Bupranolol – razlika između verzija
m . |
m + |
||
| Red 12: | Red 12: | ||
<!-- Clinical data --> |
<!-- Clinical data --> |
||
| tradename = -{Adomed, Betadrenol, Ophtorenin |
| tradename = -{Adomed, Betadrenol, Ophtorenin |
||
| Drugs.com = {{drugs.com-lat|monograph|Bupranolol}} |
| Drugs.com = {{drugs.com-lat|monograph|Bupranolol}} |
||
| MedlinePlus = |
| MedlinePlus = |
||
| Red 80: | Red 80: | ||
| sec_combustion = |
| sec_combustion = |
||
}} |
}} |
||
'''Bupranolol''' je [[organsko jedinjenje]], koje sadrži 14 [[atom]]a [[ugljenik]]a i ima [[Молекулска маса|molekulsku masu]] od 271,783 [[Јединица атомске масе|-{Da |
'''Bupranolol''' je [[organsko jedinjenje]], koje sadrži 14 [[atom]]a [[ugljenik]]a i ima [[Молекулска маса|molekulsku masu]] od 271,783 [[Јединица атомске масе|-{Da]].<ref>{{Cite pmid|21059682|noedit}}</ref><ref>{{cite pmid|18048412|noedit}}</ref> |
||
== Osobine == |
== Osobine == |
||
| Red 93: | Red 93: | ||
| [[Геометрија молекула|Broj rotacionih veza]] || 6 |
| [[Геометрија молекула|Broj rotacionih veza]] || 6 |
||
|- |
|- |
||
| [[Particioni koeficijent]]<ref>{{cite doi/10.1021/jp980230o|noedit}}</ref> (-{''ALogP'') |
| [[Particioni koeficijent]]<ref>{{cite doi/10.1021/jp980230o|noedit}}</ref> (-{''ALogP'') || 3,0 |
||
|- |
|- |
||
| [[Rastvorljivost]]<ref>{{cite pmid|11749573|noedit}}</ref> (-{''logS'', log(''mol/L'' |
| [[Rastvorljivost]]<ref>{{cite pmid|11749573|noedit}}</ref> (-{''logS'', log(''mol/L'')) || -4,3 |
||
|- |
|- |
||
| [[Polarna površina molekula|Polarna površina]]<ref>{{cite pmid|11020286|noedit}}</ref> (-{''PSA'' |
| [[Polarna površina molekula|Polarna površina]]<ref>{{cite pmid|11020286|noedit}}</ref> (-{''PSA'', [[Ангстрем (јединица)|Å<sup>2</sup>]]) || 41,5 |
||
|} |
|} |
||
| Red 111: | Red 111: | ||
{{Portal-lat|Medicina|Hemija}} |
{{Portal-lat|Medicina|Hemija}} |
||
{{Commonscat-lat|Bupranolol}} |
{{Commonscat-lat|Bupranolol}} |
||
* [http://www.drugbank.ca/drugs/DB08808 -{Bupranolol |
* [http://www.drugbank.ca/drugs/DB08808 -{Bupranolol] |
||
{{Medicinsko upozorenje-lat}} |
{{Medicinsko upozorenje-lat}} |
||
Verzija od 7. aprila 2014. u 02:55
{{Drugbox-lat | IUPAC_name = | image = Bupranolol.svg | width = | alt = | image2 = | width2 = | alt2 = | imagename = | drug_name = Bupranolol | caption =
| tradename = -{Adomed, Betadrenol, Ophtorenin | Drugs.com = Monografija | MedlinePlus = | licence_EU = | licence_US = | DailyMedID = | pregnancy_AU = | pregnancy_US = | pregnancy_category= | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | dependency_liability = | routes_of_administration = Oftalmički, oralno
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = 2-4 h | excretion =
| CAS_number_Ref = 
| CAS_number = 23284-25-5
| CAS_supplemental =
| ATCvet =
| ATC_prefix = C07
| ATC_suffix = AA19
| ATC_supplemental =
| PubChem = 2475
| PubChemSubstance =
| IUPHAR_ligand = 550
| DrugBank_Ref = Šablon:Drugbankcite
| DrugBank = DB08808
| ChemSpiderID_Ref =
| ChemSpiderID = 2381
| UNII_Ref =
| UNII =
| KEGG_Ref =
| KEGG =
| ChEBI_Ref =
| ChEBI = 200929
| ChEMBL_Ref =
| ChEMBL = 305380
| synonyms =
|C=14 |H=22 |Cl=1 |N=1 |O=2
| molecular_weight = 271,783
| smiles = CC1=CC(OCC(O)CNC(C)(C)C)=C(Cl)C=C1
| StdInChI = 1S/C14H22ClNO2/c1-10-5-6-12(15)13(7-10)18-9-11(17)8-16-14(2,3)4/h5-7,11,16-17H,8-9H2,1-4H3
| StdInChIKey_Ref =
| StdInChI_comment =
| StdInChIKey = HQIRNZOQPUAHHV-UHFFFAOYSA-N
| StdStdInChI_Ref =
| density =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| specific_rotation =
| sec_combustion =
}}
Bupranolol je organsko jedinjenje, koje sadrži 14 atoma ugljenika i ima molekulsku masu od 271,783 -{Da.[1][2]
Osobine
| Osobina | Vrednost |
|---|---|
| Broj akceptora vodonika | 3 |
| Broj donora vodonika | 2 |
| Broj rotacionih veza | 6 |
| Particioni koeficijent[3] (-{ALogP) | 3,0 |
| Rastvorljivost[4] (-{logS, log(mol/L)) | -4,3 |
| Polarna površina[5] (-{PSA, Å2) | 41,5 |
Reference
- ↑ Knox C, Law V, Jewison T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS (2011). „DrugBank 3.0: a comprehensive resource for omics research on drugs”. Nucleic Acids Res. 39 (Database issue): D1035-41. DOI:10.1093/nar/gkq1126. PMC 3013709. PMID 21059682.
- ↑ David S. Wishart, Craig Knox, An Chi Guo, Dean Cheng, Savita Shrivastava, Dan Tzur, Bijaya Gautam, and Murtaza Hassanali (2008). „DrugBank: a knowledgebase for drugs, drug actions and drug targets”. Nucleic Acids Res 36 (Database issue): D901-6. DOI:10.1093/nar/gkm958. PMC 2238889. PMID 18048412.
- ↑ Ghose, A.K., Viswanadhan V.N., and Wendoloski, J.J. (1998). „Prediction of Hydrophobic (Lipophilic) Properties of Small Organic Molecules Using Fragment Methods: An Analysis of AlogP and CLogP Methods”. J. Phys. Chem. A 102: 3762-3772. DOI:10.1021/jp980230o.
- ↑ Tetko IV, Tanchuk VY, Kasheva TN, Villa AE. (2001). „Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices”. Chem Inf. Comput. Sci. 41: 1488-1493. DOI:10.1021/ci000392t. PMID 11749573.
- ↑ Ertl P., Rohde B., Selzer P. (2000). „Fast calculation of molecular polar surface area as a sum of fragment based contributions and its application to the prediction of drug transport properties”. J. Med. Chem. 43: 3714-3717. DOI:10.1021/jm000942e. PMID 11020286.
Literatura
- Hardman JG, Limbird LE, Gilman AG. (2001). Goodman & Gilman's The Pharmacological Basis of Therapeutics (10 izd.). New York: McGraw-Hill. DOI:10.1036/0071422803. ISBN 0-07-135469-7.
- Thomas L. Lemke, David A. Williams, ur. (2007). Foye's Principles of Medicinal Chemistry (6 izd.). Baltimore: Lippincott Willams & Wilkins. ISBN 0-7817-6879-9.
