(y - 8)(y + 5)
c) x = 1.34 or x = -0.47 (y - 1)
b) _ , a 0, b 0
10. a) 8t
1
Chapter 6 Review, pages 352 to 354 b
c) __ , x y
-1 d)
_ 3
, a 3
1. a) 0. It creates an expression that is undefined. 5(x + y) a+3
e) _ , x -2, -1, 0, _
b) Example: Some rational expressions have 1 2
non-permissible values. x+1 3
For _ 2 , x may not take on the value 3.
f) __ , x 2
-(x + 2)
x-3 3
a) _ , m 0 b) _
2. Agree. Example: There are an unlimited number m x - 1 , x -3, -2, 0, 2
11. x
of ways of creating equivalent expressions by 2
multiplying the numerator and denominator c) _
1 _
, a 3, 4 d) , x 3, - _
1 4 , -4
6 5 3
by the same term; because you are actually
12. x centimetres
multiplying by 1 _ X =1 .
( ) 13. a) 10x
X
3. a) y 0 b) x -1 c) none b) (x - 2)(x + 1)

d) a -2, 3 e) m -1, _
3 f) t 2
Example: The advantage is that less
2 simplifying needs to be done.
558 MHR Answers
14. a) __
m+3
b) _
m, x 0 d) m = 1 or m = - _
21 , m 3
5 x 2
c) 1, x -y d) -1 e) no solution, x 3
__
e) _
1 _ , x 0, - _1
6
x - y , x y f) x =
2 2
a) _
15.
5x b) 1, y 0 g) x = -5 or x = 1, x -2, 3
12
c) ___ , x 3
9x + 34 21. The numbers are 4 and 8.
(x + 3)(x - 3) 22. Elaine would take 7.5 h.

d) ___ , a -3, 2
a 23. a) _
160 + 36 + __
160 = 150
(a + 3)(a - 2) x x + 0.7
e) 1, a b b) 570x 2 - 1201x - 560 = 0, x = 2.5 m/s.

f) _____ , x -1, _
2x 2 - 6x - 3 3 c) The rate of ascent is 9 km/h.
(x + 1)(2x - 3)(2x + 3) 2
a) _ + _ = _
1 1 a+b Chapter 6 Practice Test, page 355
16.
a b ab
1. D
b) Left Side = _ + _
1 1
a b 2. B

=_ b +_ a 3. A
ab ab 4. A
= __
a+b 5. D
ab 6. x -3, -1, 3, _5
= Right Side 3
7. k = -1
Exam mark, d = __ ;
a+b+c
17.
3
8.
__
5y - 2
,y2
Final mark = _ ( )(
1 a__ +b+c
) () + _1 d 6
2 3 2 9. Let x represent the time for the smaller auger to
= ___
a + b + c + 3d fill the bin.
6 _6 + _ 6 =1
Example: ___ = d
60 + 70 + 80
x x-5
3
10. Example: For both you use an LCD. When
____
60 + 70 + 80 + 3(70)
= 70 solving, you multiply by the LCD to eliminate
6
18. a) i) the amount that Beth spends per chair; the denominators, while in addition and
$10 more per chair than planned subtraction of rational expressions, you use the
ii) the amount that Helen spends per chair; LCD to group terms over a single denominator.
$10 less per chair than planned Add or subtract. Solve.
iii) the number of chairs Helen bought _x - _x _x + _x = 16
iv) the number of chairs Beth bought 4 7 5 3
v) the total number of chairs purchased by =_
7x - _4x _x _x
15( ) + 15( ) = 15(16)
28 28 5 3
the two sisters
=_
3x 3x + 5x = 240
b) ___
450c - 500 or ___ 50(9c - 10)
, c 10 28 8x = 240
c2 - 100 (c - 10)(c + 10)
x = 30
19. Example: When solving a rational equation, you
11. x = 4; x -2, 3
multiply all terms by the LCD to eliminate the
12.
__
5x + 3
- __
2x - 1 = __
2x - 1 - _
3 - x ; x = 2.3
denominators. In addition and subtraction of 5x 2x 2x x
rational expressions, you use an LCD to simplify 13. The speed in calm air is 372 km/h.
by grouping terms over one denominator.

Add or subtract. Solve. Chapter 7 Absolute Value and


_x + _x _x + _x = 5 Reciprocal Functions
3 2 3 2
=_
2x + _
3x 2x + 3x = 30 7.1 Absolute Value, pages 363 to 367
6 6 5x = 30
= _
5x x=6 1. a) 9 b) 0 c) 7
6
d) 4.728 e) 6.25 f) 5.5
20. a) s = -9, s -3
b) x = -4 or x = -1, x 1, -
2 _ 2. -0.8, -0.4, | _35 |, |0.8|, 1.1, |-1 _14 |, |-2|
3. 2.2, |- _ |, |1.3|,|1 _ |, |-0.6|, -1.9, -2.4
3 7 1
c) z = 1, z 0 5 10

Answers MHR 559


4. a) 7 b) -5 c) 10 d) 13 24. a) i) x = 1, x = -3
5. Examples: ii) x = 1, x = -5; you can verify by trying
a) |2.1 - (-6.7)| = 8.8 b) |5.8 - (-3.4)| = 9.2 them in the equation.
c) |2.1 - (-3.4)| = 5.5 d) |-6.7 - 5.8| = 12.5 b) It has no zeros. This method can only be
6. a) 10 b) -2.8 c) 5.25 d) 9 e) 17 used for functions that have zeros.
7. Examples: 25. Example: Squaring a number makes it positive,
a) |3 - 8| = 5 b) |-8 - 12| = 20 while the square root returns only the positive root.
c) |9 - 2| = 7 d) |15 - (-7)| = 22
e) |a - b| f) |m - n| 7.2 Absolute Value Functions, pages 375 to 379
8. |7 - (-11)| + |-9 - 7|; 34 C
1. a) x y = |f(x)| b) x y = |f(x)|
9. Example:
|24 - 0| + |24 - 10| + |24 - 17| + |24 - 30| + -2 3 -2 0
|24 - 42| + |24 - 55| + |24 - 72|; 148 km -1 1 -1 2
10. 1743 miles
0 1 0 2
11. a) $369.37
b) The net change is the change from the 1 3 1 0
beginning point to the end point. The 2 5 2 4
total change is all the changes in between
2. (-5, 8)
added up.
3. x-intercept: 3; y-intercept: 4
12. a) 7.5 b) 90 c) 0.875
4. x-intercepts: -2, 7; y-intercept: _3
13. 4900 m or 4.9 km 2
14. a) 1649 ft b) 2325 ft 5. a) b)
15. $0.36 y y
16. a) 6 km b) 9 km
4 4
17. a) The students get the same result of 90.66.
b) It does not matter the order in which you y = |f(x)|
2 2
y = |f(x)|
square something and take the absolute
value of it. x
-4 -2 0 2x -2 0 2 4
c) Yes, because the result of squaring a number is
-2 -2
the same whether it was positive or negative. y = f(x) y = f(x)
18. a) Michel looks at both cases; the argument is
either positive or negative.
c) y
x - 7 if x 7
b) i) |x - 7| = { 7 - x if x < 7 4

2x - 1 if x _ 1
ii) |2x - 1| =
{1 - 2x if x < _
2
1
2
-2 0
2

2
y = |f(x)|

4 x
3 - x, if x 3
{
iii) |3 - x| =
x - 3, if x > 3
-2
y = f(x)
iv) x 2 + 4
19. Example: Changing +5 to -5 is incorrect.
6. a) x-intercept: 3; y-intercept: 6;
Example: Change the sign so that it is positive.
domain: {x | x R}; range: {y | y 0, y R}
20. 83 mm
y
21. Example: when you want just the speed of
something and not the velocity 4
22. Example: signed because you want positive for
up, negative for down, and zero for the top 2
23. a) 176 cm
b) 4; 5; 2; 1; 4; 8; 1; 1; 2; 28 is the sum -2 0 2 4 x
c) 3.11 y = |2x - 6|
-2
d) It means that most of the players are within
3.11 cm of the mean.

560 MHR Answers


b) x-intercept: -5; y-intercept: 5; b) y
domain: {x | x R}; range: {y | y 0, y R}
4
y = |f(x)|
y
2
4
y = |x + 5|
2 -4 -2 0 2 4 x
-2
y = f(x)
-6 -4 -2 0 x

c) y = |f(x)| y
c) x-intercept: -2; y-intercept: 6;
domain: {x | x R}; range: {y | y 0, y R} 4
f(x)
2
4
-8 -6 -4 -2 0 2x
2
-2

-6 -4 -2 0 x y = f(x)
-4
f(x) = |-3x - 6|

d) x-intercept: -3; y-intercept: 3; 8. a) x-intercepts: -2, 2; y-intercept: 4;


domain: {x | x R}; range: {y | y 0, y R} domain: {x | x R}; range: {y | y 0, y R}
y
g(x)
g(x) = |-x - 3| 4
4

2
2

-4 -2 0 2 x
-8 -6 -4 -2 0 2x y = |x2 - 4|

e) x-intercept: 4; y-intercept: 2; b) x-intercepts: -3, -2; y-intercept: 6;


domain: {x | x R}; range: {y | y 0, y R} domain: {x | x R}; range: {y | y 0, y R}
y y
y= 1
_x - 2
| | 4
2 2

2
-2 0 2 4 6 x

-6 -4 -2 0 x
f) x-intercept: -9; y-intercept: 3; y = |x2 + 5x + 6|
domain {x | x R}; range {y | y 0, y R}
c) x-intercepts: -2, 0.5; y-intercept: 2;
h(x)
domain: {x | x R}; range: {y | y 0, y R}
h(x) = 1|
_x + 3
| 4
3 f(x)
4
-16 -12 -8 -4 0 x
2
7. a) y

4 -6 -4 -2 0 2 x
f(x) = |-2x2 - 3x + 2|
y = |f(x)|
2

-4 -2 0 2 4 x
y = f(x)
-2

Answers MHR 561


d) x-intercepts: -6, 6; y-intercept: 9; 12. a) b)
domain: {x | x R}; range: {y | y 0, y R} g(x)
x g(x)
y g(x) = |6 - 2x|
-1 8 6
8
0 6 4
y= 1 |
_ x2 - 9
| 2 2
4 4
2
3 0
-8 -4 0 4 8 12 x 5 4
-2 0 2 4 x

e) y-intercept: 10; domain: {x | x R};


c) domain: {x | x R}; range: {y | y 0, y R}
range: {y | y 1, y R} d) y = 6 - 2x if x 3
g(x) y = 2x - 6 if x > 3
4 13. a) y-intercept: 8; x-intercepts: -2, 4
b) g(x)
g(x) = |(x - 3)2 + 1|
2
8

0 2 4 6 8 10 x 4

f) y-intercept: 16; domain: {x | x R}; -4 -2 0 2 4 6 x


range: {y | y 4, y R} g(x) = |x2 - 2x - 8|

h(x) c) domain: {x | x R}; range: {y | y 0, y R}


d) y = x 2 - 2x - 8 if x -2 or x 4;
6
y = -x 2 + 2x + 8 if -2 < x < 4
14. a) x-intercepts: - _ , 2; y-intercept: 4
4 2
h(x) = |-3(x + 2)2 - 4| 3
2 b) g(x)
4
-8 -6 -4 -2 0 x g(x) = |3x - 4x - 4|
2
2

9. a) y = 2x - 2 if x 1
-8 -6 -4 -2 0 2 x
y = 2 - 2x if x < 1
b) y = 3x + 6 if x -2
y = -3x - 6 if x < -2 c) domain: {x | x R}; range: {y | y 0, y R}
c) y = _ x - 1 if x 2 _2 or x 2;
1
d) y = 3x 2 - 4x - 4 if x -
2 3
y=1-_ 1 x if x < 2
y = -3x 2 + 4x + 4 if - _
2 <x<2
2 3
10. a) y = 2x 2 - 2 if x -1 or x 1 15. Michael is right. Since the vertex of the original
y = -2x 2 + 2 if -1 < x < 1 function is below the x-axis, the absolute value
b) y = (x - 1.5)2 - 0.25 if x 1 or x 2 function will have a different range and a
y = -(x - 1.5)2 + 0.25 if 1 < x < 2 different graph.
c) y = 3(x - 2)2 - 3 if x 1 or x 3 16. a) y y = |0.475x - 55.1|
y = -3(x - 2)2 + 3 if 1 < x < 3
11. a) y = x - 4 if x 4 40
y = 4 - x, if x < 4
b) y = 3x + 5 if x - _
5 0 40 80 120 160 200 x
3
y = -3x - 5 if x < - _ 5
b) (116, 0)
3
c) y = -x 2 + 1 if -1 x 1 c) (236, 57) is where the puck will be at the
y = x 2 - 1 if x < -1 or x > 1 far side of the table, which is right in the
d) y = x 2 - x - 6 if x -2 or x 3 middle of the goal.
y = -x 2 + x + 6 if -2 < x < 3

562 MHR Answers


17. The distance travelled is 13 m. 29. Examples:
18. a) The two graphs are identical. They are Step 1 Yes.
identical because one is the negative of the Step 2 Absolute value is needed because the
other but since they are in absolute value facility could be to the east or west of each town.
brackets there is no change. total = |x| + |x - 10| + |x - 17| + |x - 30|
y + |x - 42| + |x - 55| + |x - 72|
Step 3 x: [0, 60, 10]
4
y: [-30, 300, 20]
f(x) = |3x - 2| Step 4 The point
2
g(x) = |-3x + 2|
(30, 142) on the graph
shows that there is a
-2 0 2 4 6 x
point that minimizes
the distance to each city. The point represents
b) f (x) = |-4x - 3|
a place 30 km east of Allenby and results in a
19. f (x) = |-x 2 + 6x - 5|
total distance from all towns of 142 km.
b) y = _ (x + 3)2
f(x) 4
6
30. a) y = |(x - 3)2 + 7| |
5 |
c) y = |-x 2 - 6| d) y = |5(x + 3)2 + 3|
4
7.3 Absolute Value Equations, pages 389 to 391
2
1. a) x = -7, x = 7 b) x = -4, x = 4
c) x=0 d) no solution
0 2 4 6 x 2. a) x = -6, x = 14 b) x = -5, x = -1
f(x) = |x2 - 6x + 5|
c) x = -14, x = -2 d) no solution
20. a = -4, b = 6 or a = 4, b = -6 3. a) |x| = 2 b) |x - 2| = 6
21. b = 4; c = -12 c) |x - 4| = 5
22. Example: The square of something is always
4. a) x = -19, x = 5 b) x = _2 , x = 2
positive, so taking the absolute value does nothing. 3
23. Example: No, it is not true for all x, y R. For c) no solution d) x = 3.5, x = 10.5
instance, if x and y are of different sign the left 5. a) no solution b) x = -9, x = 1
side will not equal the right side. _1
c) m = - , m = 3 d) no solution
3
24.
a = -_
y 11 , a = -3
|x| + |y| = 5 e)
4 3 __
6. a) x = -3, x = 3 b) x = 2, x = 3
2 c) x -3 or x 3
__ __
d) x = __
1 + 5
, x = __
5 - 1

x
2 2
-4 -2 0 2 4
e) x = -4, x = -2, x = 4, x = 6
-2 7. a) |d - 18| = 0.5
b) 17.5 mm and 18.5 mm are allowed
-4
8. a) |c - 299 792 456.2| = 1.1
b) 299 792 455.1 m/s or 299 792 457.3 m/s
25. 9. a) |V - 50 000| = 2000 b) 48 000 L, 52 000 L
Case |x||y| |xy|
10. a) 2.2, 11.8 b) |x - 7| = 4.8
x 0, y 0 xy xy 11. a) 66.5 g b) 251 mL and 265 mL
x 0, y < 0 x(-y) -xy 12. a) perigee: 356 400 km; apogee: 406 700 km
x < 0, y 0 (-x)y -xy b) Example: The moon is usually around
381 550 km away plus or minus 25 150 km.
x < 0, y < 0 (-x)(-y) xy
13. a) greater than or equal to zero
26. Example: They have the same shape but b) less than or equal to zero

14. a) x = _ if x 0, x = __ if x < 0;
different positions. b+c -b - c
27. Example: Graph the functions, taking care to a a
allow them only in their specified domain. b + c 0, a 0
28. If the discriminant is less than or equal to 0 and b) x = b + c if x b, x = b - c if x < b; c 0
a > 0, then the graphs will be equivalent.

Answers MHR 563


15. Andrea is correct. Erin did not choose the two v) x = -4, x = 4
cases correctly. d) i) x = 3, x = -4 ii) y = 2
1 ___
x + x - 12
16. |t - 11.5| = 2.5; t = 9 C, t = 14 C iii) x 3, x -4
17. a) |x - 81| = 16.2; 64.8 mg, 97.2 mg iv) The zeros of the original function are
b) Example: They might lean toward the non-permissible values of the reciprocal
97.2 mg because it would provide function.
more relief because there is more v) x = 3, x = -4
b) x = - _
of the active ingredient. 3. a) x = 2
7
3
18. |t - 10| = 2 c) x = 2, x = -4 d) x = 4, x = 5
19. a) sometimes true; x -1 4. When x = 3, there is a division by zero, which
b) sometimes true; if x = -a, then the solution is undefined.
a) no x-intercepts, y-intercept: _
is 0. For all other values of x, the solution is 1
5.
greater than 0. 5
b) no x-intercepts, y-intercept: - _
c) always true 1
4
20. Examples:
c) no x-intercepts, y-intercept: - _
1
a) |x - 3| = 5 b) |x| = -2 9
d) no x-intercepts, y-intercept: _
c) |x| = 0 d) |x| = 5 1
21. Yes; the positive case is ax + b = 0, which always 12
has a solution. 6. Example: Locate zeros and invariant points.
22. a) |x - 3| = 4 b) |x 2 - 4| = 5 Use these points to help sketch the graph of the
23. Example: The first equation has no solution reciprocal function.
because an absolute value expression cannot a) y
equal a negative number. The second equation 4
has two solutions because the absolute value
y = f(x)
expression equates to a positive number, so two 2
cases are possible.
24. Example: When solving each case, the solutions -2 0 2 4 x
generated are for the domain {x | x R}. -2
However, since each case is only valid for
a specific domain, solutions outside of that -4 1
y = ___
domain are extraneous. f(x)

b) y
7.4 Reciprocal Functions, pages 403 to 409
y = f(x)
4
1. a) y = _
1 b) y = __
1
2-x 3x - 5
2 1
__
1 ___
1 y = ___
c) y = 2
d) y = 2 f(x)
x -9 x - 7x + 10
2. a) i) x = -5 ii) y = _
1 iii) x -5 -6 -4 -2 0 2 4 x
x+5
-2
iv) The zeros of the original function are
the non-permissible values of the reciprocal -4
function.
v) x = -5
b) i) x = - _ ii) y = __ iii) x - _
1 1 1 c) y
2 2x + 1 2
8
iv) The zeros of the original function are
the non-permissible values of the reciprocal 6
function.
v) x = - _
1 4
y = f(x)
2
c) i) x = -4, x = 4 ii) y = __
1 1
2
x 2 - 16 y = ___
f(x)
iii) x -4, x 4
iv) The zeros of the original function are -4 -2 0 2 4 6 x
the non-permissible values of the reciprocal -2
function.
-4

564 MHR Answers


7. a) y x=4 b) y
y=x-4 x=4
4 4

2 2
(0, -0.25) (5, 1) (-2.16, 1) (0, -0.125) (4.16, 1)
(4, 0)
-2 0 2 4 6 8 x -4 -2 0 2 4 6 8 x
(3, -1) (-2, 0) (4, 0)
-2 -2
(-1.83, -1) (3.83, -1)

-4 1 -4
(0, -4) y = _____ y = x2 - 2x - 8
x-4
(0, -8)
-6
1
b) x = -2 y y = ___________
y = 2x + 4 -8 x2 - 2x - 8
4 x = -2
(0, 4)
2 1
(-1.5, 1) y = ______ c) y
2x + 4
(-2, 0) 4
-6 -4 -2 0 2 4 x
(-2.5, -1) (0, 0.25) (0, -0.5) y = x2 - x - 2
-2 2
(-1.30, 1) (2.30, 1)

-4
-4 -2 0 2 4 6 x
(-1, 0) (2, 0)
-2 (1.62, -1)
(-0.62, -1)
c) y x=3 (0, -2)
1
-4 y = __________
4 x2 - x - 2
x = -1 x=2

( )
1 2
0, - __
6
(3, 0)
(3.5, 1)
d) y

6
-2 0 2 4 6 x
(2.5, -1) y = x2 + 2
-2 4

y = 2x - 6 2 1
-4 (0, 2) y = ______
1 x2 + 2
y = ______
-6 2x - 6 -4 -2 0 2 4 x
(0, -6)
(0, 0.5)

9. a) D b) C c) A d) B
d) y x=1
10. a) i) y
4 4
y=x-3
y=x-1 2
2
(0, -1) (2, 1)

x -2 0 2 4 6 x
-2 0 2 4 6
(1, 0) -2
-2

-4 1 -4
y = _____
x-1
ii) Example: Use the vertical asymptote to
8. a) y
find the zero of the function. Then, use
y = x2 - 16
the invariant point and the x-intercept to
16 graph the function.
(0, -0.06)
iii) y = x - 3
8
(-4.12, 1) (4.12, 1)

-8 -4 0 4 8 12 x
(-4, 0) (4, 0)
-8
(-3.87, -1) (3.87, -1)
1
-16 y = ______
(0, -16) x2 - 16
x = -4 x=4
Answers MHR 565
b) i) y 15. a) Example: Complete the square to change it
to vertex form.
4
b) Example: The vertex helps with the location
2 of the maximum for the U-shaped section of
the graph of g(x).
c) g(x)
-4 -2 0 2 4 x
-2 4
1
y = (x + 3)(x - 1) g(x) = ___________
-4 2 x2 - 6x - 7

-2 0 2 4 6 8 x
ii) Example: Use the vertical asymptotes to
-2
find the zeros of the function. Then, use
the given point to determine the vertex -4
and then graph the function.
iii) y = (x + 3)(x - 1) 16. a) k = 720 000 b)
11. a) f b) y = T c) 1800 days
c) 0.4 Hz d) 1440 workers
Frequency (Hz)

1
f = __ d) 0.625 s
T

17. y

4
0 Period (s) T
2 1
12. a) y = ___
f(x)

-2 0 2 4 6 x
-2

-4
y = f(x)
b) {d | d > 10, d R}
c) 17.5 min
d) 23.125 m; it means 18. a) False; only if the function has a zero is this
that the diver has a true.
maximum of 40 min b) False; only if the function has a zero is this
at a depth of true.
23.125 m. c) False; sometimes there is an undefined
value.
e) Yes; at large depths it is almost impossible 19. a) Both students are correct. The non-permissible
to not stop for decompression. values are the roots of the corresponding
13. a) p = _1 b) p equation.
P b) Yes
c) 20.8 Hz 1
__ p= 20. a) v = 60 mm b) f = 205.68 mm
Pitch (Hz)

P
21. Step 1 f(x)
4
1
f(x) = ______
2 4x - 2
0 Period (s) P
14. a) I = 0.004 _
1 b) -2 0 2 4 x
d2
c) 0.000 16 W/m2 -2

-4

566 MHR Answers


Step 2 4. 43.8 km
a) x f(x) x f(x) 5. a) $2.12 b) $4.38
6. a) b)
0 -0.5 1 0.5
y
x f(x) g(x)
0.4 -2.5 0.6 2.5
-2 -8 8 12
0.45 -5 0.55 5
-1 -3 3 8
0.47 -8.33 0.53 8.33
0 2 2
0.49 -25 0.51 25 g(x)
4
1 7 7
0.495 -50 0.505 50
2 12 12
0.499 -250 0.501 250 -2 0 2x
b) The function approaches infinity or negative -4
f(x)
infinity. The function will always approach
-8
infinity or negative infinity.
Step 3
a) c) f (x): domain {x | x R}, range {y | y R};
x f(x) x f(x)
_ g (x): domain {x | x R},
-_
1 1
-10 10 range {y | y 0, y R}
42 38
_ d) Example: They are the same graph except
-_
1 1
-100 100 the absolute value function never goes
402 398
__ below zero; instead it reflects back over
- __
1 1
-1000 1000 the x-axis.
4002 3998
__ 7. a)
- __1 1 x f(x) g(x)
-10 000 10 000
40 002 39 998
-2 4 4
-100 000 - __ 1
100 000
__
1
400 002 399 998 -1 7 7
0 8 8
b) The function approaches zero.
22. 1 7 7

y = f(x) y=
_
1 2 4 4
f (x)
b) y
The absolute value of the The absolute value of the
function gets very large. function gets very small. 8

Function values are positive. Reciprocal values are positive. g(x)


4
Function values are negative. Reciprocal values are negative.
The zeros of the function The zeros of the function -4 -2 0 2 4 x
are the x-intercepts of the are the vertical asymptotes -4
graph. of the graph. f(x)

The value of the function The value of the reciprocal -8


is 1. function is 1.
The absolute value of the c) f (x): domain {x | x R},
The absolute value of the
reciprocal approaches infinity range {y | y 8, y R}; g(x):
function approaches zero.
or negative infinity.
domain {x | x R}, range {y | y 0, y R}
The value of the function The value of the reciprocal d) Example: They are the same graph except
is -1. function is -1. the absolute value function never goes
below zero; instead it reflects back over the
Chapter 7 Review, pages 410 to 412 x-axis.
1. a) 5 b) 2.75 c) 6.7 8. a) y = 2x - 4 if x 2

2. -4, -2.7, |1 _ |, |-1.6|, |-3.5|, - _


1 __ 9 y = 4 - 2x if x < 2
2
9 ,
2 | | b) y = x 2 - 1 if x -1 or x 1
3. a) 9 b) 2 c) 18.75 d) 20 y = 1 - x 2 if -1 < x < 1

Answers MHR 567


9. a) The functions have different graphs because 16. a) y
the initial graph goes below the x-axis. The
4
absolute value brackets reflect anything y = 4x - 9
below the x-axis above the x-axis.
b) The functions have the same graphs because ( )
1 2
0, - __
9
(2.5, 1)

the initial function is always positive. x


-2 0 2 4 6
10. a = 15, b = 10 (2.25, 0)
-2
11. a) x = -3.5, x = 5.5 (2, -1)
b) no solution
-4
c) x = -3, x = 3, x -1.7, x 1.7 1
y = ______
d) m = -1, m = 5 -6 4x - 9
b) x = _ , x = _
12. a) q = -11, q = -7
1 2
4 3 -8
x = 2.25
c) x = 0, x = 5, x = 7 ___
(0, -9)
d) x = _ , x = __
3 -1 + 21
2 4 b) x = -2.5 y
13. a) first low tide 2.41 m; first high tide 5.74 m (0, 5)
1 4
b) The total change is 8.5 m. y = ______
2x + 5
14. The two masses are 24.78 kg and 47.084 kg. 2
15. a) y (-2, 1) (0, 0.2)
x=3
(-2.5, 0)
4 -6 -4 -2 0 2 x
y = f(x)
(-3, -1)
( )
1 2 -2
0, - __ y = 2x + 5
(3.5, 1)
6
(3, 0) -4
-2 0 2 4 6 x
(2.5, -1)
-2
17. a) i) y = __
1
-4 x 2 - 25
1 ii) The non-permissable values are x = -5
y = ___ and x = 5. The equations of the vertical
-6 f(x)
(0, -6)
asymptotes are x = -5 and x = 5.
iii) no x-intercepts; y-intercept: - _
1
b) x = -5 y x=1 25
iv) y
8 y = x2 - 25
10
6
(0, 5)
-8 -4 0 4 8 12 x
4
-10
2 1
(-4.83, 1) (0.83, 1) y = _______
(0, 0.2) -20 x2 - 25
(-5, 0) (1, 0)
-8 -6 -4 -2 0 2 x
(-5.16, -1)
-2
(1.16, -1)
b) i) y = ___
1
x 2 - 6x + 5
1 -4 ii) The non-permissable values are x = 5
y = f(x) y = ___
f(x) and x = 1. The equations of the vertical
asymptotes are x = 5 and x = 1.
iii) no x-intercept; y-intercept _
1
5

568 MHR Answers


iv) y 10. a) y = __
1 b) x = _
6
6 - 5x 5
y = x - 6x + 5
2
4 c) Example: Use the asymptote already found
and the invariant points to sketch the graph.
1 2
y = ___________ y
x2 - 6x + 5
6
-6 -4 -2 0 2 4 6 x
4 1
y = ______
-2
6 - 5x
-4 2

-2 0 2 4 x
18. a) 240 N b) 1.33 m
-2
c) If the distance is doubled the force is
halved. If the distance is tripled only a third y = 6 - 5x
-4
of the force is needed.

Chapter 7 Practice Test, pages 413 to 414 11. a) y = |2.5x| b) 43.6 c) 39.3
12. a)
1. B
2. C
3. D
4. A
5. B
6. a) f(x)
b) i) 748.13 N ii) 435.37 N
4 c) more than 25 600 km will result in a weight
less than 30 N.
2
Cumulative Review, Chapters 57, pages 416 to 417
0 2 4 6 x _______
f(x) = |2x - 7| 1. 18x3y____
6

-2 2. 4abc 2
3ac
3
__ __ ___ ___ __ __
3. 8 , 2 3 , 18 , 36 , 2 9 , 3 6
___
4. a) 9 2a__ ,a0
b) x-intercept: _7 ; y-intercept: 7
2 b) 11x 5__, x 0 __
3
c) domain: {x | x R}; range: {y | y 0, y R} 5. a) -16 3 ___
b) 3 __2
__
_7
d) y = 2x - 7 if x c) 12a__
- 12 a + 2 3a - 2 3 , a __
0
2 6. a) 3 b) 4 - 2 3
y = 7 - 2x if x < _
7 __
c) -3 - 3 2
2
7. x = 1, x = _
2 7. x = 3
3 8. a) 430 ft
8. w = 4, w = _
2 b) Example: The velocity would decrease
3
with an increasing radius because of the
9. Example: In Case 1, the mistake is that after
expression h - 2r.
taking the absolute value brackets off, the inside
term was incorrectly copied down. It should 9. a) _ a , a 0, b 0 b) _ , x 4
-1
4b3 x-4
have been x - 4. Then, there are no solutions ____(x - 3)2(x + 5)
from Case 1. In Case 2, the mistake is that after c) , x 1, -1, -2, 3
(x + 2)(x + 1)(x - 1)
taking the absolute value brackets off, the inside
d) _1 , x 0, 2
term was incorrectly multiplied by negative 6
one. It should have been ___
-x + 4. Then, the e) 1, x -3, -2, 2, 3
___
solutions are x = __
-5 + 41
and x = __ .
-5 - 41
2 2

Answers MHR 569


10. a) ___
a 2
+ 11a - 72
, a -2, 7 20. y
(a + 2)(a - 7) y = f(x)
b) ____ , x -4, -2, 2
3x 3 + x2 - 11x + 12 4
(x + 4)(x - 2)(x + 2)
2 1
____ 2x 2 - x - 15 y = ___
c) , x -5, -1, 5 f(x)
(x - 5)(x + 5)(x + 1)
11. Example: No; they are not equivalent because the -6 -4 -2 0 2 4 x
expression should have the restriction of x -5. -2
12. x = 12
13.
_1 -4
4
14. |4 - 6|, |-5|, |8.4|, |2(-4) - 5|
15. a) y = 3x - 6 if x 2 21. y
1
y = 6 - 3x if x < 2 y = _______2 4
(x + 2)
b) y = _ (x - 2)2 - 3 if x -1 or x 5
1
3 2 (-1, 1)
y = -_ 1 (x - 2)2 + 3 if -1 < x < 5 (-3, 1)
(0.25, 0)
3
-8 -6 -4 -2 0 2 x
16. a) i) y
x = -2
4
22. a) Example: The shape, range, and y-intercept
2
will be different for y = |f(x)|.
b) Example: The graph of the reciprocal
function has a horizontal asymptote at
0 2 4 x
y = |3x - 7| y = 0 and a vertical asymptote at x = _
1.
-2 3
Unit 3 Test, pages 418 to 419
ii) x-intercept: _ ; y-intercept: 7
7
3 1. C
iii) domain: {x | x R}; range: {y | y 0, y R} 2. D
b) i) y 3. B
4. C
6
5. D
4
6. B
7. D
2 8. B
9. 3 ___
-2 0 2 4 6 x 10. _
10

y = |x2 - 3x - 4| 6
11. 28
ii) x-intercepts: -1, 4; y-intercept: 4 12. -2
iii) domain: {x | x R}; range: {y | y 0, y R} 13. -2, 2
17. a) x = 5, x = -4 b) x = 3, x = -3 __ __ __
14. 5, 3 7 , 6 2 , 4 5
18. a) Example: Absolute value must be used
15. a) Example: Square both sides.
because area is always positive.
b) x 2.5 c) There are no solutions.
b) Area = 7
19. y f (x) = x - 4 16.
__
4(2x + 5)
, x -2.5, -2, 1, 0.5, 4
(x - 4)
2 17. Example:
a) _
2x = __
x + 10
b) x -3, 0 c) x = 4
x x+3
-2 0 2 4 x 18. a) y
-2
y = f(x) 4
-4
2
y = |2x - 5|

0 2 4 6 x

570 MHR Answers


b) y-intercept: 5; x-intercept: _5 For (3, -2): In y = -x 2 + 4x - 5:
2
c) domain: {x | x R}; range: {y | y 0, y R}
Left Side Right Side
y = -2 -x 2 + 4x - 5
d) y = 2x - 5 if x _
5
2 = -(3)2 + 4(3) - 5
y = 5 - 2x if x < _
5 = -2
___ 2 Left Side = Right Side
19. x = __ , 1, 2
3 17
2 In y = x - 5:
20. y Left Side Right Side
y = -2 x -5
4
=3-5
(2.16, 1) = -2
2
(-4.16, 1) (2, 0) Left Side = Right Side
(-4, 0) (0, -0.125)
So, both solutions are verified.
-8 -6 -4 -2 0 2 4 x
3. a) linear-quadratic; (-4, 1) and (-1, -2)
(-3.83, -1) (1.83, -1)
-2 b) quadratic-quadratic; no solution
y = x2 + 2x - 8 c) linear-quadratic; (1, -4)
-4
4. a)
1 -6
y = ___________
x2 + 2x - 8
(0, -8)
-8
x = -4 x=2

21. a) t = _
72 b) 4.97 ft/s c) 11.43 s
(-3, 4) and (0, 7)
s b)

Chapter 8 Systems of Equations


8.1 Solving Systems of Equations Graphically,
pages 435 to 439
(2, 3) and (4, 1)
1. a) System A models the situation: to go off a
c)
ramp at different heights means two positive
vertical intercepts, and in this system the
launch angles are different, causing the bike
with the lower trajectory to land sooner.
System B is not correct because it shows
both jumps starting from the same height. (-14.5, -37.25) and (-2, -31)
System C has one rider start from zero, which d)
would mean no ramp. In System D, a steeper
trajectory would mean being in the air longer
but the rider is going at the same speed.
b) The rider was at the same height and at the
same time after leaving the jump regardless
of which ramp was chosen. (-1, 2) and (1, 2)
2. For (0, -5): In y = -x 2 + 4x - 5: e)
Left Side Right Side
y = -5 -x 2 + 4x - 5
= -(0)2 + 4(0) - 5
= -5
Left Side = Right Side
(7, 11) and (15, 107)
In y = x - 5:
Left Side Right Side
y = -5 x-5
=0-5
= -5
Left Side = Right Side

Answers MHR 571


5. a) 7. Examples:
a) b)
y y

(5, 5) and (23, 221) or d = 5, h = 5 and


d = 23, h = 221 0 x 0 x
b)

c) d)
y y
no solution
c)

0 x
0 x

8. Examples:
(-6.75, 3.875) and (-2, -8) or v = -6.75,
a) y = x - 3 b) y = -2 c) y = x - 1
t = 3.875 and v = -2, t = -8
9. a) (100, 3800) and (1000, 8000)
d)
b) When he makes and sells either 100 or
1000 shirts, Jonas makes no profit as costs
equal revenue.
c) Example: (550, 15 500). This quantity
(550 shirts) has the greatest difference
(-3.22, -1.54) and (-1.18, -3.98) or between cost and revenue.
n = -3.22, m = -1.54 and n = -1.18, 10. (0, 3.9) and (35.0, 3.725)
m = -3.98 11. a) d = 1.16t 2 and d = 1.74(t - 3)2
e) b) A suitable domain is 0 t 23.
d

300
Distance (m)

first car:
200
d = 1.16t2
(-2.5, 306.25) or h = -2.5, t = 306.25 100 second car:
6. The two parabolas have the same vertex, d = 1.74(t - 3)2
but different values of a.
0 10 20 t
Example: y = x 2 and y = 2x 2. Time (s)
y y = 2x 2 c)
20
y = x2
10

-2 O 2 x
(1.65, 3.16) and (16.35, 310.04) While
(1.65, 3.16) is a graphical solution to the
system, it is not a solution to the problem
since the second car starts 3 s after the
first car.
d) At 16.35 s after the first car starts, both cars
have travelled the same distance.

572 MHR Answers


12. a) d) These are the locations where the frog and
grasshopper are at the same distance and
height relative to the frogs starting point.
If the frog does not catch the grasshopper at
the first point, there is another opportunity.
However, we do not know anything about
Both start at (0, 0), at the fountain, and
time, i.e., the speed of either one, so the
they have one other point in common,
grasshopper may be gone.
approximately (0.2, 1.0). The tallest 16. a) (0, 0) and approximately (1.26, 1.59) Since
stream reaches higher and farther than 0 is a non-permissible value for x and y, the
the smaller stream. point (0, 0) is not a solution to this system.
b)
b) 1.26 cm
c) V = lwh
V = 1.26 1.26 1.26
V = 2.000 376
So, the volume is very close to 2 cm3.
They both start at (0, 0), but the second d) If x represents the length of one side, then
stream passes through the other fountains V = x3__. For a volume of 2 cm3, 2 = x3. Then,
3
spray 5.03 m from the fountain, at a height x = 2 or approximately 1.26. Menaechmus
of 4.21 m. did not have a calculator to find roots.
13. a) Let x represent the smaller integer and y the 17. Examples:
larger integer. x + y = 21, 2x 2 - 15 = y. a) y = x 2 + 1 and y = x + 3
b) b) y = x 2 + 1 and y = -(x - 1)2 + 6
c) y = x 2 + 1 and y = (x + 1)2 - 2x
18. Examples:
No solution: Two parabolas do not intersect and
the line is between them, intersecting neither,
or the parabolas are coincident and the line
One point of intersection does not give does not intersect them.
integers. The two integers are 4 and 17. y y
14. a) The blue line and the parabola intersect
at (2, 2). The green line and the parabola
intersect at (-4.54, -2.16).
b) Example: There is one possible location 0 x 0 x
to leave the jump and one location for
the landing.
15. a) h
40 (54, 36) One solution: Two parabolas intersect once,
grasshopper with a line tangent to both curves, or the
Height (cm)

(50, 25) parabolas are coincident and the line is tangent.


20 y y
frog

0 x 0 x
0 20 40 60 80 100 d
Distance (cm)
b) Frog: y = -0.01(x - 50)2 + 25
Grasshopper: y = -0.0625(x - 54)2 + 36
c) (40.16, 24.03) and (69.36, 21.25)

Answers MHR 573


Two solutions: Two parabolas intersect twice, In 144w 2 + 48z 2 = 43:
with a line passing through both points of Left Side = 144 _( )1 2 + 48 _
3 2
( )
intersection, or the parabolas are coincident and 3 4
= 16 + 27
the line passes through two points on them.
= 43
y y
= Right Side
So, _1
( , _
3
) is a solution.
3 4
0 x 3. a) (-6, 38) and (2, 6) b) (0.5, 4.5)
0 x
c) (-2, 10) and (2, 30)
d) (-2.24, -1.94) and (2.24, 15.94)
e) no solution
a) - _ , 4 and (3, 25)
1
19. Example: Similarities: A different number of
solutions are possible. It can be solved graphically
4. ( 2 )
b) (-0.5, 14.75) and (8, 19)
or algebraically. Differences: Some systems
c) (-1.52, -2.33) and (1.52, 3.73)
involving quadratic equations cannot be solved by
d) (1.41, -4) and (-1.41, -4)
elimination. The systems in this section involve
e) There are an infinite number of solutions.
equations that are more difficult to solve.
5. a) (2.71, -1.37) and (0.25, 0.78)
20. a) Two solutions. The y-intercept of the line
b) (-2.41, 10.73) and (2.5, 10)
is above the vertex, and the parabola opens
c) (0.5, 6.25) and (0.75, 9.3125)
upward.
6. a) They are both correct.
b) No solution. The parabolas vertex is at (0, 3)
b) Graph n = m2 + 7
and it opens upward, while the line has
and n = m2 + 0.5 to
y-intercept -5 and negative slope.
see that there is no
c) Two solutions. One vertex is directly above
point of intersection.
the other. The upper parabola has a smaller
vertical stretch factor. 7. a) Yes. Multiplying by (-1) and then adding is
d) One solution. They share the same vertex.
equivalent to subtraction.
One opens upward, the other downward. b) Yes.
e) No solution. The first parabola has its vertex
c) Example: Adding is easier for most people.
at (3, 1) and opens upward. The second Subtracting with negative signs can be error
parabola has it vertex at (3, -1) and opens prone.
downward. 8. m = 6, n = 40
f) An infinite number of solutions. When the
9. a) 7x + y + 13 b) 5x 2 - x
first equation is expanded, it is exactly the c) 60 = 7x + y + 13 and 10y = 5x 2 - x. Since
same as the second equation. the perimeter and the area are both based
on the same dimensions, x and y must
8.2 Solving Systems of Equations Algebraically,
represent the same values. You can solve the
pages 451 to 456 system to find the actual dimensions.
1. In k + p = 12: In 4k 2 - 2p = 86: d) (5, 12); the base is 24 m, the height is 10 m
Left Side Left Side and the hypotenuse is 26 m.
k+p 4k 2 - 2p e) A neat verification uses the Pythagorean
=5+7 = 4(5)2 - 2(7) Theorem: 242 + 102 = 676 and 262 = 676.
= 12 = 86 Alternatively, in the context:
= Right Side = Right Side Perimeter = 24 + 10 + 26 = 60
So, (5, 7) is a solution. Area = _ 1 (24)(10) = 120
2
2. In 18w 2 - 16z 2 = -7:
10. a) x - y = -30 and y + 3 + x 2 = 189
Left Side = 18 _
1 2 - 16 _ 2
3
( )
3 4 ( ) b)
c)
(12, 42) or (-13, 17)
For 12 and 42:
= 18 _
1 - 16 _
( ) 9
( ) 12 - 42 = -30 and
9 16
42 + 3 + 122 = 189
=2-9
For -13 and 17: -13 - 17 = -30 and
= -7
17 + 3 + (-13)2 = 189
= Right Side
So, both solutions check.

574 MHR Answers


11. a) C = 2r, C = 3r 2 c) Example: This is where the fragments are at
b) r=_
2, C = _
4 , A = _
4 the same height and the same distance from
3 3 9 the summit.
12. a) 5.86 m and 34.14 m b) 31.25 J
16. a) The solution for the system of equations
c)
will tell the horizontal distance from and
the height above the base of the mountain,
where the charge lands.
b) 150.21 m
17. a) 103 items b) $377 125.92
d) Find the sum of the values of Ek and Ep at 18. a) (-3.11, 0.79), (3.11, 0.79) and (0, 16)
several choices for d. Observe that the sum b) Example: 50 m2
b) y = - _ x + _
19. a) (2, 6)
1 13 c) 2.19 units
is constant, 62.5. This can be deduced from 4 2
the graph because each is a reflection of the 20. (2, 1.5) and (-1, 3)
other in the horizontal line y = 31.25. 21. y = 0.5(x + 1)2 - 4.5 and y = -x - 4 or
13. a) approximately 15.64 s y = 0.5(x + 1)2 - 4.5 and y = 2x - 4
b) approximately 815.73 m 22. Example: Graphing is relatively quick using a
c) h(t) = -4.9t 2 + 2015 graphing calculator, but may be time-consuming
= -4.9(15.64)2 + 2015 and inaccurate using pencil and grid paper.
816.4 Sometimes, rearranging the equation to enter into
h(t) = -10.5t + 980 the calculator is a bit tricky. The algebraic methods
= -10.5(15.64) + 980 will always give an exact answer and do not rely
815.78 on having technology available. Some systems
The solution checks. Allowing for rounding of equations may be faster to solve algebraically,
errors, the height is about 816 m when the especially if one variable is easily eliminated.
parachute is opened after 15.64 s. 23. (-3.39, -0.70) and (-1.28, 4.92)
14. a) y 24. Example: Express the quadratic in vertex
form, y = (x - 2)2 - 2. This parabola has its
8
minimum at (2, -2) and its y-intercept at 2.
6 The linear function has its y-intercept at -2
and has a negative slope so it is never close to
4 the parabola. Algebraically,
-_1 x - 2 = x 2 - 4x + 2
2 2
-x - 4 = 2x 2 - 8x + 4
0 = 2x 2 - 7x + 8
-6 -4 -2 O 2 4 6 x
This quadratic equation has no real roots.
Therefore, the graphs do not intersect.
b) (-1.3, 3) c) y = 2x 2 and y = (x + 3)2
25. Step 1: Example: In a standard viewing
d) (-1.24, 3.09) and (7.24, 104.91) Example:
window, it looks like there are two solutions
The estimate was close for one point, but
when b > 0, one solution when b = 0, and no
did not get the other.
solution when b < 0
Step 2: There are two solutions when b > - _
15. a) For the first fragment, substitute v0 = 60, 1,
= 45, and h0 = 2500: 4
h(x) = - __ 4.9 x 2 + (tan )x + h0 one solution when b = - _ 1 , and no solution
4
(v0 cos )2 when b < - _ 1.
h(x) = - ___ 4.9 4
x 2 + (tan 45)x + 2500 Steps 3 and 4: two solutions when |m| > 2, one
(60 cos 45)2
h(x) -0.003x 2 + x + 2500 solution when m = 2, and no solution when
For the second fragment, substitute v0 = 60, |m| < 2
= 60, and h0 = 2500: Step 5: For m = 1: two solutions when b > 0,
one solution when b = 0, and no solution when
h(x) = - __ 4.9 x 2 + (tan )x + h0 b < 0; for m = -1: two solutions when b < 0,
(v0 cos )2
h(x) = - ___ 4.9 one solution when b = 0, and no solution
x 2 + (tan 60)x + 2500
(60 cos 60)2 when b > 0; two solutions when |m| > 2b, one
h(x) -0.005x 2 + 1.732x + 2500 solution when m = 2b, and no solution when
b) (0, 2500) and (366, 2464.13) |m| < 2b

Answers MHR 575


Chapter 8 Review, pages 457 to 458 b)

1. a) (2, -5)
b)

(-1.86, -6.27) and (1, -3)


c)

c) (6.75, -12.125)
2. a) no solution, one solution, two solutions
y y y

(-2.05, -5.26) and (1.34, -4.83) or


0 x 0 x 0 x d = -2.05, t = -5.26 and d = -1.34,
t = -4.83
a) road arch: y = - _ (x - 8)2 + 6
6.
3
b) no solution, one solution, two solutions
32
river arch: y = - _
y y y 1 (x - 24)2 + 8
18
b) (14.08, 2.53)
0 x 0 x 0 x c) Example: the location and height of the
support footing
7. a) Example: The first equation models the
horizontal distance travelled and the height of
c) no solution, one solution, two solutions
the ball; it would follow a parabolic path that
y y y
opens downward. The linear equation models
the profile of the hill with a constant slope.
b) d = 0, h = 0 and d = 14.44, h = 7.22
0 x 0 x 0 x
c) Example: The point (0, 0) represents the
starting point, where the ball was kicked.
3. a) The point (14.44, 7.22) is where the ball
would land on the hill. The coordinates give
the horizontal distance and vertical distance
from the point that the ball was kicked.
8. a) Example: (2, -3) and (6, 5)
b) (2, -3) and (6, 5)
(-6, 0)
b) 9. The solution _( 1 , 1 is correct.
)
2
a) _ , _ and - _ , -4 ; substitution, because
1 5 5
10. (
2 2 ) ( 3 )
the first equation is already solved for p
b) (3.16, -13) and (-3.16, -13); elimination,
because it is easy to make opposite
(0, 1) and (4, 1) coefficients for the y-terms
c) - _ , - _ and (2, -1); elimination
4. Example: Adam is not correct. For all values of 2 53
x, x 2 + 3 is always 2 greater than x 2 + 1 and the ( 3 9)
two parabolas never intersect. after clearing the fractions
5. a) d) (0.88, 0.45) and (-1.88, 3.22); substitution
after isolating y in the second equation
11. a) 0 m and 100 m b) 0 m and 10 m
12. a) the time when both cultures have the same
rate of increase of surface area
b) (0, 0) and (6.67, 0.02)
(0, 3.33) or x = 0, p = 3 _
1
c) The point (0, 0) represents the starting point.
3
In 6 h 40 min, the two cultures have the
same rate of increase of surface area.

576 MHR Answers


Chapter 8 Practice Test, pages 459 to 460 d) y 2x - 10; slope of 2; y-intercept of -10;
the boundary is a solid line.
1. C
e) y - _ x + 4; slope of - _ ; y-intercept of 4;
4 4
2. C 5 5
3. B the boundary is a solid line.
f) y > _ x - 5; slope of _ ; y-intercept of -5;
4. D 1 1
5. D 2 2
6. n = -4 the boundary is a dashed line.
4. a) y
7. a) _ , - _ and (-2, -7)
3 35
4 ( 16 ) b) (1, -4)
4
8. a)
y -2x + 5
2

4
-4
- 2 0
-2
- 2 4 x
-2
-2
(0.76, 1.05)
b) Example: At this time, 0.76 s after Sophie -4
-4
starts her jump, both dancers are at the same
height above the ground. b) y
9. a) perimeter: 8y = 4x + 28
area: 6y + 3 = x 2 + 14x + 48 4
3y - x > 8
b) The perimeter is 16 m. The area is 15 m2.
2
10. a) y=_ 1 x 2 and y = _
1 (x - 1)2
3 2
b) (5.45, 9.90) and (0.55, 0.10) -4 -2 0 2 4 x
11. a)
c) y
4x + 2y - 12 0
4

2
b) Example: At this point, a horizontal distance
of 0.4 cm and a vertical distance of 0.512 cm -2 0 2 4 6 x
from the start of the jump, the second part of -2
the jump begins.
12. A(-3.52, 0), B(7.52, 0), C(6.03, 14.29) -4
area = 78.88 square units
d) y
Chapter 9 Linear and Quadratic 2 4x - 10y < 40
Inequalities
2 0
-2
- 2 4 6 8 10 x
9.1 Linear Inequalities in Two Variables,
-2
-2
pages 472 to 475
-4
-4
1. a) (6, 7), (12, 9)
b) (-6, -12), (4, -1), (8, -2)
c) (12, -4), (5, 1) d) (3, 1), (6, -4)
e) y
2. a) (1, 0), (-2, 1) b) (-5, 8), (4, 1)
c) (5, 1) d) (3, -1) 6
3. a) y x + 3; slope of 1; y-intercept of 3; the
4
boundary is a solid line. xy-6
b) y > 3x + 5; slope of 3; y-intercept of 5; the 2
boundary is a dashed line.
c) y > -4x + 7; slope of -4; y-intercept of 7;
4
-4
- 2 0
-2
- 2 4 x
the boundary is a dashed line.

Answers MHR 577


5. a) y _6 x - _
18 b) y < - x + _1 _
15 b) Graph by hand because the slope and the
5 5 4 2
y-intercept are whole numbers.
y
4
10x < 2.5y
2

c) y > _
5 x+_
7 d) y _1 x - _
11
12 3 6 6 4
-4
- 2 0
-2
- 2 4 x
-2
-2

c) Graph by hand because the slope is a simple


fraction and the y-intercept is 0.
y
e) y _
36 x + _
260
2.5x < 10y
53 53
4
-4
- 2 0
-2 2 4 x

d) Graph using technology because the


slope and the y-intercept are complicated
fractions.
_1 489 x + __
6. y - x
5 y -_ 14 500
1279 1279

7. y < _7 x e) Graph by hand because the slope and the


2
y-intercept are whole numbers.
y
4

8. Examples:
-4 -2 0 2 4 x
a) Graph by hand because the slope and the
-2
-2
y-intercept are whole numbers. 0.8x - 0.4y > 0
y
6
6x + 3y 21 9. a) y < _1 x + 2 b) y < - x _1
4 4
4 _
3
c) y > x - 4 d) y -_
3x + 5
2 4
10. y
2
4
x + 0y > 0
-4 -2 0 2 4 x
2
-2

-4 -2 0 2 4 x
-2

The graph of this solution is everything to the


right of the y-axis.

578 MHR Answers


11. a) 12x + 12y 250, where x represents the (0, 0), approximately (0, 388.9) and (500, 55.6),
number of moccasins sold, x 0, and and (500, 0); y-intercept: the maximum number
y represents the hours worked, y 0. of megawatt hours of wind power that can be
b) y produced; x-intercept: the maximum number of
24 12x + 12y 250 megawatt hours of hydroelectric power that can
16
be produced
Step 3 Example: It would be very time-consuming
8 to attempt to find the revenue for all possible
combinations of power generation. You cannot
x be certain that the spreadsheet gives the
0 8 16 24
maximum revenue.
Step 4 The maximum revenue is $53 338,
c) Example: (4, 20), (8, 16), (12, 12) with 500 MWh of hydroelectric power and
d) Example: If she loses her job, then she will approximately 55.6 MWh of wind power.
still have a source of income. 19. Example:
12. a) 30x + 50y 3000, x 0, y 0, where
Example Example Example Example
x represents the hours of work and y
1 2 3 4
represents the hours of marketing assistance.
b) Linear
y yx yx y>x y<x
Inequality
60 Inequality
> <
Sign
40
Boundary
Solid Solid Dashed Dashed
20 Solid/Dashed
30x + 50y 3000 Shaded
Above Below Above Below
0 20 40 60 80 100 x Region
20. Example: Any scenario with a solution that has
13. 0.3x + 0.05y 100, x 0, y 0, where the form 5y + 3x 150, x 0, y 0 is correct.
x represents the number of minutes used and 21. a) 48 units2
y represents the megabytes of data used; she b) The y-intercept is the height of the triangle.
should stay without a plan if her usage stays in The larger it gets, the larger the area gets.
the region described by the inequality. c) The slope of the inequality dictates where
14. 60x + 45y 50, x 0, y 0, where the x-intercept will be, which is the base
x represents the area of glass and y represents of the triangle. Steeper slope gives a closer
the mass of nanomaterial. x-intercept, which gives a smaller area.
15. 125x + 55y 7000, x 0, y 0, where d) If you consider the magnitude, then
x represents the hours of ice rental and nothing changes.
y represents the hours of gym rental.
16. Example: 9.2 Quadratic Inequalities in One Variable,
a) y = x 2 b) y x 2; y < x 2 pages 484 to 487
c) This does satisfy the definition of a solution
region. The boundary is a curve not a line. 1. a) {x | 1 x 3, x R}
{x | x 1 or x 3, x R}
y_ 3 x + 384, 0 x 512; y - _3 x + 384, b)
17.
4 4 c) {x | x < 1 or x > 3, x R}
0 x 512; y - _3 x + 1152, 512 x 1024; d) {x | 1 < x < 3, x R}
4 2. a) {x | x R} b) {x | x = 2, x R}
y_ 3 x - 384, 512 x 1024
c) no solution d) {x | x 2, x R}
4
18. Step 1 60x + 90y 35 000 3. a) not a solution b) solution
Step 2 y - _2x + _3500 , 0 x 500, y 0 c) solution d) not a solution
3 9 4. a) {x | x -10 or x 4, x R}
b) {x | x < -12 or x > -2, x R}
c) x | x < - _ or x > _ , x R
5 7
{ 3 __ 2 __
}
{
d) x | -2 - _6
x2+ _6
,xR }
2 2

Answers MHR 579


5. a) {x | -6 x 3, x R} 14. a) a > 0; b2 - 4ac 0 b) a < 0; b2 - 4ac = 0
b) {x | x -3 or x -1, x R} c) a 0; b2 - 4ac > 0
c) {x | _43 < x < 6, x R} 15. Examples:
a) x 2 - 5x - 14 0 b) x 2 - 11x + 10 > 0
d) {x -8 x 2, x R}
| c) 3x - 23x + 30 0 d) 20x 2 + 19x + 3 > 0
2
6. a) {x -3 < x < 5, x R}
| e) x 2 + 6x + 2 0 f) x 2 + 1 > 0
b) {x x < -12 or__x > -1, x R}
| 2
__ g) x + 1 <__0 __ __ __
c) {x x 1 - 6 or x 1 + 6 , x R}
| 16. {x | x - 6 or - 2 x 2 or x 6 ,
d) {x | x -8 or x _ 1, x R
} x R}
2
7. a) {x | -8 x -6, x R} 17. a) It is the solution because it is the set of
b) {x | x -4 or x 7, x R} values for which the parabola lies above
c) There is no solution. the line.
d)
7 or x > _
{x | x < - _ 9 , x R} b) -x 2 + 13x - 12 0
2 2 c) {x | 1 x 12, x R}
8. a) {x | 2 < x < 8, x R} d) They are the same solutions. The inequality
Example: Use graphing because it is a simple was just rearranged in part c).
graph to draw. 18. They all require this step because you need the
x | x -_ 3 or x _
5, x R
b) { 4 3 } related function to work with.
19. Answers may vary.
Example: Use sign analysis because it is 20. a) The solution is incorrect. He switched the
easy to factor.
___ ___ inequality sign when he added 2 to both
c) {x | 1 - 13 x 1 + 13 , x R}
sides in the first step.
Example: Use test points and the zeros. b) {x | -3 x -2, x R}
d) {x | x 3, x R}
Example: Use case analysis because it is 9.3 Quadratic Inequalities in Two Variables,
easy to factor and solve for the inequalities.
____ ____ pages 496 to 500
{x | ___ x ___ , x R }
13 - 145 13 + 145
9. a)
2 2 1. a) (2, 6), (-1, 3)
b) {x | x < -12 or x > 2, x R} b) (2, -2), (0, -6), (-2, -15)
c) {x|x<_ 5 or x > 4, x R
} c) None
2 d) (-4, 2), (1, 3.5), (3, 2.5)
x | x -_ 8 or x _
7, x R
d) { 3 2 } ___
2. a)
b)
(0, 1), (1, 0), (3, 6), (-2, 15)
(-2, -3), (0, -8)
Ice equal to or thicker than __ cm, or
5 30
10. a) c) (2, 9)
3
about 9.13 cm, will support the weight of d) (-2, 2), (-3, -2)
a vehicle. 3. a) y < -x 2 - 4x + 5 b) y _1 x
2
-x+3
2
2
b) 9h 1500 ___ _1
c) y - x 2 - x + 3 d) y > 4x 2 + 5x - 6
Ice equal to or thicker than __ cm, or
10 15 4
c)
3 4. a) b)
about 12.91 cm, will support the weight of y y
2 1
a vehicle. y > - _ (x - 4)2 - 1
8 2
d) Example: The relationship between ice
strength and thickness is not linear. 0 2 4 6 8x
6
11. a) x 2 630 000, where x represents the 2
-2
-
radius, in metres. 4
________ y 2(x + 3)2 + 4
0 x __ 630 000 c) 0 m x 447.81 m -4
-4
b) 2
12. a) 2 years or more -6
-6
b) One of the solutions is negative, which does -6 -4 -2 0 x 8
-8
-
not make sense in this problem. Time cannot
be negative.
c) -t 2 + 14 5; t 3; 3 years or more
13.
_
x2
+ x 4; the shorter leg should be greater
2
than or equal to 2 cm.

580 MHR Answers


c) y d) y
8 2

6
1 -8
-10 -6 4
-4
- 2 0
-2
- 2 x
4 -2
-2
y < 3(x + 1)2 + 5
2 1 -4
-4
y _ (x + 7)2 - 4
2
6
-6
- 4
-4
- -2 0 2 x
6. a) b)
y y
d) y 4
-2 0 2 x
8
-2 2
4
-4
0 2 4 x
0 4 8 12 16 x -6
- 6 -2
-4
-4 1
y _ (x - 7)2 - 2 yx +x-6 2
y > x2 - 5x + 4
4 8
-8 -4

5. a) y
c) d)
-2 0 2 4 6 x y y
-2 4
0 4 8 x
-4 y < -2(x - 1)2 - 5 4
-4 2

-6 8
-8
-6 -4 -2 0 x
8
-8 2
-12 -2
- 2
y < x2 + 8x + 16
-16
b) y
-20
6
-24
4 y x2 - 6x - 16

2
7. a) y < 3x 2 + 13x + 10 b) y -x 2 + 4x + 7
y > (x + 6)2 + 1
-8 -6 -4 -2 0 x

c) y
2
y _ (x - 8)2
6 3
c) y x 2 + 6 d) y > -2x 2 + 5x - 8
4

0 2 4 6 8 10 x

8. a) y _1 x + 1 2
2
b) y > -_ 1 (x - 1) 2
+3
3

Answers MHR 581


9. a) y = - _1 (x - 50)2
+4 Chapter 9 Review, pages 501 to 503
625
b) y < -_1 (x - 50)
2
+ 4, 0 x 100 1. a) b)
625
2
10. a) L -0.000 125a + 0.040a - 2.442, y y
6
0 a 180, L 0 2
4 y > -3
_x + 2
4
-2 0 2 4 x
2
-2
y 3x - 5 -2 0 2 4 x
-4
b) any angle greater than or equal to -2
6
-6
approximately 114.6 and less than
or equal to 180 c) d)
11. a) y < -0.03x 2 + 0.84x - 0.08
y y
b) 0 -0.03x 2 + 0.84x - 0.28 6
{x | 0.337 x 27.662, x R} 2
c) The width of the river is 27.325 m. 4
12. a) 0 < -2.944t 2 + 191.360t - 2649.6 -2 0 2 4 x
2
b) Between 20 s and 45 s is when the jet is 4x + 2y 8
-2
above 9600 m.
c) 25 s 3x - y 6 4
-4
- 2 0
-2
- 2 x
-4
13. a) y = -0.04x 2 + 5 b) 0 -0.04x 2 + 5 -2
-2
14. a) y -x 2 + 20x or y -1(x - 10)2 + 100 -6
b) -x 2 + 20x -50 0; she must have between
3 and 17 ads.
e) y
15. y -0.0001x 2 - 600 and y -0.0002x 2 - 700
16. a) y = (4 + 0.5x)(400 - 20x) or 4
10x - 4y + 3 < 11
y = -10x 2 + 120x + 1600; x represents the
number of $0.50 increases and y represents 2
the total revenue.
b) 0 -10x 2 + 120x - 200; to raise $1800 the 6
-6
- 4
-4
- 2 0
-2
- 2 4 x
price has to be between $5 and $9. -2
-2
c) 0 -10x 2 + 120x; to raise $1600 the price
has to be between $4 and $10.
17. a) 0 0.24x 2 - 8.1x + 64; from approximately 2. a) y 2x + 3 b) y > 0.25x - 1
12.6 years to 21.1 years after the year 2000 c) y < -3x + 2 d) y -0.75x + 2
b) p 0.24t 2 - 8.1t + 74, t 0, p 0 _4
3. a) y > - x + _
22 b) y _5 x + 13
5 5 2

Only the portion of the graph from t = 0


to t 16.9 and from p = 0 to p = 100 is c) y < _
32 x + _
80 d) y > -
31 x + _
_ 165
11 11 11 44
reasonable. This represents the years over
which the methane produced goes from a
maximum percent of 100 to a minimum
percent around 16.9 years.
c) from approximately 12.6 years to 16.9 years
after the year 2000
d) He should take only positive values of x
from 0 to 16.9, because after that the model
is no longer relevant.
18. Answers may vary.

582 MHR Answers


e) y _
1x c) The solution to the inequality within
12
the given context is 0 < v 70.25. The
maximum stopping speed of 70.25 km/h is
not half of the answer from part a) because
the function is quadratic not linear.
11. a) y _ (x + 3)2 - 4
1 b) y > 2(x - 3)2
2
12. a) b)
4. a) 15x + 10y 120, where x represents the
y y
number of movies and y represents the y -x2 + 4
number of meals. 4
-4 0
- 4x
b) y -1.5x + 12
-4 2

-8
-2 0
- 2 4x
-12
- -2

c) The region below the line in quadrant I


1
-16
(x 0, y 0) shows which combinations y < x2 + 2x - 15
will work for her budget. The values of x
and y must be whole numbers. c) d)
5. a) $30 for a laptop and $16 for a DVD player y y
b) 30x + 16y 1000, where x represents the
2
number of laptops sold and y represents the -2 0 2 x
number DVD player sold. -4
- 4
c) y -1.875x + 62.5 y > 6x2 + x - 12 -2 0 2 4 x
The region above the 8
-8 -2
-
line in quadrant I
shows which 2
-12 -4
- 4
combinations will
-16 -6
- 6
give the desired y (x - 1)2 - 6
commission. The values of x and y must be
whole numbers. 13. a) y < x 2 + 3
6. a) {x | x < -7 or x > 9, x R} b) y -(x + 4)2 + 2
b) {x | x -2.5 or x 6, x R} 14. a) y 0.003t 2 - 0.052t + 1.986,
c) {x | -12 < x <__4, x R} __ 0 t 20, y 0
d) {x | x 3 - 5 or x 3 + 5 , x R}

a) x | - _ x _ , x R
4 1
7. { 3
___
2 } ___
{
b) x | __
5 - 21
< x < __ , x R
5 + 21
}
4 4
c) {x | -4 x 8, x R} b) 0.003t 2 - 0.052t - 0.014 0; the years it
___
d) x | x ___
-6 - 2 14 was at most 2 t/ha were from 1975 to 1992.
{ 5 ___ 15. a) r 0.1v 2

or x ___
-6 + 2 14
,xR } You cannot have a
__5 __ negative value for
a) x | __ x __ , x R
{ }
6 - 2 3 6 + 2 3 the speed or the
8.
3 3 radius. Therefore,
b) The path has to be between those two points
the domain is
to allow people up to 2 m in height to walk {v | v 0, v R} and the range is
under the water. {r | r 0, r R}.
9. The length can be anything up to and including b) Any speed above 12.65 m/s will complete
6 m. The width is just half the length, so it is a the loop.
16. a) 20 _ x 2 - 4x + 90
maximum of 3 m. 1
10. a) 104.84 km/h 20
b) 0.007v 2 + 0.22v 50 b) {x | 0 x 25.86 or 54.14 x 90, x R};
the solution shows where the cable is at
least 20 m high.

Answers MHR 583


Chapter 9 Practice Test, pages 504 to 505 c) 50x + 80y 2400, where x represents the
number of ink sketches sold (x 0) and
1. B
y represents the number of watercolours
2. A
sold (y 0); the related line is parallel to
3. C
the original with a greater x-intercept and
4. B
y-intercept.
5. C
d) y - _ x + 30,
5
6. y 8
4
y 0, x 0

8x 2(y - 5)
2

x 12. a) Example: f(x) = x 2 - 2x - 15


-4 -2 0 2 4
b) Example: any quadratic function with two
-2
-2
real zeros and whose graph opens upward
c) Example: It is easier to express them in

7. {x | - _32 < x < _45 , x R} vertex form because you can tell if the
parabola opens upward and has a vertex
8. y below the x-axis, which results in two zeros.
13. a) 0.01a2 + 0.05a + 107 < 120
6
b) {x | -38.642 < x < 33.642, x R}
4 c) The only solutions that make sense are those
where x is greater than 0. A person cannot
y > (x - 5)2 + 4
2 have a negative age.

x Cumulative Review, Chapters 89, pages 508 to 509


0 2 4 6
1. a) B b) D c) A d) C
9. y 0.02x 2 2. (-2.2, 10.7), (2.2, -2.7)
10. 25x + 20y 300, where x represents the number 3. a) (-1, -4), (2, 5)
of hours scuba diving (x 0) and y represents b) The ordered pairs represent the points
the number of hours sea kayaking (y 0). where the two functions intersect.
y 4. a) b > 3.75 b) b = 3.75 c) b < 3.75
5.
16
Solving Linear-Quadratic Systems
25x + 20y 300
12
Substitution Method Elimination Method
8 Determine Multiply the
Determine which
which variable linear equation
variable to solve for.
4 to eliminate. as needed.
Solve the linear equation
0 4 8 12 x for the chosen variable.
Substitute the Add a new linear equation and
11. a) 50x + 80y 1200, where x represents the expression for the quadratic equation.
number of ink sketches sold (x 0) and y variable into the
represents the number of watercolours sold quadratic equation and
(y 0). simplify.
b) y - _ x + 15,
5 Solve New Quadratic Equation
8
y 0, x 0 Substitute the value(s) into
Example: (0, 15), the original linear equation to
No Solution
(2, 15), (8, 12) determine the corresponding
value(s) of the other variable.

584 MHR Answers


6. 16. {x | x -7 or x 2.5, x R}
Solving Quadratic-Quadratic Systems 17. The widths must be between 200 m and 300 m.

Substitution Method Elimination Method Unit 4 Test, pages 511 to 513


Solve one quadratic Eliminate Multiply equations
equation for the y-term. the y-term. as needed. 1. C
2. C
Substitute the
3. B
expression for the y-term
Add new equations. 4. B
into the other quadratic
5. D
equation and simplify.
6. D
Solve New Quadratic Equation 7. A
Substitute the value(s) into an 8. B
No solution. original equation to determine 9. A
the corresponding value(s) of x. 10. 5
7. The two stocks will be the same price at $34 11. 3
and $46. 12. 1s
8. Example: The number of solutions can be 13. a) (0, 0), (2, 4)
determined by the location of the vertex and b) The points are where the golfer is standing
the direction in which the parabola opens. The and where the hole is.
vertex of the first parabola is above the x-axis 14. g(x) = -(x - 6)2 + 13
and it opens upward. The vertex of the second 15. (-9, 256), (-1, 0)
parabola is below the x-axis and it opens 16. a) Example: In the second step, she should
downward. The system will have no solution. have subtracted 2 from both sides of the
9. (-1.8, -18.6), (0.8, 2.6) inequality. It should be 3x 2 - 5x - 12 > 0.
b) x | x < - _ or x > 3, x R
4
{ 3 }
17. The ball is above 3 m for 1.43 s.

10. (1, 6)
a) b) (0, -5), (1, 24)
11. D
a) b) A c) B d) C
12. y > x2 + 1
a) b) y -(x + 3)2 + 2
13. Results in a true statement. Shade the region
a)
that contains the point (0, 0).
b) Results in a false statement. Shade the region
that does not contain the point (2, -5).
c) The point (-1, 1) cannot be used as a test
point. The point is on the boundary line.
14. y < -2x + 4
15. y

4
y x - 3x - 4
2
2

-6 -4 -2 O 2 4 6 x
2
-2

-4

-6

Answers MHR 585


Glossary
A arithmetic series The terms of an arithmetic
sequence expressed as a sum. This sum can
absolute value For a real number a, the be determined using the formula
Sn = _
n [2t + (n - 1)d] or S = _
absolute value is written as |a| and is a n (t + t ),
positive number. 2 1 n 2 1 n

where n is the number of terms, t1 is the first


|a| = { a,-a,if ifa a<0 0 term, d is the common difference, and tn is
the nth term.
absolute value equation An equation that asymptote A line whose distance from a given
includes the absolute value of an expression curve approaches zero.
involving a variable.
axis of symmetry A line through the vertex
absolute value function A function that that divides the graph of a quadratic function
involves the absolute value of a variable. into two congruent halves. The x-coordinate
acute angle An angle that is between 0 of the vertex defines the equation of the axis
and 90. of symmetry.

acute triangle A triangle in which each of


the three interior angles is acute. B
altitude (of a triangle) The perpendicular binomial A polynomial with two terms.
distance from a vertex to the opposite side For example, x2 + 3, m2n + 4n, and
of a triangle. 2x - 5y are binomials.
y
4
boundary A line or curve that separates the
2 Cartesian plane into two regions and may or
altitude
may not be part of the solution region. Drawn
-4 -2 0 2 4 x as a solid line and included in the solution
-2 region if the inequality involves or .
Drawn as a dashed line and not included
ambiguous case From the given information, in the solution region if the inequality
the solution for the triangle is not clear: involves < or >.
there might be one triangle, two triangles, or
no triangle.
C
angle in standard position The position of an
common difference The difference between
angle when its initial arm is on the positive
successive terms in an arithmetic sequence,
x-axis and its vertex is at the origin of a
which may be positive or negative. The
coordinate grid.
common difference, d, is equal to tn - tn - 1.
arithmetic sequence A sequence in which
For the sequence 1, 4, 7, 10, , the
the difference between consecutive terms
common difference is 3.
is constant. An arithmetic sequence is
represented by the formula for the general term common ratio The ratio of successive terms
tn = t1 + (n - 1)d, where t1 is the first term, n in a geometric sequence, which may be
is the number of terms, and d is the common positive or negative. The common ratio, r,
tn
difference. is equal to _ .
tn - 1
The sequence 1, 4, 7, 10, is arithmetic.
For the sequence 1, 2, 4, 8, 16, , the
common ratio is 2.
586 MHR Glossary
completing the square An algebraic process discriminant The expression b2 - 4ac located
used to write a quadratic polynomial in the under the radical sign in the quadratic
form a(x - p)2 + q. formula. Its value is used to determine the
nature of the roots of a quadratic equation
conjugates Two binomial factors whose
ax2 + bx + c = 0, a 0.
product is the difference of two squares. The
binomials (a + b) and (a - b) are conjugates divergent series A series with an infinite
since their product is a2 - b2. number of terms, in which the sequence of
partial sums does not approach a fixed value.
convergent series A series with an infinite
This type of series has r > 1 or r < -1.
number of terms, in which the sequence of
partial sums approaches a fixed value. This type domain The set of all possible values for
of series has -1 < r < 1, and the fixed value can the independent variable in a relation.
t1
be determined using the formula S = _ .
1-r
cosine law The relationship between the
E
cosine of an angle and the lengths of the three elimination method An algebraic method of
sides of any triangle. If a, b, c are the sides of solving a system of equations. Add or subtract
a triangle and C is the angle opposite c, the the equations to eliminate one variable and
cosine law is c2 = a2 + b2 - 2ab cos C. solve for the other variable.
B exact value Answers involving radicals or
c
fractions are exact, unlike approximated
a
decimal values.
C b A Fractions such as _1 are exact, but an
3
cosine ratio For an acute angle in a right approximation of _ 1 such as 0.333 is not.
3
triangle, the ratio of the length of the adjacent
side to the length of the hypotenuse. extraneous root A number obtained in
solving an equation that does not satisfy
cos A = ___
adjacent
hypotenuse the initial restrictions on the variable.
B
hypotenuse
opposite
F
factor Any number or algebraic expression
A C that when multiplied with one or more other
adjacent
numbers or algebraic expressions forms a
product.
D
The factors of 12 are 1, 2, 3, 4, and 6.
degree (of a polynomial) The degree of the
highest-degree term in a polynomial. The factors of 4a2 + 2ab are 1, 2, a, 2a,
4a + 2b, 2a + b, and 4a2 + 2ab.
For example, the polynomial 7a2 - 3a
has degree two. finite sequence A sequence that ends and has
a final term.
difference of squares An expression of the
form a2 - b2 that involves the subtraction of The sequence 2, 5, 8, 11, 14 is a
two squares. finite sequence.

For example, x2 - 4 and (y + 1)2 - (z + 2)2


are differences of squares.

Glossary MHR 587


function A relation in which each value of the initial arm The arm of an angle in standard
independent variable is associated with exactly position that lies on the x-axis.
one value of the dependent variable. For every y
value in the domain, there is a unique value in
the range.
terminal
arm
function notation A notation used when a
0 initial x
relation is a function. It is written f (x) and arm
read as f of x or f at x.

G
inequality A mathematical statement
general term An expression for directly
comparing expressions that may not be
determining any term of a sequence, or the
equal. These can be written using the
nth term. It is denoted by tn.
symbols less than (<), greater than (>),
For the sequence 1, 4, 7, 10, , less than or equal to (), greater than or
the general term is tn = 3n - 2. equal to (), and not equal to ().
geometric sequence A sequence in which infinite sequence A sequence that does
the ratio of consecutive terms is constant. A not end or have a final term.
geometric sequence can be represented by the
The sequence 5, 10, 15, 20, is an
formula for the general term tn = t1r n - 1, where
infinite sequence.
t1 is the first term, r is the common ratio, and n
is the number of terms. infinite geometric series A geometric series
that does not end or have a final term. An
The sequence 1, 2, 4, 8, 16, is geometric.
infinite geometric series may be convergent
geometric series The terms of a geometric or divergent.
sequence expressed as a sum. This sum can be
invariant point A point that remains
t1(r n - 1)
determined using the formula Sn = __ , unchanged when a transformation is
r-1
where t1 is the first term, r is the common applied to it.
ratio, n is the number of terms, and r 1.
M
H maximum value (of a function) The
horizontal asymptote Describes the behaviour greatest value in the range of a function.
of a graph when |x| is very large. The line For a quadratic function that opens
y = b is a horizontal asymptote if the values of downward, the y-coordinate of the vertex.
the function approach b when |x| is very large. minimum value (of a function) The least
value in the range of a function. For a
I quadratic function that opens upward, the
y-coordinate of the vertex.
index Indicates which root to take.
index
monomial A polynomial with one term.
For example, 5, 2x, 3s2, -8cd, and _
n4
n
x
3
are monomials.

588 MHR Glossary


N primary trigonometric ratios The three
ratiossine, cosine, and tangentdefined
non-permissible value Any value for a in a right triangle.
variable that makes an expression undefined.
For rational expressions, any value that results Pythagorean Theorem In a right triangle, the
in a denominator of zero. square of the length of the hypotenuse is equal
to the sum of the squares of the lengths of the
In __ , you must exclude the value for
x+2
x-3 other two sides.
which x - 3 = 0, giving a non-permissible
value of x = 3.
Q
quadrant On a Cartesian plane, the x-axis and
O the y-axis divide the plane into four quadrants.
oblique triangle A triangle that does not y
contain a right angle. 90 < < 180 0 < < 90
II I
obtuse angle An angle that measures more
than 90 but less than 180. 0 x
III IV
obtuse triangle A triangle containing one 180 < < 270 270 < < 360
obtuse angle.
quadrantal angle An angle in standard position
P whose terminal arm lies on one of the axes.
parabola The symmetrical curve of the Examples are 0, 90, 180, 270, and 360.
graph of a quadratic function. quadratic equation A second-degree equation
parameter A constant that can assume with standard form ax2 + bx + c = 0, where
different values but does not change the a 0.
form of the expression or function. For example, 2x2 + 12x + 16 = 0.
In y = mx + b, m is a parameter that quadratic formula The formula
________
represents the slope of the line and b is a
x = ____ for determining
-b b2 - 4ac
parameter that represents the y-intercept. 2a
the roots of a quadratic equation of the
perfect square trinomial The result of
form ax2 + bx + c = 0, a 0.
squaring a binomial.
quadratic function A function f whose value
For example, (x + 5)2 = x2 + 10x + 25
f (x) is given by a polynomial of degree two.
is a perfect square trinomial.
For example, f (x) = x2 is the simplest
piecewise function A function composed of
form of a quadratic function.
two or more separate functions or pieces, each
with its own specific domain, that combine
to define the overall function. The absolute R
value function y = |x| can be defined as the radical Consists of a root symbol, an index,
x, if x 0
piecewise function y = { -x, if x < 0
. and a radicand.
__
It can be rational (for __
example, 4 ) or irrational (for example, 2 ).
polynomial An algebraic expression formed by index radical
n
adding or subtracting terms that are products x
of whole-number powers of variables. radicand

For example, x + 5, 2d - 2.4, and radical equation An equation with radicals


3s2 + 5s - 6 are polynomials. that have variables in the radicands.

Glossary MHR 589


radicand The quantity under the radical sign. root(s) of an equation The solution(s) to
n an equation.
x
radicand

range The set of all possible values for the


S
dependent variable as the independent variable sequence An ordered list of numbers, where
takes on all possible values of the domain. a mathematical pattern or rule is used to
generate the next term in the list.
rational equation An equation containing at
least one rational expression. sine law The relationship between the sides
and angles in any triangle. The sides of a
For example, x = __
x - 3 and _
x -_
7
x = 3. triangle are proportional to the sines of the
x+1 4
opposite angles.
rational expression An algebraic fraction
with a numerator and a denominator that __ a =_ b =_ c
sin A sin B sin C
are polynomials.
For example, _ 1 , __
m , and ___ y2 - 1 B
.
x m+1 y 2 + 2y + 1 a c
x2 - 4 is a rational expression with a
denominator of 1. C A
b
rationalize A procedure for converting to
a rational number without changing the sine ratio For an acute angle in a
value of the expression. If the radical is in right triangle, the ratio of the length of
the denominator, both the numerator and the opposite side to the length of the
hypotenuse. sin A = ___
opposite
denominator must be multiplied by a quantity
that will produce a rational denominator. hypotenuse
B
reciprocal (of a number) The multiplier of a
number to give a product of 1. For example,
hypotenuse
_3 is the reciprocal of _4 because _3 _4 = 1. opposite
4 3 4 3
reciprocal function A function y = _1
A
f(x) adjacent C
defined by y = _ 1 =_ 1 if f (a) = b,
f(a) b solution (of an inequality) A value or set
f (a) 0, b 0. of values that results in a true inequality
reference angle The acute angle whose vertex statement. The solution can contain a specific
is the origin and whose arms are the terminal value or many values.
arm of the angle and the x-axis. The reference solution region All the points in the Cartesian
angle is always a positive acute angle. plane that satisfy an inequality. Also known as
y the solution set.

230 square root One of two equal factors of a


0 x number.
50 ___ ______
For example, 49 = (7)(7)
=7

The reference angle for 230 is 50. standard form (of a quadratic function) The
form f (x) = ax2 + bx + c or y = ax2 + bx + c,
reflection A transformation in which a
where a, b, and c are real numbers and a 0.
figure is reflected over a reflection line.

590 MHR Glossary


substitution method An algebraic method translation A slide transformation that
of solving a system of equations. Solve one results in a shift of the original figure or
equation for one variable. Then, substitute graph without changing its shape.
that value into the other equation and solve
trinomial A polynomial with three terms.
for the other variable.
For example, x2 + 3x - 1 and
system of linear-quadratic equations A linear
2x2 - 5xy + 10y2 are trinomials.
equation and a quadratic equation involving
the same variables. A graph of the system
involves a line and a parabola. V
system of quadratic-quadratic equations vertex (of a parabola) The lowest point of
Two quadratic equations involving the same the graph (if the graph opens upward) or the
variables. The graph involves two parabolas. highest point of the graph (if the graph opens
downward).

T vertex form (of a quadratic function) The


form y = a(x - p)2 + q, or f (x) = a(x - p)2 + q,
tangent ratio For an acute angle in a right
where a, p, and q are constants and a 0.
triangle, the ratio of the length of the
opposite side to the length of the adjacent vertical asymptote For reciprocal

side. tan A = __
opposite functions, vertical asymptotes occur at the
adjacent non-permissible values of the function.
B The line x = a is a vertical asymptote if the
curve approaches the line more and more
hypotenuse closely as x approaches a, and the values of
opposite the function increase or decrease without
bound as x approaches a.
A adjacent C

terminal arm The arm of an angle in standard X


position that meets the initial arm at the origin x-intercept The x-coordinate of the point
to form an angle. where a line or curve crosses the x-axis.
y It is the value of x when y = 0.

terminal
arm Y
0 initial x
arm
y-intercept The y-coordinate of the point
where a line or curve crosses the y-axis.
It is the value of y when x = 0.

test point A point not on the boundary of the


graph of an inequality that is representative of
Z
all the points in a region. A point that is used zero(s) of a function The value(s) of x
to determine whether the points in a region for which f (x) = 0. These values of x are
satisfy the inequality. related to the x-intercept(s) of the graph of
a function f (x).
transformation A change made to a figure
or a relation such that the figure or the zero product property States that if the
graph of the relation is shifted or changed in product of two real numbers is zero, then
shape. Examples are translations, reflections, one or both of the numbers must be zero.
and stretches.

Glossary MHR 591


Index
A determining terms, 1011, D
1314
absolute value, 356, 358363 denominator, 332335
Gausss method, 2224
comparing and ordering, 361 discriminant, 246
general term, 9
defined, 360 divergent series, 60
generating, 1415
determining, 360 dividing
staircase numbers, 68
evaluating expressions, 361 radical expressions, 286288
arithmetic series, 2227
absolute value equations, 380388 rational expressions, 322326
defined, 24
defined, 381
determining terms, 26
extraneous solution for, E
determining the sum of, 25
383384
Gausss method, 2224 exact value, 79
linear and quadratic
asymptote, 395 extraneous roots
expressions, 386387
axis of symmetry, 145 absolute value equations,
no solution for, 384
383384
problems involving, 387388
B defined, 236
quadratic, 385386 radical equations, 297
solving, 382383 boundary, 466 rational equations, 344
absolute value functions, 368375
defined, 370 C F
graphing, 370374
invariant point, 371 career links factoring quadratic equations. See
linear, 368369 aerospace designer, 141 quadratic equations (factoring)
piecewise definition, 370 biomedical engineer, 5 Fibonacci sequence, 4, 32
quadratic, 369 chemical engineer, 463 finite sequences, 8
See also functions commercial diver, 357 fractal geometry, 4647
adding mathematical modeller, 309 See also geometric series
radicals, 276277 meteorologist, 271 functions
rational expressions and physical therapist, 73 absolute value, 368375
equations, 332335 robotics engineer, 205 linear, 368369, 396399
algebra university researcher, 423 maximum value of, 145
determining terms, 1314 common denominator, 332333 minimum value of, 145
systems of equations, 440451 common difference, 9 quadratic, 142146
ambiguous case, 104107 common ratio, 34 reciprocal, 392403
angles completing the square, 180192, See also absolute value
cosine law, 117118 234240 functions; quadratic
quadrantal angle, 93 applying, 239 functions; reciprocal
sine law, 104 converting to vertex form, functions
See also trigonometric ratios 183188
angles (standard position), 7482 defined, 183 G
defined, 77 to find maximum values, 191 Gausss method, 2224
determining, 81 quadratic equations, 234240 general term
exact values, 79, 82 quadratic functions, 180182 arithmetic sequences, 9
initial arm, 77 solving a quadratic equation, geometric sequences, 34
reference angle, 78, 8081 236 geometric sequences, 3239
special right triangles, 79 conjugates, 287 applying, 37
terminal arm, 77 convergent series, 60 common ratio, 34
arithmetic sequences, 616 cosine law, 114119 defined, 32
arithmetic series, 24 defined, 116 determining terms, 3436
common difference, 9 determining angles, 117118 general term, 34
defined, 9 determining distance, 116117 geometric series, 4653
determining number of terms, 12 triangles, 118119 applying, 52

592 MHR Index


defined, 48 solution region, 465 quadratic functions in motion,
determining sum of, 4852 test points, 467 197
fractal trees, 4647 writing and solving, 469471 space anomalies, 330
geometric series (infinite), 5863 logistic spirals, 4 space exploration, 293
convergent series, 60 space tourism, 367
defined, 60 M triangulation, 113
divergent series, 60 trilateration, 125
sums of, 6162 maximum value (of a function), See also unit projects
Golden Mean spiral, 4 145
graphing minimum value (of a function), Q
absolute value functions, 145
370374 modelling quadrantal angle, 93
functions and reciprocals, completing the square, quadratic equations
394395 190192 completing the square,
linear inequalities in two quadratic functions (standard 234240
variables, 466468 form), 171172 defined, 208
quadratic equations, 206214 quadratic functions (vertex discriminant, 246
quadratic functions in vertex form), 154156 extraneous root, 236
form, 148153 with systems of equations, factoring, 218229
quadratic inequalities in 432433, 443444 quadratic formula, 244253
two variables, 490492, multiplying root(s) of an equation, 208
496497 radical expressions, 284286 zero(s) of a function, 208
reciprocal linear functions, quadratic equations (factoring),
rational expressions, 323324,
396399 218229
326
reciprocal quadratic functions, applying, 226227
399402 polynomials, 220, 222
N
systems of equations, 424434 quadratic equations, 223225
non-permissible values, 312 quadratic expressions,
I 220221
P writing and solving, 228
inequalities quadratic equations (graphical
boundary, 466 parabola, 144 solutions of), 206214
half-plane, 466 patterns. See sequences and equations with one root,
linear inequalities, 464471 series 208209
quadratic inequalities (one piecewise function, 370 equations with two roots,
variable), 476484 project corner 210212
quadratic inequalities (two avalanche blasting, 243 equations without roots, 212
variables), 488496 avalanche safety, 233 root(s) of an equation, 208
solution region, 465 carbon nanotubes and zero(s) of a function, 208
test points, 467 engineering, 456 quadratic formula, 244253
infinite geometric series. See contour maps, 257 applying, 252
geometric series (infinite) diamond mining, 31 defined, 244
infinite sequences, 8 financial considerations, 487 determining roots, 246247
initial arm, 77 forestry, 45 discriminant, 246
invariant point, 371
Milky Way galaxy, 281 quadratic functions
minerals, 21 axis of symmetry, 145
L nanotechnology, 439 completing the square,
linear inequalities, 464471 oil discovery, 57 180192
boundary, 466 parabolic shape, 162 defined, 144
graphing, 466468 petroleum, 65 maximum value of, 145
half-plane, 466 prospecting, 87 minimum value of, 145

Index MHR 593


parabola, 144 radical expressions (multiplying reference angle, 78, 8081
zero(s) of a function, 208 and dividing), 282289 root(s) of an equation
See also functions conjugates, 287 defined, 208
quadratic functions (standard dividing, 286288 discriminants, 246
form), 163173 multiplying, 284286 equations with one root,
analyzing, 168171 rationalizing, 287 208209
characteristics of, 166168 radical expressions and equations with two roots,
defined, 164 equations, 272278, 294300 210212
modelling situations, 171172 adding and subtracting, equations without roots, 212
quadratic functions (vertex form), 276277
142156 comparing and ordering, 276 S
axis of symmetry, 145 conjugates, 287
sequences and series
combining transformations, converting mixed radicals to
arithmetic sequences, 616
147 entire radicals, 274
arithmetic series, 2227
completing the square, expressing entire radicals as
common difference, 9
183189 mixed radicals, 275
common ratio, 34
determining intercepts, like radicals, 273
convergent series, 60
153154 radical equations, 294300 divergent series, 60
graphs of, 148153 rationalizing, 287 Fibonacci sequence, 4, 32
maximum value (of a rational equations, 341348 finite and infinite sequences, 8
function), 145 defined, 342 fractal geometry, 4647
minimum value (of a extraneous roots, 344 general term, 9
function), 145 solving, 342343 geometric sequences, 3239
modelling problems, 154156 rational expressions, 308, geometric series, 4653
parabola, 144 310317, 322326 infinite geometric series, 5863
parameter, 146147 adding and subtracting, sequence (defined), 8
vertex, 144 332335 sine law, 100107
quadratic inequalities (one applying, 315316 ambiguous case, 104107
variable), 476484 common denominators, angle measures, 104
applying, 483 332333 defined, 102
solving, 478482 defined, 310 side lengths, 102103
quadratic inequalities (two dividing, 324326 solution region, 465
variables), 488496 equivalent rational spirals, 4, 23
defining solution regions, expressions, 313 squared spirals, 23
493494 multiplying, 323324, 326 staircase numbers, 68
graphing, 490491 non-permissible values, 312 standard form (of a quadratic
interpreting graphs of, simplifying, 313315 function). See quadratic
495496 unlike denominators, 332, functions (standard form)
334335 standard position. See angles
rationalizing radicals, 287 (standard position)
R
reciprocal functions, 392403 subtracting
radical equations, 294300 asymptote, 395 radicals, 276277
defined, 295 defined, 394 rational expressions and
equations with one radical functions and reciprocals, equations, 332335
term, 296 394395 systems of equations
equations with two radical reciprocals of linear functions, algebraic solutions, 440451
terms, 298 396399 graphical solutions, 424434
extraneous roots, 297 reciprocals of quadratic modelling with, 432433,
problems involving, 299 functions, 399402 443444

594 MHR Index


system of linear-quadratic exact value, 79, 82 quadratic functions in
equations, 425, 426, 427, initial arm, 77 everyday life, 139, 263
428429, 430431, 441445 quadrantal angle, 93 space: past, present, future,
system of quadratic-quadratic reference angle, 78, 8081 269, 415
equations, 425, 429430, sine law, 100107 See also project corner
432433, 447450 special right triangles, 79 unlike denominators, 332, 334335
terminal arm, 77
T trigonometric ratios, 8895 V
trigonometric ratios, 8895
terminal arm, 77 vertex (of a parabola), 144
angles greater than 90 degrees,
test points, 467 vertex form (of a quadratic
8889
triangles function). See quadratic
determining, 9095
cosine law, 118119 functions (vertex form)
equilateral triangles, 282
U
isosceles right triangles, 283 Z
special right triangles, 79 unit projects
Zenos paradoxes, 58
trigonometry avalanche control, 263
zero(s) of a function, 208
ambiguous case, 104107 Canadas natural resources, 3,
angle in standard position, 71, 131132
7482 nanotechnology, 421, 461,
cosine law, 114119 506507

Index MHR 595


Credits
Photo Credits Alamy/GetStock; p52 David Tanaka; p55 top Bill
Ivy, Jeff Greenberg/Alamy/GetStock; p57 Bill Ivy;
iv David Tanaka; v Kelly Funk/All Canada Photos; p58 Mary Evans Picture Library/Alamy; p64 O.
vi top background Karen Kasmauski/CORBIS, Bierwagon/IVY IMAGES; p66 Clarence W. Norris/
left David Tanaka, left bottom Keith Douglas, middle Lone Pine Photo; p70 Toronto Star/GetStock;
top O. Bierwagon/IVY IMAGES, right top Lloyd p71 top Keith Douglas, Paul A. Souders/CORBIS,
Sutton/Alamy, middle W.Ivy/IVY IMAGES; vii TOP Judy Waytiuk/Alamy/Get Stock;
top left background NASA Goddard Space Flight pp7273 background J. DeVisser/IVY IMAGES,
Center, top left Gemini Observatory, GMOS Team, lower left Ethel Davies/Robert Harding World
lower left background Brenda Tharp/Photo Imagery/Corbis, middle right Henryk Sadura/iStock,
Researchers Inc., left Alexander Kuzovlev/iStock, lower right Artiga Photo/Corbis; p74 Stapleton
top right Nick Higham/Alamy/GetStock, middle Collection/Corbis; p82 McGraw Hill Companies;
CCL/wiki, bottom right Masterfile; LOWER top Jerry p84 lower Hazlan Abdul Hakim/iStock; p85 top left
Lodriguss/Photo Researchers Inc., Science Source/ David Tanaka, Don Bayley/iStock, Derivative work
Photo Researchers Inc.; viii NASA; ix middle left by Chris Buckley, UK. Original by Mohammed
Bill Ivy, Diving Plongeon Canada, Clarence W. Abubakr, ECE, GRIET, Hyderabad, India. Used by
Norris/Lone Pine Photo; xi Al Harvey/The Slide permission; p86 Courtesy of Uncle Milton
Farm; pp23 background Karen Kasmauski/CORBIS, Industries. Used by permission; p88 Courtesy of
left David Tanaka, left bottom Keith Douglas, middle Syncrude Canada Ltd.; p100 Hal Bergman/iStock;
top O. Bierwagon/IVY IMAGES, right top Lloyd p101 CCL/wiki; p102 Bryan & Cherry Alexander/
Sutton/Alamy; pp45 top left background NASA Arctic Photos; p109 Terry Melnyk; p110 left The
Goddard Space Flight Center, top left Gemini Founders, Chief Whitecap and John Lake by Hans
Observatory-GMOS Team, lower left background Holtkamp, Traffic Bridge, River Landing, Saskatoon
Brenda Tharp/Photo Researchers Inc., left Alexander 06. Wayne Shiels/Lone Pine Photo; top right Daniel
Kuzovlev/iStock, top right Nick Higham/Alamy/ Cardiff/iStock, Olivier Pitras/Sygma/Corbis;
GetStock, middle CCL/wiki, bottom Masterfile; p114 NASA; p117 Cameron Whitman/iStock;
p6 top Jerry Lodriguss/Photo Researchers Inc., p121 left NASA, Moondog by Tony White,
Science Source/Photo Researchers Inc.; p12 Richard National Gallery of Washington; p123 top Russ
Sidey/iStock; p18 Geese and Ulus by Lucy Heinl/All Canada Photos; p124 Peter J. Van
Angoyuaq of Baker Lake. 22by 27 fabric, Used by Coeverden de Groot; p132 W. Ivy/IVY IMAGES;
permission of the artist. Photo by WarkInuit; p133 Al Harvey/The Slide Farm; p134 M. Fieguth/
p19 top catnap/iStock, Photo courtesy of Rio Tinto; IVY IMAGES; p135 top W. Lankinen/IVY IMAGES,
p20 David Tanaka; p22 Bettman/Corbis; p25 Edward Guy Laflamme/Kunoki; p137 Manitoba MS Society;
R. Degginger/Alamy/GetStock; p28 top A Breach in pp138139 background Ed Darack/Science Faction/
Hunger Photo: Dave Roels. Used by permission of Corbis, top left background clockwise Mark Herreid/
The Greater Vancouver Food Bank and iStock, Victor Kapas/iStock, James Brittain/VIEW/
CANstruction Vancouver, UnBEARable Hunger by Corbis, Clayton Hansen/iStock, Chris Moseley/
Butler Rogers Baskett Architects, P.C.-2008 Canadian Avalanche Association; pp140141 David
International Jurors Favorite. Photo: Kevin Wick. Tanaka, bottom right Thierry Boccon-Gibod/Getty
Canstruction is a trademarked Charity Competition Images; p142 Used by permission, Ford Motor
of the Design and Construction Industry under the Company; p154 Arpad Benedek/iStock; p159 Orestis
auspices of the Society for Design Administration; Panagiotou/epa/Corbis; p160 top Alan Marsh/First
p31 top chris scredon/iStock, Ljupco Smokovsk/ Light, David Keith Jones/Alamy/GetStock; p163 top
iStock, Reuters/Corbis; p32 Janez Habjanic/iStock; Ryan Remiorz/The Canadian Press, Chuck Stoody/
pp33, 35,40 David Tanaka; p41 top Bill Ivy, The Canadian Press; p169 Arco Images GmbH/
Biophoto Associates/Photo Researchers Inc.; p42 top Alamy; p171 Chris Harris/All Canada Photos;
left clockwise Courtesy of the Arctic Winter Games, p175 Ron Erwin/iStock; p176 Bryan Weinstein/
Sol Neelman/Corbis, CCL/wiki, Jesper Kunuk Egede; iStock; p180 Cliff Whittem/Alamy/GetStock;
p43 top efesan/iStock, Leslie Casals/iStock; p45 B. p181 Pat OHara/Corbis; p190 moodboard/CORBIS;
Lowry/IVY IMAGES; p46 top John Glover/Alamy/ p194 top Joe Gough/iStock, Lynden Pioneer
GetStock, David Tanaka, Manor Photography/ Museum/Alamy/GetStock; p195 top Bill Ivy,

596 MHR Credits


N. Lightfoot/IVY IMAGES; p196 Alena Brozova/ p306 Winnipeg Free Press/Ruth Bonneville/The
iStock; p197 V.J. Matthew/iStock; p198 Hank Canadian Press; p307 Photo courtesy of employees
Morgan/Photo Researchers Inc.; p199 Christy Seely/ of Snap Lake Mine; pp 308309 NASA, bottom right
iStock; pp204205 left Alinari/Art Resource, NY, Olivier Polet/Corbis; p310 Nikada/iStock;
top down Doug Berry/iStock, David Tanaka, B. p319 Martin Thomas Photography/Alamy/GetStock;
Lowry/IVY IMAGES; p205 top left Bill Ivy, NASA, p321 Fotosearch 2010; p322 Photo courtesy of
bottom right Nils Jorgensen/Rex Features/The Aboriginal House, University of Manitoba;
Canadian Press; p206 Lenscraft Imaging/iStock; p327 Kevin Miller/iStock; p328 top B. Lowry/IVY
p207 dblight/iStock; p216 left Bill Ivy, Diving IMAGES, David Tanaka; p329 top NASA, Richard
Plongeon Canada; p217 Clarence W. Norris/Lone Lam/The Canadian Press; p330 NASA; p331 Roger
Pine Photo; p218 Christina Ivy/IVY IMAGES; Russmeyer/Corbis; p337 David Tanaka; p338 Kelly
p219 Sol Neelman/Corbis; p226 Courtesy of Kathy Funk/All Canada Photos; p341 The Art Archive/
Hughes & Chris Mckay. C.A.M. K9 Pool, Errington, Bibliothque des Arts Dcoratifs Paris/Gianni Dagli
British Columbia; p228 top Christopher Hudson/ Orti Ref: AA374072; p345 Tony Freeman/PhotoEdit
iStock, Masterfile; p231 left Dmitry Kostyukov/AFP/ Inc.; p346 Photo courtesy of Trappers Festival;
Getty Images, Masterfile; p233 Keven Drews Ho/The p349 Boomer Jerritt/All Canada Photos; p350 Bryan
Canadian Press; p234 Steve Ogle/All Canada Photos; & Cherry Alexander/Arctic Photos; p354 top Nina
p235 Rich Wheater/All Canada Photos; p236 Dmitry Shannon/iStock, B. Lowry/IVY IMAGES; p355 Mike
Kutlayev/iStock; p237 David Tanaka; p241 Sampics/ Eikenberry/iStock; pp356357 background Jaap2/
Corbis; p243 left Rupert Wedgwood/Canadian iStock, top left clockwise Grant Dougall/iStock, Eric
Avalanche Association, Chris Moseley/Canadian Hood/iStock, Amos Nachoum/Corbis, rzelich/
Avalanche Association; p252 Round Bale by Jill iStock; p358 Grant Dougall/iStock; p362 J. Whyte/
Moloy. Oil on Canvas 90x120 cm. Photo by David IVY IMAGES; p364 left Mike Grandmaison/All
Tanaka. Used by permission of the artist; Canada Photos, Gunter Marx/Alamy/GetStock;
p255 Courtesy of the Government of Saskatchewan; p367 top Christina Ivy/IVY IMAGES, Shigemi
p257 Boomer Jerritt/All Canada Photos; p258, 260 Numazawa/Atlas Photo Bank/Photo Researchers
Masterfile; p262 B. Lowry/IVY IMAGES; Inc.; p368 Adam Hart-Davis/Photo Researchers Inc.;
p265 Courtesy of James Michels; p267 Cathrine p378 Ron Nickel/Design Pics/Getty Images;
Wessel/CORBIS; pp268269 top left David Parker/ p380 top William Radcliffe/Science Faction/Corbis,
Photo Researchers Inc., NOAA/Reuters/Corbis, Paramount Television/The Kobal Collection;
lower NASA, p269 right Jim Reed/Photo p389 Floortje/iStock; p390 left Galileo Project/
Researchers Inc.; pp270271 background NOAA, NASA, mike proto/iStock; p391 Reuters/NASA;
top left clockwise, Jeff McIntosh/The Canadian p392 Duncan Walker/iStock; p406 left Sheila Terry/
Press, NASA, AP/Cristobal Fuentes/The Canadian Photo Researchers Inc., Reinhard Dirscherl/
Press, Visuals Unlimited/Corbis, AP/Luca Bruno/ maXximages; p407 top Elena Elisseeva/iStock,
The Canadian Press; p276 Formline Revolution Photograph by David R. Spencer, 1986, reproduced
Bentwood Chest by Corey Moraes. Photo by Spirit from www.scenic-railroads.com with permission of
Wrestler Gallery. Used by permission of the artist; the photographer and released to GFDL courtesy of
p279 top NOAA, Clincher by Jonathan Forrest. David R. Spencer; p410 Brad Wrobleski/Radius
Used by permission of the artist; p280, 281, 282 Images/All Canada Photos; p411 Mike
NASA/JPL; p283 David Tanaka; p285 The Art Grandmaison/All Canada Photos; p412 Tjanze/
Archive/Russian State Museum-Saint Petersburg/ iStock; p414 NASA; p419 Nathan Denette/The
Superstock; p291 Gunter Marx/Alamy/GetStock; Canadian Press; pp 420421 background Masterfile,
p292 AP/Bela Szandelszky/The Canadian Press; p420 top Jenny E. Ross/Corbis, Ron Stroud/
p294 David Tanaka; p295 Bill Ivy; p299 Nathan Masterfile, Photo courtesy of Dr. Ian Foulds;
Denette/The Canadian Press; p301 top David R. p421 Colin Cuthbert/Photo Researchers Inc., E.M.
Frazier Photolibrary, Inc./Alamy/GetStock, Chris Pasieka/SPL/Corbis; p422 top Oleksiy Maksymenko
Cheadle/All Canada Photos; p302 Ross Chandler/ Photography/Alamy/GetStock, Bill Ivy, p423 top left
iStock, Terrance Klassen/Alamy/GetStock; clockwise Bill Ivy, Getty Images, Photo courtesy of
p303 Jared Hobbs/All Canada Photos; p304 Dick Dr. Ian Foulds; p424 Willie B. Thomas/iStock;
DeRyk/Gallagher Centre; p305 CCL/wiki; p427 COC/Mike Ridewood/The Canadian Press;

Credits MHR 597


p432 Torsten Blackwood/Getty Images; p435 Rich AP/The Canadian Press; p476 Jeff McIntosh/The
Legg/iStock; p436 Robert Dall/The Canadian Press; Canadian Press; p485 Darko Zeljkovic/Belleville
p437 left Steve Maehl/iStock, David Tanaka; Intelligencer/The Canadian Press; p486 left Don
p438 Stephen Srathdee/iStock; p439 top Diane Bayley/iStock, Hakan German/iStock; p487 Jesse
Diederich/iStock, Associated Press; p440 top Mary Lang/iStock; p488 Kord.com/First Light; p493 Scott
Evans Picture Library, Leonard de Selva/Corbis; Boehm/Getty Images Sport; p494 Alexey Gostev/
p443 Bill Ivy; p445 Tom Hanson/The Canadian iStock; p495 Masterfile; p498 top B. Lowry/IVY
Press; p449 Christopher Futcher/iStock; p453 Photo IMAGES, Darryl Dyck/The Canadian Press;
courtesy of Ansgar Walk/wiki; p454 Rainer Albiez/ p499 Canadian Space Agency; p500 James Leynse/
iStock; p455 iTobi/iStock; p456 Martin McCarthy/ Corbis; p502 top Don Hammond/Design Pics/Corbis,
iStock; p458 Linde Stewart/iStock; p460 Alexander Jorge Alvarado/peruinside.com; p505 Beat Glauser/
Yakovlev/iStock; p461 top Richard Ransier/Corbis, iStock; p507 top Yuriko Nakao/Reuters, lower left
Larry Williams/Corbis, Rudy Sulgan/Corbis; Milan Zeremski/iStock, jamesbenet/iStock;
pp462463 Alexander Raths/iStock, lower darren p510 Clay Blackburn/iStock; p512 Ryan Remiorz/
baker/iStock; p463 top Christian Lagereek/iStock, The Canadian Press;
Mel Evans/The Canadian Press; p464 Chris
Schmidt/iStock; p470 Bill Ivy; p473 left Bill Ivy,
Collection of the Alberta Foundation for the Arts.
Technical Art
Used by permission of the artist Jason Carter; Brad Black, Tom Dart, Kim Hutchinson, and
p474 top Martin McCarthy/iStock, Matt Dunham/ Brad Smith of First Folio Resource Group, Inc.

598 MHR Credits

You might also like