| Oleyl alcohol[1] | |
|---|---|
 |
|
|
(Z)-Octadec-9-en-1-ol |
|
|
Other names
Octadecenol |
|
| Identifiers | |
| CAS number | 143-28-2  |
| PubChem | 5284499 |
| ChemSpider | 4447562 |
| UNII | 172F2WN8DV |
| KEGG | D05245 |
| Jmol-3D images | Image 1 |
|
|
|
|
| Properties | |
| Molecular formula | C18H36O |
| Molar mass | 268.478 g/mol |
| Density | 0.845-0.855 g/cm3 |
| Melting point |
13-19 °C |
| Boiling point |
330-360 °C |
| Solubility in water | Insoluble |
| Hazards | |
| NFPA 704 |
 0
1
0
|
 (verify) (what is:  / ?)Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
|
| Infobox references | |
Oleyl alcohol, octadecenol, or cis-9-octadecen-1-ol, is a fatty alcohol coming from inedible beef fat. It is also found in fish oil. Its chemical formula is C18H36O or CH3(CH2)7-CH=CH-(CH2)8OH.
It is a non-ionic, unsaturated fatty alcohol.
It has uses as a nonionic surfactant, emulsifier, emollient and thickener in skin creams, lotions and many other cosmetic products, plasticizer for softening fabrics, surfactant and hair coating in shampoos and hair conditioners, and a carrier for medications.[2]
References [link]
- ^ Chemicalland21.com
- ^ Record in the Household Products Database of NLM
