Mephenytoin: Difference between revisions
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Entranced98 (talk | contribs) +sd |
||
| (21 intermediate revisions by 15 users not shown) | |||
| Line 1: | Line 1: | ||
{{short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 459493896 |
||
| IUPAC_name = |
| IUPAC_name = 5-Ethyl-3-methyl-5-phenyl-imidazolidine-2,4-dione |
||
| image = Mephenytoin.svg |
| image = Mephenytoin.svg |
||
| alt = Structural formula of mephenytoin |
|||
| width = |
| width = 135 |
||
| image2 = Mephenytoin 3D spacefill.png |
|||
| alt2 = Space-filling model of the mephenytoin molecule |
|||
| width2 = 160 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{drugs.com|CONS|mephenytoin}} |
| Drugs.com = {{drugs.com|CONS|mephenytoin}} |
||
| MedlinePlus = a611020 |
| MedlinePlus = a611020 |
||
| pregnancy_US = C |
| pregnancy_US = C |
||
| ⚫ | |||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| ⚫ | |||
| ⚫ | |||
| elimination_half-life = 7 hours |
| elimination_half-life = 7 hours |
||
| ⚫ | |||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 7223 |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 50-12-4 |
| CAS_number = 50-12-4 |
||
| ATC_prefix = N03 |
| ATC_prefix = N03 |
||
| ATC_suffix = AB04 |
| ATC_suffix = AB04 |
||
| ⚫ | |||
| PubChem = 4060 |
| PubChem = 4060 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| Line 34: | Line 45: | ||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=12 | H=14 | N=2 | O=2 |
| C=12 | H=14 | N=2 | O=2 |
||
| molecular_weight = 218.252 |
|||
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C |
| smiles = O=C2N(C(=O)NC2(c1ccccc1)CC)C |
||
| InChI = 1/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
|||
| InChIKey = GMHKMTDVRCWUDX-UHFFFAOYAK |
|||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
| StdInChI = 1S/C12H14N2O2/c1-3-12(9-7-5-4-6-8-9)10(15)14(2)11(16)13-12/h4-8H,3H2,1-2H3,(H,13,16) |
||
| Line 44: | Line 52: | ||
| StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N |
| StdInChIKey = GMHKMTDVRCWUDX-UHFFFAOYSA-N |
||
}} |
}} |
||
<!-- |
|||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
| ⚫ | |||
--> |
|||
'''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a [[hydantoin]], used as an [[anticonvulsant]]. It was introduced approximately 10 years after [[phenytoin]], in the late 1940s. The significant [[metabolite]] of mephenytoin is [[nirvanol]] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a [[hypnotic]]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood [[dyscrasia]] in 1% of patients. |
'''Mephenytoin''' (marketed as '''Mesantoin''' by Novartis) is a [[hydantoin]], used as an [[anticonvulsant]]. It was introduced approximately 10 years after [[phenytoin]], in the late 1940s. The significant [[metabolite]] of mephenytoin is [[nirvanol]] (5-ethyl-5-phenylhydantoin), which was the first hydantoin (briefly used as a [[hypnotic]]). However, nirvanol is quite toxic and mephenytoin was only considered after other less toxic anticonvulsants had failed. It can cause potentially fatal blood [[dyscrasia]] in 1% of patients. |
||
| Line 56: | Line 58: | ||
==References== |
==References== |
||
{{refbegin}} |
|||
* ''The Treatment of Epilepsy'' edited by S. D. Shorvon, David R. Fish, Emilio Perucca, W. Edwin Dodson. Blackwell Publishing. 2004. ISBN 0-632-06046-8 |
|||
* |
* {{cite book | title = The Treatment of Epilepsy | veditors = Shorvon SD, Fish DR, Perucca E, Dodson WE | publisher = Blackwell Publishing | date = 2004 | isbn = 0-632-06046-8 }} |
||
* {{cite book | title = The Medical Treatment of Epilepsy | vauthors = Resor SR | publisher = Marcel Dekker | date = 1991 | isbn = 0-8247-8549-5 }} |
|||
* |
* {{cite web | url = http://ctdbase.org/detail.go?type=chem&acc=D008617 | work = The Comparative Toxicogenomics Database | title = Mephenytoin }} |
||
{{refend}} |
|||
{{Anticonvulsants}} |
{{Anticonvulsants}} |
||