Lesopitron
{{Drugbox-lat | IUPAC_name = 2-{4-[4-(4-hloro-1H-pirazol-1-il)butil]piperazin-1-il}pirimidin | image = Lesopitron.png | width = | image2 = | width2 =
| tradename = | pregnancy_category = | legal_status = Nije kontrolisana supstanca | routes_of_administration = Oralno
| bioavailability = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 132449-46-8 | ATC_prefix = none | ATC_suffix = | PubChem = 60813 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = | DrugBank = | ChemSpiderID = 54801 | UNII_Ref = | UNII = H1CGM4755H
| C=15 | H=21 | Cl=1 | N=6 | molecular_weight = 320,82 g/mol | smiles = Clc1cn(nc1)CCCCN3CCN(c2ncccn2)CC3 | StdInChI_Ref = | StdInChI = | StdInChIKey_Ref = | StdInChIKey = }}
Lesopitron (E-4424) je selektivni pun agonist 5-HT1A receptora koji je strukturno srodan sa azapironima.[1] On je bio u razvoju kao anksiolitik za tretman generalizovanog anksioznog poremećaja.[2][3] Dospeo je do faze II kliničkih ispitivanja, ali je razvoj prekinut.[2][3]
Reference
уреди- ^ Haj-Dahmane S; Jolas T; Laporte AM; et al. (1994). „Interactions of lesopitron (E-4424) with central 5-HT1A receptors: in vitro and in vivo studies in the rat”. European Journal of Pharmacology. 255 (1-3): 185—96. PMID 8026543. doi:10.1016/0014-2999(94)90097-3.
- ^ а б Micheli F (2001). „Lesopitron (Esteve)”. IDrugs : the Investigational Drugs Journal. 4 (2): 218—24. PMID 16032484.
- ^ а б Fresquet A; Sust M; Lloret A; et al. (2000). „Efficacy and safety of lesopitron in outpatients with generalized anxiety disorder”. The Annals of Pharmacotherapy. 34 (2): 147—53. PMID 10676820.[мртва веза]