Lihat sumber bagi Striknina

{{chembox
| Watchedfields =  changed
| verifiedrevid = 470471685
| ImageFile = Strychnine.svg
| ImageSize = 180
| ImageFile1 = Strychnine-from-xtal-3D-balls.png
| IUPACName =
| OtherNames =Strychnidin-10-one<ref>Retrieved from SciFinder. [May 7, 2018]</ref>
| Section1 = {{Chembox Identifiers
| IUPHAR_ligand = 347
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 389877
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = H9Y79VD43J
| InChI = 1/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| InChIKey = QMGVPVSNSZLJIA-FVWCLLPLBR
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H22N2O2/c24-18-10-16-19-13-9-17-21(6-7-22(17)11-12(13)5-8-25-16)14-3-1-2-4-15(14)23(18)20(19)21/h1-5,13,16-17,19-20H,6-11H2/t13-,16-,17-,19-,20-,21+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QMGVPVSNSZLJIA-FVWCLLPLSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=57-24-9
| CASNo_Comment = (base)
| CASNo1_Ref = {{cascite|correct|??}}
| CASNo1 = 60-41-3
| CASNo1_Comment = (sulfate)
| PubChem = 441071
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 227934
| ChEMBL2_Ref = {{ebicite|correct|EBI}}
| ChEMBL2 = 612118
| ChEMBL3_Ref = {{ebicite|correct|EBI}}
| ChEMBL3 = 486399
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C06522
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 28973
| SMILES = O=C7N2c1ccccc1[C@@]64[C@@H]2[C@@H]3[C@@H](OC/C=C5\[C@@H]3C[C@@H]6N(CC4)C5)C7
| RTECS = WL2275000
| UNNumber = 1692
  }}

| Section2 = {{Chembox Properties
| C=21 | H=22 | N=2 | O=2
| Odor = Odorless
| Appearance = White or translucent crystal or crystalline powder; Bitter tasting
| Density = 1.36 g cm<sup>−3</sup>
| BoilingPtK = 557 to 559
| MeltingPtK = 543
| pKa = 8.25<ref name="Everett1957">{{cite journal |doi=10.1039/JR9570001120 |title=The constitution of aspidospermine. Part III. Reactivity at the nitrogen atoms, and biogenetic considerations |journal=Journal of the Chemical Society |pages=1120–3 |year=1957 |last1=Everett |first1=A. J. |last2=Openshaw |first2=H. T. |last3=Smith |first3=G. F. }}</ref>
| Solubility = 0.02% (20°C)<ref name=PGCH/>
  }}

| Section3 = {{Chembox Hazards
| MainHazards = Very toxic
| GHSPictograms = {{GHS06}}{{GHS09}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|300|310|330|410}}
| PPhrases = {{P-phrases|260|264|273|280|284|301+310}}
| NFPA-H = 4
| NFPA-F = 0
| NFPA-R = 0
| FlashPt = Non flammable.
| AutoignitionPt = Non flammable.
| IDLH = 3 mg/m<sup>3</sup><ref name=PGCH>{{PGCH|0570}}</ref>
| PEL = TWA 0.15 mg/m<sup>3</sup><ref name=PGCH/>
| REL = TWA 0.15 mg/m<sup>3</sup><ref name=PGCH/>
| LD50 = 0.5 mg/kg (dog, oral)<br />0.5 mg/kg (cat, oral)<br />2 mg/kg (mouse, oral)<br />16 mg/kg (rat, oral)<br />2.35 (rat, oral)<ref name=IDLH>{{IDLH|57249|Strychnine}}</ref>
| LDLo = 0.6 mg/kg (rabbit, oral)<ref name=IDLH/>
  }}
}}

'''Striknina''' merupakan sejenis bahan [[alkaloid]] [[hablur]] yang [[toksik]], berwarna hening dan berasa pahit, digunakan sebagai [[pestisid]] khusus untuk membasmi [[vertebrat]] kecil seperti [[burung]] dan [[rodensia]]. Jika disedut, ditelan atau diserap melalui mata atau mulut, bahan ini menyebabkan keracunan yang mengakibatkan [[konvulsi|kekejangan otot]] dan akhirnya maut daripada [[asfiksia]].<ref name="sharma">Sharma, R. K., ''Consice textbook of forensic medicine & toxicology'', Elsevier, 2008</ref>  Biarpun tiada kesan perubahan yang diketahui, pada zaman dahulu kesan pengejang itu dipercayai mendatangkan faedah jika diambil secara kecil-kecilan. Sumber paling utama ialah benih-benih daripada pokok ''[[Strychnos nux-vomica]]''.

==Rujukan==
{{reflist}}

{{Tunas-kimia}}

{{Agen kimia}}
{{Toksin}}
{{Neurotoksin}}

[[Category:Toksin tumbuhan]]
[[Category:Konvulsan]]
[[Category:Laktam]]
[[Category:Alkaloid indola]]
[[Category:Avisida]]
[[Category:Sebatian pahit]]
[[Category:Eter]]
[[Category:Neurotoksin]]