« Perphénazine » : différence entre les versions
Apparence
Contenu supprimé Contenu ajouté
m r2.7.1) (robot Ajoute : fa:پرفنازین |
m Requête bot : Migration de {{Chimiebox}} |
||
Ligne 1 : | Ligne 1 : | ||
{{ébauche|composé chimique|médecine|pharmacie}} |
{{ébauche|composé chimique|médecine|pharmacie}} |
||
{{Infobox Chimie |
|||
{{Chimiebox |
|||
| nom = Perphénazine |
| nom = Perphénazine |
||
| image = Perphenazine2d.png |
| image = Perphenazine2d.png |
||
Ligne 13 : | Ligne 13 : | ||
| CAS = {{CAS|5|8|3|9|9}} |
| CAS = {{CAS|5|8|3|9|9}} |
||
| EINECS = {{EINECS|2|0|0|3|8|1|5}} |
| EINECS = {{EINECS|2|0|0|3|8|1|5}} |
||
| RTECS = |
|||
| ATC = {{ATC|N05AB03}} |
| ATC = {{ATC|N05AB03}} |
||
| DrugBank = DB00850 |
| DrugBank = DB00850 |
||
Ligne 21 : | Ligne 22 : | ||
| SMILES = C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |
| SMILES = C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |
||
| InChI = 1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
| InChI = 1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
||
| InChIKey = |
|||
| StdInChI = |
|||
| StdInChIKey = |
|||
| apparence = |
| apparence = |
||
<!-- Propriétés chimiques --> |
<!-- Propriétés chimiques --> |
||
| formule = | |
| formule = |C=21|H=26|Cl=1|N=3|O=1|S=1 |
||
| masseMol = |
| masseMol = |
||
| pKa = 7.94 <ref name="ChemIDplus">{{ChemID|58-39-9|Perphenazine}}, consulté le 31 juillet 2009</ref> |
| pKa = 7.94 <ref name="ChemIDplus">{{ChemID|58-39-9|Perphenazine}}, consulté le 31 juillet 2009</ref> |
||
| momentDipolaire = |
| momentDipolaire = |
||
| susceptibiliteMagnetique = |
|||
| diametreMoleculaire = |
|||
| indiceIode = |
|||
| indiceAcide = |
|||
| indiceSaponification = |
|||
<!-- Propriétés physiques --> |
<!-- Propriétés physiques --> |
||
| TTransitionVitreuse = |
|||
| fusion = {{tmp|97|°C}} <ref name="ChemIDplus"/> |
| fusion = {{tmp|97|°C}} <ref name="ChemIDplus"/> |
||
| ebullition = {{tmp||°C}} |
| ebullition = {{tmp||°C}} |
||
| solubilite = {{Unité/2|28.3|mg||l|-1}} ([[eau]],{{tmp|24|°C}}) <ref name="ChemIDplus"/> |
| solubilite = {{Unité/2|28.3|mg||l|-1}} ([[eau]],{{tmp|24|°C}}) <ref name="ChemIDplus"/> |
||
| miscibilite = |
|||
| masseVolumique = {{Unité/2||g||cm|-3}} |
| masseVolumique = {{Unité/2||g||cm|-3}} |
||
| TAutoInflammation = {{tmp||°C}} |
| TAutoInflammation = {{tmp||°C}} |
||
Ligne 41 : | Ligne 52 : | ||
| conductivitéThermique = |
| conductivitéThermique = |
||
| conductivitéÉlectrique = |
| conductivitéÉlectrique = |
||
| vitesseSon = |
|||
<!-- Thermochimie --> |
<!-- Thermochimie --> |
||
| emsGaz = |
| emsGaz = |
||
Ligne 61 : | Ligne 73 : | ||
| mobilitEelectronique = |
| mobilitEelectronique = |
||
| mobiliteTrous = |
| mobiliteTrous = |
||
| 1reEnergieIonisation = |
|||
| constanteDielectrique = |
|||
<!-- Cristallographie --> |
<!-- Cristallographie --> |
||
| |
| systemeCristallin = |
||
| |
| reseauBravais = |
||
| Pearson = |
|||
| classe = |
| classe = |
||
| |
| Schoenflies = |
||
| Strukturbericht = |
|||
| structureType = |
|||
| parametresMaille = |
| parametresMaille = |
||
| volume = |
|||
| densiteTheorique = |
|||
| macle = |
| macle = |
||
<!-- Propriétés optiques --> |
<!-- Propriétés optiques --> |
||
Ligne 77 : | Ligne 96 : | ||
| transparence = |
| transparence = |
||
| pvrRotatoire = |
| pvrRotatoire = |
||
| cteVerdet = |
|||
<!-- Précautions --> |
<!-- Précautions --> |
||
| radioactif = |
|||
| 67548EEC = |
|||
| 67548EECref = |
| 67548EECref = |
||
| symboles = |
| symboles = |
||
Ligne 92 : | Ligne 114 : | ||
| SGHref = |
| SGHref = |
||
| SGH = {{SGH|}} |
| SGH = {{SGH|}} |
||
| CIRC = |
|||
| inhalation = |
| inhalation = |
||
| peau = |
| peau = |
||
Ligne 101 : | Ligne 124 : | ||
| LogP = 4,2 <ref name="ChemIDplus"/> |
| LogP = 4,2 <ref name="ChemIDplus"/> |
||
| DJA = |
| DJA = |
||
| odorat = |
|||
<!-- Données pharmacocinétiques --> |
<!-- Données pharmacocinétiques --> |
||
| CAM = |
| CAM = |
Version du 27 janvier 2013 à 07:13
Perphénazine | |
![]() | |
Identification | |
---|---|
Nom UICPA | 2-[4-[3-(2-chloro-10H-phenothiazin-10-yl) propyl]piperazin-1-yl]ethanol |
No CAS | |
No ECHA | 100.000.346 |
No CE | 200-381-5 |
Code ATC | N05 |
DrugBank | DB00850 |
PubChem | 4748 |
ChEBI | 8028 |
SMILES | |
InChI | |
Propriétés chimiques | |
Formule | C21H26ClN3OS [Isomères] |
Masse molaire[2] | 403,969 ± 0,027 g/mol C 62,44 %, H 6,49 %, Cl 8,78 %, N 10,4 %, O 3,96 %, S 7,94 %, |
pKa | 7.94 [1] |
Propriétés physiques | |
T° fusion | 97 °C [1] |
Solubilité | 28,3 mg·l-1 (eau,24 °C) [1] |
Écotoxicologie | |
DL50 | 120 mg·kg-1 (souris, oral) 19 mg·kg-1 (souris, i.v.) 80 mg·kg-1 (souris, s.c.) 64 mg·kg-1 (souris, i.p.) [1] |
LogP | 4,2 [1] |
Données pharmacocinétiques | |
Biodisponibilité | 40 % (orale) |
Métabolisme | hépatique |
Demi-vie d’élim. | 8-12 (jusqu'à 20) heures |
Excrétion |
biliaire |
Unités du SI et CNTP, sauf indication contraire. | |
modifier ![]() |
La perphénazine (Trilifon) est un antipsychotique typique, utilisé depuis des décennies.
Voir aussi
Articles connexes
Liens externes
- Compendium suisse des médicaments : spécialités contenant Perphénazine
Notes et références
- (en) « Perphénazine », sur ChemIDplus, consulté le 31 juillet 2009
- Masse molaire calculée d’après « Atomic weights of the elements 2007 », sur www.chem.qmul.ac.uk.