Benzobarbital: Difference between revisions
Content deleted Content added
added CSID, (Std)InChI & (Std)InChIKey |
Citation bot (talk | contribs) Altered journal. | Use this bot. Report bugs. | Suggested by Whoop whoop pull up | Category:Barbiturates | #UCB_Category 36/61 |
||
| (22 intermediate revisions by 17 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| ⚫ | |||
| Watchedfields = changed |
|||
| ⚫ | |||
| IUPAC_name = 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| IUPAC_name = 1-benzoyl-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
||
| image = Benzobarbital. |
| image = Benzobarbital.svg |
||
| width = |
| width = 175 |
||
| image2 = Benzobarbital ball-and-stick.png |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Line 27: | Line 30: | ||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 744-80-9 |
| CAS_number = 744-80-9 |
||
| ATC_prefix = |
| ATC_prefix = none |
||
| ATC_suffix = |
| ATC_suffix = |
||
| PubChem = 12938 |
| PubChem = 12938 |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1338506 |
|||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| Line 35: | Line 40: | ||
| UNII = YNJ78BD0AH |
| UNII = YNJ78BD0AH |
||
| synonyms = Benzonal |
| synonyms = Benzonal |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|||
| |
| ChemSpiderID = 12402 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=19 | H=16 | N=2 | O=4 |
| C=19 | H=16 | N=2 | O=4 |
||
| molecular_weight = 336.341 g/mol |
|||
| smiles = CCC1(C(=O)NC(=O)N(C1=O)C(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
| smiles = CCC1(C(=O)NC(=O)N(C1=O)C(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|||
| |
| StdInChI = 1S/C19H16N2O4/c1-2-19(14-11-7-4-8-12-14)16(23)20-18(25)21(17(19)24)15(22)13-9-5-3-6-10-13/h3-12H,2H2,1H3,(H,20,23,25) |
||
| InChIKey = QMOWPJIFTHVQMB-UHFFFAOYAE |
|||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|||
| StdInChI = 1S/C19H16N2O4/c1-2-19(14-11-7-4-8-12-14)16(23)20-18(25)21(17(19)24)15(22)13-9-5-3-6-10-13/h3-12H,2H2,1H3,(H,20,23,25) |
|||
| |
| StdInChIKey = QMOWPJIFTHVQMB-UHFFFAOYSA-N |
||
}} |
}} |
||
'''Benzobarbital''' (Benzonal) is a [[barbiturate]] derivative. It has [[anticonvulsant]] effects and has been used for the treatment of [[epilepsy]]. |
'''Benzobarbital''' (Benzonal) is a [[barbiturate]] derivative. It has [[anticonvulsant]] effects and has been used for the treatment of [[epilepsy]]. |
||
<ref>{{cite journal | vauthors = Okudzhava VM, Chankvetadze BG | title = [Pharmacological characteristics of an anti-convulsive drug Benzonal and the evaluation of its therapeutic effectiveness (review of the literature)] | language = russian | journal = Zhurnal Nevropatologii I Psikhiatrii imeni S.S. Korsakova | volume = 89 | issue = 11 | pages = 136–45 | year = 1989 | pmid = 2696306 }}</ref> |
|||
<ref>{{ cite pmid | 2696306 }}</ref> |
|||
It has similar liver enzyme inducing effects to the closely related drug [[phenobarbital]], which may be exploited in some clinical applications. |
It has similar liver enzyme inducing effects to the closely related drug [[phenobarbital]], which may be exploited in some clinical applications. |
||
<ref>{{cite journal | vauthors = Nadzhimutdinov KN, Khakimov ZZ, Kabulov S | title = [The advantages of benzonal as an inducer of the liver mono-oxygenase enzyme system compared to phenobarbital] | language = russian | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | volume = 55 | issue = 1 | pages = 68–71 | year = 1992 | pmid = 1305441 }}</ref> |
|||
<ref>{{ cite pmid | 1305441 }}</ref> |
|||
<ref>{{cite journal | vauthors = Novozheeva TP, Saratikov AS, Grishanova AI, Gutkina NI, Akhmedzhanov RR, Khatsenko OG, Kozlovskaia NE | title = [Benzonal--a phenobarbital-type of inducer of the mono-oxygenase system] | language = russian | journal = Biulleten' Eksperimental'noi Biologii I Meditsiny | volume = 111 | issue = 2 | pages = 163–5 | date = February 1991 | pmid = 1854958 | oclc = 613807502 }}</ref> |
|||
<ref>{{ cite pmid | 1854958 }}</ref> |
|||
== References == |
== References == |
||
{{reflist}} |
{{reflist}} |
||
{{barbiturates}} |
|||
{{Hypnotics and sedatives}} |
{{Hypnotics and sedatives}} |
||
{{GABAAR PAMs}} |
|||
| ⚫ | |||
| ⚫ | |||
{{sedative-stub}} |
{{sedative-stub}} |
||