Xem mã nguồn của Docusate

{{Mồ côi|date=tháng 7 2020}}
{{Infobox drug
| drug_name     = Docusate sodium
| IUPAC_name    = Sodium 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate
| image       = Docusate2DCSD.svg
| width       = 250px
| alt        = 
| caption      =
<!-- Clinical data -->
| tradename     = Colace, Ex-Lax, Senokot S
| class       = [[Stool softener]]
| Drugs.com     = {{drugs.com|monograph|Docusate_Salts}}
| MedlinePlus    = a601113
| pregnancy_AU   = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment = 
| pregnancy_US   = C

| pregnancy_US_comment = <ref name=Nurse2013>{{chú thích sách|title=2013 Nurse's Drug Handbook.|date=2013|publisher=Jones & Bartlett Learning|location=Burlington, MA|isbn=9781449642846|page=366|url=https://books.google.ca/books?id=ckdTGZe7aRAC&pg=PA366}}</ref>
| pregnancy_category= 
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_NZ = <!--Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_status   = 
| routes_of_administration = [[Oral administration|By mouth]] hoặc [[Rectal administration|rectally]]

<!-- Pharmacokinetic data -->
| bioavailability  = 
| protein_bound   = 
| metabolism    = 
| metabolites    =
| onset       = 12 hrs to 5 days<ref name=AHFS2015/>
| elimination_half-life = 
| duration_of_action = 3 days<ref name=AHFS2015/>
| excretion     =

<!-- Identifiers -->
| CAS_number    = 577-11-7
| CAS_supplemental = 
| ATCvet      = 
| ATC_prefix    = A06
| ATC_suffix    = AA02
| ATC_supplemental = 
| PubChem      = 23673837
| PubChemSubstance = 
| IUPHAR_ligand   = 
| DrugBank     = 
| ChemSpiderID   = 10861
| UNII       = F05Q2T2JA0
| KEGG       = 
| ChEBI       = 
| ChEMBL      = 
| NIAID_ChemDB   =
| synonyms     =

<!-- Chemical data -->
| chemical_formula =
| C=20 | H=37 | Na=1 | O=7 | S=1
| molecular_weight = 444.56 g/mol
| SMILES      = [Na+].[O-]S(=O)(=O)C(C(=O)OCC(CC)CCCC)CC(=O)OCC(CC)CCCC
| StdInChI     = 1S/C20H38O7S.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1
| StdInChI_comment = 
| StdInChIKey    = APSBXTVYXVQYAB-UHFFFAOYSA-M
| density      = 1.1
| melting_point   = 153 to 157
| melting_high   = 
| melting_notes   = 
| boiling_point   = 
| boiling_notes   = 
| solubility    = 1 in 70 parts
| specific_rotation =
| sec_combustion  = 
}}
'''Docusate''', còn được biết là '''muối docusate''' hoặc '''dioctyl sulfosuccinate''',<ref name=Name2015>{{chú thích web|author1=American Society of Health-System Pharmacists|title=Stool Softeners|url=https://www.nlm.nih.gov/medlineplus/druginfo/meds/a601113.html|date=ngày 15 tháng 8 năm 2011|url-status=live|archiveurl=https://web.archive.org/web/20150905130954/https://www.nlm.nih.gov/medlineplus/druginfo/meds/a601113.html|archivedate=ngày 5 tháng 9 năm 2015|df=}}</ref> là thuốc nhuận tràng thuốc nhóm thuốc làm mềm phân được dùng để điều trị [[táo bón]].<ref name=AHFS2015/> Thuốc là một lựa chọn tốt cho trẻ em có phân cứng.<ref name=AHFS2015>{{chú thích web|title=Docusate Salts|url=https://www.drugs.com/monograph/docusate-salts.html|publisher=The American Society of Health-System Pharmacists|access-date =Aug 11, 2015|url-status=live|archiveurl=https://web.archive.org/web/20150923232735/http://www.drugs.com/monograph/docusate-salts.html|archivedate=ngày 23 tháng 9 năm 2015|df=}}</ref> Khi táo bón xảy ra như là một tác dụng phụ của dùng nhóm thuốc opiate (có nguồn gốc từ thuốc phiện), thuốc có thể được dùng một mình hoặc cùng với thuốc nhuận tràng kích thích. Thuốc có thể dùng dưới dạng viên nang bằng đường miệng hoặc viên đạn trực tràng. Thông thường thuốc có tác dụng trong vòng một đến ba ngày.

Tác dụng phụ không phổ biến. Hiếm khi, có triệu chứng đau bụng hoặc [[tiêu chảy]]. Hiệu quả giảm khi dùng lâu dài và dẫn đến chức năng ruột kém. Docusate được chấp nhận sử dụng trong khi [[Thai nghén|mang thai]] và [[Nuôi con bằng sữa mẹ|cho con bú]].<ref>{{chú thích sách|last1=Yaffe|first1=Sumner J.|title=Drugs in pregnancy and lactation: a reference guide to fetal and neonatal risk|date=2011|publisher=Wolters Kluwer Health/Lippincott Williams & Wilkins|location=Philadelphia|isbn=9781608317080|page=1651|edition=9|url=https://books.google.ca/books?id=OIgTE4aynrMC&pg=PA1651}}</ref> Thuốc hoạt động bằng cách cho phép nhiều nước được hấp thụ bởi phân. Thuốc thường có dạng [[natri]], [[calci]] hoặc muối [[kali]].

Thuốc nằm trong [[Danh sách các thuốc thiết yếu của WHO]], những loại thuốc hiệu quả và an toàn nhất cần thiết trong một [[hệ thống y tế]].<ref name=WHO19th>{{chú thích web|title=WHO Model List of Essential Medicines (19th List)|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|work=World Health Organization|access-date =ngày 8 tháng 12 năm 2016|date=April 2015|url-status=live|archiveurl=https://web.archive.org/web/20161213052708/http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|archivedate=ngày 13 tháng 12 năm 2016|df=}}</ref> Thuốc có sẵn dưới dạng [[thuốc gốc]] và không quá tốn kém.<ref name=Ric2013>{{chú thích sách|last1=Hamilton|first1=Richard J.|title=Tarascon pocket pharmacopoeia: 2013 classic shirt-pocket edition|date=2013|publisher=Jones & Bartlett Learning|location=Burlington, Ma.|isbn=9781449665869|page=112|edition=27|url=https://books.google.ca/books?id=lwueJ4IAl4oC&pg=PA112}}</ref> Tại Hoa Kỳ, một trăm liều có giá khoảng 14 USD. Muối natri, dioctyl sodium sulfosuccinate, cũng được sử dụng làm [[phụ gia thực phẩm]], [[Nhũ tương|chất nhũ tương]], chất phân tán, [[Chất hoạt động bề mặt|chất tẩm ướt]] và một số tác dụng khác.<ref>{{chú thích sách|last1=Michael|first1=fcompiled by|last2=Ash|first2=Irene|title=Handbook of preservatives|date=2004|publisher=Synapse information resources|location=Endicott, N.Y.|isbn=9781890595661|page=375|url=https://books.google.ca/books?id=XZ2QB7bu5LwC&pg=PA375}}</ref>

==Tham khảo==
{{tham khảo|32em}}

[[Thể loại:Acid sulfonic]]
[[Thể loại:Thuốc thiết yếu của WHO]]
[[Thể loại:RTT]]