Cilastatin: Difference between revisions
m size |
Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[us |
||
| Line 26: | Line 26: | ||
| ATC_supplemental = |
| ATC_supplemental = |
||
| PubChem = 5280454 |
| PubChem = 5280454 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
| DrugBank = EXPT00918 |
| DrugBank = EXPT00918 |
||
| KEGG_Ref = {{keggcite|changed|kegg}} |
| KEGG_Ref = {{keggcite|changed|kegg}} |
||
Revision as of 05:27, 7 August 2011
{{drugbox
| Verifiedfields = changed
| verifiedrevid = 396313475
| IUPAC_name = (Z)-7-[(2R)-2-amino-3-hydroxy-3-oxopropyl]sulfanyl-2-{[(1S)-
2,2-dimethylcyclopropanecarbonyl]amino}hept-2-enoic acid
| image = Cilastatin Structural Formulae.png
| width = 250px
| ChemSpiderID_Ref = 
| ChemSpiderID = 4940183
| UNII_Ref =
| UNII = 141A6AMN38
| ChEMBL_Ref = 
| ChEMBL = 766
| InChI = 1/C16H26N2O5S/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/t10-,11+/m1/s1
| smiles = O=C(N\C(=C/CCCCSC[C@@H](C(=O)O)N)C(=O)O)[C@H]1CC1(C)C
| InChIKey = DHSUYTOATWAVLW-MNOVXSKEBN
| CASNo_Ref =
| InChI1 = 1/C16H26N2O5S/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/b12-6-/t10-,11+/m1/s1
| InChIKey1 = DHSUYTOATWAVLW-WFVMDLQDBJ
| StdInChI_Ref =
| StdInChI = 1S/C16H26N2O5S/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/b12-6-/t10-,11+/m1/s1
| StdInChIKey_Ref =
| StdInChIKey = DHSUYTOATWAVLW-WFVMDLQDSA-N
| CAS_number = 82009-34-5
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| PubChem = 5280454
| DrugBank_Ref =
| DrugBank = EXPT00918
| KEGG_Ref =
| KEGG = D07698
| C=16|H=26|N=2|O=5|S=1
| molecular_weight = 358.454 g/mol
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
}}
Cilastatin is a chemical compound which inhibits the human enzyme dehydropeptidase.[1]
Dehydropeptidase is found in the kidney and is responsible for degrading the antibiotic imipenem. Cilastatin is therefore combined intravenously with imipenem in order to protect it from dehydropeptidase and prolong its antibacterial effect. However, cilastatin itself does not have antibiotic activity.
Another carbapenem, meropenem is resistant to dehydropeptidase; therefore, it can be given without cilastatin.
References
- ^ Keynan S, Hooper NM, Felici A, Amicosante G, Turner AJ (1995). "The renal membrane dipeptidase (dehydropeptidase I) inhibitor, cilastatin, inhibits the bacterial metallo-beta-lactamase enzyme CphA". Antimicrob. Agents Chemother. 39 (7): 1629–31. PMC 162797. PMID 7492120.
{{cite journal}}: CS1 maint: multiple names: authors list (link)