Program for nth Catalan Number
Last Updated :
23 Jul, 2025
Catalan numbers are defined as a mathematical sequence that consists of positive integers, which can be used to find the number of possibilities of various combinations. The nth term in the sequence denoted Cn, is found in the following formula: \frac{(2n)!}{((n + 1)! n!)}
The first few Catalan numbers for n = 0, 1, 2, 3, 4, 5… are: 1, 1, 2, 5, 14, 42, 132, 429, 1430, 4862, ... so on.
Catalan numbers occur in many interesting counting problems like the following.
- Count the number of expressions containing n pairs of parentheses that are correctly matched.
- Count the number of possible Binary Search Trees with n keys (See this)
- Count the number of full binary trees (A rooted binary tree is full if every vertex has either two children or no children) with n+1 leaves.
- Given a number n, return the number of ways you can draw n chords in a circle with 2 x n points such that no 2 chords intersect.
Refer to this for more applications.
Examples:
Input: n = 6
Output: 132
Explanation: C(6)=C(0)C(5)+C(1)C(4)+C(2)C(3)+C(3)C(2)+C(4)C(1)+C(5)C(0)=132
Input: n = 8
Output: 1430
Explanation: C(8)=C(0)C(7)+C(1)C(6)+C(2)C(5)+C(3)C(4)+C(4)C(3)+C(5)C(2)+C(6)C(1)+C(7)C(0)=1430
Input: n = 5
Output: 42
Explanation: C(5)=C(0)C(4)+C(1)C(3)+C(2)C(2)+C(3)C(1)+C(4)C(0)=42
[Naive Approach] By using Recursion
Catalan numbers satisfy the following recursive formula: C_0=C_1=1 \ and \ C_{n}=\sum_{i=0}^{n-1}C_iC_{n-i-1} \ for \ n\geq 2
Step-by-step approach:
- Base condition for the recursive approach, when n <= 1, return 1.
- Iterate from i = 0 to i < n.
- Make a recursive call catalan(i) and catalan(n - i - 1) and keep adding the product of both into res.
- Return the res.
C++
// C++ program to find nth catalan number
#include <iostream>
using namespace std;
int findCatalan(int n) {
// Base case
if (n <= 1)
return 1;
// catalan(n) is sum of
// catalan(i)*catalan(n-i-1)
int res = 0;
for (int i = 0; i < n; i++)
res += findCatalan(i) * findCatalan(n - i - 1);
return res;
}
int main() {
int n = 6;
int res = findCatalan(n);
cout << res;
return 0;
}
Java
// Java program to find nth catalan number
class GfG {
static int findCatalan(int n) {
// Base case
if (n <= 1) {
return 1;
}
// catalan(n) is the sum of catalan(i) *
// catalan(n-i-1)
int res = 0;
for (int i = 0; i < n; i++) {
res += findCatalan(i) * findCatalan(n - i - 1);
}
return res;
}
public static void main(String[] args) {
int n = 6;
int res = findCatalan(n);
System.out.println(res);
}
}
Python
# Python program to find nth catalan number
def findCatalan(n):
# Base case
if n <= 1:
return 1
# catalan(n) is sum of catalan(i) * catalan(n-i-1)
res = 0
for i in range(n):
res += findCatalan(i) * findCatalan(n - i - 1)
return res
n = 6
res = findCatalan(n)
print(res)
C#
// C# program to find nth catalan number
using System;
class GfG {
static int findCatalan(int n) {
// Base case
if (n <= 1)
return 1;
// catalan(n) is the sum of catalan(i) *
// catalan(n-i-1)
int res = 0;
for (int i = 0; i < n; i++) {
res += findCatalan(i) * findCatalan(n - i - 1);
}
return res;
}
static void Main(string[] args) {
int n = 6;
int res = findCatalan(n);
Console.WriteLine(res);
}
}
JavaScript
// JavaScript program to find nth catalan number
function findCatalan(n) {
// Base case
if (n <= 1) {
return 1;
}
// catalan(n) is the sum of catalan(i) * catalan(n-i-1)
let res = 0;
for (let i = 0; i < n; i++) {
res += findCatalan(i) * findCatalan(n - i - 1);
}
return res;
}
let n = 6;
let res = findCatalan(n);
console.log(res);
Output1 1 2 5 14 42 132 429 1430 4862
Time Complexity: O(2n) (T(n)=\sum_{i=0}^{n-1}T(i)*T(n-i-1) \ for \ n\geq 1)
Auxiliary Space: O(n)
[Better Approach] By using Dynamic Programming
We can observe that the above recursive implementation does a lot of repeated work. Since there are overlapping subproblems, we can use dynamic programming for this.
Step-by-step approach:
- Create an array catalan[] for storing ith Catalan number.
- Initialize, catalan[0] and catalan[1] = 1
- Loop through i = 2 to the given Catalan number n.
- Loop through j = 0 to j < i and Keep adding value of catalan[j] * catalan[i - j - 1] into catalan[i].
- Finally, return catalan[n]
C++
// C++ program to find nth catalan number
#include <iostream>
using namespace std;
int findCatalan(int n) {
// Table to store results of subproblems
int catalan[n + 1];
// Initialize first two values in table
catalan[0] = catalan[1] = 1;
// Fill entries in catalan[] using recursive formula
for (int i = 2; i <= n; i++) {
catalan[i] = 0;
for (int j = 0; j < i; j++)
catalan[i] += catalan[j] * catalan[i - j - 1];
}
// Return last entry
return catalan[n];
}
int main() {
int n = 6;
int res = findCatalan(n);
cout << res;
return 0;
}
Java
// Java program to find nth catalan number
class GfG {
static int findCatalan(int n) {
// Table to store results of subproblems
int[] catalan = new int[n + 1];
// Initialize first two values in the table
catalan[0] = catalan[1] = 1;
// Fill entries in catalan[] using the recursive
// formula
for (int i = 2; i <= n; i++) {
catalan[i] = 0;
for (int j = 0; j < i; j++) {
catalan[i]
+= catalan[j] * catalan[i - j - 1];
}
}
// Return the last entry
return catalan[n];
}
public static void main(String[] args) {
int n = 6;
int res = findCatalan(n);
System.out.println(res);
}
}
Python
# Python program to find nth catalan number
def findCatalan(n):
# Table to store results of subproblems
catalan = [0] * (n + 1)
# Initialize first two values in the table
catalan[0] = catalan[1] = 1
# Fill entries in catalan[] using the recursive formula
for i in range(2, n + 1):
catalan[i] = 0
for j in range(i):
catalan[i] += catalan[j] * catalan[i - j - 1]
# Return the last entry
return catalan[n]
n = 6
res = findCatalan(n)
print(res)
C#
// C# program to find nth catalan number
using System;
class GfG {
static int findCatalan(int n) {
// Table to store results of subproblems
int[] catalan = new int[n + 1];
// Initialize first two values in the table
catalan[0] = catalan[1] = 1;
// Fill entries in catalan[] using the recursive
// formula
for (int i = 2; i <= n; i++) {
catalan[i] = 0;
for (int j = 0; j < i; j++) {
catalan[i]
+= catalan[j] * catalan[i - j - 1];
}
}
// Return the last entry
return catalan[n];
}
static void Main() {
int n = 6;
int res = findCatalan(n);
Console.WriteLine(res);
}
}
JavaScript
// JavaScript program to find nth catalan number
function findCatalan(n) {
// Table to store results of subproblems
let catalan = new Array(n + 1).fill(0);
// Initialize first two values in the table
catalan[0] = catalan[1] = 1;
// Fill entries in catalan[] using the recursive formula
for (let i = 2; i <= n; i++) {
catalan[i] = 0;
for (let j = 0; j < i; j++) {
catalan[i] += catalan[j] * catalan[i - j - 1];
}
}
// Return the last entry
return catalan[n];
}
let n = 6;
let res = findCatalan(n);
console.log(res);
Output1 1 2 5 14 42 132 429 1430 4862
Time Complexity: O(n2)
Auxiliary Space: O(n)
[Expected Approach] By using Binomial Coefficient
We can also use the below formula to find nth Catalan number in O(n) time.
C_n=\frac{1}{n+1}\binom{2n}{n}
Below are the steps for calculating nCr.
- Create a variable to store the answer and change r to n - r if r is greater than n - r because we know that C(n, r) = C(n, n-r) if r > n - r
- Run a loop from 0 to r-1
- In every iteration update ans as (ans*(n-i))/(i+1), where i is the loop counter.
- So the answer will be equal to ((n/1)*((n-1)/2)*…*((n-r+1)/r), which is equal to nCr.
Below are steps to calculate Catalan numbers using the formula: 2nCn/(n+1)
- Calculate 2nCn using the similar steps that we use to calculate nCr
- Return the value 2nCn/ (n + 1)
C++
// C++ program for nth Catalan Number
#include <iostream>
using namespace std;
// Returns value of Binomial Coefficient C(n, k)
int binomialCoeff(int n, int k) {
int res = 1;
// Since C(n, k) = C(n, n-k)
if (k > n - k)
k = n - k;
// Calculate value of [n*(n-1)*---*(n-k+1)] /
// [k*(k-1)*---*1]
for (int i = 0; i < k; ++i)
{
res *= (n - i);
res /= (i + 1);
}
return res;
}
// A Binomial coefficient based function to find nth catalan
// number in O(n) time
int findCatalan(int n) {
// Calculate value of 2nCn
int c = binomialCoeff(2 * n, n);
// return 2nCn/(n+1)
return c / (n + 1);
}
int main() {
int n = 6;
int res = findCatalan(n);
cout << res;
return 0;
}
Java
// Java program for nth Catalan Number
class GfG {
// Returns value of Binomial Coefficient C(n, k)
static int binomialCoeff(int n, int k) {
int res = 1;
// Since C(n, k) = C(n, n-k)
if (k > n - k) {
k = n - k;
}
// Calculate value of [n*(n-1)*...*(n-k+1)] /
// [k*(k-1)*...*1]
for (int i = 0; i < k; ++i) {
res *= (n - i);
res /= (i + 1);
}
return res;
}
// A Binomial coefficient based function to find nth
// catalan number in O(n) time
static int findCatalan(int n) {
// Calculate value of 2nCn
int c = binomialCoeff(2 * n, n);
// return 2nCn / (n+1)
return c / (n + 1);
}
public static void main(String[] args) {
int n = 6;
int res = findCatalan(n);
System.out.println(res);
}
}
Python
# Python program for nth Catalan Number
# Returns value of Binomial Coefficient C(n, k)
def binomialCoeff(n, k):
res = 1
# Since C(n, k) = C(n, n-k)
if k > n - k:
k = n - k
# Calculate value of [n*(n-1)*...*(n-k+1)] / [k*(k-1)*...*1]
for i in range(k):
res *= (n - i)
res //= (i + 1)
return res
# A Binomial coefficient based function to find nth
# catalan number in O(n) time
def findCatalan(n):
# Calculate value of 2nCn
c = binomialCoeff(2 * n, n)
# return 2nCn / (n+1)
return c // (n + 1)
n = 6
res = findCatalan(n)
print(res)
C#
// C# program for nth Catalan Number
using System;
class GfG {
// Returns value of Binomial Coefficient C(n, k)
static int binomialCoeff(int n, int k) {
int res = 1;
// Since C(n, k) = C(n, n-k)
if (k > n - k) {
k = n - k;
}
// Calculate value of [n*(n-1)*...*(n-k+1)] / [k*(k-1)*...*1]
for (int i = 0; i < k; ++i) {
res *= (n - i);
res /= (i + 1);
}
return res;
}
// A Binomial coefficient based function to find nth
// catalan number in O(n) time
static int findCatalan(int n) {
// Calculate value of 2nCn
int c = binomialCoeff(2 * n, n);
// return 2nCn / (n+1)
return c / (n + 1);
}
static void Main() {
int n = 6;
int res = findCatalan(n);
Console.WriteLine(res);
}
}
JavaScript
// JavaScript program for nth Catalan Number
// Function to calculate the Binomial Coefficient C(n, k)
function binomialCoeff(n, k) {
let result = 1;
// Since C(n, k) = C(n, n-k)
if (k > n - k) {
k = n - k;
}
// Calculate value of [n*(n-1)*---*(n-k+1)] /
// [k*(k-1)*---*1]
for (let i = 0; i < k; i++) {
result *= (n - i);
result /= (i + 1);
}
return result;
}
// A function to find the nth Catalan number using the
// Binomial Coefficient
function findCatalan(n) {
// Calculate value of 2nCn
const c = binomialCoeff(2 * n, n);
// Return 2nCn / (n+1)
return Math.floor(c
/ (n + 1));
}
const n = 6;
const res = findCatalan(n);
console.log(res);
Output1 1 2 5 14 42 132 429 1430 4862
Time Complexity: O(n).
Auxiliary Space: O(1)
We can also use the below formulas to find nth Catalan number in O(n) time.
C_n=\frac{(2n)!}{(n+1)!n!}=\prod_{k=2}^{n}\frac{n+k}{k} \ for \ n\geq 0
C_n = \frac{2(2n-1)}{n+1}*C_{n-1} \ \ \ {|} \ \ {n>0}
[Alternate Approach] By using the (n-1)th Catalan Number
We already know how to calculate the nth Catalan Number using the below formula, 
This formula can be further simplified to express the nth Catalan Number in the terms of (n-1)th Catalan Number,

Below are steps to calculate Catalan numbers using the above formula:
- Initialize a variable res = 1
- Print 1 as the first Catalan Number
- Iterate from i = 1 to i < n
- Update res with res = (res * (4 * i - 2)) / (i + 1)
- print res
C++
// C++ program for nth Catalan Number
#include <iostream>
using namespace std;
int findCatalan(int n) {
int res = 1;
// Use the iterative approach to
// calculate the nth Catalan number
for (int i = 2; i <= n; i++) {
res = ((res * (4 * i - 2)) / (i + 1));
}
return res;
}
int main() {
int n = 6;
int res = findCatalan(n);
cout << res;
return 0;
}
Java
// Java program for nth Catalan Number
class GfG {
static int findCatalan(int n) {
int res = 1;
// Use the iterative approach to
// calculate the nth Catalan number
for (int i = 2; i <= n; i++) {
res = (res * (4 * i - 2)) / (i + 1);
}
return res;
}
public static void main(String[] args) {
int n = 6;
int res = findCatalan(n);
System.out.println(res);
}
}
Python
# Python program for nth Catalan Number
def findCatalan(n):
result = 1
# Use the iterative approach to calculate
# the nth Catalan number
for i in range(2, n + 1):
result = (result * (4 * i - 2)) // (i + 1)
return result
n = 6
res = findCatalan(n)
print(res)
C#
// C# program for nth Catalan Number
using System;
class GfG {
static int findCatalan(int n) {
int result = 1;
// Use the iterative approach to calculate the nth
// Catalan number
for (int i = 2; i <= n; i++) {
result = (result * (4 * i - 2)) / (i + 1);
}
return result;
}
static void Main(string[] args) {
int n = 6;
int res = findCatalan(n);
Console.WriteLine(res);
}
}
JavaScript
// JavaScript program for nth Catalan Number
function findCatalan(n) {
let result = 1;
// Use the iterative approach to calculate the nth
// Catalan number
for (let i = 2; i <= n; i++) {
result = (result * (4 * i - 2)) / (i + 1);
}
return result;
}
const n = 6;
const res = findCatalan(n);
console.log(res);
Time Complexity: O(n)
Auxiliary Space: O(1), since no extra space has been taken.
Program for Nth Catalan Number (using Binomial Coefficient)
Similar Reads
Basics & Prerequisites
Data Structures
Array Data StructureIn this article, we introduce array, implementation in different popular languages, its basic operations and commonly seen problems / interview questions. An array stores items (in case of C/C++ and Java Primitive Arrays) or their references (in case of Python, JS, Java Non-Primitive) at contiguous
3 min read
String in Data StructureA string is a sequence of characters. The following facts make string an interesting data structure.Small set of elements. Unlike normal array, strings typically have smaller set of items. For example, lowercase English alphabet has only 26 characters. ASCII has only 256 characters.Strings are immut
2 min read
Hashing in Data StructureHashing is a technique used in data structures that efficiently stores and retrieves data in a way that allows for quick access. Hashing involves mapping data to a specific index in a hash table (an array of items) using a hash function. It enables fast retrieval of information based on its key. The
2 min read
Linked List Data StructureA linked list is a fundamental data structure in computer science. It mainly allows efficient insertion and deletion operations compared to arrays. Like arrays, it is also used to implement other data structures like stack, queue and deque. Hereâs the comparison of Linked List vs Arrays Linked List:
2 min read
Stack Data StructureA Stack is a linear data structure that follows a particular order in which the operations are performed. The order may be LIFO(Last In First Out) or FILO(First In Last Out). LIFO implies that the element that is inserted last, comes out first and FILO implies that the element that is inserted first
2 min read
Queue Data StructureA Queue Data Structure is a fundamental concept in computer science used for storing and managing data in a specific order. It follows the principle of "First in, First out" (FIFO), where the first element added to the queue is the first one to be removed. It is used as a buffer in computer systems
2 min read
Tree Data StructureTree Data Structure is a non-linear data structure in which a collection of elements known as nodes are connected to each other via edges such that there exists exactly one path between any two nodes. Types of TreeBinary Tree : Every node has at most two childrenTernary Tree : Every node has at most
4 min read
Graph Data StructureGraph Data Structure is a collection of nodes connected by edges. It's used to represent relationships between different entities. If you are looking for topic-wise list of problems on different topics like DFS, BFS, Topological Sort, Shortest Path, etc., please refer to Graph Algorithms. Basics of
3 min read
Trie Data StructureThe Trie data structure is a tree-like structure used for storing a dynamic set of strings. It allows for efficient retrieval and storage of keys, making it highly effective in handling large datasets. Trie supports operations such as insertion, search, deletion of keys, and prefix searches. In this
15+ min read
Algorithms
Searching AlgorithmsSearching algorithms are essential tools in computer science used to locate specific items within a collection of data. In this tutorial, we are mainly going to focus upon searching in an array. When we search an item in an array, there are two most common algorithms used based on the type of input
2 min read
Sorting AlgorithmsA Sorting Algorithm is used to rearrange a given array or list of elements in an order. For example, a given array [10, 20, 5, 2] becomes [2, 5, 10, 20] after sorting in increasing order and becomes [20, 10, 5, 2] after sorting in decreasing order. There exist different sorting algorithms for differ
3 min read
Introduction to RecursionThe process in which a function calls itself directly or indirectly is called recursion and the corresponding function is called a recursive function. A recursive algorithm takes one step toward solution and then recursively call itself to further move. The algorithm stops once we reach the solution
14 min read
Greedy AlgorithmsGreedy algorithms are a class of algorithms that make locally optimal choices at each step with the hope of finding a global optimum solution. At every step of the algorithm, we make a choice that looks the best at the moment. To make the choice, we sometimes sort the array so that we can always get
3 min read
Graph AlgorithmsGraph is a non-linear data structure like tree data structure. The limitation of tree is, it can only represent hierarchical data. For situations where nodes or vertices are randomly connected with each other other, we use Graph. Example situations where we use graph data structure are, a social net
3 min read
Dynamic Programming or DPDynamic Programming is an algorithmic technique with the following properties.It is mainly an optimization over plain recursion. Wherever we see a recursive solution that has repeated calls for the same inputs, we can optimize it using Dynamic Programming. The idea is to simply store the results of
3 min read
Bitwise AlgorithmsBitwise algorithms in Data Structures and Algorithms (DSA) involve manipulating individual bits of binary representations of numbers to perform operations efficiently. These algorithms utilize bitwise operators like AND, OR, XOR, NOT, Left Shift, and Right Shift.BasicsIntroduction to Bitwise Algorit
4 min read
Advanced
Segment TreeSegment Tree is a data structure that allows efficient querying and updating of intervals or segments of an array. It is particularly useful for problems involving range queries, such as finding the sum, minimum, maximum, or any other operation over a specific range of elements in an array. The tree
3 min read
Pattern SearchingPattern searching algorithms are essential tools in computer science and data processing. These algorithms are designed to efficiently find a particular pattern within a larger set of data. Patten SearchingImportant Pattern Searching Algorithms:Naive String Matching : A Simple Algorithm that works i
2 min read
GeometryGeometry is a branch of mathematics that studies the properties, measurements, and relationships of points, lines, angles, surfaces, and solids. From basic lines and angles to complex structures, it helps us understand the world around us.Geometry for Students and BeginnersThis section covers key br
2 min read
Interview Preparation
Practice Problem