/*------------------------------------------------------------------------- * slotsync.c * Functionality for synchronizing slots to a standby server from the * primary server. * * Copyright (c) 2024-2025, PostgreSQL Global Development Group * * IDENTIFICATION * src/backend/replication/logical/slotsync.c * * This file contains the code for slot synchronization on a physical standby * to fetch logical failover slots information from the primary server, create * the slots on the standby and synchronize them periodically. * * Slot synchronization can be performed either automatically by enabling slot * sync worker or manually by calling SQL function pg_sync_replication_slots(). * * If the WAL corresponding to the remote's restart_lsn is not available on the * physical standby or the remote's catalog_xmin precedes the oldest xid for * which it is guaranteed that rows wouldn't have been removed then we cannot * create the local standby slot because that would mean moving the local slot * backward and decoding won't be possible via such a slot. In this case, the * slot will be marked as RS_TEMPORARY. Once the primary server catches up, * the slot will be marked as RS_PERSISTENT (which means sync-ready) after * which slot sync worker can perform the sync periodically or user can call * pg_sync_replication_slots() periodically to perform the syncs. * * If synchronized slots fail to build a consistent snapshot from the * restart_lsn before reaching confirmed_flush_lsn, they would become * unreliable after promotion due to potential data loss from changes * before reaching a consistent point. This can happen because the slots can * be synced at some random time and we may not reach the consistent point * at the same WAL location as the primary. So, we mark such slots as * RS_TEMPORARY. Once the decoding from corresponding LSNs can reach a * consistent point, they will be marked as RS_PERSISTENT. * * The slot sync worker waits for some time before the next synchronization, * with the duration varying based on whether any slots were updated during * the last cycle. Refer to the comments above wait_for_slot_activity() for * more details. * * Any standby synchronized slots will be dropped if they no longer need * to be synchronized. See comment atop drop_local_obsolete_slots() for more * details. *--------------------------------------------------------------------------- */ #include "postgres.h" #include #include "access/xlog_internal.h" #include "access/xlogrecovery.h" #include "catalog/pg_database.h" #include "commands/dbcommands.h" #include "libpq/pqsignal.h" #include "pgstat.h" #include "postmaster/interrupt.h" #include "replication/logical.h" #include "replication/slotsync.h" #include "replication/snapbuild.h" #include "storage/ipc.h" #include "storage/lmgr.h" #include "storage/proc.h" #include "storage/procarray.h" #include "tcop/tcopprot.h" #include "utils/builtins.h" #include "utils/pg_lsn.h" #include "utils/ps_status.h" #include "utils/timeout.h" /* * Struct for sharing information to control slot synchronization. * * The slot sync worker's pid is needed by the startup process to shut it * down during promotion. The startup process shuts down the slot sync worker * and also sets stopSignaled=true to handle the race condition when the * postmaster has not noticed the promotion yet and thus may end up restarting * the slot sync worker. If stopSignaled is set, the worker will exit in such a * case. The SQL function pg_sync_replication_slots() will also error out if * this flag is set. Note that we don't need to reset this variable as after * promotion the slot sync worker won't be restarted because the pmState * changes to PM_RUN from PM_HOT_STANDBY and we don't support demoting * primary without restarting the server. See LaunchMissingBackgroundProcesses. * * The 'syncing' flag is needed to prevent concurrent slot syncs to avoid slot * overwrites. * * The 'last_start_time' is needed by postmaster to start the slot sync worker * once per SLOTSYNC_RESTART_INTERVAL_SEC. In cases where an immediate restart * is expected (e.g., slot sync GUCs change), slot sync worker will reset * last_start_time before exiting, so that postmaster can start the worker * without waiting for SLOTSYNC_RESTART_INTERVAL_SEC. */ typedef struct SlotSyncCtxStruct { pid_t pid; bool stopSignaled; bool syncing; time_t last_start_time; slock_t mutex; } SlotSyncCtxStruct; static SlotSyncCtxStruct *SlotSyncCtx = NULL; /* GUC variable */ bool sync_replication_slots = false; /* * The sleep time (ms) between slot-sync cycles varies dynamically * (within a MIN/MAX range) according to slot activity. See * wait_for_slot_activity() for details. */ #define MIN_SLOTSYNC_WORKER_NAPTIME_MS 200 #define MAX_SLOTSYNC_WORKER_NAPTIME_MS 30000 /* 30s */ static long sleep_ms = MIN_SLOTSYNC_WORKER_NAPTIME_MS; /* The restart interval for slot sync work used by postmaster */ #define SLOTSYNC_RESTART_INTERVAL_SEC 10 /* * Flag to tell if we are syncing replication slots. Unlike the 'syncing' flag * in SlotSyncCtxStruct, this flag is true only if the current process is * performing slot synchronization. */ static bool syncing_slots = false; /* * Structure to hold information fetched from the primary server about a logical * replication slot. */ typedef struct RemoteSlot { char *name; char *plugin; char *database; bool two_phase; bool failover; XLogRecPtr restart_lsn; XLogRecPtr confirmed_lsn; XLogRecPtr two_phase_at; TransactionId catalog_xmin; /* RS_INVAL_NONE if valid, or the reason of invalidation */ ReplicationSlotInvalidationCause invalidated; } RemoteSlot; static void slotsync_failure_callback(int code, Datum arg); static void update_synced_slots_inactive_since(void); /* * If necessary, update the local synced slot's metadata based on the data * from the remote slot. * * If no update was needed (the data of the remote slot is the same as the * local slot) return false, otherwise true. * * *found_consistent_snapshot will be true iff the remote slot's LSN or xmin is * modified, and decoding from the corresponding LSN's can reach a * consistent snapshot. * * *remote_slot_precedes will be true if the remote slot's LSN or xmin * precedes locally reserved position. */ static bool update_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid, bool *found_consistent_snapshot, bool *remote_slot_precedes) { ReplicationSlot *slot = MyReplicationSlot; bool updated_xmin_or_lsn = false; bool updated_config = false; Assert(slot->data.invalidated == RS_INVAL_NONE); if (found_consistent_snapshot) *found_consistent_snapshot = false; if (remote_slot_precedes) *remote_slot_precedes = false; /* * Don't overwrite if we already have a newer catalog_xmin and * restart_lsn. */ if (remote_slot->restart_lsn < slot->data.restart_lsn || TransactionIdPrecedes(remote_slot->catalog_xmin, slot->data.catalog_xmin)) { /* * This can happen in following situations: * * If the slot is temporary, it means either the initial WAL location * reserved for the local slot is ahead of the remote slot's * restart_lsn or the initial xmin_horizon computed for the local slot * is ahead of the remote slot. * * If the slot is persistent, both restart_lsn and catalog_xmin of the * synced slot could still be ahead of the remote slot. Since we use * slot advance functionality to keep snapbuild/slot updated, it is * possible that the restart_lsn and catalog_xmin are advanced to a * later position than it has on the primary. This can happen when * slot advancing machinery finds running xacts record after reaching * the consistent state at a later point than the primary where it * serializes the snapshot and updates the restart_lsn. * * We LOG the message if the slot is temporary as it can help the user * to understand why the slot is not sync-ready. In the case of a * persistent slot, it would be a more common case and won't directly * impact the users, so we used DEBUG1 level to log the message. */ ereport(slot->data.persistency == RS_TEMPORARY ? LOG : DEBUG1, errmsg("could not synchronize replication slot \"%s\"", remote_slot->name), errdetail("Synchronization could lead to data loss, because the remote slot needs WAL at LSN %X/%08X and catalog xmin %u, but the standby has LSN %X/%08X and catalog xmin %u.", LSN_FORMAT_ARGS(remote_slot->restart_lsn), remote_slot->catalog_xmin, LSN_FORMAT_ARGS(slot->data.restart_lsn), slot->data.catalog_xmin)); if (remote_slot_precedes) *remote_slot_precedes = true; /* * Skip updating the configuration. This is required to avoid syncing * two_phase_at without syncing confirmed_lsn. Otherwise, the prepared * transaction between old confirmed_lsn and two_phase_at will * unexpectedly get decoded and sent to the downstream after * promotion. See comments in ReorderBufferFinishPrepared. */ return false; } /* * Attempt to sync LSNs and xmins only if remote slot is ahead of local * slot. */ if (remote_slot->confirmed_lsn > slot->data.confirmed_flush || remote_slot->restart_lsn > slot->data.restart_lsn || TransactionIdFollows(remote_slot->catalog_xmin, slot->data.catalog_xmin)) { /* * We can't directly copy the remote slot's LSN or xmin unless there * exists a consistent snapshot at that point. Otherwise, after * promotion, the slots may not reach a consistent point before the * confirmed_flush_lsn which can lead to a data loss. To avoid data * loss, we let slot machinery advance the slot which ensures that * snapbuilder/slot statuses are updated properly. */ if (SnapBuildSnapshotExists(remote_slot->restart_lsn)) { /* * Update the slot info directly if there is a serialized snapshot * at the restart_lsn, as the slot can quickly reach consistency * at restart_lsn by restoring the snapshot. */ SpinLockAcquire(&slot->mutex); slot->data.restart_lsn = remote_slot->restart_lsn; slot->data.confirmed_flush = remote_slot->confirmed_lsn; slot->data.catalog_xmin = remote_slot->catalog_xmin; SpinLockRelease(&slot->mutex); if (found_consistent_snapshot) *found_consistent_snapshot = true; } else { LogicalSlotAdvanceAndCheckSnapState(remote_slot->confirmed_lsn, found_consistent_snapshot); /* Sanity check */ if (slot->data.confirmed_flush != remote_slot->confirmed_lsn) ereport(ERROR, errmsg_internal("synchronized confirmed_flush for slot \"%s\" differs from remote slot", remote_slot->name), errdetail_internal("Remote slot has LSN %X/%08X but local slot has LSN %X/%08X.", LSN_FORMAT_ARGS(remote_slot->confirmed_lsn), LSN_FORMAT_ARGS(slot->data.confirmed_flush))); } updated_xmin_or_lsn = true; } if (remote_dbid != slot->data.database || remote_slot->two_phase != slot->data.two_phase || remote_slot->failover != slot->data.failover || strcmp(remote_slot->plugin, NameStr(slot->data.plugin)) != 0 || remote_slot->two_phase_at != slot->data.two_phase_at) { NameData plugin_name; /* Avoid expensive operations while holding a spinlock. */ namestrcpy(&plugin_name, remote_slot->plugin); SpinLockAcquire(&slot->mutex); slot->data.plugin = plugin_name; slot->data.database = remote_dbid; slot->data.two_phase = remote_slot->two_phase; slot->data.two_phase_at = remote_slot->two_phase_at; slot->data.failover = remote_slot->failover; SpinLockRelease(&slot->mutex); updated_config = true; /* * Ensure that there is no risk of sending prepared transactions * unexpectedly after the promotion. */ Assert(slot->data.two_phase_at <= slot->data.confirmed_flush); } /* * We have to write the changed xmin to disk *before* we change the * in-memory value, otherwise after a crash we wouldn't know that some * catalog tuples might have been removed already. */ if (updated_config || updated_xmin_or_lsn) { ReplicationSlotMarkDirty(); ReplicationSlotSave(); } /* * Now the new xmin is safely on disk, we can let the global value * advance. We do not take ProcArrayLock or similar since we only advance * xmin here and there's not much harm done by a concurrent computation * missing that. */ if (updated_xmin_or_lsn) { SpinLockAcquire(&slot->mutex); slot->effective_catalog_xmin = remote_slot->catalog_xmin; SpinLockRelease(&slot->mutex); ReplicationSlotsComputeRequiredXmin(false); ReplicationSlotsComputeRequiredLSN(); } return updated_config || updated_xmin_or_lsn; } /* * Get the list of local logical slots that are synchronized from the * primary server. */ static List * get_local_synced_slots(void) { List *local_slots = NIL; LWLockAcquire(ReplicationSlotControlLock, LW_SHARED); for (int i = 0; i < max_replication_slots; i++) { ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i]; /* Check if it is a synchronized slot */ if (s->in_use && s->data.synced) { Assert(SlotIsLogical(s)); local_slots = lappend(local_slots, s); } } LWLockRelease(ReplicationSlotControlLock); return local_slots; } /* * Helper function to check if local_slot is required to be retained. * * Return false either if local_slot does not exist in the remote_slots list * or is invalidated while the corresponding remote slot is still valid, * otherwise true. */ static bool local_sync_slot_required(ReplicationSlot *local_slot, List *remote_slots) { bool remote_exists = false; bool locally_invalidated = false; foreach_ptr(RemoteSlot, remote_slot, remote_slots) { if (strcmp(remote_slot->name, NameStr(local_slot->data.name)) == 0) { remote_exists = true; /* * If remote slot is not invalidated but local slot is marked as * invalidated, then set locally_invalidated flag. */ SpinLockAcquire(&local_slot->mutex); locally_invalidated = (remote_slot->invalidated == RS_INVAL_NONE) && (local_slot->data.invalidated != RS_INVAL_NONE); SpinLockRelease(&local_slot->mutex); break; } } return (remote_exists && !locally_invalidated); } /* * Drop local obsolete slots. * * Drop the local slots that no longer need to be synced i.e. these either do * not exist on the primary or are no longer enabled for failover. * * Additionally, drop any slots that are valid on the primary but got * invalidated on the standby. This situation may occur due to the following * reasons: * - The 'max_slot_wal_keep_size' on the standby is insufficient to retain WAL * records from the restart_lsn of the slot. * - 'primary_slot_name' is temporarily reset to null and the physical slot is * removed. * These dropped slots will get recreated in next sync-cycle and it is okay to * drop and recreate such slots as long as these are not consumable on the * standby (which is the case currently). * * Note: Change of 'wal_level' on the primary server to a level lower than * logical may also result in slot invalidation and removal on the standby. * This is because such 'wal_level' change is only possible if the logical * slots are removed on the primary server, so it's expected to see the * slots being invalidated and removed on the standby too (and re-created * if they are re-created on the primary server). */ static void drop_local_obsolete_slots(List *remote_slot_list) { List *local_slots = get_local_synced_slots(); foreach_ptr(ReplicationSlot, local_slot, local_slots) { /* Drop the local slot if it is not required to be retained. */ if (!local_sync_slot_required(local_slot, remote_slot_list)) { bool synced_slot; /* * Use shared lock to prevent a conflict with * ReplicationSlotsDropDBSlots(), trying to drop the same slot * during a drop-database operation. */ LockSharedObject(DatabaseRelationId, local_slot->data.database, 0, AccessShareLock); /* * In the small window between getting the slot to drop and * locking the database, there is a possibility of a parallel * database drop by the startup process and the creation of a new * slot by the user. This new user-created slot may end up using * the same shared memory as that of 'local_slot'. Thus check if * local_slot is still the synced one before performing actual * drop. */ SpinLockAcquire(&local_slot->mutex); synced_slot = local_slot->in_use && local_slot->data.synced; SpinLockRelease(&local_slot->mutex); if (synced_slot) { ReplicationSlotAcquire(NameStr(local_slot->data.name), true, false); ReplicationSlotDropAcquired(); } UnlockSharedObject(DatabaseRelationId, local_slot->data.database, 0, AccessShareLock); ereport(LOG, errmsg("dropped replication slot \"%s\" of database with OID %u", NameStr(local_slot->data.name), local_slot->data.database)); } } } /* * Reserve WAL for the currently active local slot using the specified WAL * location (restart_lsn). * * If the given WAL location has been removed, reserve WAL using the oldest * existing WAL segment. */ static void reserve_wal_for_local_slot(XLogRecPtr restart_lsn) { XLogSegNo oldest_segno; XLogSegNo segno; ReplicationSlot *slot = MyReplicationSlot; Assert(slot != NULL); Assert(XLogRecPtrIsInvalid(slot->data.restart_lsn)); while (true) { SpinLockAcquire(&slot->mutex); slot->data.restart_lsn = restart_lsn; SpinLockRelease(&slot->mutex); /* Prevent WAL removal as fast as possible */ ReplicationSlotsComputeRequiredLSN(); XLByteToSeg(slot->data.restart_lsn, segno, wal_segment_size); /* * Find the oldest existing WAL segment file. * * Normally, we can determine it by using the last removed segment * number. However, if no WAL segment files have been removed by a * checkpoint since startup, we need to search for the oldest segment * file from the current timeline existing in XLOGDIR. * * XXX: Currently, we are searching for the oldest segment in the * current timeline as there is less chance of the slot's restart_lsn * from being some prior timeline, and even if it happens, in the * worst case, we will wait to sync till the slot's restart_lsn moved * to the current timeline. */ oldest_segno = XLogGetLastRemovedSegno() + 1; if (oldest_segno == 1) { TimeLineID cur_timeline; GetWalRcvFlushRecPtr(NULL, &cur_timeline); oldest_segno = XLogGetOldestSegno(cur_timeline); } elog(DEBUG1, "segno: " UINT64_FORMAT " of purposed restart_lsn for the synced slot, oldest_segno: " UINT64_FORMAT " available", segno, oldest_segno); /* * If all required WAL is still there, great, otherwise retry. The * slot should prevent further removal of WAL, unless there's a * concurrent ReplicationSlotsComputeRequiredLSN() after we've written * the new restart_lsn above, so normally we should never need to loop * more than twice. */ if (segno >= oldest_segno) break; /* Retry using the location of the oldest wal segment */ XLogSegNoOffsetToRecPtr(oldest_segno, 0, wal_segment_size, restart_lsn); } } /* * If the remote restart_lsn and catalog_xmin have caught up with the * local ones, then update the LSNs and persist the local synced slot for * future synchronization; otherwise, do nothing. * * Return true if the slot is marked as RS_PERSISTENT (sync-ready), otherwise * false. */ static bool update_and_persist_local_synced_slot(RemoteSlot *remote_slot, Oid remote_dbid) { ReplicationSlot *slot = MyReplicationSlot; bool found_consistent_snapshot = false; bool remote_slot_precedes = false; (void) update_local_synced_slot(remote_slot, remote_dbid, &found_consistent_snapshot, &remote_slot_precedes); /* * Check if the primary server has caught up. Refer to the comment atop * the file for details on this check. */ if (remote_slot_precedes) { /* * The remote slot didn't catch up to locally reserved position. * * We do not drop the slot because the restart_lsn can be ahead of the * current location when recreating the slot in the next cycle. It may * take more time to create such a slot. Therefore, we keep this slot * and attempt the synchronization in the next cycle. */ return false; } /* * Don't persist the slot if it cannot reach the consistent point from the * restart_lsn. See comments atop this file. */ if (!found_consistent_snapshot) { ereport(LOG, errmsg("could not synchronize replication slot \"%s\"", remote_slot->name), errdetail("Synchronization could lead to data loss, because the standby could not build a consistent snapshot to decode WALs at LSN %X/%08X.", LSN_FORMAT_ARGS(slot->data.restart_lsn))); return false; } ReplicationSlotPersist(); ereport(LOG, errmsg("newly created replication slot \"%s\" is sync-ready now", remote_slot->name)); return true; } /* * Synchronize a single slot to the given position. * * This creates a new slot if there is no existing one and updates the * metadata of the slot as per the data received from the primary server. * * The slot is created as a temporary slot and stays in the same state until the * remote_slot catches up with locally reserved position and local slot is * updated. The slot is then persisted and is considered as sync-ready for * periodic syncs. * * Returns TRUE if the local slot is updated. */ static bool synchronize_one_slot(RemoteSlot *remote_slot, Oid remote_dbid) { ReplicationSlot *slot; XLogRecPtr latestFlushPtr; bool slot_updated = false; /* * Make sure that concerned WAL is received and flushed before syncing * slot to target lsn received from the primary server. */ latestFlushPtr = GetStandbyFlushRecPtr(NULL); if (remote_slot->confirmed_lsn > latestFlushPtr) { /* * Can get here only if GUC 'synchronized_standby_slots' on the * primary server was not configured correctly. */ ereport(AmLogicalSlotSyncWorkerProcess() ? LOG : ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("skipping slot synchronization because the received slot sync" " LSN %X/%08X for slot \"%s\" is ahead of the standby position %X/%08X", LSN_FORMAT_ARGS(remote_slot->confirmed_lsn), remote_slot->name, LSN_FORMAT_ARGS(latestFlushPtr))); return false; } /* Search for the named slot */ if ((slot = SearchNamedReplicationSlot(remote_slot->name, true))) { bool synced; SpinLockAcquire(&slot->mutex); synced = slot->data.synced; SpinLockRelease(&slot->mutex); /* User-created slot with the same name exists, raise ERROR. */ if (!synced) ereport(ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("exiting from slot synchronization because same" " name slot \"%s\" already exists on the standby", remote_slot->name)); /* * The slot has been synchronized before. * * It is important to acquire the slot here before checking * invalidation. If we don't acquire the slot first, there could be a * race condition that the local slot could be invalidated just after * checking the 'invalidated' flag here and we could end up * overwriting 'invalidated' flag to remote_slot's value. See * InvalidatePossiblyObsoleteSlot() where it invalidates slot directly * if the slot is not acquired by other processes. * * XXX: If it ever turns out that slot acquire/release is costly for * cases when none of the slot properties is changed then we can do a * pre-check to ensure that at least one of the slot properties is * changed before acquiring the slot. */ ReplicationSlotAcquire(remote_slot->name, true, false); Assert(slot == MyReplicationSlot); /* * Copy the invalidation cause from remote only if local slot is not * invalidated locally, we don't want to overwrite existing one. */ if (slot->data.invalidated == RS_INVAL_NONE && remote_slot->invalidated != RS_INVAL_NONE) { SpinLockAcquire(&slot->mutex); slot->data.invalidated = remote_slot->invalidated; SpinLockRelease(&slot->mutex); /* Make sure the invalidated state persists across server restart */ ReplicationSlotMarkDirty(); ReplicationSlotSave(); slot_updated = true; } /* Skip the sync of an invalidated slot */ if (slot->data.invalidated != RS_INVAL_NONE) { ReplicationSlotRelease(); return slot_updated; } /* Slot not ready yet, let's attempt to make it sync-ready now. */ if (slot->data.persistency == RS_TEMPORARY) { slot_updated = update_and_persist_local_synced_slot(remote_slot, remote_dbid); } /* Slot ready for sync, so sync it. */ else { /* * Sanity check: As long as the invalidations are handled * appropriately as above, this should never happen. * * We don't need to check restart_lsn here. See the comments in * update_local_synced_slot() for details. */ if (remote_slot->confirmed_lsn < slot->data.confirmed_flush) ereport(ERROR, errmsg_internal("cannot synchronize local slot \"%s\"", remote_slot->name), errdetail_internal("Local slot's start streaming location LSN(%X/%08X) is ahead of remote slot's LSN(%X/%08X).", LSN_FORMAT_ARGS(slot->data.confirmed_flush), LSN_FORMAT_ARGS(remote_slot->confirmed_lsn))); slot_updated = update_local_synced_slot(remote_slot, remote_dbid, NULL, NULL); } } /* Otherwise create the slot first. */ else { NameData plugin_name; TransactionId xmin_horizon = InvalidTransactionId; /* Skip creating the local slot if remote_slot is invalidated already */ if (remote_slot->invalidated != RS_INVAL_NONE) return false; /* * We create temporary slots instead of ephemeral slots here because * we want the slots to survive after releasing them. This is done to * avoid dropping and re-creating the slots in each synchronization * cycle if the restart_lsn or catalog_xmin of the remote slot has not * caught up. */ ReplicationSlotCreate(remote_slot->name, true, RS_TEMPORARY, remote_slot->two_phase, remote_slot->failover, true); /* For shorter lines. */ slot = MyReplicationSlot; /* Avoid expensive operations while holding a spinlock. */ namestrcpy(&plugin_name, remote_slot->plugin); SpinLockAcquire(&slot->mutex); slot->data.database = remote_dbid; slot->data.plugin = plugin_name; SpinLockRelease(&slot->mutex); reserve_wal_for_local_slot(remote_slot->restart_lsn); LWLockAcquire(ProcArrayLock, LW_EXCLUSIVE); xmin_horizon = GetOldestSafeDecodingTransactionId(true); SpinLockAcquire(&slot->mutex); slot->effective_catalog_xmin = xmin_horizon; slot->data.catalog_xmin = xmin_horizon; SpinLockRelease(&slot->mutex); ReplicationSlotsComputeRequiredXmin(true); LWLockRelease(ProcArrayLock); update_and_persist_local_synced_slot(remote_slot, remote_dbid); slot_updated = true; } ReplicationSlotRelease(); return slot_updated; } /* * Synchronize slots. * * Gets the failover logical slots info from the primary server and updates * the slots locally. Creates the slots if not present on the standby. * * Returns TRUE if any of the slots gets updated in this sync-cycle. */ static bool synchronize_slots(WalReceiverConn *wrconn) { #define SLOTSYNC_COLUMN_COUNT 10 Oid slotRow[SLOTSYNC_COLUMN_COUNT] = {TEXTOID, TEXTOID, LSNOID, LSNOID, XIDOID, BOOLOID, LSNOID, BOOLOID, TEXTOID, TEXTOID}; WalRcvExecResult *res; TupleTableSlot *tupslot; List *remote_slot_list = NIL; bool some_slot_updated = false; bool started_tx = false; const char *query = "SELECT slot_name, plugin, confirmed_flush_lsn," " restart_lsn, catalog_xmin, two_phase, two_phase_at, failover," " database, invalidation_reason" " FROM pg_catalog.pg_replication_slots" " WHERE failover and NOT temporary"; /* The syscache access in walrcv_exec() needs a transaction env. */ if (!IsTransactionState()) { StartTransactionCommand(); started_tx = true; } /* Execute the query */ res = walrcv_exec(wrconn, query, SLOTSYNC_COLUMN_COUNT, slotRow); if (res->status != WALRCV_OK_TUPLES) ereport(ERROR, errmsg("could not fetch failover logical slots info from the primary server: %s", res->err)); /* Construct the remote_slot tuple and synchronize each slot locally */ tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); while (tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) { bool isnull; RemoteSlot *remote_slot = palloc0(sizeof(RemoteSlot)); Datum d; int col = 0; remote_slot->name = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); remote_slot->plugin = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); /* * It is possible to get null values for LSN and Xmin if slot is * invalidated on the primary server, so handle accordingly. */ d = slot_getattr(tupslot, ++col, &isnull); remote_slot->confirmed_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->restart_lsn = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->catalog_xmin = isnull ? InvalidTransactionId : DatumGetTransactionId(d); remote_slot->two_phase = DatumGetBool(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->two_phase_at = isnull ? InvalidXLogRecPtr : DatumGetLSN(d); remote_slot->failover = DatumGetBool(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); remote_slot->database = TextDatumGetCString(slot_getattr(tupslot, ++col, &isnull)); Assert(!isnull); d = slot_getattr(tupslot, ++col, &isnull); remote_slot->invalidated = isnull ? RS_INVAL_NONE : GetSlotInvalidationCause(TextDatumGetCString(d)); /* Sanity check */ Assert(col == SLOTSYNC_COLUMN_COUNT); /* * If restart_lsn, confirmed_lsn or catalog_xmin is invalid but the * slot is valid, that means we have fetched the remote_slot in its * RS_EPHEMERAL state. In such a case, don't sync it; we can always * sync it in the next sync cycle when the remote_slot is persisted * and has valid lsn(s) and xmin values. * * XXX: In future, if we plan to expose 'slot->data.persistency' in * pg_replication_slots view, then we can avoid fetching RS_EPHEMERAL * slots in the first place. */ if ((XLogRecPtrIsInvalid(remote_slot->restart_lsn) || XLogRecPtrIsInvalid(remote_slot->confirmed_lsn) || !TransactionIdIsValid(remote_slot->catalog_xmin)) && remote_slot->invalidated == RS_INVAL_NONE) pfree(remote_slot); else /* Create list of remote slots */ remote_slot_list = lappend(remote_slot_list, remote_slot); ExecClearTuple(tupslot); } /* Drop local slots that no longer need to be synced. */ drop_local_obsolete_slots(remote_slot_list); /* Now sync the slots locally */ foreach_ptr(RemoteSlot, remote_slot, remote_slot_list) { Oid remote_dbid = get_database_oid(remote_slot->database, false); /* * Use shared lock to prevent a conflict with * ReplicationSlotsDropDBSlots(), trying to drop the same slot during * a drop-database operation. */ LockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); some_slot_updated |= synchronize_one_slot(remote_slot, remote_dbid); UnlockSharedObject(DatabaseRelationId, remote_dbid, 0, AccessShareLock); } /* We are done, free remote_slot_list elements */ list_free_deep(remote_slot_list); walrcv_clear_result(res); if (started_tx) CommitTransactionCommand(); return some_slot_updated; } /* * Checks the remote server info. * * We ensure that the 'primary_slot_name' exists on the remote server and the * remote server is not a standby node. */ static void validate_remote_info(WalReceiverConn *wrconn) { #define PRIMARY_INFO_OUTPUT_COL_COUNT 2 WalRcvExecResult *res; Oid slotRow[PRIMARY_INFO_OUTPUT_COL_COUNT] = {BOOLOID, BOOLOID}; StringInfoData cmd; bool isnull; TupleTableSlot *tupslot; bool remote_in_recovery; bool primary_slot_valid; bool started_tx = false; initStringInfo(&cmd); appendStringInfo(&cmd, "SELECT pg_is_in_recovery(), count(*) = 1" " FROM pg_catalog.pg_replication_slots" " WHERE slot_type='physical' AND slot_name=%s", quote_literal_cstr(PrimarySlotName)); /* The syscache access in walrcv_exec() needs a transaction env. */ if (!IsTransactionState()) { StartTransactionCommand(); started_tx = true; } res = walrcv_exec(wrconn, cmd.data, PRIMARY_INFO_OUTPUT_COL_COUNT, slotRow); pfree(cmd.data); if (res->status != WALRCV_OK_TUPLES) ereport(ERROR, errmsg("could not fetch primary slot name \"%s\" info from the primary server: %s", PrimarySlotName, res->err), errhint("Check if \"primary_slot_name\" is configured correctly.")); tupslot = MakeSingleTupleTableSlot(res->tupledesc, &TTSOpsMinimalTuple); if (!tuplestore_gettupleslot(res->tuplestore, true, false, tupslot)) elog(ERROR, "failed to fetch tuple for the primary server slot specified by \"primary_slot_name\""); remote_in_recovery = DatumGetBool(slot_getattr(tupslot, 1, &isnull)); Assert(!isnull); /* * Slot sync is currently not supported on a cascading standby. This is * because if we allow it, the primary server needs to wait for all the * cascading standbys, otherwise, logical subscribers can still be ahead * of one of the cascading standbys which we plan to promote. Thus, to * avoid this additional complexity, we restrict it for the time being. */ if (remote_in_recovery) ereport(ERROR, errcode(ERRCODE_FEATURE_NOT_SUPPORTED), errmsg("cannot synchronize replication slots from a standby server")); primary_slot_valid = DatumGetBool(slot_getattr(tupslot, 2, &isnull)); Assert(!isnull); if (!primary_slot_valid) ereport(ERROR, errcode(ERRCODE_INVALID_PARAMETER_VALUE), /* translator: second %s is a GUC variable name */ errmsg("replication slot \"%s\" specified by \"%s\" does not exist on primary server", PrimarySlotName, "primary_slot_name")); ExecClearTuple(tupslot); walrcv_clear_result(res); if (started_tx) CommitTransactionCommand(); } /* * Checks if dbname is specified in 'primary_conninfo'. * * Error out if not specified otherwise return it. */ char * CheckAndGetDbnameFromConninfo(void) { char *dbname; /* * The slot synchronization needs a database connection for walrcv_exec to * work. */ dbname = walrcv_get_dbname_from_conninfo(PrimaryConnInfo); if (dbname == NULL) ereport(ERROR, errcode(ERRCODE_INVALID_PARAMETER_VALUE), /* * translator: first %s is a connection option; second %s is a GUC * variable name */ errmsg("replication slot synchronization requires \"%s\" to be specified in \"%s\"", "dbname", "primary_conninfo")); return dbname; } /* * Return true if all necessary GUCs for slot synchronization are set * appropriately, otherwise, return false. */ bool ValidateSlotSyncParams(int elevel) { /* * Logical slot sync/creation requires wal_level >= logical. * * Since altering the wal_level requires a server restart, so error out in * this case regardless of elevel provided by caller. */ if (wal_level < WAL_LEVEL_LOGICAL) ereport(ERROR, errcode(ERRCODE_INVALID_PARAMETER_VALUE), errmsg("replication slot synchronization requires \"wal_level\" >= \"logical\"")); /* * A physical replication slot(primary_slot_name) is required on the * primary to ensure that the rows needed by the standby are not removed * after restarting, so that the synchronized slot on the standby will not * be invalidated. */ if (PrimarySlotName == NULL || *PrimarySlotName == '\0') { ereport(elevel, errcode(ERRCODE_INVALID_PARAMETER_VALUE), /* translator: %s is a GUC variable name */ errmsg("replication slot synchronization requires \"%s\" to be set", "primary_slot_name")); return false; } /* * hot_standby_feedback must be enabled to cooperate with the physical * replication slot, which allows informing the primary about the xmin and * catalog_xmin values on the standby. */ if (!hot_standby_feedback) { ereport(elevel, errcode(ERRCODE_INVALID_PARAMETER_VALUE), /* translator: %s is a GUC variable name */ errmsg("replication slot synchronization requires \"%s\" to be enabled", "hot_standby_feedback")); return false; } /* * The primary_conninfo is required to make connection to primary for * getting slots information. */ if (PrimaryConnInfo == NULL || *PrimaryConnInfo == '\0') { ereport(elevel, errcode(ERRCODE_INVALID_PARAMETER_VALUE), /* translator: %s is a GUC variable name */ errmsg("replication slot synchronization requires \"%s\" to be set", "primary_conninfo")); return false; } return true; } /* * Re-read the config file. * * Exit if any of the slot sync GUCs have changed. The postmaster will * restart it. */ static void slotsync_reread_config(void) { char *old_primary_conninfo = pstrdup(PrimaryConnInfo); char *old_primary_slotname = pstrdup(PrimarySlotName); bool old_sync_replication_slots = sync_replication_slots; bool old_hot_standby_feedback = hot_standby_feedback; bool conninfo_changed; bool primary_slotname_changed; Assert(sync_replication_slots); ConfigReloadPending = false; ProcessConfigFile(PGC_SIGHUP); conninfo_changed = strcmp(old_primary_conninfo, PrimaryConnInfo) != 0; primary_slotname_changed = strcmp(old_primary_slotname, PrimarySlotName) != 0; pfree(old_primary_conninfo); pfree(old_primary_slotname); if (old_sync_replication_slots != sync_replication_slots) { ereport(LOG, /* translator: %s is a GUC variable name */ errmsg("replication slot synchronization worker will shut down because \"%s\" is disabled", "sync_replication_slots")); proc_exit(0); } if (conninfo_changed || primary_slotname_changed || (old_hot_standby_feedback != hot_standby_feedback)) { ereport(LOG, errmsg("replication slot synchronization worker will restart because of a parameter change")); /* * Reset the last-start time for this worker so that the postmaster * can restart it without waiting for SLOTSYNC_RESTART_INTERVAL_SEC. */ SlotSyncCtx->last_start_time = 0; proc_exit(0); } } /* * Interrupt handler for main loop of slot sync worker. */ static void ProcessSlotSyncInterrupts(WalReceiverConn *wrconn) { CHECK_FOR_INTERRUPTS(); if (ShutdownRequestPending) { ereport(LOG, errmsg("replication slot synchronization worker is shutting down on receiving SIGINT")); proc_exit(0); } if (ConfigReloadPending) slotsync_reread_config(); } /* * Connection cleanup function for slotsync worker. * * Called on slotsync worker exit. */ static void slotsync_worker_disconnect(int code, Datum arg) { WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg); walrcv_disconnect(wrconn); } /* * Cleanup function for slotsync worker. * * Called on slotsync worker exit. */ static void slotsync_worker_onexit(int code, Datum arg) { /* * We need to do slots cleanup here just like WalSndErrorCleanup() does. * * The startup process during promotion invokes ShutDownSlotSync() which * waits for slot sync to finish and it does that by checking the * 'syncing' flag. Thus the slot sync worker must be done with slots' * release and cleanup to avoid any dangling temporary slots or active * slots before it marks itself as finished syncing. */ /* Make sure active replication slots are released */ if (MyReplicationSlot != NULL) ReplicationSlotRelease(); /* Also cleanup the temporary slots. */ ReplicationSlotCleanup(false); SpinLockAcquire(&SlotSyncCtx->mutex); SlotSyncCtx->pid = InvalidPid; /* * If syncing_slots is true, it indicates that the process errored out * without resetting the flag. So, we need to clean up shared memory and * reset the flag here. */ if (syncing_slots) { SlotSyncCtx->syncing = false; syncing_slots = false; } SpinLockRelease(&SlotSyncCtx->mutex); } /* * Sleep for long enough that we believe it's likely that the slots on primary * get updated. * * If there is no slot activity the wait time between sync-cycles will double * (to a maximum of 30s). If there is some slot activity the wait time between * sync-cycles is reset to the minimum (200ms). */ static void wait_for_slot_activity(bool some_slot_updated) { int rc; if (!some_slot_updated) { /* * No slots were updated, so double the sleep time, but not beyond the * maximum allowable value. */ sleep_ms = Min(sleep_ms * 2, MAX_SLOTSYNC_WORKER_NAPTIME_MS); } else { /* * Some slots were updated since the last sleep, so reset the sleep * time. */ sleep_ms = MIN_SLOTSYNC_WORKER_NAPTIME_MS; } rc = WaitLatch(MyLatch, WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH, sleep_ms, WAIT_EVENT_REPLICATION_SLOTSYNC_MAIN); if (rc & WL_LATCH_SET) ResetLatch(MyLatch); } /* * Emit an error if a promotion or a concurrent sync call is in progress. * Otherwise, advertise that a sync is in progress. */ static void check_and_set_sync_info(pid_t worker_pid) { SpinLockAcquire(&SlotSyncCtx->mutex); /* The worker pid must not be already assigned in SlotSyncCtx */ Assert(worker_pid == InvalidPid || SlotSyncCtx->pid == InvalidPid); /* * Emit an error if startup process signaled the slot sync machinery to * stop. See comments atop SlotSyncCtxStruct. */ if (SlotSyncCtx->stopSignaled) { SpinLockRelease(&SlotSyncCtx->mutex); ereport(ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("cannot synchronize replication slots when standby promotion is ongoing")); } if (SlotSyncCtx->syncing) { SpinLockRelease(&SlotSyncCtx->mutex); ereport(ERROR, errcode(ERRCODE_OBJECT_NOT_IN_PREREQUISITE_STATE), errmsg("cannot synchronize replication slots concurrently")); } SlotSyncCtx->syncing = true; /* * Advertise the required PID so that the startup process can kill the * slot sync worker on promotion. */ SlotSyncCtx->pid = worker_pid; SpinLockRelease(&SlotSyncCtx->mutex); syncing_slots = true; } /* * Reset syncing flag. */ static void reset_syncing_flag() { SpinLockAcquire(&SlotSyncCtx->mutex); SlotSyncCtx->syncing = false; SpinLockRelease(&SlotSyncCtx->mutex); syncing_slots = false; }; /* * The main loop of our worker process. * * It connects to the primary server, fetches logical failover slots * information periodically in order to create and sync the slots. */ void ReplSlotSyncWorkerMain(const void *startup_data, size_t startup_data_len) { WalReceiverConn *wrconn = NULL; char *dbname; char *err; sigjmp_buf local_sigjmp_buf; StringInfoData app_name; Assert(startup_data_len == 0); MyBackendType = B_SLOTSYNC_WORKER; init_ps_display(NULL); Assert(GetProcessingMode() == InitProcessing); /* * Create a per-backend PGPROC struct in shared memory. We must do this * before we access any shared memory. */ InitProcess(); /* * Early initialization. */ BaseInit(); Assert(SlotSyncCtx != NULL); /* * If an exception is encountered, processing resumes here. * * We just need to clean up, report the error, and go away. * * If we do not have this handling here, then since this worker process * operates at the bottom of the exception stack, ERRORs turn into FATALs. * Therefore, we create our own exception handler to catch ERRORs. */ if (sigsetjmp(local_sigjmp_buf, 1) != 0) { /* since not using PG_TRY, must reset error stack by hand */ error_context_stack = NULL; /* Prevents interrupts while cleaning up */ HOLD_INTERRUPTS(); /* Report the error to the server log */ EmitErrorReport(); /* * We can now go away. Note that because we called InitProcess, a * callback was registered to do ProcKill, which will clean up * necessary state. */ proc_exit(0); } /* We can now handle ereport(ERROR) */ PG_exception_stack = &local_sigjmp_buf; /* Setup signal handling */ pqsignal(SIGHUP, SignalHandlerForConfigReload); pqsignal(SIGINT, SignalHandlerForShutdownRequest); pqsignal(SIGTERM, die); pqsignal(SIGFPE, FloatExceptionHandler); pqsignal(SIGUSR1, procsignal_sigusr1_handler); pqsignal(SIGUSR2, SIG_IGN); pqsignal(SIGPIPE, SIG_IGN); pqsignal(SIGCHLD, SIG_DFL); check_and_set_sync_info(MyProcPid); ereport(LOG, errmsg("slot sync worker started")); /* Register it as soon as SlotSyncCtx->pid is initialized. */ before_shmem_exit(slotsync_worker_onexit, (Datum) 0); /* * Establishes SIGALRM handler and initialize timeout module. It is needed * by InitPostgres to register different timeouts. */ InitializeTimeouts(); /* Load the libpq-specific functions */ load_file("libpqwalreceiver", false); /* * Unblock signals (they were blocked when the postmaster forked us) */ sigprocmask(SIG_SETMASK, &UnBlockSig, NULL); /* * Set always-secure search path, so malicious users can't redirect user * code (e.g. operators). * * It's not strictly necessary since we won't be scanning or writing to * any user table locally, but it's good to retain it here for added * precaution. */ SetConfigOption("search_path", "", PGC_SUSET, PGC_S_OVERRIDE); dbname = CheckAndGetDbnameFromConninfo(); /* * Connect to the database specified by the user in primary_conninfo. We * need a database connection for walrcv_exec to work which we use to * fetch slot information from the remote node. See comments atop * libpqrcv_exec. * * We do not specify a specific user here since the slot sync worker will * operate as a superuser. This is safe because the slot sync worker does * not interact with user tables, eliminating the risk of executing * arbitrary code within triggers. */ InitPostgres(dbname, InvalidOid, NULL, InvalidOid, 0, NULL); SetProcessingMode(NormalProcessing); initStringInfo(&app_name); if (cluster_name[0]) appendStringInfo(&app_name, "%s_%s", cluster_name, "slotsync worker"); else appendStringInfoString(&app_name, "slotsync worker"); /* * Establish the connection to the primary server for slot * synchronization. */ wrconn = walrcv_connect(PrimaryConnInfo, false, false, false, app_name.data, &err); pfree(app_name.data); if (!wrconn) ereport(ERROR, errcode(ERRCODE_CONNECTION_FAILURE), errmsg("synchronization worker \"%s\" could not connect to the primary server: %s", app_name.data, err)); /* * Register the disconnection callback. * * XXX: This can be combined with previous cleanup registration of * slotsync_worker_onexit() but that will need the connection to be made * global and we want to avoid introducing global for this purpose. */ before_shmem_exit(slotsync_worker_disconnect, PointerGetDatum(wrconn)); /* * Using the specified primary server connection, check that we are not a * cascading standby and slot configured in 'primary_slot_name' exists on * the primary server. */ validate_remote_info(wrconn); /* Main loop to synchronize slots */ for (;;) { bool some_slot_updated = false; ProcessSlotSyncInterrupts(wrconn); some_slot_updated = synchronize_slots(wrconn); wait_for_slot_activity(some_slot_updated); } /* * The slot sync worker can't get here because it will only stop when it * receives a SIGINT from the startup process, or when there is an error. */ Assert(false); } /* * Update the inactive_since property for synced slots. * * Note that this function is currently called when we shutdown the slot * sync machinery. */ static void update_synced_slots_inactive_since(void) { TimestampTz now = 0; /* * We need to update inactive_since only when we are promoting standby to * correctly interpret the inactive_since if the standby gets promoted * without a restart. We don't want the slots to appear inactive for a * long time after promotion if they haven't been synchronized recently. * Whoever acquires the slot, i.e., makes the slot active, will reset it. */ if (!StandbyMode) return; /* The slot sync worker or SQL function mustn't be running by now */ Assert((SlotSyncCtx->pid == InvalidPid) && !SlotSyncCtx->syncing); LWLockAcquire(ReplicationSlotControlLock, LW_SHARED); for (int i = 0; i < max_replication_slots; i++) { ReplicationSlot *s = &ReplicationSlotCtl->replication_slots[i]; /* Check if it is a synchronized slot */ if (s->in_use && s->data.synced) { Assert(SlotIsLogical(s)); /* The slot must not be acquired by any process */ Assert(s->active_pid == 0); /* Use the same inactive_since time for all the slots. */ if (now == 0) now = GetCurrentTimestamp(); ReplicationSlotSetInactiveSince(s, now, true); } } LWLockRelease(ReplicationSlotControlLock); } /* * Shut down the slot sync worker. * * This function sends signal to shutdown slot sync worker, if required. It * also waits till the slot sync worker has exited or * pg_sync_replication_slots() has finished. */ void ShutDownSlotSync(void) { pid_t worker_pid; SpinLockAcquire(&SlotSyncCtx->mutex); SlotSyncCtx->stopSignaled = true; /* * Return if neither the slot sync worker is running nor the function * pg_sync_replication_slots() is executing. */ if (!SlotSyncCtx->syncing) { SpinLockRelease(&SlotSyncCtx->mutex); update_synced_slots_inactive_since(); return; } worker_pid = SlotSyncCtx->pid; SpinLockRelease(&SlotSyncCtx->mutex); if (worker_pid != InvalidPid) kill(worker_pid, SIGINT); /* Wait for slot sync to end */ for (;;) { int rc; /* Wait a bit, we don't expect to have to wait long */ rc = WaitLatch(MyLatch, WL_LATCH_SET | WL_TIMEOUT | WL_EXIT_ON_PM_DEATH, 10L, WAIT_EVENT_REPLICATION_SLOTSYNC_SHUTDOWN); if (rc & WL_LATCH_SET) { ResetLatch(MyLatch); CHECK_FOR_INTERRUPTS(); } SpinLockAcquire(&SlotSyncCtx->mutex); /* Ensure that no process is syncing the slots. */ if (!SlotSyncCtx->syncing) break; SpinLockRelease(&SlotSyncCtx->mutex); } SpinLockRelease(&SlotSyncCtx->mutex); update_synced_slots_inactive_since(); } /* * SlotSyncWorkerCanRestart * * Returns true if enough time (SLOTSYNC_RESTART_INTERVAL_SEC) has passed * since it was launched last. Otherwise returns false. * * This is a safety valve to protect against continuous respawn attempts if the * worker is dying immediately at launch. Note that since we will retry to * launch the worker from the postmaster main loop, we will get another * chance later. */ bool SlotSyncWorkerCanRestart(void) { time_t curtime = time(NULL); /* Return false if too soon since last start. */ if ((unsigned int) (curtime - SlotSyncCtx->last_start_time) < (unsigned int) SLOTSYNC_RESTART_INTERVAL_SEC) return false; SlotSyncCtx->last_start_time = curtime; return true; } /* * Is current process syncing replication slots? * * Could be either backend executing SQL function or slot sync worker. */ bool IsSyncingReplicationSlots(void) { return syncing_slots; } /* * Amount of shared memory required for slot synchronization. */ Size SlotSyncShmemSize(void) { return sizeof(SlotSyncCtxStruct); } /* * Allocate and initialize the shared memory of slot synchronization. */ void SlotSyncShmemInit(void) { Size size = SlotSyncShmemSize(); bool found; SlotSyncCtx = (SlotSyncCtxStruct *) ShmemInitStruct("Slot Sync Data", size, &found); if (!found) { memset(SlotSyncCtx, 0, size); SlotSyncCtx->pid = InvalidPid; SpinLockInit(&SlotSyncCtx->mutex); } } /* * Error cleanup callback for slot sync SQL function. */ static void slotsync_failure_callback(int code, Datum arg) { WalReceiverConn *wrconn = (WalReceiverConn *) DatumGetPointer(arg); /* * We need to do slots cleanup here just like WalSndErrorCleanup() does. * * The startup process during promotion invokes ShutDownSlotSync() which * waits for slot sync to finish and it does that by checking the * 'syncing' flag. Thus the SQL function must be done with slots' release * and cleanup to avoid any dangling temporary slots or active slots * before it marks itself as finished syncing. */ /* Make sure active replication slots are released */ if (MyReplicationSlot != NULL) ReplicationSlotRelease(); /* Also cleanup the synced temporary slots. */ ReplicationSlotCleanup(true); /* * The set syncing_slots indicates that the process errored out without * resetting the flag. So, we need to clean up shared memory and reset the * flag here. */ if (syncing_slots) reset_syncing_flag(); walrcv_disconnect(wrconn); } /* * Synchronize the failover enabled replication slots using the specified * primary server connection. */ void SyncReplicationSlots(WalReceiverConn *wrconn) { PG_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); { check_and_set_sync_info(InvalidPid); validate_remote_info(wrconn); synchronize_slots(wrconn); /* Cleanup the synced temporary slots */ ReplicationSlotCleanup(true); /* We are done with sync, so reset sync flag */ reset_syncing_flag(); } PG_END_ENSURE_ERROR_CLEANUP(slotsync_failure_callback, PointerGetDatum(wrconn)); }